Fasudil
drugOn this page
Also known as AT 877AT-877HA 1077HA-1077NSC-759827ZK-258594SID11113364SID26751605SID92708292SID104171358SID124883255SID103905389SID103905390SID124883258SID124883259K00075Fasudil hydrochlorideÊFasudil hydrochlorideÂFasudll
Summary
Fasudil (CHEMBL38380) is a phase-3 clinical-stage small-molecule EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor (ATC C04AX32) targeting ROCK1 and ROCK2; indicated across 5 conditions including cardiovascular disorder and retinal vein occlusion; with CIViC clinical evidence for 1 variant-indication association (e.g. GATA2 EXPRESSION in lung adenocarcinoma).
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- ATC class: C04AX32
- Targets: 2 (ROCK1, ROCK2)
- Indications: 5 conditions
- Clinical trials: 11
- Precision-oncology evidence (CIViC): 1 variant–indication association
- Chemistry: 291.37 Da · C14H17N3O2S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL38380 |
| Name | Fasudil |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 3547 |
| ChEBI | CHEBI:43871 |
| ATC | C04AX32 |
| Molecular formula | C14H17N3O2S |
| Molecular weight | 291.37 |
| InChIKey | NGOGFTYYXHNFQH-UHFFFAOYSA-N |
SMILES: C1CNCCN(C1)S(=O)(=O)C2=CC=CC3=C2C=CN=C3
IUPAC name: 5-(1,4-diazepan-1-ylsulfonyl)isoquinoline
ChEBI definition: An isoquinoline substituted by a (1,4-diazepan-1-yl)sulfonyl group at position 5. It is a Rho-kinase inhibitor and its hydrochloride hydrate form is approved for the treatment of cerebral vasospasm and cerebral ischemia.
Pharmacological roles (ChEBI): geroprotector, EC 2.7.11.1 (non-specific serine/threonine protein kinase) inhibitor, vasodilator agent, nootropic agent, neuroprotective agent, antihypertensive agent, calcium channel blocker.
Also known as: AT 877, AT-877, Fasudil, HA 1077, HA-1077, NSC-759827, ZK-258594, fasudil, SID11113364, SID26751605, SID92708292, SID104171358
Parent form; salt/anhydrous children: CHEMBL541388, CHEMBL4459126
Patent coverage: 3,507 distinct patent families (11,953 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 11,425 (96%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ROCK1 | Rho associated coiled-coil containing protein kinase 1 | Inhibition | 5.57 | 1.4% | Q13464 |
| ROCK2 | Rho associated coiled-coil containing protein kinase 2 | Inhibition | 5.89 | 1.1% | O75116 |
Broader ChEMBL bioactivity targets: 60 (assay-derived). Sample: Leucine-rich repeat serine/threonine-protein kinase 2, Survival motor neuron protein, C-C motif chemokine 2, Cyclin-dependent kinase 13, 5-hydroxytryptamine receptor 2B, Alpha-2A adrenergic receptor, Alpha-2B adrenergic receptor, Progesterone receptor, Menin/Histone-lysine N-methyltransferase MLL, Protein kinase C (PKC).
