Fluoxetine
drugOn this page
Also known as Fluoxetin ratiopharmFluoxetinaFluvalNSC-283480NSC-758685SymbyaxFluxetine(+/-)-FluoxetineSID26751973SID26755310SID90341619SID104171153SID50104648SID144203695SID170465374MMV001561FLUOXETINE HYDROCHLORIDEC0237422rac-Fluoxetine
Summary
Fluoxetine (CHEMBL41) is an approved small molecule (ATC N06AB03) targeting SLC29A4, HTR6, and KCNJ6; indicated across 38 conditions including stroke disorder and fibromyalgia.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N06AB03
- Targets: 9 (SLC29A4, HTR6, KCNJ6…)
- Indications: 38 conditions
- Clinical trials: 204
- Chemistry: 309.33 Da · C17H18F3NO
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL41 |
| Name | Fluoxetine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 3386 |
| ChEBI | CHEBI:86990 |
| ATC | N06AB03 |
| Molecular formula | C17H18F3NO |
| Molecular weight | 309.33 |
| InChIKey | RTHCYVBBDHJXIQ-UHFFFAOYSA-N |
SMILES: CNCCC(C1=CC=CC=C1)OC2=CC=C(C=C2)C(F)(F)F
IUPAC name: N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine
ChEBI definition: An aromatic ether consisting of 4-trifluoromethylphenol in which the hydrogen of the phenolic hydroxy group is replaced by a 3-(methylamino)-1-phenylpropyl group.
Also known as: Fluoxetin ratiopharm, Fluoxetina, Fluoxetine, Fluval, NSC-283480, NSC-758685, Symbyax, fluoxetine, Fluxetine, (+/-)-Fluoxetine, SID26751973, SID26755310
Parent form; salt/anhydrous children: CHEMBL1201082
Patent coverage: 17,245 distinct patent families (62,368 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SLC29A4 | Plasma membrane monoamine transporter | Inhibition | 4.64 | 0.7% | Q7RTT9 |
| HTR6 | 5-HT6 receptor | Antagonist | 5.8 | 0.2% | P50406 |
| KCNJ6 | Kir3.2 | Antagonist | 4.8 | 0.1% | P48051 |
| KCNC1 | Kv3.1 | 6.1 | 1.7% | P48547 | |
| HTR2A | 5-HT2A receptor | Antagonist | 6.5 | 0% | P28223 |
| ANO1 | CaCC | Inhibition | 1.2% | Q5XXA6 | |
| HTR2B | 5-HT2B receptor | Antagonist | 5.3 | 0.4% | P41595 |
| HTR2C | 5-HT2C receptor | Antagonist | 7.3 | 0% | P28335 |
| SLC6A4 | SERT | Inhibition | 8.5 | 0.7% | P31645 |
Broader ChEMBL bioactivity targets: 51 (assay-derived). Sample: Prelamin-A/C, NPC intracellular cholesterol transporter 1, Ras-related protein Rab-9A, 5-hydroxytryptamine receptor 2B, Alpha-2A adrenergic receptor, Adrenergic receptor alpha-1, Voltage-dependent L-type calcium channel subunit alpha-1C, Histamine H2 receptor, Alpha-2B adrenergic receptor, Muscarinic acetylcholine receptor M5.
