Duloxetine
drugOn this page
Also known as DuloxetinaLY-248686LY248686(S)-DuloxetineS-DuloxetineSID26719725SID26757978SID49681583SID124893161DULOXETINE HYDROCHLORIDE
Summary
Duloxetine (CHEMBL1175) is an approved small molecule (ATC N06AX21) targeting HTR6, ZC3H14, and HTR2A; indicated across 37 conditions including osteoarthritis, knee and anxiety.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N06AX21
- Targets: 6 (HTR6, ZC3H14, HTR2A…)
- Indications: 37 conditions
- Clinical trials: 331
- Chemistry: 297.4 Da · C18H19NOS
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1175 |
| Name | Duloxetine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 60835 |
| ChEBI | CHEBI:36795 |
| ATC | N06AX21 |
| Molecular formula | C18H19NOS |
| Molecular weight | 297.4 |
| InChIKey | ZEUITGRIYCTCEM-KRWDZBQOSA-N |
SMILES: CNCC[C@@H](C1=CC=CS1)OC2=CC=CC3=CC=CC=C32
IUPAC name: (3S)-N-methyl-3-naphthalen-1-yloxy-3-thiophen-2-ylpropan-1-amine
Also known as: Duloxetina, Duloxetine, LY-248686, LY248686, (S)-Duloxetine, duloxetine, S-Duloxetine, SID26719725, SID26757978, SID49681583, SID124893161, DULOXETINE
Parent form; salt/anhydrous children: CHEMBL1200328
Patent coverage: 7,911 distinct patent families (28,527 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 28,258 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HTR6 | 5-HT6 receptor | Antagonist | 6.4 | 0.2% | P50406 |
| ZC3H14 | zinc finger CCCH-type containing 14 | Binding | 0% | Q6PJT7 | |
| HTR2A | 5-HT2A receptor | Antagonist | 6.3 | 0% | P28223 |
| HTR2C | 5-HT2C receptor | Antagonist | 6 | 0% | P28335 |
| SLC6A2 | NET | Inhibition | 8.22 | 0.4% | P23975 |
| SLC6A4 | SERT | Inhibition | 8.3 | 0.7% | P31645 |
Broader ChEMBL bioactivity targets: 43 (assay-derived). Sample: Histone-lysine N-methyltransferase 2A, 5-hydroxytryptamine receptor 2B, 5-hydroxytryptamine receptor 3A, Alpha-2C adrenergic receptor, Voltage-dependent L-type calcium channel subunit alpha-1C, Alpha-2B adrenergic receptor, A-type voltage-gated potassium channel KCND3, Sodium channel protein type 5 subunit alpha, Voltage-gated L-type calcium channel, P2X purinoceptor 4.
Bioactivity
ChEMBL activities: 107 potent at pChembl ≥ 5 of 127 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P31652 | 10.09 | Ki | 0.08 | nM | CHEMBL_ACT_13325640 |
| SLC6A4 | 9.62 | Ki | 0.24 | nM | CHEMBL_ACT_13325672 |
| SLC6A4 | 9.5 | IC50 | 0.32 | nM | CHEMBL_ACT_12668699 |
| SLC6A4 | 9.3 | Ki | 0.5 | nM | CHEMBL_ACT_2714826 |
| SLC6A4 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_652283 |
| SLC6A4 | 9.1 | Ki | 0.79 | nM | CHEMBL_ACT_662615 |
| SLC6A4 | 8.85 | Ki | 1.4 | nM | CHEMBL_ACT_655872 |
| SLC6A2 | 8.8 | IC50 | 1.58 | nM | CHEMBL_ACT_12668749 |
| SLC6A4 | 8.64 | IC50 | 2.3 | nM | CHEMBL_ACT_13325591 |
| SLC6A4 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_2483387 |
| SLC6A4 | 8.52 | AC50 | 3 | nM | CHEMBL_ACT_25149883 |
| SLC6A4 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_2522762 |
| SLC6A4 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_3285117 |
| SLC6A2 | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_2483369 |
| SLC6A2 | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_2522735 |
| SLC6A4 | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_2674398 |
| SLC6A2 | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_3285116 |
| SLC6A4 | 8.34 | Ki | 4.6 | nM | CHEMBL_ACT_1617662 |
| P31652 | 8.34 | Ki | 4.6 | nM | CHEMBL_ACT_2265484 |
| SLC6A2 | 8.34 | Ki | 4.6 | nM | CHEMBL_ACT_24987129 |
| SLC6A4 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_2163924 |
| SLC6A2 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_2674440 |
| SLC6A4 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_3226179 |
| SLC6A4 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_3309571 |
| SLC6A2 | 8.22 | Ki | 5.97 | nM | CHEMBL_ACT_12169776 |
| SLC6A4 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_1753742 |
| SLC6A4 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_1755301 |
| SLC6A4 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_2020842 |
| SLC6A4 | 8.18 | IC50 | 6.6 | nM | CHEMBL_ACT_2100220 |
| SLC6A4 | 8.18 | IC50 | 6.6 | nM | CHEMBL_ACT_2397254 |
Target pathways
Aggregated over 6 target gene(s): HTR6, ZC3H14, HTR2A, HTR2C, SLC6A2, SLC6A4.
