Ensartinib
drug drugOn this page
Also known as EnsacoveX-396US9126947, 18
Summary
Ensartinib (CHEMBL4113131) is an approved small molecule targeting MET and ALK; indicated across 3 conditions including non-small cell lung carcinoma and melanoma; with CIViC clinical evidence for 3 variant-indication associations (e.g. ALK G1269A AND v::ALK Fusion in lung non-small cell carcinoma).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 2 (MET, ALK)
- Indications: 3 conditions
- Clinical trials: 30
- Precision-oncology evidence (CIViC): 3 variant–indication associations
- Chemistry: 561.4 Da · C26H27Cl2FN6O3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL4113131 |
| Name | Ensartinib |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 56960363 |
| Molecular formula | C26H27Cl2FN6O3 |
| Molecular weight | 561.4 |
| InChIKey | GLYMPHUVMRFTFV-QLFBSQMISA-N |
SMILES: C[C@@H]1CN(C[C@@H](N1)C)C(=O)C2=CC=C(C=C2)NC(=O)C3=NN=C(C(=C3)O[C@H](C)C4=C(C=CC(=C4Cl)F)Cl)N
IUPAC name: 6-amino-5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-N-[4-[(3R,5S)-3,5-dimethylpiperazine-1-carbonyl]phenyl]pyridazine-3-carboxamide
Also known as: Ensacove, Ensartinib, X-396, ENSARTINIB, US9126947, 18
Parent form; salt/anhydrous children: CHEMBL4297219
Patent coverage: 290 distinct patent families (679 SureChEMBL compound mentions), from 4 matched compound structure(s). One matched structure accounts for 660 (97%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| MET | MET proto-oncogene, receptor tyrosine kinase | Inhibition | 9.13 | 2.4% | P08581 |
| ALK | ALK receptor tyrosine kinase | Inhibition | 9.4 | 0.8% | Q9UM73 |
Broader ChEMBL bioactivity targets: 1 (assay-derived). Sample: Hepatocyte growth factor receptor.
Bioactivity
ChEMBL activities: 1 potent at pChembl ≥ 5 of 1 total. Top 100 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| MET | 9.13 | IC50 | 0.74 | nM | CHEMBL_ACT_19145487 |
Target pathways
Aggregated over 2 target gene(s): MET, ALK.
Top Reactome pathways
57 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 2 | ALK, MET |
| Disease | 2 | ALK, MET |
| Diseases of signal transduction by growth factor receptors and second messengers | 2 | ALK, MET |
| Signaling by Receptor Tyrosine Kinases | 2 | ALK, MET |
| PIP3 activates AKT signaling | 1 | MET |
| Developmental Biology | 1 | MET |
| Negative regulation of the PI3K/AKT network | 1 | MET |
| Signaling by ALK | 1 | ALK |
| Generic Transcription Pathway | 1 | MET |
| PI3K/AKT Signaling in Cancer | 1 | MET |
| Constitutive Signaling by Aberrant PI3K in Cancer | 1 | MET |
| Semaphorin interactions | 1 | MET |
| Sema4D in semaphorin signaling | 1 | MET |
| Sema4D mediated inhibition of cell attachment and migration | 1 | MET |
| Axon guidance | 1 | MET |
| Infectious disease | 1 | MET |
| RAF/MAP kinase cascade | 1 | MET |
| MAPK family signaling cascades | 1 | MET |
| MAPK1/MAPK3 signaling | 1 | MET |
| Signaling by MET | 1 | MET |
| MET Receptor Activation | 1 | MET |
| Negative regulation of MET activity | 1 | MET |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 1 | MET |
| RNA Polymerase II Transcription | 1 | MET |
| Gene expression (Transcription) | 1 | MET |
| MET activates RAS signaling | 1 | MET |
| MET activates PI3K/AKT signaling | 1 | MET |
