Galeterone
drugOn this page
Also known as GaleteronaTOK 001TOK-001VN 124VN-124VN/124
Summary
Galeterone (CHEMBL2105738) is a phase-3 clinical-stage small molecule targeting CYP17A1 and AR; indicated across 2 conditions including malignant pancreatic neoplasm; with CIViC clinical evidence for 1 variant-indication association (e.g. AR AR-V7 in prostate cancer).
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 2 (CYP17A1, AR)
- Indications: 2 conditions
- Clinical trials: 5
- Precision-oncology evidence (CIViC): 1 variant–indication association
- Chemistry: 388.5 Da · C26H32N2O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL2105738 |
| Name | Galeterone |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 11188409 |
| Molecular formula | C26H32N2O |
| Molecular weight | 388.5 |
| InChIKey | PAFKTGFSEFKSQG-PAASFTFBSA-N |
SMILES: C[C@]12CC[C@@H](CC1=CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC=C4N5C=NC6=CC=CC=C65)C)O
IUPAC name: (3S,8R,9S,10R,13S,14S)-17-(benzimidazol-1-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-ol
Also known as: Galeterona, Galeterone, TOK 001, TOK-001, VN 124, VN-124, VN/124, GALETERONE
Patent coverage: 380 distinct patent families (971 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 805 (83%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CYP17A1 | CYP17A1 | Inhibition | 6.52 | 0.1% | P05093 |
| AR | Androgen receptor | Antagonist | 6.42 | P10275 |
Broader ChEMBL bioactivity targets: 3 (assay-derived). Sample: Androgen receptor, Steroid 21-hydroxylase, Steroid 17-alpha-hydroxylase/17,20 lyase.
Bioactivity
ChEMBL activities: 17 potent at pChembl ≥ 5 of 19 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| CYP17A1 | 7.92 | IC50 | 12.16 | nM | CHEMBL_ACT_25020219 |
| CYP17A1 | 7.8 | IC50 | 16 | nM | CHEMBL_ACT_24747416 |
| CYP17A1 | 7.8 | IC50 | 16 | nM | CHEMBL_ACT_25514412 |
| CYP17A1 | 7.55 | IC50 | 28.1 | nM | CHEMBL_ACT_18505294 |
| CYP21A2 | 7.11 | IC50 | 77.2 | nM | CHEMBL_ACT_18505283 |
| CYP17A1 | 6.85 | IC50 | 140 | nM | CHEMBL_ACT_19474739 |
| CYP21A2 | 6.61 | IC50 | 248 | nM | CHEMBL_ACT_18710951 |
| CYP21A2 | 6.61 | IC50 | 248 | nM | CHEMBL_ACT_27120059 |
| CYP17A1 | 6.55 | IC50 | 282 | nM | CHEMBL_ACT_18710925 |
| CYP17A1 | 6.55 | IC50 | 282 | nM | CHEMBL_ACT_27120017 |
| CYP17A1 | 6.52 | IC50 | 300 | nM | CHEMBL_ACT_15216601 |
| AR | 6.39 | EC50 | 405 | nM | CHEMBL_ACT_15216603 |
| AR | 6.17 | EC50 | 670 | nM | CHEMBL_ACT_13344975 |
| CYP17A1 | 6.12 | IC50 | 752 | nM | CHEMBL_ACT_13344922 |
| AR | 6.07 | EC50 | 845 | nM | CHEMBL_ACT_15216602 |
| AR | 5.96 | IC50 | 1108 | nM | CHEMBL_ACT_24747427 |
| CYP17A1 | 5.45 | IC50 | 3548 | nM | CHEMBL_ACT_25020218 |
Target pathways
Aggregated over 2 target gene(s): CYP17A1, AR.
