Doxorubicin
drugOn this page
Also known as AdriablastinAdriblastinaDoxorubicinaDoxorubicineEpirubicin hydrochloride impuritydoxorubicin-HydroxydaunorubicinNSC-123127NSC-759155Valrubicin impurityAnthracyclin analogueAdriamycinAdriamicinaDoxourbicineAdriblastineadriyamicinDoxorubucinDoxoruibicinSID124886887
Summary
Doxorubicin (CHEMBL53463) is an approved small molecule (ATC L01DB01) targeting TOP2A; indicated across 137 conditions including neoplasm and ovarian neoplasm.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L01DB01
- Targets: 1 (TOP2A)
- Indications: 137 conditions
- Clinical trials: 915
- Chemistry: 543.5 Da · C27H29NO11
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL53463 |
| Name | Doxorubicin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 31703 |
| ChEBI | CHEBI:28748 |
| ATC | L01DB01 |
| Molecular formula | C27H29NO11 |
| Molecular weight | 543.5 |
| InChIKey | AOJJSUZBOXZQNB-TZSSRYMLSA-N |
SMILES: C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C2C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC=C5)OC)O)(C(=O)CO)O)N)O
IUPAC name: (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione
Other ChEBI roles (chemical / environmental): Escherichia coli metabolite.
Also known as: Adriablastin, Adriblastina, Doxorubicin, Doxorubicina, Doxorubicine, Epirubicin hydrochloride impurity, doxorubicin-, Hydroxydaunorubicin, NSC-123127, NSC-759155, Valrubicin impurity, doxorubicin
Parent form; salt/anhydrous children: CHEMBL216371, CHEMBL272706, CHEMBL359744
Patent coverage: 88,016 distinct patent families (314,282 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 314,242 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| TOP2A | DNA topoisomerase II alpha | Inhibition | 6 | 99.6% (common-essential) | P11388 |
Broader ChEMBL bioactivity targets: 41 (assay-derived). Sample: Solute carrier organic anion transporter family member 1B3, ATP-binding cassette sub-family C member 4, DNA topoisomerase 1, CDGSH iron-sulfur domain-containing protein 1, DNA topoisomerase 2-alpha, Receptor tyrosine-protein kinase erbB-2, 5-hydroxytryptamine receptor 2B, Tyrosine-protein kinase Fyn, Alpha-2A adrenergic receptor, Glutamate carboxypeptidase 2.
Bioactivity
ChEMBL activities: 44 potent at pChembl ≥ 5 of 73 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| TOP2A | 8.31 | IC50 | 4.9 | nM | CHEMBL_ACT_25724245 |
| AURKA | 7.4 | IC50 | 40 | nM | CHEMBL_ACT_6360782 |
| HIF1A | 6.92 | EC50 | 120 | nM | CHEMBL_ACT_2664579 |
| EBP | 6.82 | IC50 | 150 | nM | CHEMBL_ACT_1840671 |
| EBP | 6.7 | IC50 | 200 | nM | CHEMBL_ACT_1840661 |
| EBP | 6.52 | IC50 | 300 | nM | CHEMBL_ACT_1840668 |
| ABCB1 | 6.3 | IC50 | 504 | nM | CHEMBL_ACT_25555290 |
| ESR1 | 6.28 | AC50 | 530 | nM | CHEMBL_ACT_25167168 |
| TOP2A | 6.22 | IC50 | 600 | nM | CHEMBL_ACT_18903843 |
| TOP2B | 6.14 | IC50 | 727 | nM | CHEMBL_ACT_22415172 |
| TOP2A | 6.06 | IC50 | 880 | nM | CHEMBL_ACT_18787127 |
| TOP2A | 6.03 | IC50 | 940 | nM | CHEMBL_ACT_25036122 |
