Estrone
drugOn this page
Also known as Estradiol metabolite e1Estrogenic substanceEstronaFollicular hormoneFollicular-hormoneFolliculinFolliculinumKetohydroxyestrinNatural estrogenic substance-estroneNSC-9699TheelinThelykininTokokinWAY 164397SID11111162SID11112119SID26748037SID26751561SID50104169
Summary
Estrone (CHEMBL1405) is an approved small-molecule bone density conservation agent (ATC G03CC04) targeting ESR1 and ESR2; indicated across 2 conditions including premenstrual tension and obesity disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: G03CC04 (+1 more)
- Targets: 2 (ESR1, ESR2)
- Indications: 2 conditions
- Clinical trials: 1
- Chemistry: 270.4 Da · C18H22O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1405 |
| Name | Estrone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5870 |
| ChEBI | CHEBI:17263 |
| ATC | G03CC04, G03CA07 |
| Molecular formula | C18H22O2 |
| Molecular weight | 270.4 |
| InChIKey | DNXHEGUUPJUMQT-CBZIJGRNSA-N |
SMILES: C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)O
IUPAC name: (8R,9S,13S,14S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one
ChEBI definition: A 17-oxo steroid that is estra-1,3,5(10)-triene substituted by an hydroxy group at position 3 and an oxo group at position 17.
Pharmacological roles (ChEBI): estrogen, bone density conservation agent, antineoplastic agent.
Other ChEBI roles (chemical / environmental): human metabolite, mouse metabolite.
Also known as: Estradiol metabolite e1, Estrogenic substance, Estrona, Estrone, Follicular hormone, Follicular-hormone, Folliculin, Folliculinum, Ketohydroxyestrin, Natural estrogenic substance-estrone, NSC-9699, Theelin
Patent coverage: 12,210 distinct patent families (36,722 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 36,635 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ESR1 | Estrogen receptor-α | Agonist | 8.5 | 1.7% | P03372 |
| ESR2 | Estrogen receptor-β | Agonist | 7.93 | 0.2% | Q92731 |
Broader ChEMBL bioactivity targets: 31 (assay-derived). Sample: Microtubule-associated protein tau, Prelamin-A/C, RecQ-like DNA helicase BLM, Inositol monophosphatase 1, Endonuclease 4, Peripheral myelin protein 22, Solute carrier organic anion transporter family member 1A1, 5-hydroxytryptamine receptor 2B, Androgen receptor, Aldo-keto reductase family 1 member B1.
Bioactivity
ChEMBL activities: 58 potent at pChembl ≥ 5 of 70 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ESR2 | 9.3 | EC50 | 0.5 | nM | CHEMBL_ACT_22894629 |
| ESR1 | 9.15 | EC50 | 0.7 | nM | CHEMBL_ACT_194577 |
| ESR2 | 9.03 | EC50 | 0.94 | nM | CHEMBL_ACT_22894582 |
| HSD17B10 | 8.89 | Potency | 1.3 | nM | CHEMBL_ACT_4829419 |
| ESR1 | 8.85 | EC50 | 1.4 | nM | CHEMBL_ACT_25522266 |
| ESR2 | 8.68 | EC50 | 2.1 | nM | CHEMBL_ACT_194576 |
| ESR1 | 8.66 | Ki | 2.19 | nM | CHEMBL_ACT_7658687 |
| ESR1 | 8.62 | EC50 | 2.4 | nM | CHEMBL_ACT_22894596 |
| HSD17B1 | 8.52 | Ki | 3 | nM | CHEMBL_ACT_2616741 |
| SHBG | 8.18 | Kd | 6.61 | nM | CHEMBL_ACT_2155709 |
| ESR1 | 8.15 | EC50 | 7 | nM | CHEMBL_ACT_2937372 |
| ESR1 | 8.12 | IC50 | 7.65 | nM | CHEMBL_ACT_7658686 |
| ESR2 | 8.1 | EC50 | 8 | nM | CHEMBL_ACT_2937381 |
| LMNA | 7.95 | Potency | 11.2 | nM | CHEMBL_ACT_3637938 |
| HIF1A | 7.8 | Potency | 15.8 | nM | CHEMBL_ACT_4129688 |
| HIF1A | 7.8 | Potency | 15.8 | nM | CHEMBL_ACT_4518724 |
| ESR2 | 7.58 | EC50 | 26 | nM | CHEMBL_ACT_1701132 |
| ESR1 | 7.54 | IC50 | 29 | nM | CHEMBL_ACT_1701150 |
