Escitalopram
drugOn this page
Also known as CipralexEsertiaEsitolESCITALOPRAM OXALATESEROPLEXS-(+)-CITALOPRAM(S)-CITALOPRAM(S)-(+)-CITALOPRAMSID11110983SID11114081SID124879737SID50100207S-CitalopramCitalopram
Summary
Escitalopram (CHEMBL1508) is an approved small-molecule antidepressant (ATC N06AB10) targeting SLC6A4; indicated across 31 conditions including major depressive disorder and depressive disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N06AB10
- Targets: 1 (SLC6A4)
- Indications: 31 conditions
- Clinical trials: 491
- Chemistry: 324.4 Da · C20H21FN2O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1508 |
| Name | Escitalopram |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 146570 |
| ChEBI | CHEBI:36791 |
| ATC | N06AB10 |
| Molecular formula | C20H21FN2O |
| Molecular weight | 324.4 |
| InChIKey | WSEQXVZVJXJVFP-FQEVSTJZSA-N |
SMILES: CN(C)CCC[C@@]1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F
IUPAC name: (1S)-1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile
ChEBI definition: A 1-[3-(dimethylamino)propyl]-1-(4-fluorophenyl)-1,3-dihydro-2-benzofuran-5-carbonitrile that has S-configuration at the chiral centre. It is the active enantiomer of citalopram.
Pharmacological roles (ChEBI): antidepressant, EC 3.4.21.26 (prolyl oligopeptidase) inhibitor.
Also known as: Cipralex, Escitalopram, Esertia, Esitol, ESCITALOPRAM OXALATE, ESCITALOPRAM, ESITOL, ESERTIA, CIPRALEX, SEROPLEX, S-(+)-CITALOPRAM, (S)-CITALOPRAM
Parent form; salt/anhydrous children: CHEMBL1200322
Patent coverage: 5,696 distinct patent families (20,444 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 20,392 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SLC6A4 | SERT | Inhibition | 8.68 | 0.7% | P31645 |
Broader ChEMBL bioactivity targets: 19 (assay-derived). Sample: 5-hydroxytryptamine receptor 2B, Sodium-dependent noradrenaline transporter, 5-hydroxytryptamine receptor 2C, Sodium-dependent serotonin transporter, Alpha-1A adrenergic receptor, Histamine H1 receptor, Mu-type opioid receptor, D(3) dopamine receptor, Voltage-gated inwardly rectifying potassium channel KCNH2, Muscarinic acetylcholine receptor M1.
Bioactivity
ChEMBL activities: 35 potent at pChembl ≥ 5 of 42 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P31652 | 9.05 | Ki | 0.89 | nM | CHEMBL_ACT_3404778 |
| HTR6 | 9 | Ki | 1 | nM | CHEMBL_ACT_26025255 |
| SLC6A4 | 9 | Ki | 1 | nM | CHEMBL_ACT_3007629 |
| SLC6A4 | 9 | Ki | 1 | nM | CHEMBL_ACT_3279634 |
| SLC6A4 | 8.75 | Ki | 1.77 | nM | CHEMBL_ACT_18774541 |
| SLC6A4 | 8.68 | IC50 | 2.1 | nM | CHEMBL_ACT_17998834 |
| SLC6A4 | 8.66 | Ki | 2.2 | nM | CHEMBL_ACT_15627807 |
| SLC6A4 | 8.59 | Kd | 2.6 | nM | CHEMBL_ACT_14737775 |
| SLC6A4 | 8.15 | AC50 | 7.1 | nM | CHEMBL_ACT_25149830 |
| SLC6A4 | 8.13 | Ki | 7.4 | nM | CHEMBL_ACT_14737753 |
| SLC6A4 | 8 | IC50 | 10 | nM | CHEMBL_ACT_17998807 |
| HTR6 | 7.26 | IC50 | 55 | nM | CHEMBL_ACT_26025307 |
| CYP3A4 | 6 | Potency | 1000 | nM | CHEMBL_ACT_4957285 |
| CYP3A4 | 6 | Potency | 1000 | nM | CHEMBL_ACT_5026642 |
| CYP3A4 | 6 | AC50 | 1000 | nM | CHEMBL_ACT_6036429 |
| NFKB1 | 5.95 | Potency | 1122 | nM | CHEMBL_ACT_3671953 |
| NFKB1 | 5.95 | Potency | 1122 | nM | CHEMBL_ACT_4585235 |
| KCNH2 | 5.8 | AC50 | 1600 | nM | CHEMBL_ACT_25117083 |
| HRH1 | 5.57 | AC50 | 2700 | nM | CHEMBL_ACT_25211986 |
| CYP2C19 | 5.5 | Potency | 3162 | nM | CHEMBL_ACT_4020198 |
| CYP2C9 | 5.5 | Potency | 3162 | nM | CHEMBL_ACT_5057319 |
| CYP2C9 | 5.5 | AC50 | 3162 | nM | CHEMBL_ACT_6001705 |
| CYP2C19 | 5.5 | AC50 | 3162 | nM | CHEMBL_ACT_6044220 |
| OPRM1 | 5.38 | AC50 | 4200 | nM | CHEMBL_ACT_25146635 |
| SLC6A4 | 5.34 | IC50 | 4600 | nM | CHEMBL_ACT_13852391 |
| HRH1 | 5.34 | AC50 | 4600 | nM | CHEMBL_ACT_25116905 |
| SLC6A4 | 5.29 | EC50 | 5100 | nM | CHEMBL_ACT_17998883 |
| SLC6A4 | 5.24 | EC50 | 5800 | nM | CHEMBL_ACT_17998867 |
| ADRA1A | 5.24 | AC50 | 5800 | nM | CHEMBL_ACT_25217709 |
| ALOX15 | 5.2 | Potency | 6310 | nM | CHEMBL_ACT_4468528 |
Target pathways
Aggregated over 1 target gene(s): SLC6A4.
