Enoximone
drugOn this page
Also known as EnoximonaMDL 17,043MDL-17043PerfanFenoximoneSID11111134SID50106183SID56320891SID85231030SID90340640SID56320892SID170466419SID144203688Eenoximone
Summary
Enoximone (CHEMBL249856) is an approved small molecule (ATC C01CE03) targeting PDE3A; indicated across 3 conditions including cardiovascular disorder and congestive heart failure.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C01CE03
- Targets: 1 (PDE3A)
- Indications: 3 conditions
- Clinical trials: 5
- Chemistry: 248.3 Da · C12H12N2O2S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL249856 |
| Name | Enoximone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 53708 |
| ATC | C01CE03 |
| Molecular formula | C12H12N2O2S |
| Molecular weight | 248.3 |
| InChIKey | ZJKNESGOIKRXQY-UHFFFAOYSA-N |
SMILES: CC1=C(NC(=O)N1)C(=O)C2=CC=C(C=C2)SC
IUPAC name: 4-methyl-5-(4-methylsulfanylbenzoyl)-1,3-dihydroimidazol-2-one
Also known as: Enoximona, Enoximone, MDL 17,043, MDL-17043, Perfan, Fenoximone, SID11111134, SID50106183, SID56320891, SID85231030, SID90340640, ENOXIMONE
Patent coverage: 1,258 distinct patent families (5,206 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| PDE3A | phosphodiesterase 3A | Inhibition | 5.42 | 0.1% | Q14432 |
Broader ChEMBL bioactivity targets: 17 (assay-derived). Sample: RecQ-like DNA helicase BLM, 15-hydroxyprostaglandin dehydrogenase [NAD(+)], Peripheral myelin protein 22, Thyrotropin receptor, Phosphodiesterase 4, Phosphodiesterase 3, Phosphodiesterase; PDE3 & PDE4, cGMP-inhibited 3’,5’-cyclic phosphodiesterase 3A, Muscarinic acetylcholine receptor M1, Polyunsaturated fatty acid lipoxygenase ALOX15.
Bioactivity
ChEMBL activities: 16 potent at pChembl ≥ 5 of 28 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| BLM | 8.89 | Potency | 1.3 | nM | CHEMBL_ACT_4749895 |
| BLM | 8.89 | Potency | 1.3 | nM | CHEMBL_ACT_4933806 |
| NFKB1 | 6.1 | Potency | 794.3 | nM | CHEMBL_ACT_3671938 |
| NFKB1 | 6.1 | Potency | 794.3 | nM | CHEMBL_ACT_4585220 |
| PDE4A | 5.57 | IC50 | 2700 | nM | CHEMBL_ACT_153244 |
| PDE4A | 5.54 | IC50 | 2900 | nM | CHEMBL_ACT_1269975 |
| PDE3A | 5.5 | AC50 | 3158 | nM | CHEMBL_ACT_25190947 |
| TSHR | 5.5 | Potency | 3162 | nM | CHEMBL_ACT_3912362 |
| TSHR | 5.5 | Potency | 3162 | nM | CHEMBL_ACT_4719029 |
| PDE3B | 5.42 | IC50 | 3800 | nM | CHEMBL_ACT_406591 |
| CYP3A4 | 5.3 | Potency | 5012 | nM | CHEMBL_ACT_4949370 |
| CYP3A4 | 5.3 | Potency | 5012 | nM | CHEMBL_ACT_5018249 |
| CYP3A4 | 5.3 | AC50 | 5012 | nM | CHEMBL_ACT_6049405 |
| PDE4A | 5.3 | IC50 | 5000 | nM | CHEMBL_ACT_803144 |
| PDE3B | 5.23 | IC50 | 5900 | nM | CHEMBL_ACT_25084333 |
| HSD17B10 | 5.2 | Potency | 6310 | nM | CHEMBL_ACT_4877375 |
Target pathways
Aggregated over 1 target gene(s): PDE3A.
