Eprosartan
drugOn this page
Also known as SK&F 108566SK&F-108566SK-108566TevetenEprosartan Mesylate
Summary
Eprosartan (CHEMBL813) is an approved small-molecule antihypertensive agent (ATC C09CA02) targeting AGTR1; indicated across 5 conditions including cardiovascular disorder and essential hypertension.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C09CA02
- Targets: 1 (AGTR1)
- Indications: 5 conditions
- Clinical trials: 7
- Chemistry: 424.5 Da · C23H24N2O4S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL813 |
| Name | Eprosartan |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 5281037 |
| ChEBI | CHEBI:4814 |
| ATC | C09CA02 |
| Molecular formula | C23H24N2O4S |
| Molecular weight | 424.5 |
| InChIKey | OROAFUQRIXKEMV-LDADJPATSA-N |
SMILES: CCCCC1=NC=C(N1CC2=CC=C(C=C2)C(=O)O)/C=C(\CC3=CC=CS3)/C(=O)O
IUPAC name: 4-[[2-butyl-5-[(E)-2-carboxy-3-thiophen-2-ylprop-1-enyl]imidazol-1-yl]methyl]benzoic acid
ChEBI definition: A member of the class of imidazoles and thiophenes that is an angiotensin II receptor antagonist used for the treatment of high blood pressure.
Pharmacological roles (ChEBI): antihypertensive agent, angiotensin receptor antagonist.
Other ChEBI roles (chemical / environmental): xenobiotic, environmental contaminant.
Also known as: Eprosartan, SK&F 108566, SK&F-108566, SK-108566, Teveten, eprosartan, EPROSARTAN, Eprosartan Mesylate
Parent form; salt/anhydrous children: CHEMBL1200987
Patent coverage: 4,775 distinct patent families (19,492 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| AGTR1 | AT1 receptor | Antagonist | 9.1 | 0.4% | P30556 |
Broader ChEMBL bioactivity targets: 7 (assay-derived). Sample: Angiotensin II receptor, Angiotensin II receptor (AT-1) type-1, Type-1 angiotensin II receptor, Type-2 angiotensin II receptor, Type-1 angiotensin II receptor B, ATP-binding cassette sub-family C member 2, ATP-binding cassette sub-family C member 3.
Bioactivity
ChEMBL activities: 14 potent at pChembl ≥ 5 of 15 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P35351 | 9 | IC50 | 1 | nM | CHEMBL_ACT_144543 |
| P25095 | 9 | IC50 | 1 | nM | CHEMBL_ACT_214209 |
| P29089 | 9 | IC50 | 1 | nM | CHEMBL_ACT_33329 |
| P25095 | 9 | IC50 | 1 | nM | CHEMBL_ACT_350004 |
| P25095 | 8.82 | IC50 | 1.5 | nM | CHEMBL_ACT_1065923 |
| AGTR1 | 8.72 | AC50 | 1.9 | nM | CHEMBL_ACT_25176502 |
| AGTR1 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_33337 |
| AGTR1 | 8.38 | AC50 | 4.2 | nM | CHEMBL_ACT_25177690 |
| AGTR1 | 8.3 | AC50 | 5 | nM | CHEMBL_ACT_25177670 |
| AGTR1 | 8.26 | AC50 | 5.5 | nM | CHEMBL_ACT_25177671 |
| AGTR1 | 8.14 | IC50 | 7.3 | nM | CHEMBL_ACT_33336 |
| P25095 | 8.04 | IC50 | 9.2 | nM | CHEMBL_ACT_1065924 |
| P25095 | 6.44 | IC50 | 363 | nM | CHEMBL_ACT_348683 |
| ABCC3 | 5.18 | IC50 | 6650 | nM | CHEMBL_ACT_18130478 |
Target pathways
Aggregated over 1 target gene(s): AGTR1.