Top Reactome pathways
5 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Neurotransmitter clearance | 1 | SLC6A4 |
| Transmission across Chemical Synapses | 1 | SLC6A4 |
| Neuronal System | 1 | SLC6A4 |
| Serotonin clearance from the synaptic cleft | 1 | SLC6A4 |
| SLC-mediated transport of neurotransmitters | 1 | SLC6A4 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| response to hypoxia | 1 |
| neurotransmitter transport | 1 |
| amino acid transport | 1 |
| response to nutrient | 1 |
| memory | 1 |
| circadian rhythm | 1 |
| response to xenobiotic stimulus | 1 |
| response to toxic substance | 1 |
| positive regulation of gene expression | 1 |
| positive regulation of serotonin secretion | 1 |
| obsolete monoamine transport | 1 |
| negative regulation of cerebellar granule cell precursor proliferation | 1 |
| negative regulation of synaptic transmission, dopaminergic | 1 |
| response to estradiol | 1 |
| sodium ion transmembrane transport | 1 |
Indications & clinical
Indications
31 indications (3 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| major depressive disorder | 4 | MONDO:0002009 | MONDO:0002009 |
| depressive disorder | 4 | MONDO:0002050 | MONDO:0002050 |
| obsessive-compulsive disorder | 3 | MONDO:0008114 | EFO:0004242 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| carcinoma | 3 | MONDO:0004993 | EFO:0000313 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| pulmonary hypertension | 3 | MONDO:0005149 | MONDO:0005149 |
| bipolar disorder | 3 | MONDO:0004985 | EFO:0009963 |
| generalized anxiety disorder | 3 | MONDO:0001942 | EFO:1001892 |
| rheumatoid arthritis | 3 | MONDO:0008383 | EFO:0000685 |
| neoplasm | 3 | MONDO:0005070 | MONDO:0004992 |
| burning mouth syndrome | 3 | MONDO:0006687 | EFO:1000850 |
| cocaine dependence | 2 | MONDO:0005186 | EFO:0002610 |
| post-traumatic stress disorder | 2 | MONDO:0005146 | EFO:0001358 |
| chronic kidney disease | 2 | MONDO:0005300 | EFO:0003884 |
| stroke disorder | 2 | MONDO:0005098 | EFO:0000712 |
| drug dependence | 2 | MONDO:0005303 | EFO:0003890 |
| panic disorder | 2 | MONDO:0005383 | EFO:0004262 |
| phobic disorder | 2 | MONDO:0003699 | EFO:1001908 |
| social phobia | 2 | MONDO:0001247 | EFO:1001917 |
| borderline personality disorder | 2 | MONDO:0001156 | HP:0012076 |
| fibromyalgia | 2 | MONDO:0005546 | EFO:0005687 |
| aphasia | 2 | MONDO:0000598 | HP:0002381 |
| hepatitis C virus infection | 1 | MONDO:0005231 | EFO:0003047 |
| Alzheimer disease | 1 | MONDO:0004975 | MONDO:0004975 |
| premature ejaculation | 0 | MONDO:0001780 | EFO:0803321 |
5 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 491.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 176 |
| Not specified | 120 |
| PHASE3 | 69 |
| PHASE2 | 51 |
| PHASE1 | 40 |
| PHASE2/PHASE3 | 19 |
| PHASE1/PHASE2 | 8 |
| EARLY_PHASE1 | 8 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04245436 | PHASE4 | RECRUITING | Acute and Long-Term Antidepressant Treatment Success in Adolescents With Anxiety (AtLAS-A) |
| NCT04245748 | PHASE4 | RECRUITING | Determining Optimal Treatment Sequences in Anxious Depression (DOTS-AD) |
| NCT04336228 | PHASE4 | ACTIVE_NOT_RECRUITING | The Role of Serotonin in Compulsive Behavior in Humans: Underlying Brain Mechanisms |
| NCT04623099 | PHASE4 | RECRUITING | Pharmacogenetically-guided Escitalopram Treatment for Pediatric Anxiety: Aiming to Improve Safety and Efficacy (PrEcISE) |
| NCT05004987 | PHASE4 | RECRUITING | Aβ Dynamics in LLMD |
| NCT05017311 | PHASE4 | RECRUITING | Optimized Predictive Treatment In Medications for Unipolar Major Depression (OPTIMUM-D) |
| NCT05737511 | PHASE4 | NOT_YET_RECRUITING | Efficacy of Hydroxyzine for Patients With Panic Disorder |
| NCT06675851 | PHASE4 | RECRUITING | Reward-specific Changes of the Chemical Messenger Dopamine in the Brain of Healthy and Depressed People |
