Gemfibrozil
drug drugOn this page
Also known as CI-719EmfibGemfibroziloLopidNSC-757024SID11112705SID17389870SID26751515SID855780SID49718189SID144204164SID174007259SID144209195SID144213101SID170464998C0164788
Summary
Gemfibrozil (CHEMBL457) is an approved small-molecule antilipemic drug (ATC C10AB04) targeting SLCO1B1, SLCO1B3, and SLCO2B1; indicated across 15 conditions including coronary artery disorder and cardiovascular disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C10AB04
- Targets: 4 (SLCO1B1, SLCO1B3, SLCO2B1…)
- Indications: 15 conditions
- Clinical trials: 35
- Chemistry: 250.33 Da · C15H22O3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL457 |
| Name | Gemfibrozil |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 3463 |
| ChEBI | CHEBI:5296 |
| ATC | C10AB04 |
| Molecular formula | C15H22O3 |
| Molecular weight | 250.33 |
| InChIKey | HEMJJKBWTPKOJG-UHFFFAOYSA-N |
SMILES: CC1=CC(=C(C=C1)C)OCCCC(C)(C)C(=O)O
IUPAC name: 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid
Pharmacological roles (ChEBI): antilipemic drug.
Also known as: CI-719, Emfib, Gemfibrozil, Gemfibrozilo, Lopid, NSC-757024, gemfibrozil, SID11112705, SID17389870, SID26751515, SID855780, GEMFIBROZIL
Patent coverage: 9,271 distinct patent families (35,238 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 35,152 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SLCO1B1 | OATP1B1 | Inhibition | 0% | Q9Y6L6 | |
| SLCO1B3 | OATP1B3 | Inhibition | 0% | Q9NPD5 | |
| SLCO2B1 | OATP2B1 | Inhibition | 0% | O94956 | |
| PPARA | Peroxisome proliferator-activated receptor-α | Agonist | 4.23 | 0.7% | Q07869 |
Broader ChEMBL bioactivity targets: 18 (assay-derived). Sample: Tyrosyl-DNA phosphodiesterase 1, Nuclear receptor ROR-gamma, Survival motor neuron protein, 4’-phosphopantetheinyl transferase ffp, Solute carrier organic anion transporter family member 1B1, Solute carrier organic anion transporter family member 1B3, CDGSH iron-sulfur domain-containing protein 1, 5-hydroxytryptamine receptor 2B, Thyrotropin receptor, Muscarinic acetylcholine receptor M1, Alpha-1A adrenergic receptor, Peroxisome proliferator-activated receptor gamma, Peroxisome proliferator-activated receptor alpha, Transthyretin, Cytochrome P450 1A2, Cytochrome P450 2C9, Cytochrome P450 2C8, Fatty acid-binding protein, liver.
Bioactivity
ChEMBL activities: 11 potent at pChembl ≥ 5 of 28 total. Top 100 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| TTR | 7 | Kd | 100 | nM | CHEMBL_ACT_15670985 |
| P02692 | 5.73 | Ki | 1860 | nM | CHEMBL_ACT_2445226 |
| CYP2C8 | 5.39 | IC50 | 4100 | nM | CHEMBL_ACT_12163618 |
| SLCO1B1 | 5.39 | IC50 | 4074 | nM | CHEMBL_ACT_13800618 |
| HTR2B | 5.36 | AC50 | 4400 | nM | CHEMBL_ACT_25228002 |
| SMN1 | 5.35 | Potency | 4467 | nM | CHEMBL_ACT_3867033 |
| CYP2C9 | 5.2 | Potency | 6310 | nM | CHEMBL_ACT_5033439 |
| CYP2C9 | 5.2 | AC50 | 6310 | nM | CHEMBL_ACT_6071368 |
| SLCO1B3 | 5.15 | IC50 | 7079 | nM | CHEMBL_ACT_13798619 |
| CISD1 | 5.14 | Ki | 7291 | nM | CHEMBL_ACT_16766257 |
| CYP2C9 | 5.02 | IC50 | 9600 | nM | CHEMBL_ACT_12163620 |
Target pathways
Aggregated over 4 target gene(s): SLCO1B1, SLCO1B3, SLCO2B1, PPARA.
