Epigalocatechin Gallate
drugOn this page
Also known as (-)-epigallocatechin gallate(-)epigallocatechingallate(-)epigallocatechin gallateepigallocatechin gallateSID26719730SID49681655SID26757738(-)-epi-gallocatechine gallateEpigallocatchechingallateSID144208666SID144213767(-)-epigallocatechingallateEpigallocatechingallateC0164942(-)-epigallo-catechin gallate(-)-Epigaloocatechin gallate(-)-Epigallocathechin gallateEpigallocatechin-gallate
Summary
Epigalocatechin Gallate (CHEMBL297453) is a phase-3 clinical-stage small-molecule antineoplastic agent targeting DYRK1A, EP300, and KAT2B; indicated across 40 conditions including anogenital human papillomavirus infection and lichen planus, oral.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 4 (DYRK1A, EP300, KAT2B…)
- Indications: 40 conditions
- Clinical trials: 21
- Chemistry: 458.4 Da · C22H18O11
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL297453 |
| Name | Epigalocatechin Gallate |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 65064 |
| ChEBI | CHEBI:4806 |
| Molecular formula | C22H18O11 |
| Molecular weight | 458.4 |
| InChIKey | WMBWREPUVVBILR-WIYYLYMNSA-N |
SMILES: C1[C@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O
IUPAC name: [(2R,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl] 3,4,5-trihydroxybenzoate
ChEBI definition: A gallate ester obtained by the formal condensation of gallic acid with the (3R)-hydroxy group of (−)-epigallocatechin.
Pharmacological roles (ChEBI): antineoplastic agent, antioxidant, Hsp90 inhibitor, neuroprotective agent, geroprotector, apoptosis inducer.
Other ChEBI roles (chemical / environmental): plant metabolite.
Also known as: (-)-epigallocatechin gallate, Epigalocatechin gallate, (-)epigallocatechingallate, (-)epigallocatechin gallate, epigallocatechin gallate, Epigallocatechin gallate, (-)Epigallocatechin gallate, (-)-Epigallocatechin gallate, Epigallocatechin Gallate, SID26719730, SID49681655, SID26757738
Patent coverage: 9,012 distinct patent families (22,804 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 22,790 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| DYRK1A | dual specificity tyrosine phosphorylation regulated kinase 1A | Inhibition | 6.48 | 10.5% | Q13627 |
| EP300 | EP300 lysine acetyltransferase | Inhibition | 4.52 | 33.3% | Q09472 |
| KAT2B | lysine acetyltransferase 2B | Inhibition | 4.22 | 0.2% | Q92831 |
| TAS2R5 | TAS2R5 | Agonist | 4.91 | 0.1% | Q9NYW4 |
Broader ChEMBL bioactivity targets: 88 (assay-derived). Sample: Dual specificity tyrosine-phosphorylation-regulated kinase 4, Tyrosyl-DNA phosphodiesterase 1, Pyruvate kinase PKM, Glucose-6-phosphate 1-dehydrogenase, Polymerase acidic protein, Microtubule-associated protein tau, Lysine-specific demethylase 4E, Fructose-bisphosphate aldolase, ATP-dependent DNA helicase Q1, 4’-phosphopantetheinyl transferase ffp.
