Entospletinib
drug drugOn this page
Also known as GS-9973SYK INHIBITOR GS-9973GS9973CPD 68CG9ENTOSPLETINIB DIMESYLATEENTOSPLETINIB (GS-9973)
Summary
Entospletinib (CHEMBL3265032) is a phase-3 clinical-stage small molecule targeting SYK; indicated across 9 conditions including acute myeloid leukemia and b-cell chronic lymphocytic leukemia.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 1 (SYK)
- Indications: 9 conditions
- Clinical trials: 12
- Chemistry: 411.5 Da · C23H21N7O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL3265032 |
| Name | Entospletinib |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 59473233 |
| Molecular formula | C23H21N7O |
| Molecular weight | 411.5 |
| InChIKey | XSMSNFMDVXXHGJ-UHFFFAOYSA-N |
SMILES: C1COCCN1C2=CC=C(C=C2)NC3=NC(=CN4C3=NC=C4)C5=CC6=C(C=C5)C=NN6
IUPAC name: 6-(1H-indazol-6-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyrazin-8-amine
Also known as: Entospletinib, GS-9973, SYK INHIBITOR GS-9973, ENTOSPLETINIB, GS9973, CPD 68, CG9, ENTOSPLETINIB DIMESYLATE, ENTOSPLETINIB (GS-9973), Entospletinib (GS-9973)
Patent coverage: 497 distinct patent families (1,628 SureChEMBL compound mentions), from 2 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SYK | spleen associated tyrosine kinase | Inhibition | 8.11 | 2% | P43405 |
Broader ChEMBL bioactivity targets: 10 (assay-derived). Sample: Receptor-type tyrosine-protein kinase FLT3, Mast/stem cell growth factor receptor Kit, Tyrosine-protein kinase SYK, High affinity nerve growth factor receptor, Tyrosine-protein kinase JAK2, Casein kinase 2, Tyrosine-protein kinase SYK, Protein-tyrosine kinase 6, Tyrosine-protein kinase BTK, Proto-oncogene tyrosine-protein kinase ROS.
Bioactivity
ChEMBL activities: 29 potent at pChembl ≥ 5 of 30 total. Top 100 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| SYK | 8.7 | EC50 | 2 | nM | CHEMBL_ACT_20609093 |
| SYK | 8.11 | IC50 | 7.7 | nM | CHEMBL_ACT_14671986 |
| SYK | 8.11 | IC50 | 7.7 | nM | CHEMBL_ACT_25497181 |
| SYK | 7.99 | IC50 | 10.3 | nM | CHEMBL_ACT_26145239 |
| SYK | 7.96 | IC50 | 11 | nM | CHEMBL_ACT_24752228 |
| SYK | 7.96 | IC50 | 11 | nM | CHEMBL_ACT_26148016 |
| SYK | 7.78 | IC50 | 16.5 | nM | CHEMBL_ACT_20609057 |
| SYK | 7.78 | IC50 | 16.5 | nM | CHEMBL_ACT_25638895 |
| SYK | 7.58 | EC50 | 26 | nM | CHEMBL_ACT_14672029 |
| SYK | 7.46 | IC50 | 35 | nM | CHEMBL_ACT_25879192 |
| SYK | 7.39 | EC50 | 41 | nM | CHEMBL_ACT_14672078 |
| SYK | 7.09 | IC50 | 82 | nM | CHEMBL_ACT_22982176 |
| SYK | 6.9 | EC50 | 125 | nM | CHEMBL_ACT_14672076 |
| JAK2 | 6.84 | IC50 | 143 | nM | CHEMBL_ACT_25879210 |
| SYK | 6.83 | IC50 | 147 | nM | CHEMBL_ACT_14672080 |
| SYK | 6.75 | EC50 | 178 | nM | CHEMBL_ACT_20609129 |
| FLT3 | 6.52 | IC50 | 303 | nM | CHEMBL_ACT_25879197 |
| FLT3 | 6.49 | EC50 | 327 | nM | CHEMBL_ACT_14672070 |
| SYK | 6.43 | EC50 | 367 | nM | CHEMBL_ACT_14672046 |
| SYK | 6.42 | IC50 | 377 | nM | CHEMBL_ACT_15225264 |
| P05532 | 6.35 | EC50 | 445 | nM | CHEMBL_ACT_14672068 |
| JAK2 | 6.34 | EC50 | 453 | nM | CHEMBL_ACT_14672066 |
| NTRK1 | 6.25 | IC50 | 569 | nM | CHEMBL_ACT_25879205 |
| CSNK2A2 | 6.22 | IC50 | 604 | nM | CHEMBL_ACT_25879211 |
| BTK | 6.1 | IC50 | 801 | nM | CHEMBL_ACT_22982182 |
| PTK6 | 6.08 | IC50 | 842 | nM | CHEMBL_ACT_25879212 |
| ROS1 | 6.07 | IC50 | 857 | nM | CHEMBL_ACT_25879195 |
| SYK | 6.06 | IC50 | 878 | nM | CHEMBL_ACT_15224040 |
| Q64725 | 5.72 | EC50 | 1900 | nM | CHEMBL_ACT_14672714 |
Target pathways
Aggregated over 1 target gene(s): SYK.