| TOP2A | 6 | IC50 | 1000 | nM | CHEMBL_ACT_2194973 |
| TOP2A | 6 | IC50 | 1000 | nM | CHEMBL_ACT_2194974 |
| TOP2A | 6 | IC50 | 990 | nM | CHEMBL_ACT_23202129 |
| MMP2 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_383367 |
| TOP2A | 5.92 | IC50 | 1200 | nM | CHEMBL_ACT_18911892 |
| TOP2A | 5.82 | IC50 | 1500 | nM | CHEMBL_ACT_18911913 |
| PGR | 5.77 | AC50 | 1700 | nM | CHEMBL_ACT_25192747 |
| HTR2A | 5.68 | AC50 | 2087 | nM | CHEMBL_ACT_25173553 |
| O70528 | 5.68 | Ki | 2078 | nM | CHEMBL_ACT_7668917 |
| TOP2A | 5.64 | IC50 | 2300 | nM | CHEMBL_ACT_18911871 |
| ERBB2 | 5.61 | IC50 | 2485 | nM | CHEMBL_ACT_7666870 |
| NR3C1 | 5.59 | AC50 | 2590 | nM | CHEMBL_ACT_25175695 |
| TOP2A | 5.58 | IC50 | 2600 | nM | CHEMBL_ACT_18911828 |
| TOP2A | 5.52 | IC50 | 3000 | nM | CHEMBL_ACT_16830847 |
| TOP2A | 5.52 | IC50 | 3000 | nM | CHEMBL_ACT_18081539 |
| O88508 | 5.52 | IC50 | 3000 | nM | CHEMBL_ACT_20689586 |
| TOP1 | 5.5 | IC50 | 3200 | nM | CHEMBL_ACT_25031393 |
| TOP2A | 5.48 | IC50 | 3300 | nM | CHEMBL_ACT_18911866 |
Target pathways
Aggregated over 1 target gene(s): TOP2A.
Top Reactome pathways
2 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Transcription of E2F targets under negative control by DREAM complex | 1 | TOP2A |
| SUMOylation of DNA replication proteins | 1 | TOP2A |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| resolution of meiotic recombination intermediates | 1 |
| sister chromatid segregation | 1 |
| hematopoietic progenitor cell differentiation | 1 |
| DNA topological change | 1 |
| chromatin organization | 1 |
| DNA damage response | 1 |
| chromosome segregation | 1 |
| female meiotic nuclear division | 1 |
| apoptotic chromosome condensation | 1 |
| embryonic cleavage | 1 |
| regulation of circadian rhythm | 1 |
| positive regulation of apoptotic process | 1 |
| positive regulation of single stranded viral RNA replication via double stranded DNA intermediate | 1 |
| positive regulation of transcription by RNA polymerase II | 1 |
| rhythmic process | 1 |
Indications & clinical
Indications
137 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| ovarian neoplasm | 3 | MONDO:0021068 | EFO:0003893 |
| hepatocellular carcinoma | 3 | MONDO:0007256 | EFO:0000182 |
| breast carcinoma | 3 | MONDO:0004989 | EFO:0000305 |
| osteosarcoma | 3 | MONDO:0009807 | EFO:0000637 |
| sarcoma | 3 | MONDO:0005089 | EFO:0000691 |
| ovarian carcinoma | 3 | MONDO:0005140 | EFO:0001075 |
| non-Hodgkin lymphoma | 3 | MONDO:0018908 | EFO:0005952 |
| carcinoma | 3 | MONDO:0004993 | EFO:0000313 |
| acute lymphoblastic leukemia | 3 | MONDO:0004967 | EFO:0000220 |
| lymphoma | 3 | MONDO:0005062 | EFO:0000574 |
| small cell lung carcinoma | 3 | MONDO:0008433 | EFO:0000702 |
| endometrium neoplasm | 3 | MONDO:0021251 | EFO:0004230 |
| mantle cell lymphoma | 3 | MONDO:0018876 | EFO:1001469 |
| breast neoplasm | 3 | MONDO:0021100 | EFO:0003869 |
| B-cell acute lymphoblastic leukemia | 3 | MONDO:0004947 | EFO:0000094 |
