Furosemide
drugOn this page
Also known as Aluzine 20Aluzine 40Aluzine 500AquamedDiuresalDryptalFroopFrumaxFrumilFrusemideFruseticFrusidFrusolFuroscixFurosemidaFurosemidumHydroledLasixLasix ret
Summary
Furosemide (CHEMBL35) is an approved small-molecule loop diuretic (ATC C03CA01) targeting GPR35, GABRA6, and SLC12A1; indicated across 43 conditions including congestive heart failure and heart failure.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C03CA01
- Targets: 4 (GPR35, GABRA6, SLC12A1…)
- Indications: 43 conditions
- Clinical trials: 207
- Chemistry: 330.74 Da · C12H11ClN2O5S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL35 |
| Name | Furosemide |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 3440 |
| ChEBI | CHEBI:47426 |
| ATC | C03CA01 |
| Molecular formula | C12H11ClN2O5S |
| Molecular weight | 330.74 |
| InChIKey | ZZUFCTLCJUWOSV-UHFFFAOYSA-N |
SMILES: C1=COC(=C1)CNC2=CC(=C(C=C2C(=O)O)S(=O)(=O)N)Cl
IUPAC name: 4-chloro-2-(furan-2-ylmethylamino)-5-sulfamoylbenzoic acid
ChEBI definition: A chlorobenzoic acid that is 4-chlorobenzoic acid substituted by a (furan-2-ylmethyl)amino and a sulfamoyl group at position 2 and 5 respectively. It is a diuretic used in the treatment of congestive heart failure.
Pharmacological roles (ChEBI): loop diuretic.
Other ChEBI roles (chemical / environmental): xenobiotic, environmental contaminant.
Also known as: Aluzine 20, Aluzine 40, Aluzine 500, Aquamed, Diuresal, Dryptal, Froop, Frumax, Frumil, Frusemide, Frusetic, Frusid
Parent form; salt/anhydrous children: CHEMBL1788133
Patent coverage: 126,181 distinct patent families (224,045 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 223,890 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| GPR35 | GPR35 | Agonist | 5.63 | 0.2% | Q9HC97 |
| GABRA6 | GABAA receptor α6 subunit | Antagonist | 0.1% | Q16445 | |
| SLC12A1 | Kidney-specific Na-K-Cl symporter | Inhibition | 5.15 | 0.6% | Q13621 |
| SLC12A2 | Basolateral Na-K-Cl symporter | Inhibition | 5.13 | 0.1% | P55011 |
Broader ChEMBL bioactivity targets: 24 (assay-derived). Sample: G-protein coupled receptor 35, Solute carrier family 22 member 6, CDGSH iron-sulfur domain-containing protein 1, Carbonic anhydrase 2, Solute carrier organic anion transporter family member 2A1, 5-hydroxytryptamine receptor 1A, Carbonic anhydrase 13, Carbonic anhydrase 7, Carbonic anhydrase 1, Carbonic anhydrase 6.
Bioactivity
ChEMBL activities: 34 potent at pChembl ≥ 5 of 44 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| CA14 | 7.28 | Ki | 52 | nM | CHEMBL_ACT_2492029 |
| CA14 | 7.28 | Ki | 52 | nM | CHEMBL_ACT_29061803 |
| CA1 | 7.21 | Ki | 62 | nM | CHEMBL_ACT_2491952 |
| CA1 | 7.21 | Ki | 62 | nM | CHEMBL_ACT_29061767 |
| CA2 | 7.19 | Ki | 65 | nM | CHEMBL_ACT_2491959 |
| CA2 | 7.19 | Ki | 65 | nM | CHEMBL_ACT_29061770 |
| CA1 | 7.1 | IC50 | 80 | nM | CHEMBL_ACT_27123884 |
| CA6 | 6.84 | Ki | 143 | nM | CHEMBL_ACT_29061788 |
| CA6 | 6.64 | Ki | 230 | nM | CHEMBL_ACT_29061785 |
| CA6 | 6.61 | Ki | 245 | nM | CHEMBL_ACT_2491994 |
| CA12 | 6.58 | Ki | 261 | nM | CHEMBL_ACT_2492015 |
| CA12 | 6.58 | Ki | 261 | nM | CHEMBL_ACT_29061797 |
| CA5B | 6.49 | Ki | 322 | nM | CHEMBL_ACT_2491987 |
| CA5B | 6.49 | Ki | 322 | nM | CHEMBL_ACT_29061782 |
| CA9 | 6.38 | Ki | 420 | nM | CHEMBL_ACT_2492008 |
