Estrone Sulfuric Acid
drugOn this page
Also known as Estrone sulphateSID11112590Estrone sulfateESTROGENES_CONJUGUESESTROPIPATE
Summary
Estrone Sulfuric Acid (CHEMBL494753) is an approved small molecule targeting SLCO1A2, SLCO1B1, and SLCO1C1.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 6 (SLCO1A2, SLCO1B1, SLCO1C1…)
- Chemistry: 350.4 Da · C18H22O5S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL494753 |
| Name | Estrone Sulfuric Acid |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 3001028 |
| ChEBI | CHEBI:17474 |
| Molecular formula | C18H22O5S |
| Molecular weight | 350.4 |
| InChIKey | JKKFKPJIXZFSSB-CBZIJGRNSA-N |
SMILES: C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)OS(=O)(=O)O
IUPAC name: [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate
ChEBI definition: A steroid sulfate that is the 3-sulfate of estrone.
Other ChEBI roles (chemical / environmental): human metabolite, mouse metabolite.
Also known as: Estrone sulphate, SID11112590, Estrone sulfate, ESTROGENES_CONJUGUES, ESTROPIPATE, ESTRONE SULFURIC ACID
Parent form; salt/anhydrous children: CHEMBL1200980, CHEMBL1546237, CHEMBL2106240
Patent coverage: 1,024 distinct patent families (3,380 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 3,356 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SLCO1A2 | OATP1A2 | 0.2% | P46721 | ||
| SLCO1B1 | OATP1B1 | 0% | Q9Y6L6 | ||
| SLCO1C1 | OATP1C1 | 0.1% | Q9NYB5 | ||
| SLCO2B1 | OATP2B1 | 0% | O94956 | ||
| SLCO3A1 | OATP3A1 | 0% | Q9UIG8 | ||
| SLCO4A1 | OATP4A1 | 0.9% | Q96BD0 |
Broader ChEMBL bioactivity targets: 9 (assay-derived). Sample: Solute carrier organic anion transporter family member 1B1, ATP-binding cassette sub-family C member 4, Solute carrier organic anion transporter family member 1A1, Organic anion transporter 3, Solute carrier organic anion transporter family member 1C1, Multidrug resistance-associated protein 1, Cytochrome P450 2C9, Steryl-sulfatase, Solute carrier family 22 member 20.
Bioactivity
ChEMBL activities: 6 potent at pChembl ≥ 5 of 13 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| SLCO1B1 | 7.34 | Ki | 45.8 | nM | CHEMBL_ACT_11002244 |
| ABCC1 | 6.35 | Ki | 450 | nM | CHEMBL_ACT_11002287 |
| P46720 | 5.89 | Ki | 1300 | nM | CHEMBL_ACT_11002323 |
| STS | 5.12 | IC50 | 7600 | nM | CHEMBL_ACT_1223298 |
| STS | 5.12 | IC50 | 7600 | nM | CHEMBL_ACT_651362 |
| Q9R1U7 | 5.04 | Ki | 9100 | nM | CHEMBL_ACT_11003311 |
Target pathways
Aggregated over 6 target gene(s): SLCO1A2, SLCO1B1, SLCO1C1, SLCO2B1, SLCO3A1, SLCO4A1.
Top Reactome pathways
19 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Organic anion transport by SLCO transporters | 6 | SLCO1A2, SLCO1B1, SLCO1C1, SLCO2B1, SLCO3A1, SLCO4A1 |
| Transport of small molecules | 5 | SLCO1A2, SLCO1B1, SLCO1C1, SLCO2B1, SLCO4A1 |
| Transport of vitamins, nucleosides, and related molecules | 5 | SLCO1A2, SLCO1B1, SLCO1C1, SLCO2B1, SLCO4A1 |
| SLC-mediated transmembrane transport | 5 | SLCO1A2, SLCO1B1, SLCO1C1, SLCO2B1, SLCO4A1 |
| Metabolism | 2 | SLCO1A2, SLCO1B1 |
| Recycling of bile acids and salts | 2 | SLCO1A2, SLCO1B1 |
| Heme degradation | 2 | SLCO1B1, SLCO2B1 |
| Bile acid and bile salt metabolism | 2 | SLCO1A2, SLCO1B1 |
| Metabolism of lipids | 2 | SLCO1A2, SLCO1B1 |
| Metabolism of steroids | 2 | SLCO1A2, SLCO1B1 |
| Drug ADME | 2 | SLCO1A2, SLCO1B1 |
| Atorvastatin ADME | 2 | SLCO1B1, SLCO2B1 |
| Disease | 1 | SLCO1B1 |
| Metabolism of porphyrins | 1 | SLCO1B1 |
| SLC transporter disorders | 1 | SLCO1B1 |
| Defective SLCO1B1 causes hyperbilirubinemia, Rotor type (HBLRR) | 1 | SLCO1B1 |
| Disorders of transmembrane transporters | 1 | SLCO1B1 |
| Aspirin ADME | 1 | SLCO2B1 |
| Ciprofloxacin ADME | 1 | SLCO1A2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| monoatomic ion transport | 6 |
| sodium-independent organic anion transport | 6 |
| transmembrane transport | 6 |
| obsolete organic anion transport | 5 |
| bile acid and bile salt transport | 4 |
| prostaglandin transport | 4 |
| xenobiotic metabolic process | 3 |
| lipid transport | 3 |
| thyroid hormone transport | 3 |
| transport across blood-brain barrier | 3 |
| heme catabolic process | 2 |
| obsolete organic cation transport | 1 |
| positive regulation of thyroid hormone generation | 1 |
| phenylalanine transport | 1 |
| tryptophan transport | 1 |
Indications & clinical
Indications
0 indications (0 at ChEMBL trial phase 4).
