Fenoprofen
drug drugOn this page
Also known as FenoprofeneFenoprofenoLILLY-53858NSC-757813Progesic
Summary
Fenoprofen (CHEMBL1297) is an approved small-molecule non-steroidal anti-inflammatory drug (ATC M01AE04) targeting PTGS1 and SLC5A8; indicated across 1 condition including rheumatic disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: M01AE04
- Targets: 2 (PTGS1, SLC5A8)
- Indications: 1 condition
- Chemistry: 242.27 Da · C15H14O3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1297 |
| Name | Fenoprofen |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 3342 |
| ChEBI | CHEBI:5004 |
| ATC | M01AE04 |
| Molecular formula | C15H14O3 |
| Molecular weight | 242.27 |
| InChIKey | RDJGLLICXDHJDY-UHFFFAOYSA-N |
SMILES: CC(C1=CC(=CC=C1)OC2=CC=CC=C2)C(=O)O
IUPAC name: 2-(3-phenoxyphenyl)propanoic acid
ChEBI definition: A monocarboxylic acid that is propanoic acid in which one of the hydrogens at position 2 is substituted by a 3-phenoxyphenyl group. A non-steroidal anti-inflammatory drug, the dihydrate form of the calcium salt is used for the management of mild to moderate pain and for the relief of pain and inflammation associated with disorders such as arthritis. It is pharmacologically similar to aspirin, but causes less gastrointestinal bleeding.
Pharmacological roles (ChEBI): non-steroidal anti-inflammatory drug, cyclooxygenase 2 inhibitor, cyclooxygenase 1 inhibitor, antipyretic, non-narcotic analgesic, drug allergen.
Also known as: Fenoprofen, Fenoprofene, Fenoprofeno, LILLY-53858, NSC-757813, Progesic, fenoprofen, FENOPROFEN, FENOPROFENE
Parent form; salt/anhydrous children: CHEMBL138241, CHEMBL2068720, CHEMBL2103736
Patent coverage: 13,911 distinct patent families (56,307 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 56,255 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| PTGS1 | COX-1 | Inhibition | 6.84 | 0% | P23219 |
| SLC5A8 | SMCT1 | Inhibition | 4.57 | 0.2% | Q8N695 |
Broader ChEMBL bioactivity targets: 3 (assay-derived). Sample: Prostaglandin G/H synthase 1, Prostaglandin G/H synthase 1, Prostaglandin G/H synthase 2.
Bioactivity
ChEMBL activities: 3 potent at pChembl ≥ 5 of 5 total. Top 100 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| PTGS1 | 6.84 | IC50 | 145 | nM | CHEMBL_ACT_7648309 |
| PTGS1 | 5.82 | AC50 | 1520 | nM | CHEMBL_ACT_25205452 |
| P05979 | 5.56 | IC50 | 2730 | nM | CHEMBL_ACT_18666400 |
Target pathways
Aggregated over 2 target gene(s): PTGS1, SLC5A8.
Top Reactome pathways
12 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| COX reactions | 1 | PTGS1 |
| Metabolism | 1 | SLC5A8 |
| Nicotinate metabolism | 1 | SLC5A8 |
| Metabolism of water-soluble vitamins and cofactors | 1 | SLC5A8 |
| Metabolism of vitamins and cofactors | 1 | SLC5A8 |
| R-HSA-197264 | 1 | SLC5A8 |
| Synthesis of Prostaglandins (PG) and Thromboxanes (TX) | 1 | PTGS1 |
| Transport of small molecules | 1 | SLC5A8 |
| R-HSA-425393 | 1 | SLC5A8 |
| SLC-mediated transmembrane transport | 1 | SLC5A8 |
| Organic anion transport by SLC5/17/25 transporters | 1 | SLC5A8 |
| SLC-mediated transport of inorganic anions | 1 | SLC5A8 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| prostaglandin biosynthetic process | 1 |
| response to oxidative stress | 1 |
| regulation of blood pressure | 1 |
| cyclooxygenase pathway | 1 |
| regulation of cell population proliferation | 1 |
| long-chain fatty acid biosynthetic process | 1 |
| lipid metabolic process | 1 |
| fatty acid metabolic process | 1 |
| fatty acid biosynthetic process | 1 |
| prostaglandin metabolic process | 1 |
| prostanoid biosynthetic process | 1 |
| cellular oxidant detoxification | 1 |
| monoatomic ion transport | 1 |
| sodium ion transport | 1 |
| chloride transport | 1 |
Indications & clinical
Indications
1 approved indication. FDA phase 4, plus an anticancer drug’s labelled cancer uses (which ChEMBL often logs at phase 3).