| MET activates PTPN11 | 1 | MET |
| MET activates PTK2 signaling | 1 | MET |
| InlB-mediated entry of Listeria monocytogenes into host cell | 1 | MET |
| MET interacts with TNS proteins | 1 | MET |
| MET activates RAP1 and RAC1 | 1 | MET |
| MET receptor recycling | 1 | MET |
| MET activates STAT3 | 1 | MET |
| MET promotes cell motility | 1 | MET |
| Listeria monocytogenes entry into host cells | 1 | MET |
| Transcriptional Regulation by MECP2 | 1 | MET |
| Intracellular signaling by second messengers | 1 | MET |
| MECP2 regulates neuronal receptors and channels | 1 | MET |
| Nervous system development | 1 | MET |
| Signaling by ALK in cancer | 1 | ALK |
| ALK mutants bind TKIs | 1 | ALK |
| Drug resistance of ALK mutants | 1 | ALK |
| ASP-3026-resistant ALK mutants | 1 | ALK |
| NVP-TAE684-resistant ALK mutants | 1 | ALK |
| alectinib-resistant ALK mutants | 1 | ALK |
| brigatinib-resistant ALK mutants | 1 | ALK |
| ceritinib-resistant ALK mutants | 1 | ALK |
| crizotinib-resistant ALK mutants | 1 | ALK |
| lorlatinib-resistant ALK mutants | 1 | ALK |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| cell surface receptor protein tyrosine kinase signaling pathway | 2 |
| protein phosphorylation | 2 |
| signal transduction | 2 |
| endothelial cell morphogenesis | 1 |
| liver development | 1 |
| cell surface receptor signaling pathway | 1 |
| negative regulation of autophagy | 1 |
| neuron differentiation | 1 |
| pancreas development | 1 |
| positive regulation of transcription by RNA polymerase II | 1 |
| hepatocyte growth factor receptor signaling pathway | 1 |
| branching morphogenesis of an epithelial tube | 1 |
| positive chemotaxis | 1 |
| excitatory postsynaptic potential | 1 |
| semaphorin-plexin signaling pathway | 1 |
Indications & clinical
Indications
3 diseases in clinical trials (phase 1–3, investigational — not approved indications). Highest ChEMBL trial phase per disease; a non-cancer approved use is occasionally logged at phase 3 here.
| Disease (in trials) | Phase | MONDO | EFO |
|---|---|---|---|
| non-small cell lung carcinoma | 3 | MONDO:0005233 | EFO:0003060 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| lung neoplasm | 2 | MONDO:0021117 | MONDO:0008903 |
Clinical trials
Total trials: 30.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 17 |
| PHASE1 | 4 |
| PHASE3 | 3 |
| PHASE1/PHASE2 | 3 |
| Not specified | 2 |
| PHASE4 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT06785584 | PHASE4 | NOT_YET_RECRUITING | Efficacy and Safety of Ensartinib in Neoadjuvant Therapy for Stage IIA - IIIB (Operable or Potentially Operable) ALK-Positive Lung Adenocarcinoma :A Multicenter, Real-World Clinical Study |
| NCT02767804 | PHASE3 | ACTIVE_NOT_RECRUITING | eXalt3: Study Comparing X-396 (Ensartinib) to Crizotinib in ALK Positive Non-Small Cell Lung Cancer (NSCLC) Patients |
| NCT05341583 | PHASE3 | RECRUITING | Ensartinib as Adjuvant Treatment in Anaplastic Lymphoma Kinase (ALK) Positive Non-small Cell Lung Cancer |
| NCT06955325 | PHASE3 | NOT_YET_RECRUITING | Umbrella Trial of Adjuvant Therapy in Completely Resected High-risk Stage IA-IB NSCLC: Focus on Driver Mutations |