Top Reactome pathways
11 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 1 | AGTR1 |
| Membrane Trafficking | 1 | AGTR1 |
| Signaling by GPCR | 1 | AGTR1 |
| Class A/1 (Rhodopsin-like receptors) | 1 | AGTR1 |
| Peptide ligand-binding receptors | 1 | AGTR1 |
| GPCR downstream signalling | 1 | AGTR1 |
| G alpha (q) signalling events | 1 | AGTR1 |
| GPCR ligand binding | 1 | AGTR1 |
| Vesicle-mediated transport | 1 | AGTR1 |
| Cargo recognition for clathrin-mediated endocytosis | 1 | AGTR1 |
| Clathrin-mediated endocytosis | 1 | AGTR1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of cell growth | 1 |
| kidney development | 1 |
| renin-angiotensin regulation of aldosterone production | 1 |
| maintenance of blood vessel diameter homeostasis by renin-angiotensin | 1 |
| regulation of systemic arterial blood pressure by renin-angiotensin | 1 |
| inflammatory response | 1 |
| G protein-coupled receptor signaling pathway | 1 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 1 |
| positive regulation of cytosolic calcium ion concentration | 1 |
| Rho protein signal transduction | 1 |
| positive regulation of macrophage derived foam cell differentiation | 1 |
| regulation of vasoconstriction | 1 |
| calcium-mediated signaling | 1 |
| low-density lipoprotein particle remodeling | 1 |
| regulation of renal sodium excretion | 1 |
Indications & clinical
Indications
5 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| essential hypertension | 3 | MONDO:0001134 | MONDO:0001134 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | EFO:0000694 |
| kidney disorder | 1 | MONDO:0005240 | EFO:0003086 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 7.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 2 |
| PHASE3 | 2 |
| Not specified | 2 |
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00409903 | PHASE4 | COMPLETED | The Effect of Eprosartan on Hormones and Kidney Function in Healthy Humans. |
| NCT00438945 | PHASE4 | COMPLETED | The Effect of Eprosartan on Hormones and Kidney Function in Patients With Essential Hypertension |
| NCT01631227 | PHASE3 | COMPLETED | Comparison of the Effect of Eprosartan and Eprosartan Mesylate on Blood Pressure in Essential Hypertension |
| NCT04606563 | PHASE3 | TERMINATED | Host Response Mediators in Coronavirus (COVID-19) Infection - Is There a Protective Effect of Losartan and Other ARBs on Outcomes of Coronavirus Infection? |
| NCT01087749 | PHASE1 | COMPLETED | Pharmacokinetic Study in Patients With Chronic Kidney Disease and Healthy Volunteers |
| NCT00160160 | Not specified | COMPLETED | Comparison of Eprosartan/HCT Versus Enalapril/HCT in Hypertensives With Type II Diabetes |
| NCT04954560 | Not specified | COMPLETED | Effect of Losartan or Eprosartan on Fructose Hyperuricemia |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
140 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | AGTR1 |
| LOSARTAN | ChEMBL + PubChem | Phase 4 (approved) | AGTR1 |
| OLMESARTAN MEDOXOMIL | ChEMBL + PubChem | Phase 4 (approved) | AGTR1 |
| RIFAMPIN | ChEMBL + PubChem | Phase 4 (approved) | AGTR1 |
| SPARSENTAN | ChEMBL + PubChem | Phase 4 (approved) | AGTR1 |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | AGTR1 |
| ALFACALCIDOL | ChEMBL | Phase 4 (approved) | AGTR1 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | AGTR1 |
| ANGIOTENSIN II | ChEMBL | Phase 4 (approved) | AGTR1 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | AGTR1 |
| BALSALAZIDE | ChEMBL | Phase 4 (approved) | AGTR1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | AGTR1 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | AGTR1 |