Top Reactome pathways
47 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Hemostasis | 1 | SYK |
| GPVI-mediated activation cascade | 1 | SYK |
| Cytokine Signaling in Immune system | 1 | SYK |
| Adaptive Immune System | 1 | SYK |
| Signal Transduction | 1 | SYK |
| Disease | 1 | SYK |
| Innate Immune System | 1 | SYK |
| Immune System | 1 | SYK |
| Fcgamma receptor (FCGR) dependent phagocytosis | 1 | SYK |
| FCGR activation | 1 | SYK |
| Regulation of actin dynamics for phagocytic cup formation | 1 | SYK |
| Role of phospholipids in phagocytosis | 1 | SYK |
| DAP12 interactions | 1 | SYK |
| DAP12 signaling | 1 | SYK |
| Fc epsilon receptor (FCERI) signaling | 1 | SYK |
| Role of LAT2/NTAL/LAB on calcium mobilization | 1 | SYK |
| FCERI mediated MAPK activation | 1 | SYK |
| FCERI mediated Ca+2 mobilization | 1 | SYK |
| Integrin signaling | 1 | SYK |
| Signaling by Interleukins | 1 | SYK |
| Interleukin-2 family signaling | 1 | SYK |
| Interleukin-3, Interleukin-5 and GM-CSF signaling | 1 | SYK |
| CLEC7A (Dectin-1) signaling | 1 | SYK |
| Dectin-2 family | 1 | SYK |
| C-type lectin receptors (CLRs) | 1 | SYK |
| Infectious disease | 1 | SYK |
| Platelet activation, signaling and aggregation | 1 | SYK |
| Platelet Aggregation (Plug Formation) | 1 | SYK |
| Interleukin-2 signaling | 1 | SYK |
| Regulation of signaling by CBL | 1 | SYK |
| FLT3 Signaling | 1 | SYK |
| Leishmania infection | 1 | SYK |
| Anti-inflammatory response favouring Leishmania parasite infection | 1 | SYK |
| FCGR3A-mediated IL10 synthesis | 1 | SYK |
| Parasite infection | 1 | SYK |
| Leishmania phagocytosis | 1 | SYK |
| FCGR3A-mediated phagocytosis | 1 | SYK |
| Leishmania parasite growth and survival | 1 | SYK |
| Signaling by CSF3 (G-CSF) | 1 | SYK |
| Potential therapeutics for SARS | 1 | SYK |
| SARS-CoV Infections | 1 | SYK |
| Inactivation of CSF3 (G-CSF) signaling | 1 | SYK |
| FLT3 signaling through SRC family kinases | 1 | SYK |
| Parasitic Infection Pathways | 1 | SYK |
| Viral Infection Pathways | 1 | SYK |
| Antigen activates B Cell Receptor (BCR) leading to generation of second messengers | 1 | SYK |
| Signaling by the B Cell Receptor (BCR) | 1 | SYK |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| angiogenesis | 1 |
| cell activation | 1 |
| lymph vessel development | 1 |
| positive regulation of receptor internalization | 1 |
| stimulatory C-type lectin receptor signaling pathway | 1 |
| adaptive immune response | 1 |
| macrophage activation involved in immune response | 1 |
| neutrophil activation involved in immune response | 1 |
| leukocyte activation involved in immune response | 1 |
| serotonin secretion by platelet | 1 |
| cell surface pattern recognition receptor signaling pathway | 1 |
| negative regulation of inflammatory response to antigenic stimulus | 1 |
| protein phosphorylation | 1 |
| protein import into nucleus | 1 |
| leukocyte cell-cell adhesion | 1 |
Indications & clinical
Indications
9 diseases in clinical trials (phase 1–3, investigational — not approved indications). Highest ChEMBL trial phase per disease; a non-cancer approved use is occasionally logged at phase 3 here.