| ESR2 | 7.51 | IC50 | 31 | nM | CHEMBL_ACT_1701141 |
| ESR1 | 7.02 | IC50 | 96 | nM | CHEMBL_ACT_3214246 |
| HSD17B1 | 6.96 | IC50 | 109 | nM | CHEMBL_ACT_3214221 |
| ESR2 | 6.92 | EC50 | 120 | nM | CHEMBL_ACT_1123284 |
| ESR1 | 6.92 | EC50 | 120 | nM | CHEMBL_ACT_1123285 |
| ESR2 | 6.78 | EC50 | 166 | nM | CHEMBL_ACT_1701168 |
| BLM | 6.7 | Potency | 199.5 | nM | CHEMBL_ACT_4753916 |
| BLM | 6.7 | Potency | 199.5 | nM | CHEMBL_ACT_4945842 |
| ESR1 | 6.68 | IC50 | 210 | nM | CHEMBL_ACT_1123282 |
| HSD17B1 | 6.66 | IC50 | 218 | nM | CHEMBL_ACT_2090037 |
| HSD17B1 | 6.48 | IC50 | 330 | nM | CHEMBL_ACT_1679820 |
| ESR1 | 6.46 | AC50 | 350.7 | nM | CHEMBL_ACT_25138572 |
Target pathways
Aggregated over 2 target gene(s): ESR1, ESR2.
Top Reactome pathways
17 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| PIP3 activates AKT signaling | 2 | ESR1, ESR2 |
| Constitutive Signaling by Aberrant PI3K in Cancer | 2 | ESR1, ESR2 |
| Nuclear Receptor transcription pathway | 2 | ESR1, ESR2 |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 2 | ESR1, ESR2 |
| ESR-mediated signaling | 2 | ESR1, ESR2 |
| Extra-nuclear estrogen signaling | 2 | ESR1, ESR2 |
| Nuclear signaling by ERBB4 | 1 | ESR1 |
| SUMOylation of intracellular receptors | 1 | ESR1 |
| Ovarian tumor domain proteases | 1 | ESR1 |
| TFAP2 (AP-2) family regulates transcription of growth factors and their receptors | 1 | ESR1 |
| RUNX1 regulates estrogen receptor mediated transcription | 1 | ESR1 |
| RUNX1 regulates transcription of genes involved in WNT signaling | 1 | ESR1 |
| Regulation of RUNX2 expression and activity | 1 | ESR1 |
| Estrogen-dependent gene expression | 1 | ESR1 |
| Mitochondrial unfolded protein response (UPRmt) | 1 | ESR1 |
| Developmental Lineage of Mammary Gland Luminal Epithelial Cells | 1 | ESR1 |
| Developmental Lineage of Mammary Gland Alveolar Cells | 1 | ESR1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| negative regulation of transcription by RNA polymerase II | 2 |
| regulation of DNA-templated transcription | 2 |
| regulation of transcription by RNA polymerase II | 2 |
| signal transduction | 2 |
| estrogen receptor signaling pathway | 2 |
| positive regulation of DNA-templated transcription | 2 |
| positive regulation of transcription by RNA polymerase II | 2 |
| obsolete positive regulation of DNA-binding transcription factor activity | 2 |
| cellular response to estradiol stimulus | 2 |
| cellular response to oxygen-containing compound | 2 |
| antral ovarian follicle growth | 1 |
| epithelial cell development | 1 |
| chromatin remodeling | 1 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 1 |
| positive regulation of cytosolic calcium ion concentration | 1 |
Indications & clinical
Indications
2 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| premenstrual tension | 3 | MONDO:0004169 | MONDO:0004169 |
| obesity disorder | 2 | MONDO:0011122 | EFO:0001073 |
Clinical trials
Total trials: 1.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02402049 | PHASE3 | UNKNOWN | Homeopathic Treatment of Premenstrual Syndrome |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 0 clinical and 1 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