Top Reactome pathways
21 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 3 | HTR2A, HTR2C, HTR6 |
| Signaling by GPCR | 3 | HTR2A, HTR2C, HTR6 |
| Class A/1 (Rhodopsin-like receptors) | 3 | HTR2A, HTR2C, HTR6 |
| Amine ligand-binding receptors | 3 | HTR2A, HTR2C, HTR6 |
| GPCR downstream signalling | 3 | HTR2A, HTR2C, HTR6 |
| Serotonin receptors | 3 | HTR2A, HTR2C, HTR6 |
| GPCR ligand binding | 3 | HTR2A, HTR2C, HTR6 |
| G alpha (q) signalling events | 2 | HTR2A, HTR2C |
| SLC-mediated transport of neurotransmitters | 2 | SLC6A2, SLC6A4 |
| Neurotransmitter clearance | 1 | SLC6A4 |
| Transmission across Chemical Synapses | 1 | SLC6A4 |
| Neuronal System | 1 | SLC6A4 |
| Disease | 1 | SLC6A2 |
| Serotonin clearance from the synaptic cleft | 1 | SLC6A4 |
| Transport of small molecules | 1 | SLC6A2 |
| G alpha (s) signalling events | 1 | HTR6 |
| R-HSA-425366 | 1 | SLC6A2 |
| SLC-mediated transmembrane transport | 1 | SLC6A2 |
| SLC transporter disorders | 1 | SLC6A2 |
| Defective SLC6A2 causes orthostatic intolerance (OI) | 1 | SLC6A2 |
| Disorders of transmembrane transporters | 1 | SLC6A2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| chemical synaptic transmission | 4 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 3 |
| signal transduction | 3 |
| G protein-coupled receptor signaling pathway | 3 |
| G protein-coupled serotonin receptor signaling pathway | 3 |
| response to xenobiotic stimulus | 3 |
| intracellular calcium ion homeostasis | 2 |
| phospholipase C-activating serotonin receptor signaling pathway | 2 |
| serotonin receptor signaling pathway | 2 |
| memory | 2 |
| positive regulation of phosphatidylinositol biosynthetic process | 2 |
| positive regulation of fat cell differentiation | 2 |
| behavioral response to cocaine | 2 |
| release of sequestered calcium ion into cytosol | 2 |
| positive regulation of ERK1 and ERK2 cascade | 2 |
Indications & clinical
Indications
37 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| osteoarthritis, knee | 3 | MONDO:0005416 | EFO:0004616 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| fibromyalgia | 3 | MONDO:0005546 | EFO:0005687 |
| biliary dyskinesia | 3 | MONDO:0005667 | EFO:0007169 |
| diabetic neuropathy | 3 | MONDO:0006626 | EFO:1000783 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| peripheral neuropathy | 3 | MONDO:0005244 | EFO:0003100 |
| major depressive disorder | 3 | MONDO:0002009 | MONDO:0002009 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| generalized anxiety disorder | 3 | MONDO:0001942 | EFO:1001892 |
| osteoarthritis | 3 | MONDO:0005178 | MONDO:0005178 |
| Parkinson disease | 3 | MONDO:0005180 | MONDO:0005180 |
| burning mouth syndrome | 3 | MONDO:0006687 | EFO:1000850 |
| diabetes mellitus | 2 | MONDO:0005015 | EFO:0000400 |
| attention deficit-hyperactivity disorder | 2 | MONDO:0007743 | EFO:0003888 |
| myalgic encephalomeyelitis/chronic fatigue syndrome | 2 | MONDO:0005404 | EFO:0004540 |
| neuralgia | 2 | MONDO:0021667 | EFO:0005762 |
| diabetic kidney disease | 2 | MONDO:0005016 | EFO:0000401 |
| interstitial lung disease | 2 | MONDO:0015925 | EFO:0004244 |
| multiple sclerosis | 2 | MONDO:0005301 | MONDO:0005301 |
| alcohol abuse | 2 | MONDO:0002046 | MONDO:0007079 |
| colorectal neoplasm | 2 | MONDO:0005335 | MONDO:0005575 |
| methamphetamine dependence | 1 | MONDO:0005419 | EFO:0004701 |
| stroke disorder | 0 | MONDO:0005098 | EFO:0000712 |
| post-traumatic stress disorder | 0 | MONDO:0005146 | EFO:0001358 |
12 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 331.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 99 |
| PHASE3 | 96 |
| Not specified | 66 |
| PHASE2 | 42 |
| PHASE1 | 14 |
| PHASE2/PHASE3 | 7 |
| EARLY_PHASE1 | 4 |
| PHASE1/PHASE2 | 3 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04245436 | PHASE4 | RECRUITING | Acute and Long-Term Antidepressant Treatment Success in Adolescents With Anxiety (AtLAS-A) |
| NCT04245748 | PHASE4 | RECRUITING | Determining Optimal Treatment Sequences in Anxious Depression (DOTS-AD) |
| NCT05851898 | PHASE4 | RECRUITING | Serotonin-norepinephrine Reuptake Inhibitor in Prophylaxis of Depression Following Fragility Fractures |
| NCT05851976 | PHASE4 | RECRUITING | Duloxetine for LBP |