Bioactivity
ChEMBL activities: 104 potent at pChembl ≥ 5 of 140 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P15840 | 7.55 | Ki | 28 | nM | CHEMBL_ACT_10982199 |
| RPSA | 7.4 | Kd | 39.9 | nM | CHEMBL_ACT_25495733 |
| CLK1 | 7.14 | IC50 | 71.6 | nM | CHEMBL_ACT_25064327 |
| PSMB5 | 7.07 | IC50 | 86 | nM | CHEMBL_ACT_19449315 |
| P15917 | 7.01 | IC50 | 97 | nM | CHEMBL_ACT_24867625 |
| ADAMTS4 | 7 | IC50 | 100 | nM | CHEMBL_ACT_25014721 |
| ADAMTS5 | 7 | IC50 | 100 | nM | CHEMBL_ACT_25014725 |
| ABCB1 | 6.91 | IC50 | 124.1 | nM | CHEMBL_ACT_15612286 |
| ABCB1 | 6.91 | IC50 | 122.6 | nM | CHEMBL_ACT_15612288 |
| PKMYT1 | 6.86 | IC50 | 137 | nM | CHEMBL_ACT_29067684 |
| PKMYT1 | 6.86 | IC50 | 137 | nM | CHEMBL_ACT_29138234 |
| APP | 6.85 | IC50 | 140 | nM | CHEMBL_ACT_25079663 |
| APP | 6.75 | IC50 | 180 | nM | CHEMBL_ACT_25076262 |
| DYRK1A | 6.7 | IC50 | 200 | nM | CHEMBL_ACT_25892130 |
| P0DTD1 | 6.7 | IC50 | 200 | nM | CHEMBL_ACT_29231020 |
| BCL2 | 6.63 | Ki | 234.4 | nM | CHEMBL_ACT_2150741 |
| DYRK1A | 6.63 | IC50 | 232 | nM | CHEMBL_ACT_24846230 |
| P11412 | 6.6 | IC50 | 250 | nM | CHEMBL_ACT_2144799 |
| RAD52 | 6.56 | IC50 | 277 | nM | CHEMBL_ACT_19491420 |
| RAD52 | 6.56 | IC50 | 277 | nM | CHEMBL_ACT_22990744 |
| MTOR | 6.5 | Ki | 320 | nM | CHEMBL_ACT_24995820 |
| TDP1 | 6.5 | Potency | 316.2 | nM | CHEMBL_ACT_3930013 |
| DYRK1A | 6.48 | IC50 | 330 | nM | CHEMBL_ACT_13881655 |
| Q63470 | 6.48 | IC50 | 330 | nM | CHEMBL_ACT_15654983 |
| DYRK1A | 6.48 | IC50 | 330 | nM | CHEMBL_ACT_18762088 |
| DYRK1A | 6.48 | IC50 | 330 | nM | CHEMBL_ACT_24691636 |
| DYRK1A | 6.48 | IC50 | 330 | nM | CHEMBL_ACT_25076354 |
| DYRK1A | 6.48 | IC50 | 330 | nM | CHEMBL_ACT_25892120 |
| BCL2 | 6.47 | Ki | 335 | nM | CHEMBL_ACT_12457518 |
| BID | 6.44 | IC50 | 360 | nM | CHEMBL_ACT_24723959 |
Target pathways
Aggregated over 4 target gene(s): DYRK1A, EP300, KAT2B, TAS2R5.
Top Reactome pathways
110 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 2 | KAT2B, TAS2R5 |
| Pre-NOTCH Transcription and Translation | 2 | EP300, KAT2B |
| Regulation of gene expression in late stage (branching morphogenesis) pancreatic bud precursor cells | 2 | EP300, KAT2B |
| NOTCH1 Intracellular Domain Regulates Transcription | 2 | EP300, KAT2B |
| Constitutive Signaling by NOTCH1 PEST Domain Mutants | 2 | EP300, KAT2B |
| Constitutive Signaling by NOTCH1 HD+PEST Domain Mutants | 2 | EP300, KAT2B |
| HATs acetylate histones | 2 | EP300, KAT2B |
| B-WICH complex positively regulates rRNA expression | 2 | EP300, KAT2B |
| Metalloprotease DUBs | 2 | EP300, KAT2B |
| RUNX1 regulates genes involved in megakaryocyte differentiation and platelet function | 2 | EP300, KAT2B |
| RUNX3 regulates NOTCH signaling | 2 | EP300, KAT2B |
| NOTCH3 Intracellular Domain Regulates Transcription | 2 | EP300, KAT2B |
| NOTCH4 Intracellular Domain Regulates Transcription | 2 | EP300, KAT2B |
| Estrogen-dependent gene expression | 2 | EP300, KAT2B |
| Regulation of FOXO transcriptional activity by acetylation | 2 | EP300, KAT2B |
| Formation of paraxial mesoderm | 2 | EP300, KAT2B |
| Differentiation of naive CD4+ T cells to T helper 2 cells (Th2 cells) | 2 | EP300, KAT2B |
| Regulation of gene expression by Hypoxia-inducible Factor | 1 | EP300 |
| Developmental Biology | 1 | KAT2B |
| G0 and Early G1 | 1 | DYRK1A |
| Polo-like kinase mediated events | 1 | EP300 |