| NCT07478796 | PHASE4 | RECRUITING | TDM-Guided Treatment With SSRIs in Hospitalized Adults and Children |
| NCT00021528 | PHASE4 | COMPLETED | Sequenced Treatment Alternatives to Relieve Depression (STAR*D) |
| NCT00047671 | PHASE4 | COMPLETED | Ethnic Variations in Antidepressant Response |
| NCT00073697 | PHASE4 | COMPLETED | Treatment of Depression in Adults |
| NCT00105586 | PHASE4 | COMPLETED | Drug Therapy for Generalized Anxiety Disorder Among the Elderly |
| NCT00115011 | PHASE4 | COMPLETED | Escitalopram for the Treatment of Self-Injurious Skin Picking |
| NCT00116532 | PHASE4 | COMPLETED | Escitalopram for the Treatment of Obsessive Compulsive Disorder (OCD) |
| NCT00130455 | PHASE4 | TERMINATED | Treatment of Depression in the Elderly |
| NCT00140257 | PHASE4 | UNKNOWN | DECARD: Study of Escitalopram in the Prevention of Depression in Patients With Acute Coronary Syndrome |
| NCT00162916 | PHASE4 | UNKNOWN | Antidepressant Maintenance in Traumatic Brain Injury |
| NCT00162968 | PHASE4 | COMPLETED | Escitalopram as a Treatment for Pain in Polyneuropathy |
| NCT00166114 | PHASE4 | COMPLETED | Depression, Epinephrine, and Platelet Function |
| NCT00177216 | PHASE4 | COMPLETED | Characteristics of Sleep Patterns in Young Adults With and Without Insomnia |
| NCT00177294 | PHASE4 | COMPLETED | Augmenting Antidepressant Treatment With Interpersonal Psychotherapy for Treating Late-life Depression |
| NCT00177671 | PHASE4 | COMPLETED | Antidepressant Medication Plus Donepezil for Treating Late-life Depression |
| NCT00183677 | PHASE4 | COMPLETED | Brain Energy Metabolism in Individuals With Major Depressive Disorder Receiving Escitalopram |
| NCT00209170 | PHASE4 | COMPLETED | Depression-Diabetes Mechanisms: Urban African Americans |
| NCT00209807 | PHASE4 | UNKNOWN | Effect of Escitalopram vs. Reboxetine on Gastro-intestinal Sensitivity of Patients With Major Depressive Disorder |
| NCT00219349 | PHASE4 | COMPLETED | Cognitive-Behavioral Therapy and Escitalopram for Generalized Anxiety Disorder(GAD) |
| NCT00221494 | PHASE4 | WITHDRAWN | Can Additional Drug Therapy Accelerate Response Time to Antidepressants |
| NCT00222820 | PHASE4 | COMPLETED | Depression: The Search for Treatment-Relevant Phenotypes-Pilot Study |
| NCT00227292 | PHASE4 | WITHDRAWN | Cipralex in Treatment of Depressive Symptoms and Chronic Back Pain |
| NCT00229333 | PHASE4 | UNKNOWN | Study of Escitalopram Versus Placebo in the Treatment of Depressive Syndrome in Alzheimer’s Disease, Vascular Dementia, and Mixed Vascular and Alzheimer’s Dementia |
| NCT00231335 | PHASE4 | COMPLETED | Efficacy and Safety Study of Escitalopram Augmentation in Treatment Resistant Schizophrenia |
| NCT00234312 | PHASE4 | COMPLETED | Medications for the Treatment of Dysthymic Disorder and Double Depression |
| NCT00243477 | PHASE4 | COMPLETED | MOTIV Study- Effect of Antidepressive Treatment by Escitalopram in Patients Undergoing Coronary Artery Bypass Grafting |
| NCT00254007 | PHASE4 | COMPLETED | Depression and Traumatic Brain Injury |
| NCT00254020 | PHASE4 | COMPLETED | The Role of Cytokine-Serotonin Interactions in Post-Stroke Depression |
| NCT00260624 | PHASE4 | COMPLETED | Escitalopram Treatment of Patients With Agitated Dementia |
| NCT00296712 | PHASE4 | COMPLETED | Are Two Antidepressants a Good Initial Treatment for Depression? |
| NCT00296777 | PHASE4 | COMPLETED | Treatment of Depression Following Multiple Brain Tests |
| NCT00352885 | PHASE4 | COMPLETED | Effectiveness of Escitalopram in Preventing or Reducing Depressive Symptoms in People Receiving Interleukin-2 Treatment |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (5) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of DPWG Guideline for escitalopram and CYP2C19 | DPWG | CYP2C19 | yes | yes |