| NCT05976347 | PHASE4 | RECRUITING | Identifying and Treating Depression in the Orthopaedic Trauma Population |
| NCT06232473 | PHASE4 | RECRUITING | Patient Education and Duloxetine, Alone and in Combination, for Patients With Multisystem Functional Somatic Disorder |
| NCT06245109 | PHASE4 | RECRUITING | Brain-Based and Clinical Phenotyping of Pain Pharmacotherapy in Knee Osteoarthritis |
| NCT06423716 | PHASE4 | RECRUITING | Effect of peRiopErative duLoxetIne Administration on Opioid Consumption Following Total kneE Arthroplasty (RELIFE) |
| NCT06807866 | PHASE4 | RECRUITING | Duloxetine for Perioperative Pain in Hip Arthroplasty: A RCT |
| NCT06968624 | PHASE4 | NOT_YET_RECRUITING | Ketamine for Postherpetic Neuralgia With Depression |
| NCT00067912 | PHASE4 | COMPLETED | Duloxetine vs. Active Comparator for the Treatment of Depression |
| NCT00071695 | PHASE4 | COMPLETED | Duloxetine vs. Active Comparator in the Treatment of Patients With Depression |
| NCT00177671 | PHASE4 | COMPLETED | Antidepressant Medication Plus Donepezil for Treating Late-life Depression |
| NCT00191061 | PHASE4 | COMPLETED | A Comparison of Tolerability and Efficacy of Different Doses of Duloxetine for the Treatment of Major Depressive Disorder |
| NCT00191932 | PHASE4 | COMPLETED | Switching to Duloxetine From Other Antidepressants |
| NCT00224302 | PHASE4 | COMPLETED | Treatment of MDEs During the Course of Psychotic Disorders With Duloxetine |
| NCT00244296 | PHASE4 | COMPLETED | To Determine How Effective Duloxetine is in Treating Women 65 Years and Older With Symptoms of Stress Urinary Incontinence, or With a Combination of Stress Urinary Incontinence and Urge Urinary Incontinence Symptoms |
| NCT00266643 | PHASE4 | COMPLETED | Tolerability of Switching to Duloxetine for the Management of Diabetic Nerve Pain |
| NCT00296699 | PHASE4 | COMPLETED | A Pilot Study Assessing Duloxetine’s Efficacy in Atypical Depression |
| NCT00322621 | PHASE4 | COMPLETED | Maintenance of Effect of Duloxetine in Patients With Diabetic Peripheral Neuropathic Pain (DPNP) |
| NCT00360724 | PHASE4 | COMPLETED | Duloxetine for Chronic Depression: a Double-blind Study |
| NCT00385671 | PHASE4 | COMPLETED | An Open-Label Comparison of Duloxetine to Other Alternatives for the Management of Diabetic Peripheral Neuropathic Pain |
| NCT00398632 | PHASE4 | TERMINATED | Switching to Duloxetine to Ameliorate SSRI-Induced Sexual Dysfunction |
| NCT00401258 | PHASE4 | COMPLETED | An Open-Label Trial of Duloxetine for the Treatment of Irritable Bowel Syndrome |
| NCT00406848 | PHASE4 | COMPLETED | A Study Comparing the Efficacy and Safety of Duloxetine and Placebo for the Treatment of Depression in Elderly Patients |
| NCT00422162 | PHASE4 | COMPLETED | A Study Evaluating Duloxetine in Patients Hospitalized for Severe Depression |
| NCT00437125 | PHASE4 | COMPLETED | Study on the Tolerability of Duloxetine in Depressed Patients With Parkinson’s Disease |
| NCT00438971 | PHASE4 | COMPLETED | The Efficacy and Tolerability of Duloxetine for the Treatment of Panic Disorder |
| NCT00443352 | PHASE4 | COMPLETED | A Research Study Examining The Use Of Duloxetine In The Prevention Of Migraine Headache |
| NCT00464698 | PHASE4 | COMPLETED | Duloxetine for the Treatment of Obsessive Compulsive Disorder (OCD) |
| NCT00479726 | PHASE4 | COMPLETED | Lilly’s Emotional and Physical Symptoms of Depression Study (LEAPS) |
| NCT00494377 | PHASE4 | COMPLETED | Duloxetine Versus Duloxetine Plus Non-Drug Therapy for Depression |
| NCT00517985 | PHASE4 | COMPLETED | Duloxetine for Perimenopausal Depression |
| NCT00531895 | PHASE4 | COMPLETED | An Open Trial of Duloxetine on Comorbid Major Depression and Chronic Headache |
| NCT00532480 | PHASE4 | COMPLETED | Study of Brain Response to Emotional Pictures Using a fMRI While on Duloxetine |
| NCT00536471 | PHASE4 | COMPLETED | A Study Comparing Duloxetine and Placebo in Assessing Energy and Vitality in Major Depressive Disorder (MDD) Patients |
| NCT00607789 | PHASE4 | COMPLETED | Study of Duloxetine vs Placebo in Treatment of Binge Eating Disorder With Depression |
| NCT00609557 | PHASE4 | COMPLETED | A Single-Blind Placebo Run-in Study of Duloxetine for Activity-Limiting Osteoarthritis Pain |