| B-cell chronic lymphocytic leukemia | 3 | MONDO:0004948 | EFO:0000095 |
| neoplasm of mature B-cells | 3 | MONDO:0004949 | EFO:0000096 |
| Ewing sarcoma | 3 | MONDO:0012817 | EFO:0000174 |
| Hodgkins lymphoma | 3 | MONDO:0004952 | EFO:0000183 |
| T-cell acute lymphoblastic leukemia | 3 | MONDO:0004963 | EFO:0000209 |
| peripheral T-cell lymphoma, not otherwise specified | 3 | MONDO:0004964 | EFO:0000211 |
| angioimmunoblastic T-cell lymphoma | 3 | MONDO:0004977 | EFO:0000255 |
| diffuse large B-cell lymphoma | 3 | MONDO:0018905 | EFO:0000403 |
| Kaposi’s sarcoma | 3 | MONDO:0005055 | EFO:0000558 |
| leiomyosarcoma | 3 | MONDO:0005058 | EFO:0000564 |
| leukemia | 3 | MONDO:0005059 | EFO:0000565 |
| neuroblastoma | 3 | MONDO:0005072 | EFO:0000621 |
| plasma cell myeloma | 3 | MONDO:0009693 | EFO:0001378 |
| triple-negative breast carcinoma | 3 | MONDO:0005494 | EFO:0005537 |
| inflammatory breast carcinoma | 3 | MONDO:0006804 | EFO:1000984 |
| soft tissue sarcoma | 3 | MONDO:0018078 | EFO:1001968 |
| fallopian tube carcinoma | 3 | MONDO:0006206 | EFO:1000251 |
| peritoneal neoplasm | 3 | MONDO:0006901 | EFO:1001100 |
| ganglioneuroblastoma | 3 | MONDO:0005035 | EFO:0000502 |
| hepatoblastoma | 3 | MONDO:0018666 | EFO:1000292 |
| neutropenia | 3 | MONDO:0001475 | MONDO:0001475 |
| brain cancer | 3 | MONDO:0001657 | MONDO:0001657 |
| fallopian tube neoplasm | 3 | MONDO:0021092 | MONDO:0002158 |
| ovarian cancer | 3 | MONDO:0008170 | MONDO:0008170 |
| follicular lymphoma | 3 | MONDO:0018906 | MONDO:0018906 |
| acute biphenotypic leukemia | 3 | MONDO:0020322 | MONDO:0019460 |
| nasal cavity and paranasal sinus lethal midline granuloma | 3 | MONDO:0006828 | MONDO:0019472 |
| urothelial carcinoma | 3 | MONDO:0040679 | EFO:0008528 |
| Waldenstrom macroglobulinemia | 3 | MONDO:0100280 | MONDO:0000432 |
| kidney cancer | 3 | MONDO:0002367 | MONDO:0002367 |
| mature T-cell and NK-cell non-Hodgkin lymphoma | 3 | MONDO:0000430 | MONDO:0000430 |
| retinoblastoma | 3 | MONDO:0008380 | MONDO:0008380 |
| brain neoplasm | 3 | MONDO:0021211 | EFO:0003833 |
| desmoid tumor | 3 | MONDO:0007608 | EFO:0009907 |
| marginal zone lymphoma | 3 | MONDO:0017604 | EFO:1000630 |
| lymphoid leukemia | 2 | MONDO:0005402 | EFO:0004289 |
| glioblastoma | 2 | MONDO:0018177 | EFO:0000519 |
| adenoid cystic carcinoma | 2 | MONDO:0004971 | EFO:0000231 |
| Burkitt lymphoma | 2 | MONDO:0007243 | EFO:0000309 |
| mesothelioma | 2 | MONDO:0005065 | EFO:0000588 |
| oligoastrocytoma | 2 | MONDO:0016702 | EFO:0000630 |
| oligodendroglioma | 2 | MONDO:0016695 | EFO:0000632 |
| prostate adenocarcinoma | 2 | MONDO:0005082 | EFO:0000673 |
| renal cell carcinoma | 2 | MONDO:0005086 | EFO:0000681 |
| malignant pleural mesothelioma | 2 | MONDO:0005112 | EFO:0000770 |
| anaplastic astrocytoma | 2 | MONDO:0016684 | EFO:0002499 |
| exocrine pancreatic carcinoma | 2 | MONDO:0005192 | EFO:0002618 |
| rhabdomyosarcoma | 2 | MONDO:0005212 | EFO:0002918 |
| anaplastic large cell lymphoma | 2 | MONDO:0020325 | EFO:0003032 |