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 0 clinical and 9 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
302 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| dinoprostone | PubChem | Approved | SLCO1A2, SLCO1C1, SLCO2B1, SLCO3A1, SLCO4A1 |
| Methotrexate | PubChem | Approved | SLCO1A2, SLCO1B1, SLCO1C1, SLCO2B1, SLCO3A1 |
| Digoxin | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO1C1, SLCO2B1 |
| Lovastatin | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO2B1 |
| Pravastatin | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO2B1 |
| RIFAMPIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO2B1 |
| RIFAMYCIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO2B1 |
| Ritonavir | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO2B1 |
| Verapamil | ChEMBL + PubChem | Phase 4 (approved) | SLCO1A2, SLCO1B1, SLCO2B1 |
| Glycyrrhizin | ChEMBL + PubChem | Phase 2 (approved) | SLCO1A2, SLCO1B1, SLCO2B1 |
| aminohippuric acid | PubChem | Approved | SLCO1B1, SLCO2B1, SLCO3A1 |
| Dexamethasone | PubChem | Approved | SLCO1A2, SLCO1B1, SLCO2B1 |
| Erythromycin | PubChem | Approved | SLCO1A2, SLCO1B1, SLCO2B1 |
| Liothyronine | PubChem | Approved | SLCO1A2, SLCO1C1, SLCO4A1 |
| Penicillin G | PubChem | Approved | SLCO2B1, SLCO3A1, SLCO4A1 |
| ATAZANAVIR | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| ATORVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| CLARITHROMYCIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| CYCLOSPORINE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| ERLOTINIB | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| GEMFIBROZIL | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| GLYBURIDE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| INDOMETHACIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| OLMESARTAN MEDOXOMIL | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| PACLITAXEL | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| SIMVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| TELMISARTAN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| VINBLASTINE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| VINCRISTINE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| ELTROMBOPAG | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| SULFASALAZINE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| SILYBIN A | ChEMBL | Phase 3 | SLCO1B1, SLCO2B1 |
| GENISTEIN | ChEMBL + PubChem | Phase 2 (approved) | SLCO1B1, SLCO2B1 |
| SILICRISTIN | ChEMBL | Phase 2 | SLCO1B1, SLCO2B1 |
| Acyclovir | PubChem | Approved | SLCO1B1, SLCO2B1 |
| Allopurinol | PubChem | Approved | SLCO1B1, SLCO2B1 |
| Amantadine | PubChem | Approved | SLCO1B1, SLCO2B1 |
| Amitriptyline | PubChem | Approved | SLCO1B1, SLCO2B1 |
| Atenolol | PubChem | Approved | SLCO1B1, SLCO2B1 |
| chenodiol | PubChem | Approved | SLCO1A2, SLCO1B1 |
| Cholic Acid | PubChem | Approved | SLCO1B1, SLCO2B1 |
| Enalapril | PubChem | Approved | SLCO1A2, SLCO2B1 |
| Ezetimibe | PubChem | Approved | SLCO1B1, SLCO2B1 |
| Fexofenadine | PubChem | Approved | SLCO1A2, SLCO2B1 |
| mesalamine | PubChem | Approved | SLCO1A2, SLCO2B1 |
| Metformin | PubChem | Approved | SLCO1B1, SLCO2B1 |
| Nelfinavir | PubChem | Approved | SLCO1A2, SLCO2B1 |
| Phenytoin | PubChem | Approved | SLCO1B1, SLCO2B1 |
| Quinidine | PubChem | Approved | SLCO1A2, SLCO2B1 |
| Saquinavir | PubChem | Approved | SLCO1A2, SLCO2B1 |
| Sildenafil | PubChem | Approved | SLCO1B1, SLCO2B1 |
| theophylline | PubChem | Approved | SLCO1B1, SLCO2B1 |
| Valacyclovir | PubChem | Approved | SLCO1B1, SLCO2B1 |
| TANNIC ACID | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1 |
| BETA CAROTENE | ChEMBL | Phase 4 (approved) | SLCO1B1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | SLCO1B1 |
| CARBENOXOLONE | ChEMBL | Phase 4 (approved) | SLCO1B1 |
| DICLOXACILLIN | ChEMBL | Phase 4 (approved) | SLCO1B1 |
| ERYTHROMYCIN ESTOLATE | ChEMBL | Phase 4 (approved) | SLCO1B1 |
| ERYTHROMYCIN ETHYLSUCCINATE | ChEMBL | Phase 4 (approved) | SLCO1B1 |
Related Atlas pages
- Genes: SLCO1A2, SLCO1B1, SLCO1C1, SLCO2B1, SLCO3A1, SLCO4A1
- Drugs: dinoprostone, Methotrexate, Digoxin, Lovastatin, Pravastatin, Rifampin, Rifamycin, Ritonavir, Verapamil, aminohippuric acid, Dexamethasone, Erythromycin, Liothyronine, Penicillin G, Atazanavir, Atorvastatin, Clarithromycin, Cyclosporine, Erlotinib, Gemfibrozil, Glyburide, Indomethacin, Olmesartan Medoxomil, Paclitaxel, Simvastatin, Telmisartan, Vinblastine, Vincristine, Eltrombopag, Sulfasalazine, Silybin A, Acyclovir, Allopurinol, Amantadine, Amitriptyline, Atenolol, chenodiol, Cholic Acid, Enalapril, Ezetimibe, Fexofenadine, mesalamine, Metformin, Nelfinavir, Phenytoin, Quinidine, Saquinavir, Sildenafil, theophylline, Valacyclovir, Tannic Acid, Beta Carotene, Candesartan Cilexetil, Carbenoxolone, Dicloxacillin, Erythromycin Estolate, Erythromycin Ethylsuccinate