| NCT00619983 | PHASE4 | TERMINATED | Three Way Interaction Between Gabapentin, Duloxetine, and Donepezil in Patients With Diabetic Neuropathy |
| NCT00666757 | PHASE4 | COMPLETED | A Study Comparing Duloxetine to Other Antidepressants in the Treatment of Severe Depression |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (4) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of DPWG Guideline for duloxetine and CYP2D6 | DPWG | CYP2D6 | ||
| Annotation of CPIC Guideline for duloxetine and CYP2D6 | CPIC | CYP2D6 | ||
| Annotation of CPIC Guideline for desvenlafaxine, duloxetine, fluoxetin | CPIC | HTR2A | ||
| Annotation of CPIC Guideline for citalopram, desvenlafaxine, duloxetin | CPIC | SLC6A4 |
PharmGKB also curates 73 clinical and 101 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
777 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AMITRIPTYLINE | ChEMBL + PubChem | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| CINACALCET | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| DESLORATADINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| DIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| DOXEPIN | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| EBASTINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| FLUOXETINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| HALOPROGIN | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| ILOPERIDONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| IMIPRAMINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| LOXAPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| MEPAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| METHAPYRILENE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| MIANSERIN | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| MICONAZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| NORTRIPTYLINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| ORPHENADRINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| PIPAMAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| PROCHLORPERAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| PROMAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| PROMETHAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| PROPAFENONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| PROPRANOLOL | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| RALOXIFENE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| RISPERIDONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| TEGASEROD | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| TERFENADINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| THIORIDAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| ZIPRASIDONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| ENCLOMIPHENE | ChEMBL | Phase 3 | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| ZUCLOPENTHIXOL | ChEMBL | Phase 3 | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| METERGOLINE | ChEMBL | Phase 2 | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| PENFLURIDOL | ChEMBL | Phase 2 | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
| RITANSERIN | ChEMBL | Phase 2 | HTR2A, HTR2C, HTR6, SLC6A2, SLC6A4 |
Related Atlas pages
- Genes: HTR6, ZC3H14, HTR2A, HTR2C, SLC6A2, SLC6A4
- Diseases: osteoarthritis, knee, anxiety, fibromyalgia, biliary dyskinesia, diabetic neuropathy, dementia, peripheral neuropathy, major depressive disorder, depressive disorder, generalized anxiety disorder, osteoarthritis, Parkinson disease, burning mouth syndrome
- Drugs: Amitriptyline, Dihydroergotamine, Amiodarone, Amoxapine, Aripiprazole, Asenapine, Astemizole, Azelastine, Benztropine, Brexpiprazole, Carvedilol, Chlorpromazine, Cinacalcet, Clemastine, Clomipramine, Clotrimazole, Clozapine, Cyproheptadine, Desloratadine, Diethylstilbestrol, Diphenhydramine, Doxepin, Ebastine, Econazole, Fluoxetine, Fluphenazine, Fluspirilene, Haloperidol, Haloprogin, Iloperidone, Imipramine, Loxapine, Mepazine, Methapyrilene, Mianserin, Miconazole, Nefazodone, Nortriptyline, Orphenadrine, Pimozide, Pipamazine, Prochlorperazine, Promazine, Promethazine, Propafenone, Propranolol, Raloxifene, Risperidone, Sertindole, Sunitinib, Tamoxifen, Tegaserod, Terfenadine, Thioridazine, Ziprasidone, Enclomiphene, Zuclopenthixol