| NCT03155620 | PHASE2 | ACTIVE_NOT_RECRUITING | Targeted Therapy Directed by Genetic Testing in Treating Pediatric Patients With Relapsed or Refractory Advanced Solid Tumors, Non-Hodgkin Lymphomas, or Histiocytic Disorders (The Pediatric MATCH Screening Trial) |
| NCT03213652 | PHASE2 | ACTIVE_NOT_RECRUITING | Ensartinib in Treating Patients With Relapsed or Refractory Advanced Solid Tumors, Non-Hodgkin Lymphoma, or Histiocytic Disorders With ALK or ROS1 Genomic Alterations (A Pediatric MATCH Treatment Trial) |
| NCT03420508 | PHASE2 | ACTIVE_NOT_RECRUITING | Treating Patients With Melanoma and ALK Alterations With Ensartinib |
| NCT05241028 | PHASE2 | RECRUITING | Adjuvant Therapy of Ensartinib in Stage IB-IIIA ALK-positive Non-small Cell Lung Cancer |
| NCT05491811 | PHASE2 | ACTIVE_NOT_RECRUITING | Ensartinib in Combination With Bevacizumab in ALK-positive NSCLC Patients With TP53 Mutation |
| NCT06563999 | PHASE2 | RECRUITING | Neoadjuvant Umbrella Trial for Patients With Unresectable Stage III NSCLC Harboring Rare Mutations. |
| NCT06762327 | PHASE2 | NOT_YET_RECRUITING | Ensartinib in the Treatment of ALK Positive or MET Exon 14 Skipping Anvanced Solid Tumors Excluded Lung Cancer |
| NCT06772610 | PHASE2 | NOT_YET_RECRUITING | The Efficacy and Safety of Ensartinib As Adjuvant Therapy in Stage I ALK-positive NSCLC Patients with High Risk Factors |
| NCT06779539 | PHASE2 | NOT_YET_RECRUITING | Neoadjuvant Ensartinib in ALK Positive Resectable Stage II to III Non-Small Cell Lung Cancer |
| NCT06780839 | PHASE2 | NOT_YET_RECRUITING | Adjuvant Treatment of ALK-positive Non-small Cell Lung Cancer with Ensartinib Guided by MRD |
| NCT07235306 | PHASE2 | NOT_YET_RECRUITING | Ensartinib After Chemoradiotherapy in Stage III ALK-Mutated NSCLC |
| NCT07354061 | PHASE1/PHASE2 | RECRUITING | Neoadjuvant Therapy With Ensartinib Combined With Chemotherapy for ALK-positive Non - Small Cell Lung Cancer (NSCLC) |
| NCT07448116 | PHASE1/PHASE2 | RECRUITING | Study of MCLA-129 in Combination With Ensartinib in Patients With Advanced Solid Tumors. |
| NCT02898116 | PHASE1/PHASE2 | COMPLETED | Phase 1/2 Study of Ensartinib and Durvalumab, in ALK-rearranged Non-small Cell Lung Cancer |
| NCT03215693 | PHASE2 | UNKNOWN | X-396 Capsule in Patients With ALK-positive Non-small Cell Lung Cancer Previously Treated With Crizotinib |
| NCT03574402 | PHASE2 | UNKNOWN | Phase II Umbrella Study Directed by Next Generation Sequencing |
| NCT03608007 | PHASE2 | UNKNOWN | X-396 Capsule in Advanced NSCLC Patients With ROS1 Gene Rearrangement |
| NCT03737994 | PHASE2 | TERMINATED | Targeted Treatment for ALK Positive Patients Who Have Previously Been Treated for Non-squamous Non-small Cell Lung Cancer |
| NCT05178511 | PHASE2 | UNKNOWN | Ensatinib Treat Second-generation ALK-TKI Resistance After Second-generation ALK-TKI Resistance |
| NCT05380024 | PHASE2 | UNKNOWN | A Study of Ensartinib as Neoadjuvant Therapy for Patients With ALK Positive Resectable Non-Small Cell Lung Cancer |
| NCT04837716 | PHASE1 | ACTIVE_NOT_RECRUITING | Ensartinib, Carboplatin, Pemetrexed and Bevacizumab for the Treatment of Stage IIIC or IV or Recurrent ALK-Positive Non-small Cell Lung Cancer |
| NCT06492525 | PHASE1 | NOT_YET_RECRUITING | A Study To Evaluate The Effect Of Rifampicin Or Ltraconazole On Pharmacokinetics Of Ensartinib In Healthy Volunteers |