Bioactivity
ChEMBL activities: 111 potent at pChembl ≥ 5 of 133 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ROCK1 | 7.5 | Ki | 31.62 | nM | CHEMBL_ACT_9656597 |
| ROCK1 | 7.5 | Ki | 31.62 | nM | CHEMBL_ACT_9660835 |
| ROCK2 | 7.35 | Kd | 45 | nM | CHEMBL_ACT_26618873 |
| ROCK1 | 7.3 | Kd | 50 | nM | CHEMBL_ACT_26618870 |
| PRKX | 7.3 | Ki | 50.12 | nM | CHEMBL_ACT_9581368 |
| PRKX | 7.3 | Ki | 50.12 | nM | CHEMBL_ACT_9585119 |
| ROCK2 | 7.3 | Ki | 50.12 | nM | CHEMBL_ACT_9631141 |
| ROCK2 | 7.3 | Ki | 50.12 | nM | CHEMBL_ACT_9631341 |
| ROCK2 | 7.11 | Kd | 78 | nM | CHEMBL_ACT_10863424 |
| PRKACA | 7.1 | Ki | 79.43 | nM | CHEMBL_ACT_9649222 |
| PRKACA | 7.1 | Ki | 79.43 | nM | CHEMBL_ACT_9657626 |
| PKN3 | 7 | Kd | 99 | nM | CHEMBL_ACT_17927716 |
| ROCK1 | 7 | Ki | 100 | nM | CHEMBL_ACT_5123977 |
| CLK1 | 6.82 | Kd | 152 | nM | CHEMBL_ACT_17892370 |
| ROCK2 | 6.8 | IC50 | 158 | nM | CHEMBL_ACT_13836550 |
| ROCK2 | 6.8 | IC50 | 158 | nM | CHEMBL_ACT_24662732 |
| ROCK2 | 6.8 | IC50 | 158 | nM | CHEMBL_ACT_24973406 |
| ROCK2 | 6.8 | IC50 | 158 | nM | CHEMBL_ACT_29095221 |
| ROCK2 | 6.75 | IC50 | 180 | nM | CHEMBL_ACT_1854724 |
| CYP2D6 | 6.7 | Potency | 199.5 | nM | CHEMBL_ACT_4982145 |
| CYP2D6 | 6.7 | AC50 | 199.5 | nM | CHEMBL_ACT_6050196 |
| ROCK2 | 6.66 | IC50 | 220 | nM | CHEMBL_ACT_22401859 |
| ROCK1 | 6.58 | IC50 | 260 | nM | CHEMBL_ACT_14543540 |
| ROCK1 | 6.58 | IC50 | 260 | nM | CHEMBL_ACT_16493392 |
| ROCK1 | 6.58 | IC50 | 260 | nM | CHEMBL_ACT_22396440 |
| ROCK1 | 6.52 | IC50 | 300 | nM | CHEMBL_ACT_8047297 |
| ROCK2 | 6.5 | IC50 | 320 | nM | CHEMBL_ACT_14543544 |
| ROCK2 | 6.5 | IC50 | 320 | nM | CHEMBL_ACT_16493393 |
| ROCK2 | 6.5 | IC50 | 320 | nM | CHEMBL_ACT_22396439 |
| CLK4 | 6.5 | Ki | 316.2 | nM | CHEMBL_ACT_9682868 |
Target pathways
Aggregated over 2 target gene(s): ROCK1, ROCK2.
Top Reactome pathways
40 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Developmental Biology | 2 | ROCK1, ROCK2 |
| Signal Transduction | 2 | ROCK1, ROCK2 |
| Disease | 2 | ROCK1, ROCK2 |
| Signaling by VEGF | 2 | ROCK1, ROCK2 |
| Signaling by Rho GTPases | 2 | ROCK1, ROCK2 |
| RHO GTPase Effectors | 2 | ROCK1, ROCK2 |
| EPH-Ephrin signaling | 2 | ROCK1, ROCK2 |
| Signaling by GPCR | 2 | ROCK1, ROCK2 |
| Semaphorin interactions | 2 | ROCK1, ROCK2 |
| GPCR downstream signalling | 2 | ROCK1, ROCK2 |
| EPHB-mediated forward signaling | 2 | ROCK1, ROCK2 |
| EPHA-mediated growth cone collapse | 2 | ROCK1, ROCK2 |
| Sema4D in semaphorin signaling | 2 | ROCK1, ROCK2 |
| G alpha (12/13) signalling events | 2 | ROCK1, ROCK2 |
| Sema4D induced cell migration and growth-cone collapse | 2 | ROCK1, ROCK2 |
| Axon guidance | 2 | ROCK1, ROCK2 |
| VEGFA-VEGFR2 Pathway | 2 | ROCK1, ROCK2 |
| RHO GTPases Activate ROCKs | 2 | ROCK1, ROCK2 |
| Infectious disease | 2 | ROCK1, ROCK2 |
| RHOA GTPase cycle | 2 | ROCK1, ROCK2 |
| Signaling by Receptor Tyrosine Kinases | 2 | ROCK1, ROCK2 |
| RHO GTPase cycle | 2 | ROCK1, ROCK2 |
| RHOB GTPase cycle | 2 | ROCK1, ROCK2 |
| RHOC GTPase cycle | 2 | ROCK1, ROCK2 |
| RHOH GTPase cycle | 2 | ROCK1, ROCK2 |
| RHOBTB1 GTPase cycle | 2 | ROCK1, ROCK2 |
| Nervous system development | 2 | ROCK1, ROCK2 |