| Disease (in trials) | Phase | MONDO | EFO |
|---|---|---|---|
| acute myeloid leukemia | 3 | MONDO:0018874 | EFO:0000222 |
| B-cell chronic lymphocytic leukemia | 2 | MONDO:0004948 | EFO:0000095 |
| diffuse large B-cell lymphoma | 2 | MONDO:0018905 | EFO:0000403 |
| mantle cell lymphoma | 2 | MONDO:0018876 | EFO:1001469 |
| non-Hodgkin lymphoma | 2 | MONDO:0018908 | EFO:0005952 |
| follicular lymphoma | 2 | MONDO:0018906 | MONDO:0018906 |
| lymphoma | 2 | MONDO:0005062 | EFO:0000574 |
| acute lymphoblastic leukemia | 1 | MONDO:0004967 | EFO:0000220 |
| neoplasm | 1 | MONDO:0005070 | MONDO:0004992 |
Clinical trials
Total trials: 12.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1/PHASE2 | 6 |
| PHASE1 | 3 |
| PHASE2 | 2 |
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05020665 | PHASE3 | TERMINATED | Entospletinib Plus Intensive Induction/Consolidation Chemotherapy in Newly Diagnosed NPM1-mutated AML |
| NCT03013998 | PHASE1/PHASE2 | RECRUITING | Study of Biomarker-Based Treatment of Acute Myeloid Leukemia |
| NCT01796470 | PHASE2 | TERMINATED | Entospletinib in Combination With Idelalisib in Adults With Relapsed or Refractory Hematologic Malignancies |
| NCT02343939 | PHASE1/PHASE2 | TERMINATED | Entospletinib Monotherapy and in Combination With Chemotherapy in Adults With Acute Myeloid Leukemia (AML) |
| NCT02404220 | PHASE1/PHASE2 | TERMINATED | Safety and Efficacy of Entospletinib With Vincristine and Dexamethasone in Adults With Relapsed or Refractory Acute Lymphoblastic Leukemia (ALL) |
| NCT02568683 | PHASE1/PHASE2 | TERMINATED | Safety and Efficacy of Entospletinib (ENTO [GS-9973]) Combined With Vincristine (VCR) in Adult Participants With Relapsed or Refractory B-cell Non-Hodgkin Lymphoma (NHL) |
| NCT02983617 | PHASE2 | COMPLETED | Safety and Efficacy of the Combination of Tirabrutinib and Entospletinib With and Without Obinutuzumab in Adults With Chronic Lymphocytic Leukemia (CLL) |
| NCT03010358 | PHASE1/PHASE2 | COMPLETED | Entospletinib and Obinutuzumab in Treating Patients With Relapsed Chronic Lymphocytic Leukemia, Small Lymphocytic Lymphoma, or Non-Hodgkin Lymphoma |
| NCT03225924 | PHASE1/PHASE2 | TERMINATED | Study of Entospletinib (ENTO) in Newly Diagnosed DLBCL Patients With aaIPI>=1 Treated by Chemiotherapy |
| NCT02457598 | PHASE1 | TERMINATED | Dose Escalation and Dose Expansion Study of Tirabrutinib in Combination With Other Targeted Anti-cancer Therapies in Adults With B-cell Malignancies |
| NCT02521376 | PHASE1 | COMPLETED | Pharmacokinetics of Entospletinib in Adults With Normal and Impaired Liver Function |
| NCT03135028 | PHASE1 | TERMINATED | Entospletinib (ENTO) as Monotherapy and in Combination With Chemotherapy in Japanese Adults |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
53 molecules share ≥1 primary target. Top 53 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | SYK |
