Ethoxzolamide
drugOn this page
Also known as CardraseEthamideNSC-10679ethoxazolamideetoxzolamideSID29215007SID855751SID104171380SID56422188EthoxyzolamideSID144204399SID170465083
Summary
Ethoxzolamide (CHEMBL18) is an approved small-molecule EC 4.2.1.1 (carbonic anhydrase) inhibitor targeting CA1, CA14, and CA12.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 4 (CA1, CA14, CA12…)
- Chemistry: 258.3 Da · C9H10N2O3S2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL18 |
| Name | Ethoxzolamide |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 3295 |
| ChEBI | CHEBI:101096 |
| Molecular formula | C9H10N2O3S2 |
| Molecular weight | 258.3 |
| InChIKey | OUZWUKMCLIBBOG-UHFFFAOYSA-N |
SMILES: CCOC1=CC2=C(C=C1)N=C(S2)S(=O)(=O)N
IUPAC name: 6-ethoxy-1,3-benzothiazole-2-sulfonamide
ChEBI definition: A sulfonamide that is 1,3-benzothiazole-2-sulfonamide which is substituted by an ethoxy group at position 6. A carbonic anhydrase inhibitor, it has been used in the treatment of glaucoma, and as a diuretic.
Pharmacological roles (ChEBI): EC 4.2.1.1 (carbonic anhydrase) inhibitor, diuretic, antiglaucoma drug.
Also known as: Cardrase, Ethamide, Ethoxzolamide, NSC-10679, ethoxzolamide, ethoxazolamide, Ethoxazolamide, etoxzolamide, SID29215007, SID855751, ETHOXZOLAMIDE, SID104171380
Parent form; salt/anhydrous children: CHEMBL6146662
Patent coverage: 843 distinct patent families (3,042 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 3,026 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CA1 | carbonic anhydrase 1 | Inhibition | 7.6 | 0% | P00915 |
| CA14 | carbonic anhydrase 14 | Inhibition | 7.6 | 0% | Q9ULX7 |
| CA12 | carbonic anhydrase 12 | Inhibition | 7.66 | 0.2% | O43570 |
| CA7 | carbonic anhydrase 7 | Inhibition | 9.1 | 1.6% | P43166 |
Broader ChEMBL bioactivity targets: 30 (assay-derived). Sample: Tyrosyl-DNA phosphodiesterase 1, Pyruvate kinase PKM, Lysine-specific demethylase 4E, Prelamin-A/C, Histone-lysine N-methyltransferase 2A, Carbonic anhydrase 3, Beta-lactamase, Carbonic anhydrase 2, Carbonic anhydrase V, Carbonic anhydrase 13.
Bioactivity
ChEMBL activities: 399 potent at pChembl ≥ 5 of 408 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| CA9 | 9.6 | IC50 | 0.25 | nM | CHEMBL_ACT_19104140 |
| CA2 | 9.52 | IC50 | 0.3 | nM | CHEMBL_ACT_13344575 |
| CA2 | 9.4 | IC50 | 0.4 | nM | CHEMBL_ACT_276421 |
| CA2 | 9.31 | Ki | 0.49 | nM | CHEMBL_ACT_276422 |
| CA7 | 9.15 | Kd | 0.71 | nM | CHEMBL_ACT_12696176 |
| CA7 | 9.15 | Kd | 0.71 | nM | CHEMBL_ACT_13509967 |
| CA2 | 9.15 | Kd | 0.71 | nM | CHEMBL_ACT_13510053 |
| CA7 | 9.11 | Ki | 0.78 | nM | CHEMBL_ACT_1435545 |
| CA7 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_13407601 |
| CA7 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_13440686 |
| CA7 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_13859517 |
| CA7 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_1780605 |
| CA7 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_2056572 |
| CA7 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_2159091 |
| CA7 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_2287531 |
| CA7 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_2491997 |
| CA7 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_3310903 |
| CA7 | 9.1 | Ki | 0.8 | nM | CHEMBL_ACT_6223166 |
| CA9 | 9 | IC50 | 0.99 | nM | CHEMBL_ACT_13344560 |
| CA2 | 8.96 | Kd | 1.1 | nM | CHEMBL_ACT_12696207 |
| CA5A | 8.7 | Ki | 2 | nM | CHEMBL_ACT_1520948 |
| CA14 | 8.6 | Ki | 2.5 | nM | CHEMBL_ACT_13859493 |
| CA14 | 8.6 | Ki | 2.5 | nM | CHEMBL_ACT_2492025 |
| CA14 | 8.6 | Ki | 2.5 | nM | CHEMBL_ACT_29230175 |
| CA14 | 8.6 | Ki | 2.5 | nM | CHEMBL_ACT_6311512 |
| CA2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_1045305 |
| CA2 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_1297399 |
| CA2 | 8.32 | IC50 | 4.83 | nM | CHEMBL_ACT_19104108 |
| CA2 | 8.27 | Ki | 5.4 | nM | CHEMBL_ACT_1520947 |
| CA2 | 8.1 | Ki | 8 | nM | CHEMBL_ACT_1003708 |
Target pathways
Aggregated over 4 target gene(s): CA1, CA14, CA12, CA7.