Top Reactome pathways
1 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| G alpha (s) signalling events | 1 | PDE3A |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| oocyte maturation | 1 |
| lipid metabolic process | 1 |
| G protein-coupled receptor signaling pathway | 1 |
| response to xenobiotic stimulus | 1 |
| regulation of meiotic nuclear division | 1 |
| negative regulation of apoptotic process | 1 |
| negative regulation of vascular permeability | 1 |
| positive regulation of vascular permeability | 1 |
| positive regulation of oocyte development | 1 |
| regulation of ribonuclease activity | 1 |
| cellular response to cGMP | 1 |
| cellular response to transforming growth factor beta stimulus | 1 |
| apoptotic signaling pathway | 1 |
| negative regulation of adenylate cyclase-activating G protein-coupled receptor signaling pathway | 1 |
| negative regulation of cAMP/PKA signal transduction | 1 |
Indications & clinical
Indications
3 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| congestive heart failure | 3 | MONDO:0005009 | EFO:0000373 |
| coronary artery disorder | 3 | MONDO:0005010 | EFO:0001645 |
Clinical trials
Total trials: 5.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 2 |
| PHASE3 | 2 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00484133 | PHASE4 | UNKNOWN | Microcirculation Guided Therapy Versus Standard Treatment of Severe Sepsis |
| NCT04420455 | PHASE4 | TERMINATED | The Effects of Enoximone in Acute Exacerbation COPD |
| NCT00051285 | PHASE3 | TERMINATED | ESSENTIAL-The Studies of Oral Enoximone Therapy in Advanced Heart Failure |
| NCT00077948 | PHASE3 | TERMINATED | Enoximone Plus Extended-Release Metoprolol Succinate in Subjects With Advanced Chronic Heart Failure |
| NCT02285309 | Not specified | UNKNOWN | Perioperative Measurements of Diastolic Function in Cardiac Surgery |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
200 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CLOFARABINE | ChEMBL + PubChem | Phase 4 (approved) | PDE3A |
| IDELALISIB | ChEMBL + PubChem | Phase 4 (approved) | PDE3A |
| LOSARTAN | ChEMBL + PubChem | Phase 4 (approved) | PDE3A |
| TAFAMIDIS | ChEMBL + PubChem | Phase 4 (approved) | PDE3A |
| TAVABOROLE | ChEMBL + PubChem | Phase 4 (approved) | PDE3A |
| ACARBOSE | ChEMBL | Phase 4 (approved) | PDE3A |
| ADENOSINE | ChEMBL | Phase 4 (approved) | PDE3A |
| ALECTINIB | ChEMBL | Phase 4 (approved) | PDE3A |
| ALENDRONIC ACID | ChEMBL | Phase 4 (approved) | PDE3A |
| AMINOGLUTETHIMIDE | ChEMBL | Phase 4 (approved) | PDE3A |
| AMLEXANOX | ChEMBL | Phase 4 (approved) | PDE3A |
| ANAGRELIDE | ChEMBL | Phase 4 (approved) | PDE3A |
| ANTAZOLINE | ChEMBL | Phase 4 (approved) | PDE3A |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | PDE3A |
| BENAZEPRIL | ChEMBL | Phase 4 (approved) | PDE3A |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | PDE3A |
| BITHIONOL | ChEMBL | Phase 4 (approved) | PDE3A |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | PDE3A |
| CALCITRIOL | ChEMBL | Phase 4 (approved) | PDE3A |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | PDE3A |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | PDE3A |