Bioactivity
ChEMBL activities: 193 potent at pChembl ≥ 5 of 215 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| SLC6A4 | 9.57 | Ki | 0.27 | nM | CHEMBL_ACT_7667829 |
| SLC6A4 | 9.29 | IC50 | 0.51 | nM | CHEMBL_ACT_7667828 |
| SLC6A4 | 9.14 | Ki | 0.72 | nM | CHEMBL_ACT_1608913 |
| SLC6A4 | 9.09 | Kd | 0.81 | nM | CHEMBL_ACT_146151 |
| SLC6A4 | 8.96 | Ki | 1.1 | nM | CHEMBL_ACT_2263570 |
| SLC6A4 | 8.96 | Ki | 1.1 | nM | CHEMBL_ACT_2607121 |
| SLC6A4 | 8.85 | Ki | 1.4 | nM | CHEMBL_ACT_13340278 |
| SLC6A4 | 8.7 | Ki | 2 | nM | CHEMBL_ACT_1953185 |
| SLC6A4 | 8.66 | Ki | 2.2 | nM | CHEMBL_ACT_1978198 |
| SLC6A4 | 8.66 | Ki | 2.2 | nM | CHEMBL_ACT_2015321 |
| SLC6A4 | 8.66 | Ki | 2.2 | nM | CHEMBL_ACT_2023010 |
| SLC6A4 | 8.6 | IC50 | 2.5 | nM | CHEMBL_ACT_3106196 |
| SLC6A4 | 8.57 | EC50 | 2.7 | nM | CHEMBL_ACT_10836341 |
| P31652 | 8.57 | Ki | 2.7 | nM | CHEMBL_ACT_2452759 |
| P31652 | 8.57 | Ki | 2.7 | nM | CHEMBL_ACT_2678801 |
| P31652 | 8.56 | Ki | 2.72 | nM | CHEMBL_ACT_1156877 |
| P31652 | 8.55 | Ki | 2.8 | nM | CHEMBL_ACT_1953184 |
| P31652 | 8.54 | Ki | 2.9 | nM | CHEMBL_ACT_1978188 |
| P31652 | 8.54 | Ki | 2.9 | nM | CHEMBL_ACT_2015290 |
| P31652 | 8.54 | Ki | 2.9 | nM | CHEMBL_ACT_2022986 |
| SLC6A4 | 8.51 | IC50 | 3.1 | nM | CHEMBL_ACT_3414443 |
| SLC6A4 | 8.5 | Ki | 3.17 | nM | CHEMBL_ACT_192904 |
| SLC6A4 | 8.46 | Ki | 3.5 | nM | CHEMBL_ACT_447986 |
| SLC6A4 | 8.45 | IC50 | 3.58 | nM | CHEMBL_ACT_17702487 |
| SLC6A4 | 8.45 | IC50 | 3.58 | nM | CHEMBL_ACT_22850858 |
| P31652 | 8.41 | Ki | 3.9 | nM | CHEMBL_ACT_1736431 |
| P31652 | 8.41 | Ki | 3.9 | nM | CHEMBL_ACT_2470774 |
| SLC6A4 | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_20634537 |
| SLC6A4 | 8.3 | IC50 | 5.01 | nM | CHEMBL_ACT_5238547 |
| SLC6A4 | 8.3 | IC50 | 5.01 | nM | CHEMBL_ACT_6305167 |
Target pathways
Aggregated over 9 target gene(s): SLC29A4, HTR6, KCNJ6, KCNC1, HTR2A, ANO1, HTR2B, HTR2C, SLC6A4.
Top Reactome pathways
37 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 4 | HTR2A, HTR2B, HTR2C, HTR6 |
| Signaling by GPCR | 4 | HTR2A, HTR2B, HTR2C, HTR6 |
| Class A/1 (Rhodopsin-like receptors) | 4 | HTR2A, HTR2B, HTR2C, HTR6 |
| Amine ligand-binding receptors | 4 | HTR2A, HTR2B, HTR2C, HTR6 |
| GPCR downstream signalling | 4 | HTR2A, HTR2B, HTR2C, HTR6 |
| Serotonin receptors | 4 | HTR2A, HTR2B, HTR2C, HTR6 |
| GPCR ligand binding | 4 | HTR2A, HTR2B, HTR2C, HTR6 |
| Neuronal System | 3 | KCNC1, KCNJ6, SLC6A4 |
| G alpha (q) signalling events | 3 | HTR2A, HTR2B, HTR2C |
| Transmission across Chemical Synapses | 2 | KCNJ6, SLC6A4 |
| Potassium Channels | 2 | KCNC1, KCNJ6 |
| Transport of small molecules | 2 | ANO1, SLC29A4 |
| Neurotransmitter clearance | 1 | SLC6A4 |
| Neurotransmitter receptors and postsynaptic signal transmission | 1 | KCNJ6 |
| Activation of G protein gated Potassium channels | 1 | KCNJ6 |
| G protein gated Potassium channels | 1 | KCNJ6 |
| Inwardly rectifying K+ channels | 1 | KCNJ6 |
| Voltage gated Potassium channels | 1 | KCNC1 |
| Disease | 1 | ANO1 |
| Stimuli-sensing channels | 1 | ANO1 |
| Serotonin clearance from the synaptic cleft | 1 | SLC6A4 |
| G alpha (s) signalling events | 1 | HTR6 |
| Transport of vitamins, nucleosides, and related molecules | 1 | SLC29A4 |
| SLC-mediated transmembrane transport | 1 | SLC29A4 |
| SLC-mediated transport of neurotransmitters | 1 | SLC6A4 |
| Infectious disease | 1 | ANO1 |
| Transport of nucleosides and free purine and pyrimidine bases across the plasma membrane | 1 | SLC29A4 |
| SARS-CoV Infections | 1 | ANO1 |
| SARS-CoV-2 Infection | 1 | ANO1 |
| Induction of Cell-Cell Fusion | 1 | ANO1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 4 |
| chemical synaptic transmission | 4 |
| signal transduction | 4 |
| G protein-coupled receptor signaling pathway | 4 |
| G protein-coupled serotonin receptor signaling pathway | 4 |