Top Reactome pathways
26 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 1 | AR |
| Androgen biosynthesis | 1 | CYP17A1 |
| Glucocorticoid biosynthesis | 1 | CYP17A1 |
| Signaling by Rho GTPases | 1 | AR |
| RHO GTPase Effectors | 1 | AR |
| Generic Transcription Pathway | 1 | AR |
| Cellular responses to stress | 1 | AR |
| SUMOylation | 1 | AR |
| SUMO E3 ligases SUMOylate target proteins | 1 | AR |
| HSP90 chaperone cycle for steroid hormone receptors (SHR) in the presence of ligand | 1 | AR |
| Nuclear Receptor transcription pathway | 1 | AR |
| Metabolism of proteins | 1 | AR |
| SUMOylation of intracellular receptors | 1 | AR |
| Defective CYP17A1 causes AH5 | 1 | CYP17A1 |
| RHO GTPases activate PKNs | 1 | AR |
| Activated PKN1 stimulates transcription of AR (androgen receptor) regulated genes KLK2 and KLK3 | 1 | AR |
| Deubiquitination | 1 | AR |
| Ub-specific processing proteases | 1 | AR |
| Post-translational protein modification | 1 | AR |
| RNA Polymerase II Transcription | 1 | AR |
| Gene expression (Transcription) | 1 | AR |
| Transcriptional regulation by RUNX2 | 1 | AR |
| RUNX2 regulates osteoblast differentiation | 1 | AR |
| RUNX2 regulates bone development | 1 | AR |
| Cellular responses to stimuli | 1 | AR |
| Signaling by Rho GTPases, Miro GTPases and RHOBTB3 | 1 | AR |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| steroid biosynthetic process | 1 |
| androgen biosynthetic process | 1 |
| glucocorticoid biosynthetic process | 1 |
| sex differentiation | 1 |
| steroid metabolic process | 1 |
| cortisol biosynthetic process | 1 |
| hormone biosynthetic process | 1 |
| progesterone metabolic process | 1 |
| lipid metabolic process | 1 |
| hormone metabolic process | 1 |
| olefinic compound metabolic process | 1 |
| negative regulation of transcription by RNA polymerase II | 1 |
| MAPK cascade | 1 |
| in utero embryonic development | 1 |
| regulation of systemic arterial blood pressure | 1 |
Indications & clinical
Indications
2 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| malignant pancreatic neoplasm | 2 | MONDO:0009831 | EFO:1000359 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 5.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 2 |
| PHASE1 | 2 |
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02438007 | PHASE3 | TERMINATED | A Study of Galeterone Compared to Enzalutamide In Men Expressing Androgen Receptor Splice Variant-7 mRNA (AR-V7) Metastatic CRPC |
| NCT04098081 | PHASE2 | ACTIVE_NOT_RECRUITING | 1911GCCC: Galeterone With Gemcitabine for Patients With Metastatic Pancreatic Adenocarcinoma |
| NCT01709734 | PHASE2 | TERMINATED | A 2 Part, Phase 2 Trial of Galeterone in the Treatment of Castration Resistant Prostate Cancer |
| NCT00959959 | PHASE1 | COMPLETED | ARMOR1: Study of TOK-001 to Treat Castration Resistant Prostate Cancer |
| NCT02729376 | PHASE1 | COMPLETED | Single-Dose Study to Assess the Absorption, Metabolism, Excretion, and Mass Balance of Radiolabeled Galeterone |
Clinical evidence (CIViC)
Variant × indication × effect (1 predictive associations from 1 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| AR AR-V7 | Prostate Cancer | Sensitivity/Response | Galeterone + Enzalutamide | CIViC B | EID9549 |
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
144 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ABIRATERONE | ChEMBL + PubChem | Phase 4 (approved) | AR, CYP17A1 |
| Bicalutamide | ChEMBL + PubChem | Phase 4 (approved) | AR, CYP17A1 |
| Enzalutamide | ChEMBL + PubChem | Phase 4 (approved) | AR, CYP17A1 |
| Flutamide | ChEMBL + PubChem | Phase 4 (approved) | AR, CYP17A1 |
| TESTOSTERONE PROPIONATE | ChEMBL | Phase 4 (approved) | AR, CYP17A1 |
| CLOTRIMAZOLE | ChEMBL + PubChem | Phase 4 (approved) | CYP17A1 |
| ECONAZOLE | ChEMBL + PubChem | Phase 4 (approved) | CYP17A1 |
| MEGESTROL | ChEMBL + PubChem | Phase 4 (approved) | AR |