Top Reactome pathways
32 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Heme degradation | 3 | SLCO1B1, SLCO1B3, SLCO2B1 |
| Transport of small molecules | 3 | SLCO1B1, SLCO1B3, SLCO2B1 |
| Transport of vitamins, nucleosides, and related molecules | 3 | SLCO1B1, SLCO1B3, SLCO2B1 |
| SLC-mediated transmembrane transport | 3 | SLCO1B1, SLCO1B3, SLCO2B1 |
| Organic anion transport by SLCO transporters | 3 | SLCO1B1, SLCO1B3, SLCO2B1 |
| Atorvastatin ADME | 3 | SLCO1B1, SLCO1B3, SLCO2B1 |
| Metabolism | 2 | SLCO1B1, SLCO1B3 |
| Recycling of bile acids and salts | 2 | SLCO1B1, SLCO1B3 |
| Disease | 2 | SLCO1B1, SLCO1B3 |
| Metabolism of porphyrins | 2 | SLCO1B1, SLCO1B3 |
| Bile acid and bile salt metabolism | 2 | SLCO1B1, SLCO1B3 |
| Metabolism of lipids | 2 | SLCO1B1, SLCO1B3 |
| SLC transporter disorders | 2 | SLCO1B1, SLCO1B3 |
| Disorders of transmembrane transporters | 2 | SLCO1B1, SLCO1B3 |
| Metabolism of steroids | 2 | SLCO1B1, SLCO1B3 |
| Drug ADME | 2 | SLCO1B1, SLCO1B3 |
| BMAL1:CLOCK,NPAS2 activates circadian expression | 1 | PPARA |
| PPARA activates gene expression | 1 | PPARA |
| Transcriptional activation of mitochondrial biogenesis | 1 | PPARA |
| Activation of gene expression by SREBF (SREBP) | 1 | PPARA |
| Transcriptional regulation of white adipocyte differentiation | 1 | PPARA |
| Nuclear Receptor transcription pathway | 1 | PPARA |
| Regulation of lipid metabolism by PPARalpha | 1 | PPARA |
| SUMOylation of intracellular receptors | 1 | PPARA |
| Defective SLCO1B3 causes hyperbilirubinemia, Rotor type (HBLRR) | 1 | SLCO1B3 |
| Defective SLCO1B1 causes hyperbilirubinemia, Rotor type (HBLRR) | 1 | SLCO1B1 |
| Cytoprotection by HMOX1 | 1 | PPARA |
| Heme signaling | 1 | PPARA |
| Aspirin ADME | 1 | SLCO2B1 |
| Transcriptional regulation of brown and beige adipocyte differentiation by EBF2 | 1 | PPARA |
| Expression of BMAL (ARNTL), CLOCK, and NPAS2 | 1 | PPARA |
| RORA,B,C and NR1D1 (REV-ERBA) regulate gene expression | 1 | PPARA |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| xenobiotic metabolic process | 3 |
| monoatomic ion transport | 3 |
| obsolete organic anion transport | 3 |
| bile acid and bile salt transport | 3 |
| heme catabolic process | 3 |
| sodium-independent organic anion transport | 3 |
| transmembrane transport | 3 |
| lipid transport | 2 |
| prostaglandin transport | 2 |
| thyroid hormone transport | 1 |
| transport across blood-brain barrier | 1 |
| negative regulation of transcription by RNA polymerase II | 1 |
| response to hypoxia | 1 |
| gluconeogenesis | 1 |
| fatty acid metabolic process | 1 |
Indications & clinical
Indications
2 approved indications. FDA phase 4, plus an anticancer drug’s labelled cancer uses (which ChEMBL often logs at phase 3).
| Indication | Phase | MONDO | EFO |
|---|---|---|---|
| coronary artery disorder | 4 | MONDO:0005010 | EFO:0001645 |
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
10 diseases in clinical trials (phase 1–3, investigational — not approved indications). Highest ChEMBL trial phase per disease; a non-cancer approved use is occasionally logged at phase 3 here.