| NCT02959619 | PHASE1 | COMPLETED | Ensartinib in Non-small Cell Lung Cancer Patients With Positive ALK |
| NCT03804541 | PHASE1 | UNKNOWN | The Absorption, Metabolism and Excretion of [14C]Ensartinib in Human |
| NCT04146571 | Not specified | AVAILABLE | Expanded Access to Ensartinib for Participants With ALK+ NSCLC |
| NCT05498064 | Not specified | RECRUITING | A Real World Study of Ensartinib in Advanced ALK-positive NSCLC |
Clinical evidence (CIViC)
Variant × indication × effect (3 predictive associations from 3 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| ALK G1269A AND v::ALK Fusion | Lung Non-small Cell Carcinoma | Sensitivity/Response | Ensartinib | CIViC B | EID8861 |
| EML4::ALK Fusion AND ALK C1156Y | Lung Non-small Cell Carcinoma | Sensitivity/Response | Ensartinib | CIViC B | EID8860 |
| EML4::ALK Fusion AND ALK L1196M | Lung Non-small Cell Carcinoma | Sensitivity/Response | Ensartinib | CIViC B | EID7865 |
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
102 molecules share ≥1 primary target. Top 100 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | ALK, MET |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ALK, MET |
| GEFITINIB | ChEMBL + PubChem | Phase 4 (approved) | ALK, MET |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | ALK, MET |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | ALK, MET |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | ALK, MET |
| CERITINIB | ChEMBL | Phase 4 (approved) | ALK, MET |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | ALK, MET |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | ALK, MET |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | ALK, MET |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | ALK, MET |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | ALK, MET |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | ALK, MET |
| PALBOCICLIB | ChEMBL | Phase 4 (approved) | ALK, MET |
| SUNITINIB | ChEMBL | Phase 4 (approved) | ALK, MET |
| VANDETANIB | ChEMBL | Phase 4 (approved) | ALK, MET |
| CANERTINIB | ChEMBL | Phase 3 | ALK, MET |
| CEDIRANIB | ChEMBL | Phase 3 | ALK, MET |
| DACTOLISIB | ChEMBL | Phase 3 | ALK, MET |
| LESTAURTINIB | ChEMBL | Phase 3 | ALK, MET |
| LINIFANIB | ChEMBL | Phase 3 | ALK, MET |
| QUERCETIN | ChEMBL | Phase 3 | ALK, MET |
| BEMCENTINIB | ChEMBL | Phase 2 | ALK, MET |
| BI-2536 | ChEMBL | Phase 2 | ALK, MET |
| BMS-754807 | ChEMBL | Phase 2 | ALK, MET |
| CENISERTIB | ChEMBL | Phase 2 | ALK, MET |
| ENVONALKIB | ChEMBL | Phase 2 | ALK, MET |
| FORETINIB | ChEMBL | Phase 2 | ALK, MET |
| ILORASERTIB | ChEMBL | Phase 2 | ALK, MET |
| OSI-632 | ChEMBL | Phase 2 | ALK, MET |
| PELITINIB | ChEMBL | Phase 2 | ALK, MET |
| R-406 | ChEMBL | Phase 2 | ALK, MET |
| SU-014813 | ChEMBL | Phase 2 | ALK, MET |
| TOZASERTIB | ChEMBL | Phase 2 | ALK, MET |
| Idelalisib | PubChem | Approved | ALK, MET |
| Selumetinib | PubChem | Approved | ALK, MET |
| AFATINIB DIMALEATE | ChEMBL | Phase 4 (approved) | MET |
| ALECTINIB | ChEMBL | Phase 4 (approved) | ALK |
| AXITINIB | ChEMBL | Phase 4 (approved) | MET |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | MET |
| CABOZANTINIB S-MALATE | ChEMBL | Phase 4 (approved) | MET |
| CAPMATINIB | ChEMBL | Phase 4 (approved) | MET |
