Ethopropazine
drugOn this page
Also known as ProfenaminaProfenamineRP-3356SC-2538W-483SID11112467SID90341779
Summary
Ethopropazine (CHEMBL1206) is an approved small-molecule muscarinic antagonist (ATC N04AA05) targeting CHRM1 and CHRM2; indicated across 1 condition including parkinson disease.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N04AA05
- Targets: 2 (CHRM1, CHRM2)
- Indications: 1 condition
- Chemistry: 312.5 Da · C19H24N2S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1206 |
| Name | Ethopropazine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 3290 |
| ChEBI | CHEBI:313639 |
| ATC | N04AA05 |
| Molecular formula | C19H24N2S |
| Molecular weight | 312.5 |
| InChIKey | CDOZDBSBBXSXLB-UHFFFAOYSA-N |
SMILES: CCN(CC)C(C)CN1C2=CC=CC=C2SC3=CC=CC=C31
IUPAC name: N,N-diethyl-1-phenothiazin-10-ylpropan-2-amine
ChEBI definition: A member of the class of phenothiazines that is phenothiazine in which the hydrogen attached to the nitrogen is substituted by a 2-(diethylamino)propyl group. An antimuscarinic, it is used as the hydrochloride for the symptomatic treatment of Parkinson’s disease.
Pharmacological roles (ChEBI): muscarinic antagonist, antiparkinson drug, histamine antagonist, adrenergic antagonist, antidyskinesia agent.
Also known as: Profenamina, Profenamine, RP-3356, SC-2538, W-483, SID11112467, SID90341779, Ethopropazine, ethopropazine, ETHOPROPAZINE, PROFENAMINE, profenamine
Parent form; salt/anhydrous children: CHEMBL1200970
Patent coverage: 5,219 distinct patent families (15,984 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 15,966 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CHRM1 | M1 receptor | Antagonist | 8.51 | 0.2% | P11229 |
| CHRM2 | M2 receptor | Antagonist | 8.14 | 0% | P08172 |
Broader ChEMBL bioactivity targets: 26 (assay-derived). Sample: Lysine-specific demethylase 4E, 15-hydroxyprostaglandin dehydrogenase [NAD(+)], Alpha-2A adrenergic receptor, Cholinesterase, Amine oxidase [flavin-containing] A, D(1A) dopamine receptor, Muscarinic acetylcholine receptor M2, 5-hydroxytryptamine receptor 1A, Muscarinic acetylcholine receptor M1, Acetylcholinesterase.
Bioactivity
ChEMBL activities: 25 potent at pChembl ≥ 5 of 34 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| BCHE | 7.7 | Ki | 20 | nM | CHEMBL_ACT_137215 |
| BCHE | 7.7 | Ki | 20 | nM | CHEMBL_ACT_24829954 |
| CHRM1 | 7.44 | AC50 | 36.6 | nM | CHEMBL_ACT_25210341 |
| CHRM2 | 7.34 | AC50 | 46.1 | nM | CHEMBL_ACT_25195886 |
| CYP2D6 | 6.8 | Potency | 158.5 | nM | CHEMBL_ACT_4990260 |
| CYP2D6 | 6.8 | AC50 | 158.5 | nM | CHEMBL_ACT_6041744 |
| BCHE | 6.68 | IC50 | 210 | nM | CHEMBL_ACT_19289722 |
| ACHE | 6.58 | IC50 | 260 | nM | CHEMBL_ACT_15133454 |
| ACHE | 6.58 | IC50 | 260 | nM | CHEMBL_ACT_6217801 |
| BCHE | 6.52 | IC50 | 300 | nM | CHEMBL_ACT_15133450 |
| ACHE | 6.52 | IC50 | 300 | nM | CHEMBL_ACT_6217819 |
| ACHE | 6.52 | IC50 | 300 | nM | CHEMBL_ACT_6217829 |
| CYP1A2 | 6.3 | AC50 | 501.2 | nM | CHEMBL_ACT_6016078 |
| P81908 | 6.14 | IC50 | 720 | nM | CHEMBL_ACT_6217879 |
| DRD3 | 5.63 | AC50 | 2315 | nM | CHEMBL_ACT_25194668 |
| OPRM1 | 5.54 | AC50 | 2901 | nM | CHEMBL_ACT_25158325 |
| ADRA1A | 5.48 | AC50 | 3326 | nM | CHEMBL_ACT_25218978 |
| HIF1A | 5.4 | Potency | 3981 | nM | CHEMBL_ACT_4125661 |
| HIF1A | 5.4 | Potency | 3981 | nM | CHEMBL_ACT_4519870 |
| HTR1A | 5.32 | AC50 | 4820 | nM | CHEMBL_ACT_25165174 |
| DRD1 | 5.27 | AC50 | 5421 | nM | CHEMBL_ACT_25115360 |
| ADRA2A | 5.17 | AC50 | 6838 | nM | CHEMBL_ACT_25156579 |
| KDM4E | 5.1 | Potency | 7943 | nM | CHEMBL_ACT_3720032 |
| KCNH2 | 5 | AC50 | 10000 | nM | CHEMBL_ACT_25117908 |
| ALDH1A1 | 5 | Potency | 10000 | nM | CHEMBL_ACT_4153692 |
Target pathways
Aggregated over 2 target gene(s): CHRM1, CHRM2.