| monoatomic ion transport | 3 |
| monoatomic ion transmembrane transport | 3 |
| intracellular calcium ion homeostasis | 3 |
| phospholipase C-activating serotonin receptor signaling pathway | 3 |
| serotonin receptor signaling pathway | 3 |
| response to xenobiotic stimulus | 3 |
| positive regulation of phosphatidylinositol biosynthetic process | 3 |
| release of sequestered calcium ion into cytosol | 3 |
| positive regulation of ERK1 and ERK2 cascade | 3 |
| neurotransmitter transport | 2 |
Indications & clinical
Indications
38 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| stroke disorder | 3 | MONDO:0005098 | EFO:0000712 |
| fibromyalgia | 3 | MONDO:0005546 | EFO:0005687 |
| autism | 3 | MONDO:0005260 | EFO:0003758 |
| obsessive-compulsive disorder | 3 | MONDO:0008114 | EFO:0004242 |
| post-traumatic stress disorder | 3 | MONDO:0005146 | EFO:0001358 |
| intracerebral hemorrhage | 3 | MONDO:0013792 | EFO:0005669 |
| nicotine dependence | 3 | MONDO:0008575 | EFO:0003768 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| social phobia | 3 | MONDO:0001247 | EFO:1001917 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| major depressive disorder | 3 | MONDO:0002009 | MONDO:0002009 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | MONDO:0100096 |
| enuresis | 3 | MONDO:0024290 | MONDO:0024290 |
| influenza | 3 | MONDO:0005812 | EFO:0007328 |
| bipolar disorder | 3 | MONDO:0004985 | MONDO:0004985 |
| anxiety disorder | 3 | MONDO:0005618 | EFO:0006788 |
| gastroesophageal reflux disease | 2 | MONDO:0007186 | EFO:0003948 |
| pulmonary arterial hypertension | 2 | MONDO:0015924 | EFO:0001361 |
| epilepsy | 2 | MONDO:0005027 | EFO:0000474 |
| multiple system atrophy | 2 | MONDO:0007803 | EFO:1001050 |
| obesity disorder | 2 | MONDO:0011122 | EFO:0001073 |
| cocaine dependence | 2 | MONDO:0005186 | EFO:0002610 |
| panic disorder | 2 | MONDO:0005383 | EFO:0004262 |
| cannabis dependence | 2 | MONDO:0005689 | EFO:0007191 |
| secondary progressive multiple sclerosis | 2 | MONDO:0000450 | EFO:0008522 |
| sciatica | 2 | MONDO:0024333 | HP:0011868 |
| dysthymic disorder | 1 | MONDO:0001442 | EFO:0008623 |
| colorectal adenocarcinoma | 1 | MONDO:0005008 | EFO:0000365 |
| injury | 0 | MONDO:0021178 | EFO:0000546 |
| type 1 diabetes mellitus | 0 | MONDO:0005147 | MONDO:0005147 |
| brain cancer | 0 | MONDO:0001657 | MONDO:0021632 |
6 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 204.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 54 |
| PHASE4 | 48 |
| PHASE3 | 38 |
| PHASE2 | 35 |
| PHASE1 | 11 |
| PHASE1/PHASE2 | 8 |
| EARLY_PHASE1 | 6 |
| PHASE2/PHASE3 | 4 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05976347 | PHASE4 | RECRUITING | Identifying and Treating Depression in the Orthopaedic Trauma Population |
| NCT06046859 | PHASE4 | RECRUITING | Can Immediate Post-injury Fluoxetine Improve the Recovery Trajectories of Victims in Bodily Trauma? |
| NCT07110831 | PHASE4 | NOT_YET_RECRUITING | Disposition Kinetics of Dolutegravir Among People Living With HIV With Major Depression in Nigeria |
| NCT07478796 | PHASE4 | RECRUITING | TDM-Guided Treatment With SSRIs in Hospitalized Adults and Children |
| NCT00000373 | PHASE4 | COMPLETED | Treatment of Obsessive-Compulsive Disorder |
| NCT00006204 | PHASE4 | COMPLETED | Drug Treatment for Depressed Alcoholics (Naltrexone/Fluoxetine) |
| NCT00044616 | PHASE4 | COMPLETED | Relapse Prevention for Bipolar Type-II Disorder |
| NCT00061113 | PHASE4 | COMPLETED | Substance Dependent Teens - Impact of Treating Depression Study 1 - 1 |
| NCT00188942 | PHASE4 | COMPLETED | A Neuroimaging Investigation of Brain Activity in Major Depressive Disorder and Bipolar Disorder |
| NCT00191399 | PHASE4 | COMPLETED | Bipolar Depression Study: Bipolar Depression Assessment Study on Treatment Response |
