Ergonovine
drugOn this page
Also known as ErgobasineErgometrinaErgometrineErgostetrineErgotocineSID26754288SID124882895SID144205575
Summary
Ergonovine (CHEMBL119443) is a phase-3 clinical-stage small-molecule diagnostic agent (ATC G02AB03) targeting HTR1E and HTR2A.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- ATC class: G02AB03
- Targets: 2 (HTR1E, HTR2A)
- Clinical trials: 7
- Chemistry: 325.4 Da · C19H23N3O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL119443 |
| Name | Ergonovine |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 443884 |
| ChEBI | CHEBI:4822 |
| ATC | G02AB03 |
| Molecular formula | C19H23N3O2 |
| Molecular weight | 325.4 |
| InChIKey | WVVSZNPYNCNODU-XTQGRXLLSA-N |
SMILES: C[C@@H](CO)NC(=O)[C@H]1CN([C@@H]2CC3=CNC4=CC=CC(=C34)C2=C1)C
IUPAC name: (6aR,9R)-N-[(2S)-1-hydroxypropan-2-yl]-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide
ChEBI definition: A monocarboxylic acid amide that is lysergamide in which one of the hydrogens attached to the amide nitrogen is substituted by a 1-hydroxypropan-2-yl group (S-configuration). An ergot alkaloid that has a particularly powerful action on the uterus, its maleate (and formerly tartrate) salt is used in the active management of the third stage of labour, and to prevent or treat postpartum of postabortal haemorrhage caused by uterine atony: by maintaining uterine contraction and tone, blood vessels in the uterine wall are compressed and blood flow reduced.
Pharmacological roles (ChEBI): oxytocic, diagnostic agent, toxin.
Other ChEBI roles (chemical / environmental): fungal metabolite.
Also known as: Ergobasine, Ergometrina, Ergometrine, Ergostetrine, Ergotocine, SID26754288, SID124882895, Ergonovine, SID144205575, ERGONOVINE, ergonovine
Parent form; salt/anhydrous children: CHEMBL1213135
Patent coverage: 1,045 distinct patent families (3,432 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 3,424 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HTR1E | 5-ht1e receptor | Full agonist | 7.3 | 0% | P28566 |
| HTR2A | 5-HT2A receptor | Full agonist | 8.5 | 0% | P28223 |
Broader ChEMBL bioactivity targets: 23 (assay-derived). Sample: Microtubule-associated protein tau, Lysine-specific demethylase 4E, Fructose-bisphosphate aldolase, ATP-dependent DNA helicase Q1, 15-hydroxyprostaglandin dehydrogenase [NAD(+)], 5-hydroxytryptamine receptor 2B, Alpha-2A adrenergic receptor, Alpha-2B adrenergic receptor, D(1A) dopamine receptor, Menin/Histone-lysine N-methyltransferase MLL.
Bioactivity
ChEMBL activities: 22 potent at pChembl ≥ 5 of 37 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| HTR2A | 9.2 | Ki | 0.63 | nM | CHEMBL_ACT_7669269 |
| P28564 | 8.89 | Ki | 1.29 | nM | CHEMBL_ACT_7669267 |
| HTR6 | 8.82 | Ki | 1.5 | nM | CHEMBL_ACT_7669279 |
| HTR2A | 8.66 | IC50 | 2.21 | nM | CHEMBL_ACT_7669268 |
| HTR2B | 8.58 | Ki | 2.63 | nM | CHEMBL_ACT_7669271 |
| P28564 | 8.55 | IC50 | 2.85 | nM | CHEMBL_ACT_7669266 |
| HTR6 | 8.49 | IC50 | 3.24 | nM | CHEMBL_ACT_7669278 |
| HTR2B | 8.38 | IC50 | 4.14 | nM | CHEMBL_ACT_7669270 |
| P19327 | 8.33 | Ki | 4.64 | nM | CHEMBL_ACT_7669265 |
| P19327 | 8.09 | IC50 | 8.13 | nM | CHEMBL_ACT_7669264 |
| HTR2C | 7.96 | Ki | 11 | nM | CHEMBL_ACT_7669273 |
| HTR2C | 7.68 | IC50 | 21 | nM | CHEMBL_ACT_7669272 |
| ADRA2B | 6.88 | Ki | 132 | nM | CHEMBL_ACT_7667038 |
| DRD2 | 6.74 | Ki | 184 | nM | CHEMBL_ACT_7667106 |
| DRD3 | 6.71 | Ki | 193 | nM | CHEMBL_ACT_7667108 |
| ADRA2B | 6.54 | IC50 | 289 | nM | CHEMBL_ACT_7667037 |
| DRD2 | 6.26 | IC50 | 552 | nM | CHEMBL_ACT_7667105 |
| DRD3 | 6.25 | IC50 | 567 | nM | CHEMBL_ACT_7667107 |
| ADRA2A | 6.2 | Ki | 630 | nM | CHEMBL_ACT_7667036 |
| ADRA2A | 5.78 | IC50 | 1680 | nM | CHEMBL_ACT_7667035 |
| DRD1 | 5.53 | Ki | 2950 | nM | CHEMBL_ACT_7667104 |
| DRD1 | 5.23 | IC50 | 5901 | nM | CHEMBL_ACT_7667103 |
Target pathways
Aggregated over 2 target gene(s): HTR1E, HTR2A.