| nasopharyngeal neoplasm | 2 | MONDO:0005375 | EFO:0004252 |
| cholangiocarcinoma | 2 | MONDO:0019087 | EFO:0005221 |
| plasma cell leukemia | 2 | MONDO:0018689 | EFO:0006475 |
| hereditary breast ovarian cancer syndrome | 2 | MONDO:0003582 | Orphanet:145 |
| myelodysplastic syndrome | 2 | MONDO:0018881 | EFO:0000198 |
| acute myeloid leukemia | 2 | MONDO:0018874 | EFO:0000222 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| optic nerve glioma | 2 | MONDO:0003235 | EFO:0009254 |
| ductal breast carcinoma in situ | 2 | MONDO:0005023 | EFO:0000432 |
| gastric adenocarcinoma | 2 | MONDO:0005036 | EFO:0000503 |
| blast phase chronic myelogenous leukemia, BCR-ABL1 positive | 2 | MONDO:0006115 | EFO:1000131 |
| neuroendocrine neoplasm | 2 | MONDO:0019496 | EFO:1001901 |
| gastric neoplasm | 2 | MONDO:0021085 | MONDO:0001056 |
| carcinosarcoma | 2 | MONDO:0002928 | MONDO:0002928 |
| salivary gland cancer | 2 | MONDO:0004669 | MONDO:0004669 |
| T-cell non-Hodgkin lymphoma | 2 | MONDO:0015760 | MONDO:0015760 |
| astrocytoma (excluding glioblastoma) | 2 | MONDO:0019781 | MONDO:0016691 |
| Wilms tumor | 2 | MONDO:0006058 | MONDO:0019004 |
| glioma | 2 | MONDO:0021042 | MONDO:0100342 |
| angiosarcoma | 2 | MONDO:0016982 | EFO:0003968 |
| bone cancer | 2 | MONDO:0002129 | EFO:1000350 |
| lung neoplasm | 2 | MONDO:0021117 | MONDO:0021117 |
| dedifferentiated liposarcoma | 2 | MONDO:0020563 | EFO:0003085 |
| oral cavity neoplasm | 2 | MONDO:0021245 | EFO:0003868 |
| hematopoietic and lymphoid system neoplasm | 2 | MONDO:0002334 | MONDO:0044881 |
| adrenal cortex carcinoma | 2 | MONDO:0006639 | EFO:1000796 |
| plasma cell neoplasm | 2 | MONDO:0004959 | EFO:0000200 |
| liposarcoma | 2 | MONDO:0005060 | EFO:0000569 |
| lymphoid neoplasm | 2 | MONDO:0005157 | EFO:0001642 |
| bone neoplasm | 2 | MONDO:0019060 | EFO:0003820 |
| pancreatic neoplasm | 2 | MONDO:0021040 | EFO:0003860 |
| CD4+/CD56+ hematodermic neoplasm | 2 | MONDO:0019467 | EFO:0010580 |
| paraganglioma | 2 | MONDO:0000448 | EFO:1000453 |
| primary cutaneous T-cell non-Hodgkin lymphoma | 1 | MONDO:0000607 | EFO:0002913 |
| male breast carcinoma | 1 | MONDO:0005628 | EFO:0006861 |
| thymic carcinoma | 1 | MONDO:0006451 | EFO:1000576 |
| thymoma | 1 | MONDO:0006456 | EFO:1000581 |
| hematologic disorder | 1 | MONDO:0005570 | HP:0001871 |
| breast carcinoma in situ | 1 | MONDO:0004658 | MONDO:0004658 |
| Castleman disease | 1 | MONDO:0015564 | MONDO:0015564 |
| metastatic melanoma | 1 | MONDO:0005191 | EFO:0002617 |
| primary effusion lymphoma | 1 | MONDO:0018842 | EFO:1000491 |
| B-cell non-Hodgkin lymphoma | 1 | MONDO:0015759 | EFO:1001938 |
| pancreatic ductal adenocarcinoma | 1 | MONDO:0005184 | MONDO:0005184 |
28 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 915.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 432 |
| PHASE3 | 202 |
| PHASE1 | 108 |
| PHASE1/PHASE2 | 80 |
| Not specified | 45 |
| PHASE4 | 25 |
| PHASE2/PHASE3 | 14 |