178 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| FULVESTRANT | ChEMBL + PubChem | Phase 4 (approved) | ESR1, ESR2 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| CISPLATIN | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ELACESTRANT | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTETROL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTRIOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| LASOFOXIFENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| PHENOLPHTHALEIN | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| RALOXIFENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| SPIRONOLACTONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ACOLBIFENE | ChEMBL | Phase 3 | ESR1, ESR2 |
| AFIMOXIFENE | ChEMBL | Phase 3 | ESR1, ESR2 |
| AMCENESTRANT | ChEMBL | Phase 3 | ESR1, ESR2 |
| ARZOXIFENE | ChEMBL | Phase 3 | ESR1, ESR2 |
| BENSERAZIDE | ChEMBL | Phase 3 | ESR1, ESR2 |
| ALFATRADIOL | ChEMBL | Phase 2 | ESR1, ESR2 |
| AUS-131 | ChEMBL | Phase 2 | ESR1, ESR2 |
| BRILANESTRANT | ChEMBL | Phase 2 | ESR1, ESR2 |
| DAIDZEIN | ChEMBL | Phase 2 | ESR1, ESR2 |
| ERTEBEREL | ChEMBL | Phase 2 | ESR1, ESR2 |
| GENISTEIN | ChEMBL | Phase 2 | ESR1, ESR2 |
| GTX-758 | ChEMBL | Phase 2 | ESR1, ESR2 |
| IDOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| LEVORMELOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| MOXESTROL | ChEMBL | Phase 2 | ESR1, ESR2 |
| PIPENDOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| PRINABEREL | ChEMBL | Phase 2 | ESR1, ESR2 |
| STALLIMYCIN | ChEMBL | Phase 2 | ESR1, ESR2 |
| Bosentan | PubChem | Approved | ESR1, ESR2 |
| Dihydroergotamine | PubChem | Approved | ESR1, ESR2 |
| Fidaxomicin | PubChem | Approved | ESR1, ESR2 |
| Propoxyphene | PubChem | Approved | ESR1, ESR2 |
| Pyrazinamide | PubChem | Approved | ESR1, ESR2 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | ESR1 |
| ALECTINIB | ChEMBL | Phase 4 (approved) | ESR1 |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | ESR1 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ESR1 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | ESR1 |
| AZTREONAM | ChEMBL | Phase 4 (approved) | ESR1 |
| BELINOSTAT | ChEMBL | Phase 4 (approved) | ESR1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | ESR1 |
| BEXAROTENE | ChEMBL | Phase 4 (approved) | ESR1 |
| BISACODYL | ChEMBL | Phase 4 (approved) | ESR1 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ESR1 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | ESR1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | ESR1 |
| CASPOFUNGIN | ChEMBL | Phase 4 (approved) | ESR1 |
| CEFADROXIL | ChEMBL | Phase 4 (approved) | ESR1 |
| CEFEPIME | ChEMBL | Phase 4 (approved) | ESR1 |
| CEFTAZIDIME | ChEMBL | Phase 4 (approved) | ESR1 |
| CERIVASTATIN | ChEMBL | Phase 4 (approved) | ESR1 |
| CHLOROTRIANISENE | ChEMBL | Phase 4 (approved) | ESR1 |
Related Atlas pages
- Genes: ESR1, ESR2
- Diseases: premenstrual tension
- Drugs: Fulvestrant, Bazedoxifene, Bithionol, Cisplatin, Diethylstilbestrol, Elacestrant, Estetrol, Estradiol, Estriol, Ethinyl Estradiol, Hexachlorophene, Lasofoxifene, Medroxyprogesterone, Mifepristone, Phenolphthalein, Raloxifene, Spironolactone, Tamoxifen, Acolbifene, Afimoxifene, Amcenestrant, Arzoxifene, Benserazide, Bosentan, Dihydroergotamine, Fidaxomicin, Propoxyphene, Pyrazinamide, Acetophenazine, Alectinib, Apomorphine, Aripiprazole, Aspirin, Aztreonam, Belinostat, Benzbromarone, Bexarotene, Bisacodyl, Bromocriptine, Butoconazole, Candesartan Cilexetil, Caspofungin, Cefadroxil, Cefepime, Ceftazidime, Cerivastatin, Chlorotrianisene