| DABRAFENIB | ChEMBL | Phase 4 (approved) | MET |
| GILTERITINIB | ChEMBL | Phase 4 (approved) | ALK |
| LORLATINIB | ChEMBL | Phase 4 (approved) | ALK |
| NERATINIB | ChEMBL | Phase 4 (approved) | MET |
| OSIMERTINIB | ChEMBL | Phase 4 (approved) | ALK |
| REPOTRECTINIB | ChEMBL | Phase 4 (approved) | ALK |
| RUXOLITINIB | ChEMBL | Phase 4 (approved) | ALK |
| SORAFENIB | ChEMBL | Phase 4 (approved) | MET |
| TEPOTINIB | ChEMBL | Phase 4 (approved) | MET |
| TIVOZANIB | ChEMBL | Phase 4 (approved) | MET |
| UPADACITINIB | ChEMBL | Phase 4 (approved) | ALK |
| ALVOCIDIB | ChEMBL | Phase 3 | ALK |
| DOVITINIB | ChEMBL | Phase 3 | ALK |
| ENZASTAURIN | ChEMBL | Phase 3 | MET |
| EPIGALOCATECHIN GALLATE | ChEMBL | Phase 3 | MET |
| LINSITINIB | ChEMBL | Phase 3 | MET |
| POZIOTINIB | ChEMBL | Phase 3 | MET |
| RIGOSERTIB | ChEMBL | Phase 3 | MET |
| ROCILETINIB | ChEMBL | Phase 3 | ALK |
| SAVOLITINIB | ChEMBL | Phase 3 | MET |
| SEMAXANIB | ChEMBL | Phase 3 | ALK |
| SITRAVATINIB | ChEMBL | Phase 3 | MET |
| TIVANTINIB | ChEMBL | Phase 3 | MET |
| ALTIRATINIB | ChEMBL | Phase 2 | MET |
| AMG-208 | ChEMBL | Phase 2 | MET |
| AMG-337 | ChEMBL | Phase 2 | MET |
| AT-9283 | ChEMBL | Phase 2 | MET |
| BMS-777607 | ChEMBL | Phase 2 | MET |
| CEP-11981 | ChEMBL | Phase 2 | ALK |
| CEP-32496 | ChEMBL | Phase 2 | MET |
| DALMELITINIB | ChEMBL | Phase 2 | MET |
| DECERNOTINIB | ChEMBL | Phase 2 | MET |
| DEFOSBARASERTIB | ChEMBL | Phase 2 | MET |
| ELLAGIC ACID | ChEMBL | Phase 2 | MET |
| ELZOVANTINIB | ChEMBL | Phase 2 | MET |
| GLESATINIB | ChEMBL | Phase 2 | MET |
| GOLVATINIB | ChEMBL | Phase 2 | MET |
| GUMARONTINIB | ChEMBL | Phase 2 | MET |
| IRUPLINALKIB | ChEMBL | Phase 2 | ALK |
| MERESTINIB | ChEMBL | Phase 2 | MET |
| MK-2461 | ChEMBL | Phase 2 | MET |
| NINGETINIB | ChEMBL | Phase 2 | MET |
| RAF-265 | ChEMBL | Phase 2 | MET |
| RAVOXERTINIB | ChEMBL | Phase 2 | MET |
| REBASTINIB | ChEMBL | Phase 2 | MET |
| SAR-125844 | ChEMBL | Phase 2 | MET |
| SELICICLIB | ChEMBL | Phase 2 | ALK |
| SELITRECTINIB | ChEMBL | Phase 2 | ALK |
| TAK-715 | ChEMBL | Phase 2 | ALK |
| UCN-01 | ChEMBL | Phase 2 | MET |
| VABAMETKIB | ChEMBL | Phase 2 | MET |
| VEBRELTINIB | ChEMBL | Phase 2 | MET |
| VX-702 | ChEMBL | Phase 2 | ALK |
| ZOTIZALKIB | ChEMBL | Phase 2 | ALK |
| belumosudil | PubChem | Approved | ALK |
| Binimetinib | PubChem | Approved | MET |
| dacomitinib | PubChem | Approved | MET |
| Fostamatinib | PubChem | Approved | MET |
Related Atlas pages
- Genes: MET, ALK
- In clinical trials for: non-small cell lung carcinoma, melanoma, lung neoplasm
- Drugs: Afatinib, Crizotinib, Gefitinib, Pazopanib, Bosutinib, Brigatinib, Ceritinib, Entrectinib, Erlotinib, Fedratinib, Infigratinib, Midostaurin, Nintedanib, Palbociclib, Sunitinib, Vandetanib, Canertinib, Cediranib, Dactolisib, Lestaurtinib, Linifanib, Quercetin, Idelalisib, Selumetinib, Alectinib, Axitinib, Cabozantinib, Capmatinib, Dabrafenib, Gilteritinib, Lorlatinib, Neratinib, Osimertinib, Repotrectinib, Ruxolitinib, Sorafenib, Tepotinib, Tivozanib, Upadacitinib, Alvocidib, Dovitinib, Enzastaurin, Epigalocatechin Gallate, Linsitinib, Poziotinib, Rigosertib, Rociletinib, Savolitinib, Semaxanib, Sitravatinib, Tivantinib, belumosudil, Binimetinib, dacomitinib, Fostamatinib