| EARLY_PHASE1 | 9 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03892330 | PHASE4 | NOT_YET_RECRUITING | Combination Therapy of Anthracyclines for Children With Nephroblastoma |
| NCT05844813 | PHASE4 | ENROLLING_BY_INVITATION | Neoadjuvant Chemotherapy Combined With Targeted Treatment in High-risk Retroperitoneal Sarcoma |
| NCT06831370 | PHASE4 | RECRUITING | A Study of Brentuximab Vedotin With Doxorubicin, Vinblastine and Dacarbazine in Adults With Hodgkin Lymphoma in India |
| NCT00198991 | PHASE4 | COMPLETED | German Multicenter Trial for Treatment of Newly Diagnosed Acute Lymphoblastic Leukemia in Adults (07/2003) |
| NCT00199004 | PHASE4 | COMPLETED | Trial for Treatment of Adult Patients With Standard Risk Acute Lymphoblastic Leukemia With Chemotherapy and Rituximab |
| NCT00199017 | PHASE4 | COMPLETED | German Multicenter Trial for the Treatment of Newly Diagnosed T-lymphoblastic Lymphoma in Adults |
| NCT00199056 | PHASE4 | COMPLETED | German Multicenter Trial for Treatment of Newly Diagnosed Acute Lymphoblastic Leukemia in Adults (06/99) |
| NCT00199069 | PHASE4 | COMPLETED | German Multicenter Trial for Treatment of Newly Diagnosed Acute Lymphoblastic Leukemia in Adults (05/93) |
| NCT00199082 | PHASE4 | COMPLETED | Newly Diagnosed Mature B-ALL, Burkitt’s Lymphoma and Other High-grade Lymphoma in Adults |
| NCT00199095 | PHASE4 | COMPLETED | Treatment of Elderly Patients (>65 Years) With Acute Lymphoblastic Leukemia |
| NCT00339118 | PHASE4 | UNKNOWN | EpSSG (European Soft Tissue Sarcoma Study Group) Protocol for Non-Metastatic Rhabdomyosarcoma in Children |
| NCT00531973 | PHASE4 | UNKNOWN | A Study of Liposomal Doxorubicin in Women With Breast Cancer Exploiting Tissue Doppler Imaging |
| NCT00969462 | PHASE4 | COMPLETED | Doxorubicin Pharmacokinetics and Response in Non Hodgkin’s Lymphoma |
| NCT01088724 | PHASE4 | COMPLETED | Fludarabine, Cyclophosphamide, Doxorubicin and Rituximab for the Treatment of Post-transplant Lymphoproliferative Disease (PTLD) |
| NCT01358253 | PHASE4 | COMPLETED | Rituximab Plus Chemotherapy for CD20+ Adult Acute Lymphoblastic Leukemia |
| NCT01537029 | PHASE4 | COMPLETED | Effect of Weight on the Population Pharmacokinetic Analysis of Doxorubicin and Cyclophosphamide |
| NCT01746992 | PHASE4 | UNKNOWN | CTOP/ITE/MTX Compared With CHOP as the First-line Therapy for Newly Diagnosed Young Patients With T Cell Lymphoma |
| NCT02419742 | PHASE4 | COMPLETED | Safety and Efficacy of Trastuzumab as Part of Breast Cancer Treatment Regimen |
| NCT02559154 | PHASE4 | UNKNOWN | Modified Bortezomib-based Combination Therapy for Multiple Myeloma |
| NCT02577783 | PHASE4 | UNKNOWN | PDD vs PAD to Treat Initially Diagnosed MM |
| NCT02853500 | PHASE4 | WITHDRAWN | Effect of Surefire Infusion Device on Tumor Response to Regional Intra-arterial Therapy for Primary Liver Malignancies |
| NCT02858804 | PHASE4 | COMPLETED | EDOCH Alternating With DHAP for New Diagnosed Younger MCL |
| NCT02894645 | PHASE4 | UNKNOWN | Malaysia-Singapore Acute Lymphoblastic Leukemia 2010 Study |