| CA9 | 6.38 | Ki | 420 | nM | CHEMBL_ACT_29061794 |
| CA5A | 6.3 | Ki | 499 | nM | CHEMBL_ACT_2491980 |
| CA5A | 6.3 | Ki | 499 | nM | CHEMBL_ACT_29061779 |
| CA7 | 6.29 | Ki | 513 | nM | CHEMBL_ACT_2492001 |
| CA7 | 6.29 | Ki | 513 | nM | CHEMBL_ACT_29061791 |
| Q9D6N1 | 6.26 | Ki | 550 | nM | CHEMBL_ACT_2492022 |
| Q9D6N1 | 6.26 | Ki | 550 | nM | CHEMBL_ACT_29061800 |
| CA4 | 6.25 | Ki | 564 | nM | CHEMBL_ACT_2491973 |
| CA4 | 6.25 | Ki | 564 | nM | CHEMBL_ACT_29061776 |
| CA2 | 6.2 | Kd | 630 | nM | CHEMBL_ACT_26047528 |
| CISD1 | 5.64 | Ki | 2285 | nM | CHEMBL_ACT_16766167 |
| ABCG2 | 5.5 | IC50 | 3200 | nM | CHEMBL_ACT_24777398 |
| CA2 | 5.5 | Kd | 3140 | nM | CHEMBL_ACT_26047539 |
| GPR35 | 5.49 | Ki | 3270 | nM | CHEMBL_ACT_13445742 |
| HSD11B1 | 5.42 | IC50 | 3760 | nM | CHEMBL_ACT_2521192 |
Target pathways
Aggregated over 4 target gene(s): GPR35, GABRA6, SLC12A1, SLC12A2.
Top Reactome pathways
10 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Transport of small molecules | 2 | SLC12A1, SLC12A2 |
| R-HSA-425393 | 2 | SLC12A1, SLC12A2 |
| SLC-mediated transmembrane transport | 2 | SLC12A1, SLC12A2 |
| Cation-coupled Chloride cotransporters | 2 | SLC12A1, SLC12A2 |
| Disease | 1 | SLC12A1 |
| Class A/1 (Rhodopsin-like receptors) | 1 | GPR35 |
| SLC transporter disorders | 1 | SLC12A1 |
| Defective SLC12A1 causes Bartter syndrome 1 (BS1) | 1 | SLC12A1 |
| Disorders of transmembrane transporters | 1 | SLC12A1 |
| GABA receptor activation | 1 | GABRA6 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| chloride transmembrane transport | 3 |
| monoatomic ion transport | 3 |
| signal transduction | 2 |
| gamma-aminobutyric acid signaling pathway | 2 |
| chloride transport | 2 |
| monoatomic ion transmembrane transport | 2 |
| cell volume homeostasis | 2 |
| sodium ion transmembrane transport | 2 |
| chloride ion homeostasis | 2 |
| potassium ion homeostasis | 2 |
| sodium ion homeostasis | 2 |
| transepithelial ammonium transport | 2 |
| potassium ion import across plasma membrane | 2 |
| potassium ion transport | 2 |
| sodium ion transport | 2 |
Indications & clinical
Indications
43 indications (8 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| congestive heart failure | 4 | MONDO:0005009 | EFO:0000373 |
| heart failure | 4 | MONDO:0005252 | EFO:0003144 |
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| hypertensive disorder | 4 | MONDO:0005044 | EFO:0000537 |
| nephrotic syndrome | 4 | MONDO:0005377 | EFO:0004255 |
| cirrhosis of liver | 4 | MONDO:0005155 | EFO:0001422 |
| pulmonary edema | 4 | MONDO:0006932 | EFO:1001134 |
| syndromic disease | 4 | MONDO:0002254 | MONDO:0002254 |
| lung disorder | 3 | MONDO:0005275 | EFO:0003818 |
| pulmonary embolism | 3 | MONDO:0005279 | EFO:0003827 |
| bronchiolitis | 3 | MONDO:0002465 | HP:0011950 |
| kidney disorder | 3 | MONDO:0005240 | EFO:0003086 |
| kidney failure | 3 | MONDO:0001106 | EFO:1002048 |
| atherosclerosis | 3 | MONDO:0005311 | EFO:0003914 |
| preeclampsia | 3 | MONDO:0005081 | EFO:0000668 |
| coronary artery disorder | 3 | MONDO:0005010 | EFO:0001645 |
| common wart | 3 | MONDO:0001209 | EFO:0009662 |
| acute myocardial infarction | 3 | MONDO:0004781 | EFO:0008583 |
| essential hypertension | 3 | MONDO:0001134 | MONDO:0001134 |