| Indication | Phase | MONDO | EFO |
|---|---|---|---|
| rheumatic disorder | 4 | MONDO:0005554 | EFO:0005755 |
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
275 molecules share ≥1 primary target. Top 100 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| KETOPROFEN | ChEMBL + PubChem | Phase 4 (approved) | PTGS1, SLC5A8 |
| 2-MERCAPTOETHANESULFONIC ACID | ChEMBL | Phase 4 (approved) | PTGS1 |
| 3,3’,4’,5-TETRACHLOROSALICYLANILIDE | ChEMBL | Phase 4 (approved) | PTGS1 |
| ACARBOSE | ChEMBL | Phase 4 (approved) | PTGS1 |
| ACEMETACIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| ACETOHYDROXAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1 |
| ALITRETINOIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| AMDINOCILLIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | PTGS1 |
| ASCORBIC ACID | ChEMBL | Phase 4 (approved) | PTGS1 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| AVATROMBOPAG | ChEMBL | Phase 4 (approved) | PTGS1 |
| BELINOSTAT | ChEMBL | Phase 4 (approved) | PTGS1 |
| BENDAMUSTINE | ChEMBL | Phase 4 (approved) | PTGS1 |
| BENZIODARONE | ChEMBL | Phase 4 (approved) | PTGS1 |
| BETA CAROTENE | ChEMBL | Phase 4 (approved) | PTGS1 |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | PTGS1 |
| BROMFENAC | ChEMBL | Phase 4 (approved) | PTGS1 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | PTGS1 |
| CAPSAICIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| CAPTOPRIL | ChEMBL | Phase 4 (approved) | PTGS1 |
| CARBARIL | ChEMBL | Phase 4 (approved) | PTGS1 |
| CARPROFEN | ChEMBL | Phase 4 (approved) | PTGS1 |
| CASPOFUNGIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| CEFPODOXIME PROXETIL | ChEMBL | Phase 4 (approved) | PTGS1 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | PTGS1 |
| CEPHALOGLYCIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| CEPHALORIDINE | ChEMBL | Phase 4 (approved) | PTGS1 |
| CHLORPROTHIXENE | ChEMBL | Phase 4 (approved) | PTGS1 |
| CHOLECALCIFEROL | ChEMBL | Phase 4 (approved) | PTGS1 |
| CIANIDANOL | ChEMBL | Phase 4 (approved) | PTGS1 |
| CLOMIPHENE | ChEMBL | Phase 4 (approved) | PTGS1 |
| COLISTIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| CYCLOSERINE | ChEMBL | Phase 4 (approved) | PTGS1 |
| CYSTEINE | ChEMBL | Phase 4 (approved) | PTGS1 |
| DACTINOMYCIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| DELAMANID | ChEMBL | Phase 4 (approved) | PTGS1 |
| DEQUALINIUM | ChEMBL | Phase 4 (approved) | PTGS1 |
| DESLORATADINE | ChEMBL | Phase 4 (approved) | PTGS1 |
| DESMOPRESSIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | PTGS1 |
| DEXIBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1 |
| DEXKETOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1 |
| DEXPANTHENOL | ChEMBL | Phase 4 (approved) | PTGS1 |
| DEXRAZOXANE | ChEMBL | Phase 4 (approved) | PTGS1 |
| DICLOFENAC | ChEMBL | Phase 4 (approved) | PTGS1 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | PTGS1 |
| DIRITHROMYCIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| DOPAMINE | ChEMBL | Phase 4 (approved) | PTGS1 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| DROXIDOPA | ChEMBL | Phase 4 (approved) | PTGS1 |
| EDARAVONE | ChEMBL | Phase 4 (approved) | PTGS1 |
| ELIGLUSTAT | ChEMBL | Phase 4 (approved) | PTGS1 |
| ENASIDENIB | ChEMBL | Phase 4 (approved) | PTGS1 |
| EPIRUBICIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| ERGOCALCIFEROL | ChEMBL | Phase 4 (approved) | PTGS1 |
| ERLOTINIB | ChEMBL | Phase 4 (approved) | PTGS1 |
| ERTAPENEM | ChEMBL | Phase 4 (approved) | PTGS1 |
| ESFLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1 |
| ESTRADIOL CYPIONATE | ChEMBL | Phase 4 (approved) | PTGS1 |