| Annotation of CPIC Guideline for citalopram, escitalopram and CYP2C19 | CPIC | CYP2C19 | yes | yes |
| Annotation of DPWG Guideline for citalopram, escitalopram and CYP2D6 | DPWG | CYP2D6 | ||
| Annotation of CPIC Guideline for citalopram, escitalopram and HTR2A | CPIC | HTR2A | ||
| Annotation of CPIC Guideline for citalopram, desvenlafaxine, duloxetin | CPIC | SLC6A4 |
PharmGKB also curates 27 clinical and 206 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
440 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | SLC6A4 |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | SLC6A4 |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | SLC6A4 |
| TADALAFIL | ChEMBL + PubChem | Phase 4 (approved) | SLC6A4 |
| TAFENOQUINE | ChEMBL + PubChem | Phase 4 (approved) | SLC6A4 |
| UMECLIDINIUM | ChEMBL + PubChem | Phase 4 (approved) | SLC6A4 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| ACRIVASTINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| ALECTINIB | ChEMBL | Phase 4 (approved) | SLC6A4 |
| ALLOPURINOL | ChEMBL | Phase 4 (approved) | SLC6A4 |
| AMBENONIUM | ChEMBL | Phase 4 (approved) | SLC6A4 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| AMPHOTERICIN B | ChEMBL | Phase 4 (approved) | SLC6A4 |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| ARFORMOTEROL | ChEMBL | Phase 4 (approved) | SLC6A4 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| ATOMOXETINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| ATRACURIUM | ChEMBL | Phase 4 (approved) | SLC6A4 |
| AZATHIOPRINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BALSALAZIDE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BENZPHETAMINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BENZYDAMINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BROMHEXINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BROMODIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BROMPHENIRAMINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BUPROPION | ChEMBL | Phase 4 (approved) | SLC6A4 |
| BUTENAFINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CALCIPOTRIENE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CALCITRIOL | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CANAGLIFLOZIN | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CARBINOXAMINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CEFONICID | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CETIRIZINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CHLORPHENTERMINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CHLORPROTHIXENE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CINACALCET | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CITALOPRAM | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | SLC6A4 |
| CLIDINIUM | ChEMBL | Phase 4 (approved) | SLC6A4 |
Related Atlas pages
- Genes: SLC6A4
- Diseases: major depressive disorder, depressive disorder, obsessive-compulsive disorder, anxiety, carcinoma, dementia, pulmonary hypertension, bipolar disorder, generalized anxiety disorder, rheumatoid arthritis, neoplasm, burning mouth syndrome
- Drugs: Crizotinib, Olodaterol, Tadalafil, Tafenoquine, Umeclidinium, Acetophenazine, Acrivastine, Alectinib, Allopurinol, Ambenonium, Amiodarone, Amitriptyline, Amoxapine, Amphotericin B, Apomorphine, Arformoterol, Aripiprazole, Asenapine, Astemizole, Atomoxetine, Atracurium, Azathioprine, Azelastine, Balsalazide, Bazedoxifene, Benfluorex, Benzphetamine, Benztropine, Benzydamine, Bepridil, Bosutinib, Brexpiprazole, Bromhexine, Bromodiphenhydramine, Bromperidol, Brompheniramine, Bupropion, Butenafine, Cabergoline, Calcipotriene, Calcitriol, Canagliflozin, Carbinoxamine, Cariprazine, Carvedilol, Cefonicid, Celecoxib, Cetirizine, Chlorhexidine, Chlorpheniramine, Chlorphentermine, Chlorpromazine, Chlorprothixene, Cinacalcet, Cinnarizine, Cisapride, Clemastine, Clidinium