Enalaprilat Anhydrous
drugOn this page
Also known as enalaprilatEnalaprilatÊEnalaprilatÂC0164805
Summary
Enalaprilat Anhydrous (CHEMBL577) is an approved small-molecule EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor targeting ACE.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 1 (ACE)
- Clinical trials: 3
- Chemistry: 348.4 Da · C18H24N2O5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL577 |
| Name | Enalaprilat Anhydrous |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 44307141 |
| ChEBI | CHEBI:4786 |
| Molecular formula | C18H24N2O5 |
| Molecular weight | 348.4 |
| InChIKey | LZFZMUMEGBBDTC-ZALBZXLWSA-N |
SMILES: CC(C(=O)N1CCC[C@H]1C(=O)O)NC(CCC2=CC=CC=C2)C(=O)O
IUPAC name: (2S)-1-[2-[(1-carboxy-3-phenylpropyl)amino]propanoyl]pyrrolidine-2-carboxylic acid
ChEBI definition: Enalapril in which the ethyl ester group has been hydrolysed to the corresponding carboxylic acid. Enalaprilat is an angiotensin-converting enzyme (ACE) inhibitor and is used (often in the form of its prodrug, enalapril) in the treatment of hypertension and heart failure, for reduction of proteinuria and renal disease in patients with nephropathies, and for the prevention of stroke, myocardial infarction, and cardiac death in high-risk patients. Unlike enalapril, enalaprilat is not absorbed by mouth but is given by intravenous injection, usually as the dihydrate.
Pharmacological roles (ChEBI): EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor, antihypertensive agent.
Also known as: Enalaprilat anhydrous, enalaprilat, Enalaprilat, ENALAPRILAT, EnalaprilatÊ, EnalaprilatÂ, C0164805, ENALAPRILAT ANHYDROUS
Parent form; salt/anhydrous children: CHEMBL3989406
Patent coverage: 2,634 distinct patent families (10,256 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ACE | Angiotensin-converting enzyme | Inhibition | 7.5 | 0.7% | P12821 |
Broader ChEMBL bioactivity targets: 5 (assay-derived). Sample: Angiotensin-converting enzyme, Angiotensin-converting enzyme 2, Angiotensin-converting enzyme, Angiotensin-converting enzyme, Angiotensin-converting enzyme.
Bioactivity
ChEMBL activities: 25 potent at pChembl ≥ 5 of 25 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| Q5EGZ1 | 9.3 | Ki | 0.5 | nM | CHEMBL_ACT_1274480 |
| P47820 | 9.02 | IC50 | 0.95 | nM | CHEMBL_ACT_1114843 |
| ACE | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_104318 |
| ACE | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_25090607 |
| ACE | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_313843 |
| ACE | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_472509 |
| ACE | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_509302 |
| P12822 | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_536679 |
| ACE | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_919483 |
| P12822 | 8.85 | Ki | 1.4 | nM | CHEMBL_ACT_693009 |
| P47820 | 8.64 | IC50 | 2.3 | nM | CHEMBL_ACT_270200 |
| ACE | 8.62 | IC50 | 2.4 | nM | CHEMBL_ACT_360943 |
| ACE | 8.6 | IC50 | 2.5 | nM | CHEMBL_ACT_18097732 |
| ACE | 8.59 | IC50 | 2.6 | nM | CHEMBL_ACT_343794 |
| ACE | 8.54 | IC50 | 2.9 | nM | CHEMBL_ACT_862484 |
| ACE | 8.4 | IC50 | 3.98 | nM | CHEMBL_ACT_528716 |
| P47820 | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_693003 |
| P12822 | 8.37 | IC50 | 4.3 | nM | CHEMBL_ACT_544864 |
| P12822 | 8.24 | IC50 | 5.7 | nM | CHEMBL_ACT_1016964 |
| P12822 | 8.24 | IC50 | 5.7 | nM | CHEMBL_ACT_456627 |
| P12822 | 8.24 | IC50 | 5.8 | nM | CHEMBL_ACT_509301 |
| P12822 | 8.06 | IC50 | 8.8 | nM | CHEMBL_ACT_704361 |
| P47820 | 8.02 | IC50 | 9.6 | nM | CHEMBL_ACT_18097720 |
| P09470 | 7.94 | IC50 | 11.5 | nM | CHEMBL_ACT_18097726 |
| ACE | 5.51 | IC50 | 3100 | nM | CHEMBL_ACT_739478 |
Target pathways
Aggregated over 1 target gene(s): ACE.