| Signaling by NOTCH | 1 | KAT2B |
| Disease | 1 | KAT2B |
| Regulation of beta-cell development | 1 | KAT2B |
| Pre-NOTCH Expression and Processing | 1 | KAT2B |
| Signaling by NOTCH1 | 1 | KAT2B |
| PPARA activates gene expression | 1 | EP300 |
| Formation of the beta-catenin:TCF transactivating complex | 1 | EP300 |
| YAP1- and WWTR1 (TAZ)-stimulated gene expression | 1 | KAT2B |
| Epigenetic regulation of gene expression | 1 | KAT2B |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| positive regulation of DNA-templated transcription | 3 |
| chromatin remodeling | 3 |
| regulation of transcription by RNA polymerase II | 3 |
| nervous system development | 2 |
| circadian rhythm | 2 |
| negative regulation of transcription by RNA polymerase II | 2 |
| protein acetylation | 2 |
| heart development | 2 |
| positive regulation of neuron projection development | 2 |
| N-terminal peptidyl-lysine acetylation | 2 |
| internal peptidyl-lysine acetylation | 2 |
| transcription initiation-coupled chromatin remodeling | 2 |
| positive regulation of transcription by RNA polymerase II | 2 |
| gluconeogenesis | 2 |
| regulation of DNA-templated transcription | 2 |
Indications & clinical
Indications
40 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| anogenital human papillomavirus infection | 3 | MONDO:0005647 | EFO:0007147 |
| lichen planus, oral | 3 | MONDO:0043923 | EFO:0008517 |
| multiple system atrophy | 3 | MONDO:0007803 | EFO:1001050 |
| uterine corpus leiomyoma | 3 | MONDO:0007886 | EFO:0000731 |
| benign prostatic hyperplasia | 2 | MONDO:0010811 | EFO:0000284 |
| Down syndrome | 2 | MONDO:0008608 | EFO:0001064 |
| endometriosis | 2 | MONDO:0005133 | EFO:0001065 |
| plasma cell myeloma | 2 | MONDO:0009693 | EFO:0001378 |
| cirrhosis of liver | 2 | MONDO:0005155 | EFO:0001422 |
| epidermolysis bullosa dystrophica | 2 | MONDO:0006543 | Orphanet:303 |
| ductal breast carcinoma in situ | 2 | MONDO:0005023 | EFO:0000432 |
| breast neoplasm | 2 | MONDO:0021100 | MONDO:0007254 |
| lung neoplasm | 2 | MONDO:0021117 | MONDO:0008903 |
| follicular lymphoma | 2 | MONDO:0018906 | MONDO:0018906 |
| brain injury | 2 | MONDO:0043510 | MONDO:0043510 |
| viral infectious disease | 2 | MONDO:0005108 | EFO:0000763 |
| Alzheimer disease | 2 | MONDO:0004975 | MONDO:0004975 |
| type 2 diabetes mellitus | 2 | MONDO:0005148 | MONDO:0005148 |
| Parkinson disease | 2 | MONDO:0005180 | MONDO:0005180 |
| multiple sclerosis | 2 | MONDO:0005301 | MONDO:0005301 |
| Huntington disease | 2 | MONDO:0007739 | MONDO:0007739 |
| fragile X syndrome | 2 | MONDO:0010383 | MONDO:0010383 |
| Duchenne muscular dystrophy | 2 | MONDO:0010679 | MONDO:0010679 |
| hereditary amyloidosis | 2 | MONDO:0018634 | MONDO:0019438 |
| systemic lupus erythematosus | 2 | MONDO:0007915 | MONDO:0007915 |
| plasma cell neoplasm | 2 | MONDO:0004959 | EFO:0000200 |
| nasopharyngeal carcinoma | 2 | MONDO:0015459 | MONDO:0015459 |
| Barrett esophagus | 1 | MONDO:0013662 | EFO:0000280 |
| leukemia | 1 | MONDO:0005059 | EFO:0000565 |
| neoplasm | 1 | MONDO:0005070 | EFO:0000616 |
| prostate adenocarcinoma | 1 | MONDO:0005082 | EFO:0000673 |
| HIV infectious disease | 1 | MONDO:0005109 | EFO:0000764 |
| idiopathic pulmonary fibrosis | 1 | MONDO:0800504 | EFO:0000768 |
| non-small cell lung carcinoma | 1 | MONDO:0005233 | EFO:0003060 |
| osteoporosis | 1 | MONDO:0005298 | EFO:0003882 |