Top Reactome pathways
9 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 2 | HTR1E, HTR2A |
| Signaling by GPCR | 2 | HTR1E, HTR2A |
| Class A/1 (Rhodopsin-like receptors) | 2 | HTR1E, HTR2A |
| Amine ligand-binding receptors | 2 | HTR1E, HTR2A |
| GPCR downstream signalling | 2 | HTR1E, HTR2A |
| Serotonin receptors | 2 | HTR1E, HTR2A |
| GPCR ligand binding | 2 | HTR1E, HTR2A |
| G alpha (q) signalling events | 1 | HTR2A |
| G alpha (i) signalling events | 1 | HTR1E |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway | 2 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 2 |
| chemical synaptic transmission | 2 |
| signal transduction | 2 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 1 |
| adenylate cyclase-inhibiting serotonin receptor signaling pathway | 1 |
| adenylate cyclase-activating G protein-coupled receptor signaling pathway | 1 |
| temperature homeostasis | 1 |
| positive regulation of cytokine production involved in immune response | 1 |
| glycolytic process | 1 |
| intracellular calcium ion homeostasis | 1 |
| positive regulation of cytosolic calcium ion concentration | 1 |
| phospholipase C-activating serotonin receptor signaling pathway | 1 |
| serotonin receptor signaling pathway | 1 |
| memory | 1 |
Indications & clinical
Indications
0 indications (0 at ChEMBL trial phase 4).
Clinical trials
Total trials: 7.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 5 |
| PHASE3 | 2 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02306733 | PHASE3 | UNKNOWN | Ergometrine Versus Oxytocin in the Management of Atonic Post-partum Haemorrhage (PPH) in Women Delivered Vaginally |
| NCT02410759 | PHASE3 | UNKNOWN | Carbetocin Versus Ergometrine in the Management of Atonic Post Partum Haemorrhage (PPH) in Women Delivered Vaginally |
| NCT06285409 | Not specified | RECRUITING | Comparing the Dose-response Profiles of Uterotonics After Initial Carbetocin Administration - an Ex-vivo Study in Desensitized Human Myometrium |
| NCT00989027 | Not specified | COMPLETED | Impact of Uterotonic Agents on Isolated Human Myometrium |
| NCT01689311 | Not specified | COMPLETED | In Vitro Myometrial Contractions in Laboring and Non-laboring Women |
| NCT02046499 | Not specified | COMPLETED | A Randomized Trial Comparing Oxytocin and Oxytocin + Ergometrine for Prevention of Postpartum Haemorrhage at Caesarean Section |
| NCT03578263 | Not specified | COMPLETED | Carbetocin Versus Oxytocin and Ergometrine for the Prevention of Postpartum Hemorrhage |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
391 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Asenapine | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| Cannabidiol | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| Cyproheptadine | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| Dihydroergotamine | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| Ergotamine | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| IMIPRAMINE | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| methylergonovine | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| Olanzapine | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| Pramipexole | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| Quetiapine | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| Risperidone | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| Rizatriptan | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| Sorafenib | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| SUMATRIPTAN | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| Ziprasidone | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| Zolmitriptan | ChEMBL + PubChem | Phase 4 (approved) | HTR1E, HTR2A |