Top Reactome pathways
3 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Metabolism of Angiotensinogen to Angiotensins | 1 | ACE |
| Peptide hormone metabolism | 1 | ACE |
| Metabolism of proteins | 1 | ACE |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| kidney development | 1 |
| blood vessel remodeling | 1 |
| angiotensin maturation | 1 |
| regulation of renal output by angiotensin | 1 |
| neutrophil mediated immunity | 1 |
| antigen processing and presentation of peptide antigen via MHC class I | 1 |
| regulation of systemic arterial blood pressure by renin-angiotensin | 1 |
| positive regulation of systemic arterial blood pressure | 1 |
| proteolysis | 1 |
| spermatogenesis | 1 |
| regulation of blood pressure | 1 |
| male gonad development | 1 |
| post-transcriptional regulation of gene expression | 1 |
| negative regulation of gene expression | 1 |
| substance P catabolic process | 1 |
Indications & clinical
Indications
0 indications (0 at ChEMBL trial phase 4).
Clinical trials
Total trials: 3.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 1 |
| PHASE3 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02639637 | PHASE4 | COMPLETED | Effect of DPP4 Inhibition on Vasoconstriction |
| NCT00741156 | PHASE3 | COMPLETED | The Acute Effects of the Angiotensin-converting Enzyme Inhibitor Enalaprilat on Flow Distribution |
| NCT00226096 | Not specified | COMPLETED | Intensive Blood Pressure Reduction in Acute Cerebral Haemorrhage |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
32 molecules share ≥1 primary target. Top 32 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CAPTOPRIL | ChEMBL + PubChem | Phase 4 (approved) | ACE |
| LOSARTAN | ChEMBL + PubChem | Phase 4 (approved) | ACE |
| PERINDOPRIL | ChEMBL + PubChem | Phase 4 (approved) | ACE |
| SITAGLIPTIN | ChEMBL + PubChem | Phase 4 (approved) | ACE |
| BENAZEPRIL | ChEMBL | Phase 4 (approved) | ACE |
| ENALAPRIL | ChEMBL | Phase 4 (approved) | ACE |
| FOSINOPRIL | ChEMBL | Phase 4 (approved) | ACE |
| IMIDAPRIL | ChEMBL | Phase 4 (approved) | ACE |
| LISINOPRIL | ChEMBL | Phase 4 (approved) | ACE |
| MOEXIPRIL | ChEMBL | Phase 4 (approved) | ACE |
| QUINAPRIL | ChEMBL | Phase 4 (approved) | ACE |
| RAMIPRIL | ChEMBL | Phase 4 (approved) | ACE |
| TELMISARTAN | ChEMBL | Phase 4 (approved) | ACE |
| TRANDOLAPRIL | ChEMBL | Phase 4 (approved) | ACE |
| EDETIC ACID | ChEMBL | Phase 3 | ACE |
| QUINAPRILAT | ChEMBL + PubChem | Phase 2 (approved) | ACE |
| BENAZEPRILAT | ChEMBL | Phase 2 | ACE |
| CERONAPRIL | ChEMBL | Phase 2 | ACE |
| FOSINOPRILAT | ChEMBL | Phase 2 | ACE |
| IMIDAPRILAT | ChEMBL | Phase 2 | ACE |
| LIBENZAPRIL | ChEMBL | Phase 2 | ACE |
| MOEXIPRILAT | ChEMBL | Phase 2 | ACE |
| OMAPATRILAT | ChEMBL | Phase 2 | ACE |
| PROLINE | ChEMBL | Phase 2 | ACE |
| RENTIAPRIL | ChEMBL | Phase 2 | ACE |
| SAMPATRILAT | ChEMBL | Phase 2 | ACE |
| SPIRAPRILAT | ChEMBL | Phase 2 | ACE |
| TEPROTIDE | ChEMBL | Phase 2 | ACE |
| ZOFENOPRIL | ChEMBL | Phase 2 | ACE |
| Gallic Acid | PubChem | Approved | ACE |
| Hydrochlorothiazide | PubChem | Approved | ACE |
| Paclitaxel | PubChem | Approved | ACE |
Related Atlas pages
- Genes: ACE
- Drugs: Captopril, Losartan, Perindopril, Sitagliptin, Benazepril, Enalapril, Fosinopril, Imidapril, Lisinopril, Moexipril, Quinapril, Ramipril, Telmisartan, Trandolapril, Edetic Acid, Hydrochlorothiazide, Paclitaxel