| FOSTAMATINIB | ChEMBL + PubChem | Phase 4 (approved) | SYK |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | SYK |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | SYK |
| CERITINIB | ChEMBL | Phase 4 (approved) | SYK |
| DASATINIB | ChEMBL | Phase 4 (approved) | SYK |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | SYK |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | SYK |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | SYK |
| FOSTAMATINIB DISODIUM | ChEMBL | Phase 4 (approved) | SYK |
| GILTERITINIB | ChEMBL | Phase 4 (approved) | SYK |
| IMATINIB | ChEMBL | Phase 4 (approved) | SYK |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | SYK |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | SYK |
| NERATINIB | ChEMBL | Phase 4 (approved) | SYK |
| CEDIRANIB | ChEMBL | Phase 3 | SYK |
| LESTAURTINIB | ChEMBL | Phase 3 | SYK |
| QUERCETIN | ChEMBL | Phase 3 | SYK |
| ADAVOSERTIB | ChEMBL | Phase 2 | SYK |
| APITOLISIB | ChEMBL | Phase 2 | SYK |
| AT-9283 | ChEMBL | Phase 2 | SYK |
| BERZOSERTIB | ChEMBL | Phase 2 | SYK |
| BI-2536 | ChEMBL | Phase 2 | SYK |
| CENISERTIB | ChEMBL | Phase 2 | SYK |
| CERDULATINIB | ChEMBL | Phase 2 | SYK |
| DANUSERTIB | ChEMBL | Phase 2 | SYK |
| FISETIN | ChEMBL | Phase 2 | SYK |
| FORETINIB | ChEMBL | Phase 2 | SYK |
| GENISTEIN | ChEMBL | Phase 2 | SYK |
| GLESATINIB | ChEMBL | Phase 2 | SYK |
| GUSACITINIB | ChEMBL | Phase 2 | SYK |
| ILORASERTIB | ChEMBL | Phase 2 | SYK |
| LANRAPLENIB | ChEMBL | Phase 2 | SYK |
| LUTEOLIN | ChEMBL | Phase 2 | SYK |
| MIVAVOTINIB | ChEMBL | Phase 2 | SYK |
| PELITINIB | ChEMBL | Phase 2 | SYK |
| R-112 | ChEMBL | Phase 2 | SYK |
| R-343 | ChEMBL | Phase 2 | SYK |
| R-406 | ChEMBL | Phase 2 | SYK |
| RAF-265 | ChEMBL | Phase 2 | SYK |
| REBASTINIB | ChEMBL | Phase 2 | SYK |
| TOP-1288 | ChEMBL | Phase 2 | SYK |
| TOZASERTIB | ChEMBL | Phase 2 | SYK |
| UCN-01 | ChEMBL | Phase 2 | SYK |
| Afatinib | PubChem | Approved | SYK |
| belumosudil | PubChem | Approved | SYK |
| Binimetinib | PubChem | Approved | SYK |
| dacomitinib | PubChem | Approved | SYK |
| Gefitinib | PubChem | Approved | SYK |
| Idelalisib | PubChem | Approved | SYK |
| regorafenib | PubChem | Approved | SYK |
| Selumetinib | PubChem | Approved | SYK |
| Trametinib | PubChem | Approved | SYK |
Related Atlas pages
- Genes: SYK
- In clinical trials for: acute myeloid leukemia, B-cell chronic lymphocytic leukemia, diffuse large B-cell lymphoma, mantle cell lymphoma, non-Hodgkin lymphoma, follicular lymphoma, lymphoma
- Drugs: Crizotinib, Fostamatinib, Pazopanib, Bosutinib, Ceritinib, Dasatinib, Entrectinib, Erlotinib, Fedratinib, Gilteritinib, Imatinib, Infigratinib, Midostaurin, Neratinib, Cediranib, Lestaurtinib, Quercetin, Afatinib, belumosudil, Binimetinib, dacomitinib, Gefitinib, Idelalisib, regorafenib, Selumetinib, Trametinib