| CEFOPERAZONE | ChEMBL | Phase 4 (approved) | PDE3A |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | PDE3A |
| CHLOROQUINE | ChEMBL | Phase 4 (approved) | PDE3A |
| CHOLIC ACID | ChEMBL | Phase 4 (approved) | PDE3A |
| CILOSTAZOL | ChEMBL | Phase 4 (approved) | PDE3A |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | PDE3A |
| CLADRIBINE | ChEMBL | Phase 4 (approved) | PDE3A |
| CODEINE | ChEMBL | Phase 4 (approved) | PDE3A |
| CRISABOROLE | ChEMBL | Phase 4 (approved) | PDE3A |
| DEOXYCHOLIC ACID | ChEMBL | Phase 4 (approved) | PDE3A |
| DEQUALINIUM | ChEMBL | Phase 4 (approved) | PDE3A |
| DIPYRIDAMOLE | ChEMBL | Phase 4 (approved) | PDE3A |
| DISOPYRAMIDE | ChEMBL | Phase 4 (approved) | PDE3A |
| DUVELISIB | ChEMBL | Phase 4 (approved) | PDE3A |
| EFAVIRENZ | ChEMBL | Phase 4 (approved) | PDE3A |
| ENCORAFENIB | ChEMBL | Phase 4 (approved) | PDE3A |
| ESTRADIOL CYPIONATE | ChEMBL | Phase 4 (approved) | PDE3A |
| ESTRADIOL VALERATE | ChEMBL | Phase 4 (approved) | PDE3A |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | PDE3A |
| FEXOFENADINE | ChEMBL | Phase 4 (approved) | PDE3A |
| GEMCITABINE | ChEMBL | Phase 4 (approved) | PDE3A |
| GRISEOFULVIN | ChEMBL | Phase 4 (approved) | PDE3A |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | PDE3A |
| HYDROXOCOBALAMIN | ChEMBL | Phase 4 (approved) | PDE3A |
| HYDROXYPROGESTERONE CAPROATE | ChEMBL | Phase 4 (approved) | PDE3A |
| IBANDRONIC ACID | ChEMBL | Phase 4 (approved) | PDE3A |
| IBUDILAST | ChEMBL | Phase 4 (approved) | PDE3A |
| IDEBENONE | ChEMBL | Phase 4 (approved) | PDE3A |
| IFOSFAMIDE | ChEMBL | Phase 4 (approved) | PDE3A |
| ILOPERIDONE | ChEMBL | Phase 4 (approved) | PDE3A |
| INAMRINONE | ChEMBL | Phase 4 (approved) | PDE3A |
| INDOCYANINE GREEN ACID FORM | ChEMBL | Phase 4 (approved) | PDE3A |
| IRBESARTAN | ChEMBL | Phase 4 (approved) | PDE3A |
| ISOPROTERENOL | ChEMBL | Phase 4 (approved) | PDE3A |
| ISRADIPINE | ChEMBL | Phase 4 (approved) | PDE3A |
| LAMIVUDINE | ChEMBL | Phase 4 (approved) | PDE3A |
| LAMOTRIGINE | ChEMBL | Phase 4 (approved) | PDE3A |
| MASOPROCOL | ChEMBL | Phase 4 (approved) | PDE3A |
| MECLIZINE | ChEMBL | Phase 4 (approved) | PDE3A |
Related Atlas pages
- Genes: PDE3A
- Diseases: cardiovascular disorder, congestive heart failure, coronary artery disorder
- Drugs: Clofarabine, Idelalisib, Losartan, Tafamidis, Tavaborole, Acarbose, Adenosine, Alectinib, Alendronic Acid, Aminoglutethimide, Amlexanox, Anagrelide, Antazoline, Aripiprazole, Benazepril, Benzbromarone, Bithionol, Cabozantinib, Calcitriol, Candesartan Cilexetil, Cannabidiol, Cefoperazone, Chlorhexidine, Chloroquine, Cholic Acid, Cilostazol, Cinnarizine, Cladribine, Codeine, Crisaborole, Deoxycholic Acid, Dequalinium, Dipyridamole, Disopyramide, Duvelisib, Efavirenz, Encorafenib, Estradiol Cypionate, Estradiol Valerate, Ethinyl Estradiol, Fexofenadine, Gemcitabine, Griseofulvin, Hexachlorophene, Hydroxocobalamin, Hydroxyprogesterone Caproate, Ibandronic Acid, Ibudilast, Idebenone, Ifosfamide, Iloperidone, Inamrinone, Indocyanine Green Acid Form, Irbesartan, Isoproterenol, Isradipine, Lamivudine, Lamotrigine, Masoprocol, Meclizine