| Disease (in trials) | Phase | MONDO | EFO |
|---|---|---|---|
| nicotine dependence | 2 | MONDO:0008575 | EFO:0003768 |
| myocardial ischemia | 2 | MONDO:0024644 | EFO:1001375 |
| alcohol abuse | 2 | MONDO:0002046 | MONDO:0007079 |
| Parkinson disease | 2 | MONDO:0005180 | MONDO:0005180 |
| anemia | 1 | MONDO:0002280 | EFO:0004272 |
| HIV infectious disease | 1 | MONDO:0005109 | EFO:0000764 |
| hypertriglyceridemia | 1 | MONDO:0005347 | EFO:0004211 |
| type 2 diabetes mellitus | 1 | MONDO:0005148 | MONDO:0005148 |
| neoplasm | 1 | MONDO:0005070 | MONDO:0004992 |
| multiple sclerosis | 1 | MONDO:0005301 | MONDO:0005301 |
2 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 35.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 25 |
| PHASE2 | 5 |
| PHASE4 | 2 |
| PHASE3 | 1 |
| EARLY_PHASE1 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00243672 | PHASE4 | WITHDRAWN | Early Therapeutic Effects of Statins and Fibrates on Unstable Atherosclerotic Plaques |
| NCT01385020 | PHASE4 | COMPLETED | Effect of Gemfibrozil on the Safety and Pharmacokinetics of Red Yeast Rice in Healthy Subjects |
| NCT00283335 | PHASE3 | COMPLETED | The VA HDL Intervention Trial (HIT): Secondary Prevention of Coronary Heart Disease in Men With Low HDL-Cholesterol and Desirable LDL-Cholesterol |
| NCT05931484 | PHASE2 | NOT_YET_RECRUITING | Study to Evaluate the Safety, Tolerability, Efficacy, and PK of FHL-301 in Parkinson’s Disease Patients. |
| NCT00000461 | PHASE2 | COMPLETED | Harvard Atherosclerosis Reversibility Project (HARP) |
| NCT01876810 | PHASE2 | COMPLETED | Initial Screening of Gemfibrozil as a Novel Treatment for Tobacco Addiction |
| NCT02638597 | PHASE2 | COMPLETED | Gemfibrozil for Nicotine Smoking Cessation |
| NCT03539432 | PHASE2 | TERMINATED | Exploration of Gemfibrozil as a Treatment for AUD |
| NCT00039663 | PHASE1 | COMPLETED | Endothelial Dysfunction as a Risk Factor in HIV Study |
| NCT00108511 | PHASE1 | COMPLETED | Effect of Gemfibrozil on Serum Glycosylphosphatidylinositol (GPI) Phospholipase D and Triglycerides |
| NCT00566865 | PHASE1 | COMPLETED | Drug-Drug Interaction Study of Mitiglinide and Gemfibrozil |
| NCT00800475 | PHASE1 | COMPLETED | Bioequivalence Study Between Two Oral Formulations of Gemfibrozil Tablets |
| NCT00966966 | PHASE1 | COMPLETED | Study Evaluating Potential Interaction Between SAM-531 And Gemfibrozil When Co-Administered |
| NCT01083212 | PHASE1 | COMPLETED | To Evaluate the Effect of Gemfibrozil on the Pharmacokinetics and Pharmacodynamics of a Single Dose of AZD1656 |
| NCT01301742 | PHASE1 | COMPLETED | Relative Bioavailability of Single Dose Empagliflozin (BI 10773) When Co-administered With Multiple Doses of 600 mg Gemfibrozil Compared to Single Dose Treatment With Empagliflozin (BI 10773) When Given Alone in Healthy Volunteers |
| NCT01340846 | PHASE1 | COMPLETED | A Pharmacokinetics Study of the Effects of GSK2118436 on Warfarin, the Effects of Ketoconazole and Gemfibrozil on GSK2118436, and the Effects of Repeat Doses of GSK2118436 in Subjects With BRAF Mutant Solid Tumors |
| NCT01376232 | PHASE1 | COMPLETED | Study to Assess the Pharmacokinetics of GSK1278863A Coadministered With a High Fat Meal or an Inhibitor of CYP2C8 (Gemfibrozil) |
| NCT01736254 | PHASE1 | COMPLETED | A Study of Evacetrapib in Healthy Participants |
| NCT01797198 | PHASE1 | COMPLETED | A Study to Assess the Effect of Multiple Doses of Gemfribozil on a Single Dose of ASP3652, and to Assess the Effects of Multiple Doses of ASP3652 on a Single Dose of Repaglinide in the Body of Healthy Subjects |
| NCT01836198 | PHASE1 | COMPLETED | The Effect of Gemfibrozil, Ketoconazole and Clarithromycin on the Amount of LY2409021 in the Bloodstream |
| NCT01913379 | PHASE1 | COMPLETED | Drug-drug Interaction Study With MDV3100 (ASP9785) and Gemfibrozil and Itraconazole |
| NCT02230033 | PHASE1 | COMPLETED | Study to Assess Drug-Drug Interaction Between Itraconazole or Gemfibrozil and JNJ-56021927 |
| NCT02770222 | PHASE1 | COMPLETED | A Clinical Study to Investigate the Effect of Gemfibrozil or Rifampicin on Blood Concentrations of Selexipag in Healthy Subjects |
| NCT03624959 | PHASE1 | COMPLETED | Drug-drug Interaction Study of Ozanimod With Inhibitor or Inducer of CYP2C8 and/or CYP3A |
| NCT03723395 | PHASE1 | COMPLETED | A Drug-Drug Interaction Study in Healthy Volunteers of the Effects of Tucatinib |
| NCT04008186 | PHASE1 | COMPLETED | A Clinical Drug-Drug Interaction (DDI) Study With Omaveloxolone |
| NCT04956627 | PHASE1 | COMPLETED | A Study to Assess the Effect of Itraconazole, Phenytoin and Gemfibrozil on the Drug Levels of BMS-986166 in Healthy Participants |
