Dromostanolone Propionate
drugOn this page
Also known as DrolbanDrostanolone propionateMasteridMasterilMasteronNSC-12198NSC-1298PermastrilDromostanolone proprionate
Summary
Dromostanolone Propionate (CHEMBL1201048) is an approved small-molecule antineoplastic agent targeting AR.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 1 (AR)
- Chemistry: 360.5 Da · C23H36O3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1201048 |
| Name | Dromostanolone Propionate |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 224004 |
| ChEBI | CHEBI:31523 |
| Molecular formula | C23H36O3 |
| Molecular weight | 360.5 |
| InChIKey | NOTIQUSPUUHHEH-UXOVVSIBSA-N |
SMILES: CCC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(C[C@H](C(=O)C4)C)C)C
IUPAC name: [(2R,5S,8R,9S,10S,13S,14S,17S)-2,10,13-trimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] propanoate
Pharmacological roles (ChEBI): antineoplastic agent.
Also known as: Drolban, Dromostanolone propionate, Drostanolone propionate, Masterid, Masteril, Masteron, NSC-12198, NSC-1298, Permastril, Dromostanolone proprionate, DROMOSTANOLONE PROPIONATE
Patent coverage: 9,977 distinct patent families (42,120 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| AR | Androgen receptor | Agonist | P10275 |
Bioactivity
No ChEMBL bioactivity rows at pChembl ≥ 5 (expected for biologics / antibodies).
Target pathways
Aggregated over 1 target gene(s): AR.
Top Reactome pathways
23 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 1 | AR |
| Signaling by Rho GTPases | 1 | AR |
| RHO GTPase Effectors | 1 | AR |
| Generic Transcription Pathway | 1 | AR |
| Cellular responses to stress | 1 | AR |
| SUMOylation | 1 | AR |
| SUMO E3 ligases SUMOylate target proteins | 1 | AR |
| HSP90 chaperone cycle for steroid hormone receptors (SHR) in the presence of ligand | 1 | AR |
| Nuclear Receptor transcription pathway | 1 | AR |
| Metabolism of proteins | 1 | AR |
| SUMOylation of intracellular receptors | 1 | AR |
| RHO GTPases activate PKNs | 1 | AR |
| Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3 | 1 | AR |
| Deubiquitination | 1 | AR |
| Ub-specific processing proteases | 1 | AR |
| Post-translational protein modification | 1 | AR |
| RNA Polymerase II Transcription | 1 | AR |
| Gene expression (Transcription) | 1 | AR |
| Transcriptional regulation by RUNX2 | 1 | AR |
| RUNX2 regulates osteoblast differentiation | 1 | AR |
| RUNX2 regulates bone development | 1 | AR |
| Cellular responses to stimuli | 1 | AR |
| Signaling by Rho GTPases, Miro GTPases and RHOBTB3 | 1 | AR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| negative regulation of transcription by RNA polymerase II | 1 |
| MAPK cascade | 1 |
| in utero embryonic development | 1 |
| regulation of systemic arterial blood pressure | 1 |
| epithelial cell morphogenesis | 1 |
| transcription by RNA polymerase II | 1 |
| signal transduction | 1 |
| cell-cell signaling | 1 |
| spermatogenesis | 1 |
| single fertilization | 1 |
| positive regulation of cell population proliferation | 1 |
| negative regulation of cell population proliferation | 1 |
| male gonad development | 1 |
| positive regulation of gene expression | 1 |
| male somatic sex determination | 1 |
Indications & clinical
Indications
0 indications (0 at ChEMBL trial phase 4).