| NCT02903524 | PHASE4 | UNKNOWN | Doxorubicin Hydrochloride Liposome Injection Combination With Cyclophosphamide vs Pirarubicin Combination With Cyclophosphamide in Patients With Locally Advanced Breast Cancer |
| NCT03817853 | PHASE4 | COMPLETED | An Open-Label, Single Arm Study of Obinutuzumab Short Duration Infusion in Patients With Previously Untreated Advanced Follicular Lymphoma |
| NCT00572169 | PHASE3 | ACTIVE_NOT_RECRUITING | UARK 2006-66, Total Therapy 3B: An Extension of UARK 2003-33 Total Therapy |
| NCT01057069 | PHASE2/PHASE3 | ACTIVE_NOT_RECRUITING | Neo Adjuvant Chemotherapy in Triple Negative Breast Cancer |
| NCT01646034 | PHASE3 | ACTIVE_NOT_RECRUITING | High Dose Chemotherapy in Oligo-metastatic Homologous Recombination Deficient Breast Cancer |
| NCT01704716 | PHASE3 | RECRUITING | High Risk Neuroblastoma Study 1.8 of SIOP-Europe (SIOPEN) |
| NCT02112916 | PHASE3 | ACTIVE_NOT_RECRUITING | Combination Chemotherapy With or Without Bortezomib in Treating Younger Patients With Newly Diagnosed T-Cell Acute Lymphoblastic Leukemia or Stage II-IV T-Cell Lymphoblastic Lymphoma |
| NCT02180867 | PHASE2/PHASE3 | ACTIVE_NOT_RECRUITING | Radiation Therapy With or Without Combination Chemotherapy or Pazopanib Before Surgery in Treating Patients With Newly Diagnosed Non-rhabdomyosarcoma Soft Tissue Sarcomas That Can Be Removed by Surgery |
| NCT02306161 | PHASE3 | ACTIVE_NOT_RECRUITING | Combination Chemotherapy With or Without Ganitumab in Treating Patients With Newly Diagnosed Metastatic Ewing Sarcoma |
| NCT02661503 | PHASE3 | ACTIVE_NOT_RECRUITING | HD21 for Advanced Stages |
| NCT02845882 | PHASE3 | ACTIVE_NOT_RECRUITING | LBL-2016 for Children or Adolescents in China |
| NCT03007147 | PHASE3 | ACTIVE_NOT_RECRUITING | Imatinib Mesylate and Combination Chemotherapy in Treating Patients With Newly Diagnosed Philadelphia Chromosome Positive Acute Lymphoblastic Leukemia |
| NCT03017326 | PHASE3 | ACTIVE_NOT_RECRUITING | Paediatric Hepatic International Tumour Trial |
| NCT03020030 | PHASE3 | ACTIVE_NOT_RECRUITING | Treatment of Newly Diagnosed Acute Lymphoblastic Leukemia in Children and Adolescents |
| NCT03117751 | PHASE2/PHASE3 | ACTIVE_NOT_RECRUITING | Total Therapy XVII for Newly Diagnosed Patients With Acute Lymphoblastic Leukemia and Lymphoma |
| NCT03150693 | PHASE3 | RECRUITING | Inotuzumab Ozogamicin and Frontline Chemotherapy in Treating Young Adults With Newly Diagnosed B Acute Lymphoblastic Leukemia |
| NCT03533582 | PHASE3 | ACTIVE_NOT_RECRUITING | Cisplatin and Combination Chemotherapy in Treating Children and Young Adults With Hepatoblastoma or Liver Cancer After Surgery |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (2) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of CPNDS Guideline for daunorubicin, doxorubicin and RARG, | CPNDS | RARG;SLC28A3;UGT1A6 | yes | |
| Annotation of CPIC Guideline for aminosalicylic acid, chloramphenicol, | CPIC | G6PD |