| NCT00245635 | PHASE4 | COMPLETED | Fluoxetine in Pediatric Body Dysmorphic Disorder |
| NCT00247624 | PHASE4 | COMPLETED | Improving Sleep and Psychological Functioning in People With Depression and Insomnia |
| NCT00288574 | PHASE4 | COMPLETED | Fluoxetine to Prevent Relapse and Enhance Psychological Recovery in Women With Anorexia Nervosa |
| NCT00427128 | PHASE4 | COMPLETED | Prozac Treatment of Major Depression: Discontinuation Study |
| NCT00449007 | PHASE4 | TERMINATED | Fluoxetine and Bupropion to Treat Patients With Depression and Alcoholism |
| NCT00485771 | PHASE4 | COMPLETED | Olanzapine/Fluoxetine Combination Versus Comparator in the Treatment of Bipolar I Depression |
| NCT00533117 | PHASE4 | COMPLETED | Treating Suicidal Behavior and Self-Mutilation in People With Borderline Personality Disorder |
| NCT00557427 | PHASE4 | TERMINATED | Hypericum vs Fluoxetine for Mild to Moderate Adolescent Depression |
| NCT00573547 | PHASE4 | WITHDRAWN | Open Label Trial of Fluoxetine for the Treatment of Depression in Patients With End Stage Renal Disease |
| NCT00592852 | PHASE4 | TERMINATED | Fluoxetine for Obsessive-Compulsive Disorder in Children and Adolescents With Bipolar Disorder |
| NCT00611975 | PHASE4 | COMPLETED | Effect of Antidepressants on Sex Hormone Levels and Sexual Functioning |
| NCT00633685 | PHASE4 | UNKNOWN | Predictors of Treatment Response to Fluoxetine in PTSD Following a Recent History of War Zone Stress Exposure |
| NCT00666757 | PHASE4 | COMPLETED | A Study Comparing Duloxetine to Other Antidepressants in the Treatment of Severe Depression |
| NCT00678574 | PHASE4 | COMPLETED | The Role of GABA and Neurosteroids in Premenstrual Dysphoric Disorder |
| NCT00806234 | PHASE4 | COMPLETED | Reducing Weight Gain and Improving Metabolic Function in Children Being Treated With Antipsychotics |
| NCT00834834 | PHASE4 | COMPLETED | Comparing Treatments for Self-Injury and Suicidal Behavior in People With Borderline Personality Disorder |
| NCT00961961 | PHASE4 | COMPLETED | Prevention of Relapse & Recurrence of Bipolar Depression |
| NCT01075529 | PHASE4 | COMPLETED | Early Prediction of Fluoxetine Response |
| NCT01185977 | PHASE4 | COMPLETED | Biomarkers of Antidepressant Treatment in Adolescents With Major Depression (The Adolescents MDD Study) |
| NCT01204086 | PHASE4 | UNKNOWN | Pharmacogenomics Studies of Antidepressants |
| NCT01360190 | PHASE4 | COMPLETED | Neurophysiologic Monitoring of Antidepressant Treatment |
| NCT01436643 | PHASE4 | TERMINATED | Combination of Antidepressants and Fingolimod Relapsing-remitting Multiple Sclerosis (RRMS) Patients With Depression |
| NCT01699490 | PHASE4 | UNKNOWN | Role of Inflammation Factors and Insulin Resistance in Major Depressive Disorder |
| NCT01764867 | PHASE4 | UNKNOWN | Algorithm Guided Treatment Strategies for Major Depressive Disorder |
| NCT01824433 | PHASE4 | COMPLETED | Comparison of Venlafaxine and Fluoxetine in the Treatment of Postmenopausal Women With Major Depression |
| NCT02022709 | PHASE4 | COMPLETED | Efficacy of Exposure and Response Prevention(ERP) and SSRIs in Chinese OCD Patients |
| NCT02238977 | PHASE4 | TERMINATED | Bupropion for Depression in ESRD Patients on Hemodialysis |
| NCT02357849 | PHASE4 | TERMINATED | Fluoxetine vs Aripiprazole Comparative Trial (FACT) |
| NCT02389712 | PHASE4 | TERMINATED | 16-week Comparative Effectiveness Trial of Lamotrigine vs. Fluoxetine for Bipolar Depression |
| NCT02473250 | PHASE4 | COMPLETED | Prediction of Clinical Response to SSRI Treatment in Bipolar Disorder Using Serotonin 1A Receptor PET Imaging |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (4) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of DPWG Guideline for fluoxetine and CYP2D6 | DPWG | CYP2D6 | ||
| Annotation of CPIC Guideline for fluoxetine and CYP2D6 | CPIC | CYP2D6 | ||