| type 2 diabetes mellitus | 3 | MONDO:0005148 | MONDO:0005148 |
| chronic obstructive pulmonary disease | 3 | MONDO:0005002 | EFO:0000341 |
| nephrolithiasis | 3 | MONDO:0008171 | EFO:0004253 |
| acute kidney injury | 2 | MONDO:0002492 | HP:0001919 |
| acute lung injury | 2 | MONDO:0015796 | EFO:0004610 |
| nasal cavity polyp | 2 | MONDO:0006314 | EFO:1000391 |
| actinic keratosis | 2 | MONDO:0005173 | EFO:0002496 |
| hypertension, pregnancy-induced | 2 | MONDO:0024664 | MONDO:0024664 |
| chronic kidney disease | 2 | MONDO:0005300 | EFO:0003884 |
| bronchopulmonary dysplasia | 2 | MONDO:0019091 | MONDO:0019091 |
| neoplasm | 2 | MONDO:0005070 | MONDO:0004992 |
| prostate adenocarcinoma | 2 | MONDO:0005082 | EFO:0000673 |
| metabolic dysfunction-associated steatotic liver disease | 2 | MONDO:0013209 | EFO:0003095 |
| acute myeloid leukemia | 1 | MONDO:0018874 | EFO:0000222 |
| diabetes mellitus | 1 | MONDO:0005015 | EFO:0000400 |
| leukemia | 1 | MONDO:0005059 | EFO:0000565 |
| metastatic melanoma | 1 | MONDO:0005191 | EFO:0002617 |
| sickle cell disease | 1 | MONDO:0011382 | MONDO:0011382 |
6 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 207.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 51 |
| PHASE4 | 50 |
| PHASE3 | 34 |
| PHASE1 | 33 |
| PHASE2 | 20 |
| EARLY_PHASE1 | 7 |
| PHASE2/PHASE3 | 6 |
| PHASE1/PHASE2 | 6 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04180397 | PHASE4 | RECRUITING | Controlled Fluid Removal in Critical Ill Patients With Fluid Overload in the Intensive Care Unit. |
| NCT05276219 | PHASE4 | RECRUITING | Optimized Treatment of Pulmonary Edema or Congestion |
| NCT06094816 | PHASE4 | RECRUITING | Forebrain Electroneutral Transporters in Salt-sensitive Hypertension: an MRI Study |
| NCT06218199 | PHASE4 | RECRUITING | Diuretics vs. Afterload Reduction for Treatment of HeartLogic Alerts |
| NCT06229990 | PHASE4 | RECRUITING | A Protocol Based-Furosemide Stress Test to Evaluate Renal Recovery During Continuous Renal Replacement Therapy |
| NCT06442280 | PHASE4 | NOT_YET_RECRUITING | SGLT-2 Inhibitor and High-Dose Furosemide Plus Small-Volume Hypertonic Saline Solution in Acute HF |
| NCT06979726 | PHASE4 | RECRUITING | Gator SCALES-WHF: SubCutaneous Administration of Lasix to Eliminate Symptoms of Worsening Heart Failure |
| NCT07167862 | PHASE4 | NOT_YET_RECRUITING | Optimizing Preeclampsia Postpartum With Point-of-care Ultrasound |
| NCT07263035 | PHASE4 | RECRUITING | Urine Sodium-Driven Diuretic Adjustment Strategy in Acute Decompensated Heart Failure |
| NCT00115726 | PHASE4 | COMPLETED | Trial Assessing the Effect of Preoperative Furosemide on Intraoperative Blood Pressure |
| NCT00306696 | PHASE4 | COMPLETED | Examining the Effect of Different Diuretics on Fluid Retention in Diabetics Treated With Rosiglitazone. |
| NCT00355667 | PHASE4 | COMPLETED | Comparison of Long- and Short-acting Diuretics in Congestive Heart Failure |
| NCT00409942 | PHASE4 | COMPLETED | Effect of a New Formulation of Torasemide (Prolonged Release)on Myocardial Fibrosis in Patients With Heart Failure. |
| NCT00421863 | PHASE4 | COMPLETED | Italian Study on the Cardiovascular Effects of Systolic Blood Pressure Control - CARDIOSIS Study |
| NCT00478543 | PHASE4 | COMPLETED | Loop Diuretics in Chronic Kidney Disease |