| ESTRADIOL VALERATE | ChEMBL | Phase 4 (approved) | PTGS1 |
| ESTRIOL | ChEMBL | Phase 4 (approved) | PTGS1 |
| ETODOLAC | ChEMBL | Phase 4 (approved) | PTGS1 |
| ETORICOXIB | ChEMBL | Phase 4 (approved) | PTGS1 |
| ETRAVIRINE | ChEMBL | Phase 4 (approved) | PTGS1 |
| EZETIMIBE | ChEMBL | Phase 4 (approved) | PTGS1 |
| FELBINAC | ChEMBL | Phase 4 (approved) | PTGS1 |
| FENOTEROL | ChEMBL | Phase 4 (approved) | PTGS1 |
| FEPRAZONE | ChEMBL | Phase 4 (approved) | PTGS1 |
| FLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1 |
| FLUTICASONE FUROATE | ChEMBL | Phase 4 (approved) | PTGS1 |
| GENTIAN VIOLET | ChEMBL | Phase 4 (approved) | PTGS1 |
| GLAFENINE | ChEMBL | Phase 4 (approved) | PTGS1 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | PTGS1 |
| HEXESTROL | ChEMBL | Phase 4 (approved) | PTGS1 |
| HYDRALAZINE | ChEMBL | Phase 4 (approved) | PTGS1 |
| IBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1 |
| IDELALISIB | ChEMBL | Phase 4 (approved) | PTGS1 |
| INDIGOTINDISULFONATE | ChEMBL | Phase 4 (approved) | PTGS1 |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| ISOTRETINOIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| KETOROLAC | ChEMBL | Phase 4 (approved) | PTGS1 |
| LATANOPROSTENE BUNOD | ChEMBL | Phase 4 (approved) | PTGS1 |
| LEVALLORPHAN | ChEMBL | Phase 4 (approved) | PTGS1 |
| LEVODOPA | ChEMBL | Phase 4 (approved) | PTGS1 |
| LEVOMEPROMAZINE | ChEMBL | Phase 4 (approved) | PTGS1 |
| LINEZOLID | ChEMBL | Phase 4 (approved) | PTGS1 |
| LOMITAPIDE | ChEMBL | Phase 4 (approved) | PTGS1 |
| LOXOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1 |
| LUMIRACOXIB | ChEMBL | Phase 4 (approved) | PTGS1 |
| LUSUTROMBOPAG | ChEMBL | Phase 4 (approved) | PTGS1 |
| MECLOFENAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1 |
| MEFENAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1 |
| MELOXICAM | ChEMBL | Phase 4 (approved) | PTGS1 |
| MELPHALAN | ChEMBL | Phase 4 (approved) | PTGS1 |
| MEPAZINE | ChEMBL | Phase 4 (approved) | PTGS1 |
| MERCAPTOPURINE | ChEMBL | Phase 4 (approved) | PTGS1 |
| METAMIZOLE | ChEMBL | Phase 4 (approved) | PTGS1 |
| METHICILLIN | ChEMBL | Phase 4 (approved) | PTGS1 |
| METHIMAZOLE | ChEMBL | Phase 4 (approved) | PTGS1 |
Related Atlas pages
- Genes: PTGS1, SLC5A8
- Indicated for: rheumatic disorder
- Drugs: Ketoprofen, 2-MERCAPTOETHANESULFONIC ACID, 3,3’,4’,5-TETRACHLOROSALICYLANILIDE, Acarbose, Acemetacin, Acetohydroxamic Acid, Alitretinoin, Amdinocillin, Aripiprazole, Ascorbic Acid, Aspirin, Avatrombopag, Belinostat, Bendamustine, Benziodarone, Beta Carotene, Brigatinib, Bromfenac, Bromocriptine, Capsaicin, Captopril, Carbaril, Carprofen, Caspofungin, Cefpodoxime Proxetil, Celecoxib, Cephaloglycin, Cephaloridine, Chlorprothixene, Cholecalciferol, Cianidanol, Clomiphene, Colistin, Cycloserine, Cysteine, Dactinomycin, Delamanid, Dequalinium, Desloratadine, Desmopressin, Desogestrel, Dexibuprofen, Dexpanthenol, Dexrazoxane, Diclofenac, Diethylstilbestrol, Dirithromycin, Dopamine, Doxorubicin, Droxidopa, Edaravone, Eliglustat, Enasidenib, Epirubicin, Ergocalciferol, Erlotinib, Ertapenem, Esflurbiprofen, Estradiol Cypionate, Estradiol Valerate, Estriol, Etodolac, Etoricoxib, Etravirine, Ezetimibe, Felbinac, Fenoterol, Feprazone, Flurbiprofen, Fluticasone Furoate, Glafenine, Hexachlorophene, Hexestrol, Hydralazine, Ibuprofen, Idelalisib, Indomethacin, Isotretinoin, Ketorolac, Latanoprostene Bunod, Levallorphan, Levodopa, Levomepromazine, Linezolid, Lomitapide, Loxoprofen, Lumiracoxib, Lusutrombopag, Meclofenamic Acid, Mefenamic Acid, Meloxicam, Melphalan, Mepazine, Mercaptopurine, Metamizole, Methicillin, Methimazole