| Annotation of CPIC Guideline for desvenlafaxine, duloxetine, fluoxetin | CPIC | HTR2A | ||
| Annotation of CPIC Guideline for citalopram, desvenlafaxine, duloxetin | CPIC | SLC6A4 |
PharmGKB also curates 27 clinical and 197 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
739 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Desipramine | ChEMBL + PubChem | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, SLC29A4, SLC6A4 |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| NITAZOXANIDE | ChEMBL + PubChem | Phase 4 (approved) | ANO1, HTR2A, HTR2B, HTR2C, SLC6A4 |
| Verapamil | ChEMBL + PubChem | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, SLC29A4, SLC6A4 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| CINACALCET | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| DESLORATADINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| DIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| DOXEPIN | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| EBASTINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| ILOPERIDONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| IMIPRAMINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| KETANSERIN | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| LOXAPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| MEPAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| METHAPYRILENE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| MIANSERIN | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| MICONAZOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| NORTRIPTYLINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| OLANZAPINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| ORPHENADRINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| PIPAMAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| PROCHLORPERAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| PROMAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| PROMETHAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| PROPAFENONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| PROPRANOLOL | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| RALOXIFENE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| RISPERIDONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| TEGASEROD | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| TERFENADINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| THIORIDAZINE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| ZIPRASIDONE | ChEMBL | Phase 4 (approved) | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
| ENCLOMIPHENE | ChEMBL | Phase 3 | HTR2A, HTR2B, HTR2C, HTR6, SLC6A4 |
Related Atlas pages
- Genes: SLC29A4, HTR6, KCNJ6, KCNC1, HTR2A, ANO1, HTR2B, HTR2C, SLC6A4
- Diseases: stroke disorder, fibromyalgia, autism, obsessive-compulsive disorder, post-traumatic stress disorder, intracerebral hemorrhage, nicotine dependence, anxiety, social phobia, dementia, major depressive disorder, depressive disorder, severe acute respiratory syndrome, enuresis, influenza, bipolar disorder, anxiety disorder
- Drugs: Desipramine, Dihydroergotamine, Nitazoxanide, Verapamil, Amiodarone, Amitriptyline, Amoxapine, Aripiprazole, Asenapine, Astemizole, Azelastine, Benztropine, Brexpiprazole, Cariprazine, Carvedilol, Chlorpromazine, Cinacalcet, Clemastine, Clomipramine, Clotrimazole, Clozapine, Cyproheptadine, Desloratadine, Diethylstilbestrol, Diphenhydramine, Doxepin, Ebastine, Econazole, Fluphenazine, Fluspirilene, Haloperidol, Iloperidone, Imipramine, Ketanserin, Loxapine, Mepazine, Methapyrilene, Mianserin, Miconazole, Nefazodone, Nortriptyline, Olanzapine, Orphenadrine, Pimozide, Pipamazine, Prochlorperazine, Promazine, Promethazine, Propafenone, Propranolol, Raloxifene, Risperidone, Sertindole, Sunitinib, Tamoxifen, Tegaserod, Terfenadine, Thioridazine, Ziprasidone, Enclomiphene