| relapsing-remitting multiple sclerosis | 1 | MONDO:0005314 | EFO:0003929 |
| colonic neoplasm | 0 | MONDO:0005401 | MONDO:0021063 |
3 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 21.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 7 |
| PHASE2 | 6 |
| PHASE1/PHASE2 | 3 |
| PHASE2/PHASE3 | 2 |
| EARLY_PHASE1 | 2 |
| PHASE4 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03199430 | PHASE4 | COMPLETED | Epigallocatechin Gallate Lowers Circulating Catecholamine Concentrations and Alters Lipid Metabolism. |
| NCT00951834 | PHASE2/PHASE3 | COMPLETED | Sunphenon EGCg (Epigallocatechin-Gallate) in the Early Stage of Alzheimer´s Disease |
| NCT01183767 | PHASE2/PHASE3 | COMPLETED | Sunphenon Epigallocatechin-Gallate (EGCg) in Duchenne Muscular Dystrophy |
| NCT06068543 | PHASE2 | RECRUITING | Reducing Frailty for Older Cancer Survivors Using Supplements II |
| NCT06398405 | PHASE2 | RECRUITING | A Phase II Clinical Study of Epigallocatechin-3-gallate in Patients With Esophageal Squamous Cancer |
| NCT06524609 | PHASE1/PHASE2 | RECRUITING | EGCG for the Prevention and Treatment of TIPN |
| NCT00476138 | PHASE1/PHASE2 | UNKNOWN | Effect of Epigallocatechin-Gallate on Inner Retinal Function in Ocular Hypertension and Early Glaucoma |
| NCT00525668 | PHASE1/PHASE2 | COMPLETED | Sunphenon Epigallocatechin-gallate (EGCg) in Relapsing-remitting Multiple Sclerosis (SuniMS Study) |
| NCT01394796 | PHASE2 | COMPLETED | Egcg, a dyrk1a Inhibitor as Therapeutic Tool for Reversing Cognitive Deficits in Down Syndrome Individuals. |
| NCT01699711 | PHASE2 | COMPLETED | Normalization of dyrk1A and APP Function as an Approach to Improve Cognitive Performance and Decelerate AD Progression in DS Subjects: Epigallocatechin Gallate as Therapeutic Tool |
| NCT02015312 | PHASE2 | COMPLETED | A Trial for the Treatment of Cardiac AL-Amyloidosis With the Green Tea Compound Epigallocatechin-3-gallate (TAME-AL) |
| NCT03740295 | PHASE2 | COMPLETED | Impact of Ketone Bodies and Epigallocatechin Gallate in Multiple Sclerosis |
| NCT06531863 | EARLY_PHASE1 | RECRUITING | Curcumin and EGCG Supplementation to Improve Serum BDNF and Mood Disturbance |
| NCT03928847 | EARLY_PHASE1 | COMPLETED | Fibroblast Specific Inhibition of LOXL2 and TGFbeta1 Signaling in Patients With Pulmonary Fibrosis. |
| NCT01317953 | Not specified | AVAILABLE | Oral Green Tea Extract for Small Cell Lung Cancer |
| NCT05448365 | Not specified | RECRUITING | Vitamin D, Epigallocatechin Gallate, D-chiro-inositol and Vitamin B6 in Uterine Fibroid |
| NCT02558933 | Not specified | COMPLETED | Epigallocatechin Gallate (EGCG) to Improve Cognitive Performance in Foetal Alcohol Syndrome (FAS) Children |
| NCT03194620 | Not specified | COMPLETED | Absorption, Metabolism and Excretion of Dietary Polyphenolic Bioactives in Humans |
| NCT03883880 | Not specified | TERMINATED | Salivary Interactions With Chemosensations |
| NCT05988788 | Not specified | COMPLETED | Effect of Epigallocatechin-3-Gallate Solution as a Root Canal Irrigant on Post-Operative Pain Intensity and Bacterial Load Reduction in Necrotic Tooth |
| NCT06314113 | Not specified | UNKNOWN | Evaluation of Oral EGCG Treatment for L-SIL Associated With HPV Infection |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