PharmGKB also curates 77 clinical and 297 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
27 molecules share ≥1 primary target. Top 27 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AMSACRINE | ChEMBL | Phase 4 (approved) | TOP2A |
| CIPROFLOXACIN | ChEMBL | Phase 4 (approved) | TOP2A |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | TOP2A |
| DEXRAZOXANE | ChEMBL | Phase 4 (approved) | TOP2A |
| EPIRUBICIN | ChEMBL | Phase 4 (approved) | TOP2A |
| ETOPOSIDE | ChEMBL | Phase 4 (approved) | TOP2A |
| IDARUBICIN | ChEMBL | Phase 4 (approved) | TOP2A |
| MITOXANTRONE | ChEMBL | Phase 4 (approved) | TOP2A |
| TENIPOSIDE | ChEMBL | Phase 4 (approved) | TOP2A |
| TOPOTECAN | ChEMBL | Phase 4 (approved) | TOP2A |
| CURCUMIN | ChEMBL | Phase 3 | TOP2A |
| GEPOTIDACIN | ChEMBL | Phase 3 | TOP2A |
| AXL-1717 | ChEMBL | Phase 2 | TOP2A |
| DECERNOTINIB | ChEMBL | Phase 2 | TOP2A |
| LOSOXANTRONE | ChEMBL | Phase 2 | TOP2A |
| NEMORUBICIN | ChEMBL | Phase 2 | TOP2A |
| PIROXANTRONE | ChEMBL | Phase 2 | TOP2A |
| Afatinib | PubChem | Approved | TOP2A |
| Binimetinib | PubChem | Approved | TOP2A |
| Crizotinib | PubChem | Approved | TOP2A |
| Gefitinib | PubChem | Approved | TOP2A |
| Idelalisib | PubChem | Approved | TOP2A |
| Pazopanib | PubChem | Approved | TOP2A |
| podofilox | PubChem | Approved | TOP2A |
| regorafenib | PubChem | Approved | TOP2A |
| Selumetinib | PubChem | Approved | TOP2A |
| Trametinib | PubChem | Approved | TOP2A |
Related Atlas pages
- Genes: TOP2A
- Diseases: neoplasm, ovarian neoplasm, hepatocellular carcinoma, breast carcinoma, osteosarcoma, sarcoma, ovarian carcinoma, non-Hodgkin lymphoma, carcinoma, acute lymphoblastic leukemia, lymphoma, small cell lung carcinoma, endometrium neoplasm, mantle cell lymphoma, breast neoplasm, B-cell acute lymphoblastic leukemia, B-cell chronic lymphocytic leukemia, neoplasm of mature B-cells, Ewing sarcoma, Hodgkins lymphoma, T-cell acute lymphoblastic leukemia, peripheral T-cell lymphoma, not otherwise specified, angioimmunoblastic T-cell lymphoma, diffuse large B-cell lymphoma, Kaposi’s sarcoma, leiomyosarcoma, leukemia, neuroblastoma, plasma cell myeloma, triple-negative breast carcinoma, inflammatory breast carcinoma, soft tissue sarcoma, fallopian tube carcinoma, peritoneal neoplasm, ganglioneuroblastoma, hepatoblastoma, neutropenia, brain cancer, fallopian tube neoplasm, ovarian cancer, follicular lymphoma, acute biphenotypic leukemia, nasal cavity and paranasal sinus lethal midline granuloma, urothelial carcinoma, Waldenstrom macroglobulinemia, kidney cancer, mature T-cell and NK-cell non-Hodgkin lymphoma, retinoblastoma, brain neoplasm, desmoid tumor, marginal zone lymphoma
- Drugs: Amsacrine, Ciprofloxacin, Daunorubicin, Dexrazoxane, Epirubicin, Etoposide, Idarubicin, Mitoxantrone, Teniposide, Topotecan, Curcumin, Gepotidacin, Afatinib, Binimetinib, Crizotinib, Gefitinib, Idelalisib, Pazopanib, podofilox, regorafenib, Selumetinib, Trametinib
- Biomarker genes: ATM, LRP1B, TP53