| NCT00535925 | PHASE4 | COMPLETED | Nephropathy In Type 2 Diabetes and Cardio-renal Events |
| NCT00652652 | PHASE4 | COMPLETED | Evaluation of Combined Action Between Natrecor and Furosemide on Kidney and Neurohormone Responses in Chronic Heart Failure: A Phase-IV study704.351 / DSS |
| NCT00663195 | PHASE4 | COMPLETED | Effects of Spironolactone on Matrix Metalloproteinases (MMPs) in Heart Failure |
| NCT00664222 | PHASE4 | COMPLETED | Spironolactone and Insulin Resistance in Chronic Heart Failure (CHF) |
| NCT00741663 | PHASE4 | COMPLETED | Spironolactone Versus Spironolactone Plus Furosemide (SVSSF) |
| NCT00937092 | PHASE4 | UNKNOWN | Dopamine in Acute Decompensated Heart Failure (DAD-HF) Trial |
| NCT01060293 | PHASE4 | TERMINATED | Dopamine in Acute Decompensated Heart Failure II |
| NCT01073189 | PHASE4 | WITHDRAWN | Intra-Renal Therapy of Diuretic Unresponsive Acute Kidney Injury |
| NCT01156220 | PHASE4 | WITHDRAWN | Investigation of Gender Specificity of the Effects of Furosemide in Healthy Female and Male Volunteers |
| NCT01419132 | PHASE4 | COMPLETED | Troponin I Release After High Diuretic Doses |
| NCT01441245 | PHASE4 | COMPLETED | Loop Diuretics Administration and Acute Heart Failure |
| NCT01815892 | PHASE4 | UNKNOWN | The Use of Furosemide in Patients on Dialysis |
| NCT01901809 | PHASE4 | COMPLETED | Diuretics and Dopamine in Heart Failure With Preserved Ejection Fraction |
| NCT01942109 | PHASE4 | UNKNOWN | The Impact of TORasemide oN hemodynAmic and Neurohormonal Stress, and carDiac remOdeling in Heart Failure |
| NCT01977430 | PHASE4 | UNKNOWN | Clinical Trial to Compare Effectiveness of Diuretics in Hemodialysis Patients With Residual Renal Function |
| NCT02163655 | PHASE4 | COMPLETED | Diuretics for Postpartum High Blood Pressure in Preeclampsia |
| NCT02183792 | PHASE4 | COMPLETED | Aquaresis Utility for Hyponatremic Acute Heart Failure Study |
| NCT02351934 | PHASE4 | COMPLETED | Early Diuresis Following Colorectal Surgery |
| NCT02427880 | PHASE4 | COMPLETED | Role of Acetazolamide and Hydrochlorothiazide Followed by Furosemide in Treating Nephrotic Edema |
| NCT02458157 | PHASE4 | TERMINATED | Forced Fluid Removal in High Risk Acute Kidney Injury |
| NCT02531581 | PHASE4 | COMPLETED | Diuretic Vascular Filling in the Initial Management of Acute PE With Right Ventricular Dysfunction Normotensive |
| NCT02767024 | PHASE4 | WITHDRAWN | Intravenous Vasodilator vs. Inotropic Therapy in Patients With Heart Failure |
| NCT02960412 | PHASE4 | COMPLETED | Effect of Furosemide on Confirmation of Ureteral Patency During Routine Cystoscopy |
| NCT03226457 | PHASE4 | COMPLETED | SGLT2 Inhibition in Combination With Diuretics in Heart Failure |
| NCT03731117 | PHASE4 | TERMINATED | FURosemide Stress Test to Predict Need of Renal Replacement THERapy in Ischemic Acute Tubular Necrosis in ICU |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 7 clinical and 17 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
51 molecules share ≥1 primary target. Top 51 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Bumetanide | ChEMBL + PubChem | Phase 4 (approved) | GPR35, SLC12A1, SLC12A2 |
| BAICALEIN | ChEMBL | Phase 2 | GABRA6, GPR35 |
| APALUTAMIDE | ChEMBL + PubChem | Phase 4 (approved) | GABRA6 |