| AZELASTINE | ChEMBL | Phase 4 (approved) | HTR1E, HTR2A |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR1E, HTR2A |
| SEROTONIN | ChEMBL + PubChem | Phase 3 (approved) | HTR1E, HTR2A |
| Yohimbine | ChEMBL + PubChem | Phase 3 (approved) | HTR1E, HTR2A |
| LATREPIRDINE | ChEMBL | Phase 3 | HTR1E, HTR2A |
| LYSERGIDE | ChEMBL | Phase 2 | HTR1E, HTR2A |
| MEBUFOTENIN | ChEMBL | Phase 2 | HTR1E, HTR2A |
| PSILOCIN | ChEMBL | Phase 2 | HTR1E, HTR2A |
| RITANSERIN | ChEMBL | Phase 2 | HTR1E, HTR2A |
| FIDAXOMICIN | ChEMBL + PubChem | Phase 4 (approved) | HTR2A |
| PIMAVANSERIN | ChEMBL + PubChem | Phase 4 (approved) | HTR2A |
| PROPOXYPHENE | ChEMBL + PubChem | Phase 4 (approved) | HTR2A |
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | HTR2A |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | HTR2A |
| ACYCLOVIR | ChEMBL | Phase 4 (approved) | HTR2A |
| ALMOTRIPTAN | ChEMBL | Phase 4 (approved) | HTR2A |
| ALOSETRON | ChEMBL | Phase 4 (approved) | HTR2A |
| AMIODARONE | ChEMBL | Phase 4 (approved) | HTR2A |
| AMISULPRIDE | ChEMBL | Phase 4 (approved) | HTR2A |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | HTR2A |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | HTR2A |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | HTR2A |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | HTR2A |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR2A |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | HTR2A |
| ATOMOXETINE | ChEMBL | Phase 4 (approved) | HTR2A |
| AZATADINE | ChEMBL | Phase 4 (approved) | HTR2A |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | HTR2A |
| BEDAQUILINE | ChEMBL | Phase 4 (approved) | HTR2A |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | HTR2A |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | HTR2A |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | HTR2A |
| BENZPHETAMINE | ChEMBL | Phase 4 (approved) | HTR2A |
| BENZQUINAMIDE | ChEMBL | Phase 4 (approved) | HTR2A |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | HTR2A |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | HTR2A |
| BIFONAZOLE | ChEMBL | Phase 4 (approved) | HTR2A |
| BLONANSERIN | ChEMBL | Phase 4 (approved) | HTR2A |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | HTR2A |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | HTR2A |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | HTR2A |
| BUSPIRONE | ChEMBL | Phase 4 (approved) | HTR2A |
| BUTENAFINE | ChEMBL | Phase 4 (approved) | HTR2A |
Related Atlas pages
- Genes: HTR1E, HTR2A
- Drugs: Asenapine, Cannabidiol, Clozapine, Cyproheptadine, Dihydroergotamine, Ergotamine, Imipramine, methylergonovine, Olanzapine, Pramipexole, Quetiapine, Risperidone, Rizatriptan, Sorafenib, Sumatriptan, Ziprasidone, Zolmitriptan, Azelastine, Brexpiprazole, Serotonin, Yohimbine, Latrepirdine, Fidaxomicin, Pimavanserin, Propoxyphene, Abemaciclib, Acetophenazine, Acyclovir, Almotriptan, Alosetron, Amiodarone, Amisulpride, Amitriptyline, Amlodipine, Amoxapine, Apomorphine, Aripiprazole, Astemizole, Atomoxetine, Azatadine, Bazedoxifene, Bedaquiline, Benfluorex, Benperidol, Benzbromarone, Benzphetamine, Benzquinamide, Benztropine, Bepridil, Bifonazole, Blonanserin, Bosutinib, Bromocriptine, Bromperidol, Buspirone, Butenafine