57 molecules share ≥1 primary target. Top 57 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| COENZYME_A | ChEMBL | Phase 3 | EP300, KAT2B |
| CURCUMIN | ChEMBL | Phase 3 | DYRK1A, EP300 |
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | DYRK1A |
| BELUMOSUDIL | ChEMBL + PubChem | Phase 4 (approved) | DYRK1A |
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | DYRK1A |
| AFATINIB DIMALEATE | ChEMBL | Phase 4 (approved) | DYRK1A |
| ISOPROTERENOL | ChEMBL | Phase 4 (approved) | TAS2R5 |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | DYRK1A |
| NIRAPARIB | ChEMBL | Phase 4 (approved) | DYRK1A |
| PALBOCICLIB | ChEMBL | Phase 4 (approved) | DYRK1A |
| RUCAPARIB | ChEMBL | Phase 4 (approved) | DYRK1A |
| RUXOLITINIB | ChEMBL | Phase 4 (approved) | DYRK1A |
| SUNITINIB | ChEMBL | Phase 4 (approved) | DYRK1A |
| TOVORAFENIB | ChEMBL | Phase 4 (approved) | DYRK1A |
| ALVOCIDIB | ChEMBL | Phase 3 | DYRK1A |
| BARASERTIB | ChEMBL | Phase 3 | DYRK1A |
| CANERTINIB | ChEMBL | Phase 3 | DYRK1A |
| CRENOLANIB | ChEMBL | Phase 3 | DYRK1A |
| DEFACTINIB | ChEMBL | Phase 3 | DYRK1A |
| ENZASTAURIN | ChEMBL | Phase 3 | DYRK1A |
| LESTAURTINIB | ChEMBL | Phase 3 | DYRK1A |
| LORECIVIVINT | ChEMBL | Phase 3 | DYRK1A |
| RUBOXISTAURIN | ChEMBL | Phase 3 | DYRK1A |
| AT-7519 | ChEMBL | Phase 2 | DYRK1A |
| AT-9283 | ChEMBL | Phase 2 | DYRK1A |
| BGT-226 FREE BASE | ChEMBL | Phase 2 | DYRK1A |
| BMS-690514 | ChEMBL | Phase 2 | DYRK1A |
| CC-401 | ChEMBL | Phase 2 | DYRK1A |
| LY-2090314 | ChEMBL | Phase 2 | DYRK1A |
| MILCICLIB | ChEMBL | Phase 2 | DYRK1A |
| MIVEBRESIB | ChEMBL | Phase 2 | EP300 |
| MOLIBRESIB | ChEMBL | Phase 2 | EP300 |
| R-406 | ChEMBL | Phase 2 | DYRK1A |
| RG-547 | ChEMBL | Phase 2 | DYRK1A |
| SELICICLIB | ChEMBL | Phase 2 | DYRK1A |
| SILMITASERTIB | ChEMBL | Phase 2 | DYRK1A |
| STREPTONIGRIN | ChEMBL | Phase 2 | EP300 |
| SU-014813 | ChEMBL | Phase 2 | DYRK1A |
| TG100-115 | ChEMBL | Phase 2 | DYRK1A |
| UPROSERTIB | ChEMBL | Phase 2 | DYRK1A |
| ZOTIRACICLIB | ChEMBL | Phase 2 | DYRK1A |
| Alprazolam | PubChem | Approved | KAT2B |
| Berberine Chloride | PubChem | Approved | EP300 |
| Binimetinib | PubChem | Approved | DYRK1A |
| Crizotinib | PubChem | Approved | DYRK1A |
| dacomitinib | PubChem | Approved | DYRK1A |
| Estazolam | PubChem | Approved | KAT2B |
| Fostamatinib | PubChem | Approved | DYRK1A |
| Gefitinib | PubChem | Approved | DYRK1A |
| Idelalisib | PubChem | Approved | DYRK1A |
| Midazolam | PubChem | Approved | KAT2B |
| p-aminophenol | PubChem | Approved | KAT2B |
| Pazopanib | PubChem | Approved | DYRK1A |
| regorafenib | PubChem | Approved | DYRK1A |
| Selumetinib | PubChem | Approved | DYRK1A |
| Trametinib | PubChem | Approved | DYRK1A |
| Triazolam | PubChem | Approved | KAT2B |
Related Atlas pages
- Genes: DYRK1A, EP300, KAT2B, TAS2R5
- Diseases: anogenital human papillomavirus infection, lichen planus, oral, multiple system atrophy, uterine corpus leiomyoma
- Drugs: Coenzyme_A, Curcumin, Afatinib, Belumosudil, Abemaciclib, Isoproterenol, Midostaurin, Niraparib, Palbociclib, Rucaparib, Ruxolitinib, Sunitinib, Tovorafenib, Alvocidib, Barasertib, Canertinib, Crenolanib, Defactinib, Enzastaurin, Lestaurtinib, Lorecivivint, Ruboxistaurin, Alprazolam, Berberine Chloride, Binimetinib, Crizotinib, dacomitinib, Estazolam, Fostamatinib, Gefitinib, Idelalisib, Midazolam, Pazopanib, regorafenib, Selumetinib, Trametinib, Triazolam