| MICONAZOLE | ChEMBL + PubChem | Phase 4 (approved) | CYP17A1 |
| OSILODROSTAT | ChEMBL + PubChem | Phase 4 (approved) | CYP17A1 |
| AMINOGLUTETHIMIDE | ChEMBL | Phase 4 (approved) | CYP17A1 |
| APALUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | AR |
| BECLOMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | AR |
| BETAMETHASONE | ChEMBL | Phase 4 (approved) | AR |
| BIFONAZOLE | ChEMBL | Phase 4 (approved) | CYP17A1 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | AR |
| BROMHEXINE | ChEMBL | Phase 4 (approved) | AR |
| BUDESONIDE | ChEMBL | Phase 4 (approved) | AR |
| CHLORMADINONE | ChEMBL | Phase 4 (approved) | AR |
| CLARITHROMYCIN | ChEMBL | Phase 4 (approved) | AR |
| CLASCOTERONE | ChEMBL | Phase 4 (approved) | AR |
| CLOCORTOLONE PIVALATE | ChEMBL | Phase 4 (approved) | AR |
| CLOMIPHENE | ChEMBL | Phase 4 (approved) | AR |
| CORTISONE | ChEMBL | Phase 4 (approved) | AR |
| CYCLOFENIL | ChEMBL | Phase 4 (approved) | AR |
| DAROLUTAMIDE | ChEMBL | Phase 4 (approved) | AR |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | AR |
| DESOXIMETASONE | ChEMBL | Phase 4 (approved) | AR |
| DEXAMETHASONE | ChEMBL | Phase 4 (approved) | AR |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | AR |
| DIFLORASONE DIACETATE | ChEMBL | Phase 4 (approved) | AR |
| DORZOLAMIDE | ChEMBL | Phase 4 (approved) | AR |
| DROSPIRENONE | ChEMBL | Phase 4 (approved) | AR |
| DYDROGESTERONE | ChEMBL | Phase 4 (approved) | AR |
| EPLERENONE | ChEMBL | Phase 4 (approved) | AR |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | AR |
| ESTRADIOL CYPIONATE | ChEMBL | Phase 4 (approved) | AR |
| ESTRADIOL VALERATE | ChEMBL | Phase 4 (approved) | AR |
| ESTRIOL | ChEMBL | Phase 4 (approved) | AR |
| ESTRONE | ChEMBL | Phase 4 (approved) | AR |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | AR |
| ETHYNODIOL DIACETATE | ChEMBL | Phase 4 (approved) | AR |
| ETONOGESTREL | ChEMBL | Phase 4 (approved) | AR |
| FLUMETHASONE PIVALATE | ChEMBL | Phase 4 (approved) | AR |
| FLUOCINOLONE ACETONIDE | ChEMBL | Phase 4 (approved) | AR |
| FLUOCINONIDE | ChEMBL | Phase 4 (approved) | AR |
| FLUOXYMESTERONE | ChEMBL | Phase 4 (approved) | AR |
| FLURANDRENOLIDE | ChEMBL | Phase 4 (approved) | AR |
| FLUTICASONE FUROATE | ChEMBL | Phase 4 (approved) | AR |
| FLUTICASONE PROPIONATE | ChEMBL | Phase 4 (approved) | AR |
| HALCINONIDE | ChEMBL | Phase 4 (approved) | AR |
| HALOBETASOL PROPIONATE | ChEMBL | Phase 4 (approved) | AR |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | AR |
| HEXESTROL | ChEMBL | Phase 4 (approved) | AR |
| HYDROCORTISONE | ChEMBL | Phase 4 (approved) | AR |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | AR |
| ISOCONAZOLE | ChEMBL | Phase 4 (approved) | CYP17A1 |
| KETOCONAZOLE | ChEMBL | Phase 4 (approved) | CYP17A1 |
| LEVONORGESTREL | ChEMBL | Phase 4 (approved) | AR |
Related Atlas pages
- Genes: CYP17A1, AR
- Diseases: prostate carcinoma
- Drugs: Abiraterone, Bicalutamide, Enzalutamide, Flutamide, Testosterone Propionate, Clotrimazole, Econazole, Megestrol, Miconazole, Osilodrostat, Aminoglutethimide, Apalutamide, Aripiprazole, Beclomethasone Dipropionate, Betamethasone, Bifonazole, Bithionol, Bromhexine, Budesonide, Chlormadinone, Clarithromycin, Clascoterone, Clocortolone Pivalate, Clomiphene, Cortisone, Cyclofenil, Darolutamide, Desogestrel, Desoximetasone, Dexamethasone, Diethylstilbestrol, Diflorasone Diacetate, Dorzolamide, Drospirenone, Dydrogesterone, Eplerenone, Estradiol, Estradiol Cypionate, Estradiol Valerate, Estriol, Estrone, Ethinyl Estradiol, Ethynodiol Diacetate, Etonogestrel, Flumethasone Pivalate, Fluocinolone Acetonide, Fluocinonide, Fluoxymesterone, Flurandrenolide, Fluticasone Furoate, Fluticasone Propionate, Halcinonide, Halobetasol Propionate, Hexachlorophene, Hexestrol, Hydrocortisone, Indomethacin, Ketoconazole, Levonorgestrel