| CALCITRIOL | ChEMBL | Phase 4 (approved) | AGTR1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | AGTR1 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | AGTR1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | AGTR1 |
| DABIGATRAN ETEXILATE | ChEMBL | Phase 4 (approved) | AGTR1 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | AGTR1 |
| DISULFIRAM | ChEMBL | Phase 4 (approved) | AGTR1 |
| DOFETILIDE | ChEMBL | Phase 4 (approved) | AGTR1 |
| DONEPEZIL | ChEMBL | Phase 4 (approved) | AGTR1 |
| EFAVIRENZ | ChEMBL | Phase 4 (approved) | AGTR1 |
| EPALRESTAT | ChEMBL | Phase 4 (approved) | AGTR1 |
| FELODIPINE | ChEMBL | Phase 4 (approved) | AGTR1 |
| FENTICONAZOLE | ChEMBL | Phase 4 (approved) | AGTR1 |
| GUAIFENESIN | ChEMBL | Phase 4 (approved) | AGTR1 |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | AGTR1 |
| IBANDRONIC ACID | ChEMBL | Phase 4 (approved) | AGTR1 |
| INDOCYANINE GREEN ACID FORM | ChEMBL | Phase 4 (approved) | AGTR1 |
| IRBESARTAN | ChEMBL | Phase 4 (approved) | AGTR1 |
| IVACAFTOR | ChEMBL | Phase 4 (approved) | AGTR1 |
| LEFLUNOMIDE | ChEMBL | Phase 4 (approved) | AGTR1 |
| LOVASTATIN | ChEMBL | Phase 4 (approved) | AGTR1 |
| MILTEFOSINE | ChEMBL | Phase 4 (approved) | AGTR1 |
| NIFEDIPINE | ChEMBL | Phase 4 (approved) | AGTR1 |
| NIMESULIDE | ChEMBL | Phase 4 (approved) | AGTR1 |
| NITAZOXANIDE | ChEMBL | Phase 4 (approved) | AGTR1 |
| NORGESTIMATE | ChEMBL | Phase 4 (approved) | AGTR1 |
| NOSCAPINE | ChEMBL | Phase 4 (approved) | AGTR1 |
| OXYMETHOLONE | ChEMBL | Phase 4 (approved) | AGTR1 |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | AGTR1 |
| PONATINIB | ChEMBL | Phase 4 (approved) | AGTR1 |
| PRAZOSIN | ChEMBL | Phase 4 (approved) | AGTR1 |
| PROPRANOLOL | ChEMBL | Phase 4 (approved) | AGTR1 |
| PYRVINIUM | ChEMBL | Phase 4 (approved) | AGTR1 |
| RIMONABANT | ChEMBL | Phase 4 (approved) | AGTR1 |
| RITONAVIR | ChEMBL | Phase 4 (approved) | AGTR1 |
| ROCURONIUM | ChEMBL | Phase 4 (approved) | AGTR1 |
| ROSIGLITAZONE | ChEMBL | Phase 4 (approved) | AGTR1 |
| SARALASIN | ChEMBL | Phase 4 (approved) | AGTR1 |
| SELEXIPAG | ChEMBL | Phase 4 (approved) | AGTR1 |
| SIMVASTATIN | ChEMBL | Phase 4 (approved) | AGTR1 |
| SORAFENIB | ChEMBL | Phase 4 (approved) | AGTR1 |
| SULCONAZOLE | ChEMBL | Phase 4 (approved) | AGTR1 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | AGTR1 |
| TELMISARTAN | ChEMBL | Phase 4 (approved) | AGTR1 |
| TELOTRISTAT | ChEMBL | Phase 4 (approved) | AGTR1 |
| TELOTRISTAT ETHYL | ChEMBL | Phase 4 (approved) | AGTR1 |
| TIPRANAVIR | ChEMBL | Phase 4 (approved) | AGTR1 |
Related Atlas pages
- Genes: AGTR1
- Diseases: cardiovascular disorder, essential hypertension, severe acute respiratory syndrome
- Drugs: Crizotinib, Losartan, Olmesartan Medoxomil, Rifampin, Sparsentan, Tegaserod, Alfacalcidol, Amitriptyline, Angiotensin Ii, Aripiprazole, Balsalazide, Benzbromarone, Butoconazole, Calcitriol, Candesartan Cilexetil, Carvedilol, Clotrimazole, Dabigatran Etexilate, Desogestrel, Disulfiram, Dofetilide, Donepezil, Efavirenz, Epalrestat, Felodipine, Fenticonazole, Guaifenesin, Haloperidol, Ibandronic Acid, Indocyanine Green Acid Form, Irbesartan, Ivacaftor, Leflunomide, Lovastatin, Miltefosine, Nifedipine, Nimesulide, Nitazoxanide, Norgestimate, Noscapine, Oxymetholone, Pimozide, Ponatinib, Prazosin, Propranolol, Pyrvinium, Rimonabant, Ritonavir, Rocuronium, Rosiglitazone, Saralasin, Selexipag, Simvastatin, Sorafenib, Sulconazole, Sunitinib, Telmisartan, Telotristat, Telotristat Ethyl, Tipranavir