| CLONAZEPAM | ChEMBL + PubChem | Phase 4 (approved) | GABRA6 |
| CROMOLYN | ChEMBL + PubChem | Phase 4 (approved) | GPR35 |
| DIAZEPAM | ChEMBL + PubChem | Phase 4 (approved) | GABRA6 |
| ENZALUTAMIDE | ChEMBL + PubChem | Phase 4 (approved) | GABRA6 |
| FLUMAZENIL | ChEMBL + PubChem | Phase 4 (approved) | GABRA6 |
| AMLEXANOX | ChEMBL | Phase 4 (approved) | GPR35 |
| APREPITANT | ChEMBL | Phase 4 (approved) | GPR35 |
| BREXANOLONE | ChEMBL | Phase 4 (approved) | GABRA6 |
| CINACALCET | ChEMBL | Phase 4 (approved) | GPR35 |
| DICUMAROL | ChEMBL | Phase 4 (approved) | GPR35 |
| EMETINE | ChEMBL | Phase 4 (approved) | GPR35 |
| ENTACAPONE | ChEMBL | Phase 4 (approved) | GPR35 |
| FLUOXETINE | ChEMBL | Phase 4 (approved) | GPR35 |
| GANAXOLONE | ChEMBL | Phase 4 (approved) | GABRA6 |
| LINDANE | ChEMBL | Phase 4 (approved) | GABRA6 |
| LIOTHYRONINE | ChEMBL | Phase 4 (approved) | GABRA6 |
| LODOXAMIDE | ChEMBL | Phase 4 (approved) | GPR35 |
| LOPERAMIDE | ChEMBL | Phase 4 (approved) | GPR35 |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | GPR35 |
| PERPHENAZINE | ChEMBL | Phase 4 (approved) | GPR35 |
| PIMAVANSERIN | ChEMBL | Phase 4 (approved) | GPR35 |
| PROPOFOL | ChEMBL | Phase 4 (approved) | GABRA6 |
| TOLCAPONE | ChEMBL | Phase 4 (approved) | GPR35 |
| VORAPAXAR | ChEMBL | Phase 4 (approved) | GPR35 |
| QUERCETIN | ChEMBL + PubChem | Phase 3 (approved) | GPR35 |
| 2,4-DINITROPHENOL | ChEMBL | Phase 2 | GPR35 |
| ABECARNIL | ChEMBL | Phase 2 | GABRA6 |
| BRETAZENIL | ChEMBL | Phase 2 | GABRA6 |
| BUFROLIN | ChEMBL | Phase 2 | GPR35 |
| BX 471 FREE BASE | ChEMBL | Phase 2 | GPR35 |
| DELORAZEPAM | ChEMBL | Phase 2 | GABRA6 |
| ELLAGIC ACID | ChEMBL | Phase 2 | GPR35 |
| FLAVONE | ChEMBL | Phase 2 | GABRA6 |
| FORETINIB | ChEMBL | Phase 2 | GPR35 |
| LUTEOLIN | ChEMBL | Phase 2 | GPR35 |
| NIFLUMIC ACID | ChEMBL | Phase 2 | GPR35 |
| NIGULDIPINE | ChEMBL | Phase 2 | GPR35 |
| NITECAPONE | ChEMBL | Phase 2 | GPR35 |
| PANADIPLON | ChEMBL | Phase 2 | GABRA6 |
| PROGABIDE | ChEMBL | Phase 2 | GABRA6 |
| ZAPRINAST | ChEMBL | Phase 2 | GPR35 |
| .gamma.-aminobutyric acid | PubChem | Approved | GABRA6 |
| alfaxalone | PubChem | Approved | GABRA6 |
| Caffeine | PubChem | Approved | GABRA6 |
| Ciprofloxacin | PubChem | Approved | GABRA6 |
| Fipronil | PubChem | Approved | GABRA6 |
| Phenytoin | PubChem | Approved | GABRA6 |
| valproate | PubChem | Approved | GABRA6 |
Related Atlas pages
- Genes: GPR35, GABRA6, SLC12A1, SLC12A2
- Diseases: congestive heart failure, heart failure, cardiovascular disorder, hypertensive disorder, nephrotic syndrome, cirrhosis of liver, pulmonary edema, syndromic disease, lung disorder, pulmonary embolism, bronchiolitis, kidney disorder, kidney failure, atherosclerosis, preeclampsia, coronary artery disorder, common wart, acute myocardial infarction, essential hypertension, type 2 diabetes mellitus, chronic obstructive pulmonary disease, nephrolithiasis
- Drugs: Bumetanide, Apalutamide, Clonazepam, Cromolyn, Diazepam, Enzalutamide, Flumazenil, Amlexanox, Aprepitant, Brexanolone, Cinacalcet, Dicumarol, Emetine, Entacapone, Fluoxetine, Ganaxolone, Lindane, Liothyronine, Lodoxamide, Loperamide, Nefazodone, Perphenazine, Pimavanserin, Propofol, Tolcapone, Vorapaxar, Quercetin, Caffeine, Ciprofloxacin, Phenytoin, valproate