Etidocaine
drugOn this page
Also known as EtidocainaW-19053 FREE BASEW-19053 [AS HYDROCHLORIDE]SID144206521
Summary
Etidocaine (CHEMBL492) is an approved small-molecule local anaesthetic (ATC N01BB57) targeting SCN2A.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N01BB57 (+1 more)
- Targets: 1 (SCN2A)
- Chemistry: 276.4 Da · C17H28N2O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL492 |
| Name | Etidocaine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 37497 |
| ChEBI | CHEBI:4904 |
| ATC | N01BB57, N01BB07 |
| Molecular formula | C17H28N2O |
| Molecular weight | 276.4 |
| InChIKey | VTUSIVBDOCDNHS-UHFFFAOYSA-N |
SMILES: CCCN(CC)C(CC)C(=O)NC1=C(C=CC=C1C)C
IUPAC name: N-(2,6-dimethylphenyl)-2-[ethyl(propyl)amino]butanamide
ChEBI definition: An amino acid amide in which 2-[ethyl(propyl)amino]butanoic acid and 2,6-dimethylaniline have combined to form the amide bond. Used as a local anaesthetic (amide caine), it has rapid onset and long action properties, similar to bupivacaine, and is given by injection during surgical procedures and during labour and delivery.
Pharmacological roles (ChEBI): local anaesthetic.
Also known as: Etidocaina, Etidocaine, W-19053 FREE BASE, W-19053 [AS HYDROCHLORIDE], ETIDOCAINE, SID144206521, etidocaine
Parent form; salt/anhydrous children: CHEMBL1200597
Patent coverage: 3,105 distinct patent families (11,778 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SCN2A | Nav1.2 | Pore blocker | 6 | 0.1% | Q99250 |
Broader ChEMBL bioactivity targets: 3 (assay-derived). Sample: Sodium channel protein type 5 subunit alpha, Sodium channel alpha subunits; brain (Types I, II, III), Potassium channel subfamily K member 3.
Bioactivity
ChEMBL activities: 1 potent at pChembl ≥ 5 of 3 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| SCN1A | 5.46 | IC50 | 3500 | nM | CHEMBL_ACT_346931 |
Target pathways
Aggregated over 1 target gene(s): SCN2A.
Top Reactome pathways
11 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Developmental Biology | 1 | SCN2A |
| L1CAM interactions | 1 | SCN2A |
| Muscle contraction | 1 | SCN2A |
| Axon guidance | 1 | SCN2A |
| Interaction between L1 and Ankyrins | 1 | SCN2A |
| Cardiac conduction | 1 | SCN2A |
| Phase 0 - rapid depolarisation | 1 | SCN2A |
| Nervous system development | 1 | SCN2A |
| Sensory Perception | 1 | SCN2A |
| Sensory perception of taste | 1 | SCN2A |
| Sensory perception of sweet, bitter, and umami (glutamate) taste | 1 | SCN2A |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| sodium ion transport | 1 |
| nervous system development | 1 |
| memory | 1 |
| intrinsic apoptotic signaling pathway in response to osmotic stress | 1 |
| neuronal action potential | 1 |
| sodium ion transmembrane transport | 1 |
| myelination | 1 |
| neuron apoptotic process | 1 |
| cellular response to hypoxia | 1 |
| cardiac muscle cell action potential involved in contraction | 1 |
| action potential | 1 |
| regulation of heart rate | 1 |
| monoatomic ion transport | 1 |
| monoatomic ion transmembrane transport | 1 |
| regulation of membrane potential | 1 |
Indications & clinical
Indications
0 indications (0 at ChEMBL trial phase 4).
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
134 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AMIODARONE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| AMITRIPTYLINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| BROMPHENIRAMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| CHLORPHENIRAMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| CHLORPROMAZINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| COCAINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| CYPROHEPTADINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| DESIPRAMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| DIBUCAINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| DICYCLOMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| DILTIAZEM | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| DIPHENHYDRAMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| DROPERIDOL | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| FELODIPINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| FLUPHENAZINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| HALOPERIDOL | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| IMIPRAMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| LAMOTRIGINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| LEVORPHANOL | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| LOPERAMIDE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| MEXILETINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| NIFEDIPINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| NISOLDIPINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PHENOXYBENZAMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PHENTOLAMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PHENYTOIN | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PIMOZIDE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PRAMOXINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PRAZOSIN | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PRILOCAINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PROMETHAZINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PROPARACAINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| QUINIDINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| QUININE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| RESERPINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| TETRABENAZINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| TETRACAINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| THIORIDAZINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| TRIFLUOPERAZINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| VERAPAMIL | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| ARTICAINE | ChEMBL | Phase 4 (approved) | SCN2A |
| BENOXINATE | ChEMBL | Phase 4 (approved) | SCN2A |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | SCN2A |
| BUPIVACAINE | ChEMBL | Phase 4 (approved) | SCN2A |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | SCN2A |
| DIPHENIDOL | ChEMBL | Phase 4 (approved) | SCN2A |
| HEXYLCAINE | ChEMBL | Phase 4 (approved) | SCN2A |
| MIANSERIN | ChEMBL | Phase 4 (approved) | SCN2A |
| MIBEFRADIL | ChEMBL | Phase 4 (approved) | SCN2A |
| PHENIRAMINE | ChEMBL | Phase 4 (approved) | SCN2A |
| PRENYLAMINE | ChEMBL | Phase 4 (approved) | SCN2A |
| PROMAZINE | ChEMBL | Phase 4 (approved) | SCN2A |
| PROPOXYCAINE | ChEMBL | Phase 4 (approved) | SCN2A |
| QUINACRINE | ChEMBL | Phase 4 (approved) | SCN2A |
| RILUZOLE | ChEMBL | Phase 4 (approved) | SCN2A |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | SCN2A |
| YOHIMBINE | ChEMBL + PubChem | Phase 3 (approved) | SCN2A |
| AJMALINE | ChEMBL | Phase 3 | SCN2A |
| ELECLAZINE | ChEMBL | Phase 3 | SCN2A |
| NITRENDIPINE | ChEMBL | Phase 3 | SCN2A |
Related Atlas pages
- Genes: SCN2A
- Drugs: Amiodarone, Amitriptyline, Brompheniramine, Chlorpheniramine, Chlorpromazine, Cocaine, Cyproheptadine, Desipramine, Dibucaine, Dicyclomine, Diltiazem, Diphenhydramine, Droperidol, Felodipine, Fluphenazine, Haloperidol, Imipramine, Lamotrigine, Levorphanol, Loperamide, Mexiletine, Nifedipine, Nisoldipine, Phenoxybenzamine, Phentolamine, Phenytoin, Pimozide, Pramoxine, Prazosin, Prilocaine, Promethazine, Proparacaine, Quinidine, Quinine, Reserpine, Tetrabenazine, Tetracaine, Thioridazine, Trifluoperazine, Verapamil, Articaine, Benoxinate, Bepridil, Bupivacaine, Cinnarizine, Diphenidol, Hexylcaine, Mianserin, Mibefradil, Pheniramine, Prenylamine, Promazine, Propoxycaine, Quinacrine, Riluzole, Sertindole, Yohimbine, Ajmaline, Eleclazine, Nitrendipine