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
130 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| MEGESTROL | ChEMBL + PubChem | Phase 4 (approved) | AR |
| ABIRATERONE | ChEMBL | Phase 4 (approved) | AR |
| APALUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | AR |
| BECLOMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | AR |
| BETAMETHASONE | ChEMBL | Phase 4 (approved) | AR |
| BICALUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| BITHIONOL | ChEMBL | Phase 4 (approved) | AR |
| BROMHEXINE | ChEMBL | Phase 4 (approved) | AR |
| BUDESONIDE | ChEMBL | Phase 4 (approved) | AR |
| CHLORMADINONE | ChEMBL | Phase 4 (approved) | AR |
| CLARITHROMYCIN | ChEMBL | Phase 4 (approved) | AR |
| CLASCOTERONE | ChEMBL | Phase 4 (approved) | AR |
| CLOCORTOLONE PIVALATE | ChEMBL | Phase 4 (approved) | AR |
| CLOMIPHENE | ChEMBL | Phase 4 (approved) | AR |
| CORTISONE | ChEMBL | Phase 4 (approved) | AR |
| CYCLOFENIL | ChEMBL | Phase 4 (approved) | AR |
| DAROLUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | AR |
| DESOXIMETASONE | ChEMBL | Phase 4 (approved) | AR |
| DEXAMETHASONE | ChEMBL | Phase 4 (approved) | AR |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | AR |
| DIFLORASONE DIACETATE | ChEMBL | Phase 4 (approved) | AR |
| DORZOLAMIDE | ChEMBL | Phase 4 (approved) | AR |
| DROSPIRENONE | ChEMBL | Phase 4 (approved) | AR |
| DYDROGESTERONE | ChEMBL | Phase 4 (approved) | AR |
| ENZALUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| EPLERENONE | ChEMBL | Phase 4 (approved) | AR |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | AR |
| ESTRADIOL CYPIONATE | ChEMBL | Phase 4 (approved) | AR |
| ESTRADIOL VALERATE | ChEMBL | Phase 4 (approved) | AR |
| ESTRIOL | ChEMBL | Phase 4 (approved) | AR |
| ESTRONE | ChEMBL | Phase 4 (approved) | AR |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | AR |
| ETHYNODIOL DIACETATE | ChEMBL | Phase 4 (approved) | AR |
| ETONOGESTREL | ChEMBL | Phase 4 (approved) | AR |
| FLUMETHASONE PIVALATE | ChEMBL | Phase 4 (approved) | AR |
| FLUOCINOLONE ACETONIDE | ChEMBL | Phase 4 (approved) | AR |
| FLUOCINONIDE | ChEMBL | Phase 4 (approved) | AR |
| FLUOXYMESTERONE | ChEMBL | Phase 4 (approved) | AR |
| FLURANDRENOLIDE | ChEMBL | Phase 4 (approved) | AR |
| FLUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| FLUTICASONE FUROATE | ChEMBL | Phase 4 (approved) | AR |
| FLUTICASONE PROPIONATE | ChEMBL | Phase 4 (approved) | AR |
| HALCINONIDE | ChEMBL | Phase 4 (approved) | AR |
| HALOBETASOL PROPIONATE | ChEMBL | Phase 4 (approved) | AR |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | AR |
| HEXESTROL | ChEMBL | Phase 4 (approved) | AR |
| HYDROCORTISONE | ChEMBL | Phase 4 (approved) | AR |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | AR |
| LEVONORGESTREL | ChEMBL | Phase 4 (approved) | AR |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | AR |
| METHYLPREDNISOLONE | ChEMBL | Phase 4 (approved) | AR |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | AR |
| MOMETASONE FUROATE | ChEMBL | Phase 4 (approved) | AR |
| NILUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| NOMEGESTROL | ChEMBL | Phase 4 (approved) | AR |
| NORETHINDRONE | ChEMBL | Phase 4 (approved) | AR |
| NORETHYNODREL | ChEMBL | Phase 4 (approved) | AR |
| OXANDROLONE | ChEMBL | Phase 4 (approved) | AR |
Related Atlas pages
- Genes: AR
- Drugs: Megestrol, Abiraterone, Apalutamide, Aripiprazole, Beclomethasone Dipropionate, Betamethasone, Bicalutamide, Bithionol, Bromhexine, Budesonide, Chlormadinone, Clarithromycin, Clascoterone, Clocortolone Pivalate, Clomiphene, Cortisone, Cyclofenil, Darolutamide, Desogestrel, Desoximetasone, Dexamethasone, Diethylstilbestrol, Diflorasone Diacetate, Dorzolamide, Drospirenone, Dydrogesterone, Enzalutamide, Eplerenone, Estradiol, Estradiol Cypionate, Estradiol Valerate, Estriol, Estrone, Ethinyl Estradiol, Ethynodiol Diacetate, Etonogestrel, Flumethasone Pivalate, Fluocinolone Acetonide, Fluocinonide, Fluoxymesterone, Flurandrenolide, Flutamide, Fluticasone Furoate, Fluticasone Propionate, Halcinonide, Halobetasol Propionate, Hexachlorophene, Hexestrol, Hydrocortisone, Indomethacin, Levonorgestrel, Medroxyprogesterone, Methylprednisolone, Mifepristone, Mometasone Furoate, Nilutamide, Norethindrone, Norethynodrel, Oxandrolone