Top Reactome pathways
12 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Metabolism | 4 | CA1, CA12, CA14, CA7 |
| Reversible hydration of carbon dioxide | 4 | CA1, CA12, CA14, CA7 |
| Erythrocytes take up carbon dioxide and release oxygen | 1 | CA1 |
| Erythrocytes take up oxygen and release carbon dioxide | 1 | CA1 |
| Cytokine Signaling in Immune system | 1 | CA1 |
| O2/CO2 exchange in erythrocytes | 1 | CA1 |
| Immune System | 1 | CA1 |
| Transport of small molecules | 1 | CA1 |
| Interleukin-12 family signaling | 1 | CA1 |
| Signaling by Interleukins | 1 | CA1 |
| Gene and protein expression by JAK-STAT signaling after Interleukin-12 stimulation | 1 | CA1 |
| Interleukin-12 signaling | 1 | CA1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| response to fructose | 1 |
| estrous cycle | 1 |
| chloride ion homeostasis | 1 |
| positive regulation of synaptic transmission, GABAergic | 1 |
| obsolete positive regulation of cellular pH reduction | 1 |
| regulation of intracellular pH | 1 |
| neuron cellular homeostasis | 1 |
| regulation of chloride transport | 1 |
Indications & clinical
Indications
0 indications (0 at ChEMBL trial phase 4).
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
85 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ACETAMINOPHEN | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| ACETAZOLAMIDE | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| CELECOXIB | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| CHLORTHALIDONE | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| COUMARIN | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| DICHLORPHENAMIDE | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| DOBUTAMINE | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| FUROSEMIDE | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| LACOSAMIDE | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| SALICYLIC ACID | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| BORTEZOMIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| BRINZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| DORZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| FAMOTIDINE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| IMATINIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| INDAPAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| LEVETIRACETAM | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| MAFENIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| METHAZOLAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| NILOTINIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| SULFANILAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| TOPIRAMATE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| TRICHLORMETHIAZIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| TRIENTINE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| VALDECOXIB | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| VERALIPRIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| ZONISAMIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14, CA7 |
| CAFFEIC ACID | ChEMBL | Phase 3 | CA1, CA12, CA14, CA7 |
| CURCUMIN | ChEMBL | Phase 3 | CA1, CA12, CA14, CA7 |
| QUERCETIN | ChEMBL | Phase 3 | CA1, CA12, CA14, CA7 |
| RESVERATROL | ChEMBL | Phase 3 | CA1, CA12, CA14, CA7 |
| SACCHARIN | ChEMBL | Phase 3 | CA1, CA12, CA14, CA7 |
| SPERMIDINE | ChEMBL | Phase 3 | CA1, CA12, CA14, CA7 |
| CARZENIDE | ChEMBL | Phase 2 | CA1, CA12, CA14, CA7 |
| COUMAPHOS | ChEMBL | Phase 2 | CA1, CA12, CA14, CA7 |
| ELLAGIC ACID | ChEMBL | Phase 2 | CA1, CA12, CA14, CA7 |
| GALLIC ACID | ChEMBL | Phase 2 | CA1, CA12, CA14, CA7 |
| INDISULAM | ChEMBL | Phase 2 | CA1, CA12, CA14, CA7 |
| IROSUSTAT | ChEMBL | Phase 2 | CA1, CA12, CA14, CA7 |
| PCI-27483 | ChEMBL | Phase 2 | CA1, CA12, CA14, CA7 |
| SONEPIPRAZOLE | ChEMBL | Phase 2 | CA1, CA12, CA14, CA7 |
| HYDROQUINONE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14 |
| PHENOL | ChEMBL | Phase 4 (approved) | CA1, CA12, CA14 |
| PYRITHIONE ZINC | ChEMBL | Phase 4 (approved) | CA12, CA14, CA7 |
| SULPIRIDE | ChEMBL | Phase 4 (approved) | CA1, CA12, CA7 |
| P-TOLUENESULFONAMIDE | ChEMBL | Phase 3 | CA1, CA12, CA7 |
| THIMEROSAL | ChEMBL | Phase 3 | CA12, CA14, CA7 |
| SODIUM CYCLAMATE | ChEMBL | Phase 2 | CA12, CA14, CA7 |
| SULFASUCCINAMIDE | ChEMBL | Phase 2 | CA1, CA12, CA14 |
| HYDROCHLOROTHIAZIDE | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA14 |
| PAZOPANIB | ChEMBL + PubChem | Phase 4 (approved) | CA1, CA12 |
| SULTHIAME | ChEMBL | Phase 4 (approved) | CA1, CA7 |
| ZOLEDRONIC ACID | ChEMBL | Phase 4 (approved) | CA12, CA14 |
| PRITELIVIR | ChEMBL | Phase 3 | CA1, CA12 |
| BENZYLSULFAMIDE | ChEMBL | Phase 2 | CA1, CA12 |
| DAIDZEIN | ChEMBL | Phase 2 | CA12, CA7 |
| DITIOCARB | ChEMBL | Phase 2 | CA1, CA12 |
| FLAVONE | ChEMBL | Phase 2 | CA1, CA12 |
| ISOQUERCETIN | ChEMBL | Phase 2 | CA12, CA7 |
| LUTEOLIN | ChEMBL | Phase 2 | CA12, CA7 |
Related Atlas pages
- Genes: CA1, CA14, CA12, CA7
- Drugs: Acetaminophen, Acetazolamide, Celecoxib, Chlorthalidone, Dichlorphenamide, Dobutamine, Furosemide, Lacosamide, Salicylic Acid, Bortezomib, Brinzolamide, Dorzolamide, Famotidine, Imatinib, Indapamide, Levetiracetam, Mafenide, Methazolamide, Nilotinib, Sulfanilamide, Topiramate, Trichlormethiazide, Trientine, Valdecoxib, Veralipride, Zonisamide, Caffeic Acid, Curcumin, Quercetin, Resveratrol, Saccharin, Spermidine, Hydroquinone, Phenol, Pyrithione Zinc, Sulpiride, P-Toluenesulfonamide, Thimerosal, Hydrochlorothiazide, Pazopanib, Sulthiame, Zoledronic Acid, Pritelivir