| Potential therapeutics for SARS | 2 | ROCK1, ROCK2 |
| SARS-CoV Infections | 2 | ROCK1, ROCK2 |
| RHOBTB GTPase Cycle | 2 | ROCK1, ROCK2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| mitotic cytokinesis | 2 |
| epithelial to mesenchymal transition | 2 |
| aortic valve morphogenesis | 2 |
| smooth muscle contraction | 2 |
| signal transduction | 2 |
| Rho protein signal transduction | 2 |
| positive regulation of cardiac muscle hypertrophy | 2 |
| positive regulation of gene expression | 2 |
| negative regulation of angiogenesis | 2 |
| actin cytoskeleton organization | 2 |
| regulation of cell adhesion | 2 |
| cortical actin cytoskeleton organization | 2 |
| actomyosin structure organization | 2 |
| regulation of actin cytoskeleton organization | 2 |
| positive regulation of MAPK cascade | 2 |
Indications & clinical
Indications
5 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| cardiovascular disorder | 3 | MONDO:0004995 | EFO:0000319 |
| retinal vein occlusion | 2 | MONDO:0006951 | EFO:1001157 |
| retinopathy of prematurity | 2 | MONDO:0006952 | EFO:1001158 |
| dementia | 2 | MONDO:0001627 | HP:0000726 |
| amyotrophic lateral sclerosis | 2 | MONDO:0004976 | MONDO:0004976 |
Clinical trials
Total trials: 11.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 8 |
| PHASE2/PHASE3 | 2 |
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT06861192 | PHASE2/PHASE3 | RECRUITING | Clinical Study of Fasudil Hydrochloride and PD1 Inhibitor Combined With Androgen Deprivation in Neoadjuvant Therapy of Prostate Cancer |
| NCT00498615 | PHASE3 | COMPLETED | A Rho-kinase Inhibitor (Fasudil) in the Treatment of Raynaud’s Phenomenon |
| NCT03391219 | PHASE2/PHASE3 | UNKNOWN | Combined Intravitreal Injection of Bevacizumab and Fasudil Versus Bevacizumab Alone for Macular Edema Secondary to Retinal Vein Occlusion in Previously Treated Patients |
| NCT05218668 | PHASE2 | ACTIVE_NOT_RECRUITING | Rho Kinase Inhibitor in Amyotrophic Lateral Sclerosis (REAL) |
| NCT06362707 | PHASE2 | RECRUITING | Fasudil Trial for Treatment of Early Alzheimer’s Disease (FEAD) |
| NCT07250542 | PHASE2 | RECRUITING | A Clinical Study on the Efficacy and Safety of Fasudil Hydrochloride Combined With Immunotherapy in the Treatment of Metastatic Castration-resistant Prostate Cancer |
| NCT00120718 | PHASE2 | COMPLETED | The Effect of Fasudil on Vascular Function in Humans |
| NCT01935518 | PHASE2 | UNKNOWN | A Clinical Trial of Safety and Efficacy of Fasudil in Subjects With Amyotrophic Lateral Sclerosis (ALS) |
| NCT03792490 | PHASE2 | COMPLETED | Inhibition of Rho Kinase (ROCK) With Fasudil as Disease-modifying Treatment for ALS |
| NCT04734379 | PHASE2 | UNKNOWN | Rho Kinase (ROCK) Inhibitor in Tauopathies - 1 |
| NCT04793659 | PHASE2 | COMPLETED | Fasudil fOr redUcing elopemeNt and Spatial Disorientation |
Clinical evidence (CIViC)
Variant × indication × effect (1 predictive associations from 1 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| GATA2 EXPRESSION | Lung Adenocarcinoma | Sensitivity/Response | Bortezomib + Fasudil | CIViC D | EID301 |
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