Top Reactome pathways
13 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 2 | CHRM1, CHRM2 |
| Signaling by GPCR | 2 | CHRM1, CHRM2 |
| Class A/1 (Rhodopsin-like receptors) | 2 | CHRM1, CHRM2 |
| Amine ligand-binding receptors | 2 | CHRM1, CHRM2 |
| GPCR downstream signalling | 2 | CHRM1, CHRM2 |
| Muscarinic acetylcholine receptors | 2 | CHRM1, CHRM2 |
| GPCR ligand binding | 2 | CHRM1, CHRM2 |
| Membrane Trafficking | 1 | CHRM2 |
| G alpha (q) signalling events | 1 | CHRM1 |
| G alpha (i) signalling events | 1 | CHRM2 |
| Vesicle-mediated transport | 1 | CHRM2 |
| Cargo recognition for clathrin-mediated endocytosis | 1 | CHRM2 |
| Clathrin-mediated endocytosis | 1 | CHRM2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| signal transduction | 2 |
| G protein-coupled receptor signaling pathway | 2 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 2 |
| adenylate cyclase-inhibiting G protein-coupled acetylcholine receptor signaling pathway | 2 |
| phospholipase C-activating G protein-coupled acetylcholine receptor signaling pathway | 2 |
| G protein-coupled acetylcholine receptor signaling pathway | 2 |
| chemical synaptic transmission | 2 |
| nervous system development | 2 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 1 |
| neuromuscular synaptic transmission | 1 |
| regulation of locomotion | 1 |
| positive regulation of monoatomic ion transport | 1 |
| saliva secretion | 1 |
| cognition | 1 |
| regulation of postsynaptic membrane potential | 1 |
Indications & clinical
Indications
1 indication (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| Parkinson disease | 4 | MONDO:0005180 | MONDO:0005180 |
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
537 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Afatinib | ChEMBL + PubChem | Phase 4 (approved) | CHRM1, CHRM2 |
| chenodiol | ChEMBL + PubChem | Phase 4 (approved) | CHRM1, CHRM2 |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | CHRM1, CHRM2 |
| LINAGLIPTIN | ChEMBL + PubChem | Phase 4 (approved) | CHRM1, CHRM2 |
| Mavorixafor | ChEMBL + PubChem | Phase 4 (approved) | CHRM1, CHRM2 |
| PIMAVANSERIN | ChEMBL + PubChem | Phase 4 (approved) | CHRM1, CHRM2 |
| VORAPAXAR | ChEMBL + PubChem | Phase 4 (approved) | CHRM1, CHRM2 |
| ACETYLCHOLINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| ACLIDINIUM BROMIDE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| AMBENONIUM | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| AMDINOCILLIN PIVOXIL | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| AMODIAQUINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| ANISOTROPINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| ATROPINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| AZATADINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| BENZYDAMINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| BETHANECHOL | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| BIPERIDEN | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| BROMODIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| BROMPHENIRAMINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CARBACHOL | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CARBAMOYLCHOLINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CARBETAPENTANE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CASPOFUNGIN | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CEVIMELINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CHLORMADINONE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CHLOROQUINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CHLORPROTHIXENE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CITALOPRAM | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CLIDINIUM | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CLOMIPHENE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| COBIMETINIB | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CYCLIZINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CYCLOBENZAPRINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CYCLOFENIL | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CYCLOPENTOLATE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| DARIFENACIN | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| DEQUALINIUM | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| DESIPRAMINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
| DESLORATADINE | ChEMBL | Phase 4 (approved) | CHRM1, CHRM2 |
Related Atlas pages
- Genes: CHRM1, CHRM2
- Diseases: Parkinson disease
- Drugs: Afatinib, chenodiol, Linagliptin, Mavorixafor, Pimavanserin, Vorapaxar, Acetylcholine, Aclidinium Bromide, Ambenonium, Amdinocillin Pivoxil, Amiodarone, Amitriptyline, Amodiaquine, Amoxapine, Anisotropine, Aripiprazole, Astemizole, Atropine, Azatadine, Azelastine, Bazedoxifene, Benperidol, Benztropine, Benzydamine, Bethanechol, Biperiden, Bromocriptine, Bromodiphenhydramine, Brompheniramine, Cabozantinib, Carbachol, Carbetapentane, Cariprazine, Caspofungin, Cevimeline, Chlormadinone, Chloroquine, Chlorpheniramine, Chlorpromazine, Chlorprothixene, Cinnarizine, Citalopram, Clemastine, Clidinium, Clomiphene, Clomipramine, Clotrimazole, Clozapine, Cobimetinib, Cyclizine, Cyclobenzaprine, Cyclofenil, Cyclopentolate, Cyproheptadine, Darifenacin, Dequalinium, Desipramine, Desloratadine