51 molecules share ≥1 primary target. Top 51 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| BELUMOSUDIL | ChEMBL + PubChem | Phase 4 (approved) | ROCK1, ROCK2 |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ROCK1, ROCK2 |
| BARICITINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| CAPIVASERTIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| MOMELOTINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| NETARSUDIL | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| RUXOLITINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| TOFACITINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| UPADACITINIB | ChEMBL | Phase 4 (approved) | ROCK1, ROCK2 |
| AFURESERTIB | ChEMBL | Phase 3 | ROCK1, ROCK2 |
| ALVOCIDIB | ChEMBL | Phase 3 | ROCK1, ROCK2 |
| DOVITINIB | ChEMBL | Phase 3 | ROCK1, ROCK2 |
| LESTAURTINIB | ChEMBL | Phase 3 | ROCK1, ROCK2 |
| LINIFANIB | ChEMBL | Phase 3 | ROCK1, ROCK2 |
| RIPASUDIL | ChEMBL | Phase 3 | ROCK1, ROCK2 |
| CENISERTIB | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| DECERNOTINIB | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| ILORASERTIB | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| LAUROGUADINE | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| R-406 | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| RG-547 | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| RIPASUDIL HYDROCHLORIDE DIHYDRATE | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| SAR-407899 FREE BASE | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| SU-014813 | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| UCN-01 | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| UPROSERTIB | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| VEROSUDIL | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| ZOTIRACICLIB | ChEMBL | Phase 2 | ROCK1, ROCK2 |
| Afatinib | PubChem | Approved | ROCK1, ROCK2 |
| Binimetinib | PubChem | Approved | ROCK1, ROCK2 |
| dacomitinib | PubChem | Approved | ROCK1, ROCK2 |
| Fostamatinib | PubChem | Approved | ROCK1, ROCK2 |
| Gefitinib | PubChem | Approved | ROCK1, ROCK2 |
| Idelalisib | PubChem | Approved | ROCK1, ROCK2 |
| Pazopanib | PubChem | Approved | ROCK1, ROCK2 |
| regorafenib | PubChem | Approved | ROCK1, ROCK2 |
| Selumetinib | PubChem | Approved | ROCK1, ROCK2 |
| Trametinib | PubChem | Approved | ROCK1, ROCK2 |
| CERITINIB | ChEMBL | Phase 4 (approved) | ROCK2 |
| PALBOCICLIB | ChEMBL | Phase 4 (approved) | ROCK2 |
| VANDETANIB | ChEMBL | Phase 4 (approved) | ROCK2 |
| BMS-690514 | ChEMBL | Phase 2 | ROCK1 |
| FORETINIB | ChEMBL | Phase 2 | ROCK2 |
| PH-797804 | ChEMBL | Phase 2 | ROCK2 |
| SIMUROSERTIB | ChEMBL | Phase 2 | ROCK1 |
| VX-702 | ChEMBL | Phase 2 | ROCK1 |
| Belzutifan | PubChem | Approved | ROCK2 |
Related Atlas pages
- Genes: ROCK1, ROCK2
- Diseases: cardiovascular disorder, lung adenocarcinoma
- Drugs: Belumosudil, Crizotinib, Baricitinib, Bosutinib, Capivasertib, Fedratinib, Midostaurin, Momelotinib, Netarsudil, Ruxolitinib, Sunitinib, Tofacitinib, Upadacitinib, Afuresertib, Alvocidib, Dovitinib, Lestaurtinib, Linifanib, Ripasudil, Afatinib, Binimetinib, dacomitinib, Fostamatinib, Gefitinib, Idelalisib, Pazopanib, regorafenib, Selumetinib, Trametinib, Ceritinib, Palbociclib, Vandetanib, Belzutifan