| NCT05069870 | PHASE1 | UNKNOWN | A Study to Investigate the Drug-drug Interactions (DDIs) of SKLB1028 With Itraconazole, Gemfibrozil or Rifampicin in Healthy Subjects |
| NCT05932303 | PHASE1 | COMPLETED | A Study to Assess the Effect of Multiple Doses of Itraconazole, Gemfibrozil, or Carbamazepine on BMS-986278 in Healthy Participants |
| NCT05959447 | PHASE1 | COMPLETED | Evaluation of the Potential Drug-drug Interactions Between Gemfibrozil or Dabigatran Etexilate and Camlipixant |
| NCT06064539 | PHASE1 | COMPLETED | Study of Drug-drug Interaction of the Effects of Gemfibrozil and Rifampicin on SAR442168 in Healthy Adult Subjects |
| NCT06392659 | PHASE1 | COMPLETED | A Phase 1, Open-label Study Evaluating the Pharmacokinetics and Drug-drug Interaction of VX-993 in Healthy Adults |
| NCT06809608 | PHASE1 | COMPLETED | A Study Investigating the Effect of Different Approved Medications on How the Body Processes the Study Compound RO7795081 |
| NCT02045056 | EARLY_PHASE1 | COMPLETED | Modulation of Micro-RNA Pathways by Gemfibrozil in Predementia Alzheimer Disease |
| NCT00474201 | Not specified | COMPLETED | Drug Interaction Study of Lopinavir/Ritonavir and Gemfibrozil |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
336 molecules share ≥1 primary target. Top 100 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CYCLOSPORINE | ChEMBL + PubChem | Phase 4 (approved) | PPARA, SLCO1B1, SLCO1B3, SLCO2B1 |
| ATAZANAVIR | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| ATORVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| CLARITHROMYCIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| DIGOXIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| ERLOTINIB | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| INDOMETHACIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| OLMESARTAN MEDOXOMIL | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| PACLITAXEL | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| PRAVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| RIFAMPIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| RIFAMYCIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| RITONAVIR | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| TELMISARTAN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| VERAPAMIL | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| VINBLASTINE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| VINCRISTINE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| ELTROMBOPAG | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| SULFASALAZINE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| SILYBIN A | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3, SLCO2B1 |
| GENISTEIN | ChEMBL + PubChem | Phase 2 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| GLYCYRRHIZIN | ChEMBL + PubChem | Phase 2 (approved) | SLCO1B1, SLCO1B3, SLCO2B1 |
| SILICRISTIN | ChEMBL | Phase 2 | SLCO1B1, SLCO1B3, SLCO2B1 |
| URSOLIC ACID | ChEMBL | Phase 2 | PPARA, SLCO1B1, SLCO1B3 |
| Acyclovir | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Allopurinol | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Amantadine | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| aminohippuric acid | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Amitriptyline | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Atenolol | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Cholic Acid | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Dexamethasone | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Erythromycin | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Ezetimibe | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Metformin | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Methotrexate | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Phenytoin | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Sildenafil | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| theophylline | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| Valacyclovir | PubChem | Approved | SLCO1B1, SLCO1B3, SLCO2B1 |
| CANDESARTAN CILEXETIL | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| DOXORUBICIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B3, SLCO2B1 |
| ETOPOSIDE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B3, SLCO2B1 |
| Fenofibrate | ChEMBL + PubChem | Phase 4 (approved) | PPARA, SLCO2B1 |
| GLYBURIDE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| HYDROXYZINE PAMOATE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| LOVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| MITOXANTRONE | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B3, SLCO2B1 |
| Pioglitazone | ChEMBL + PubChem | Phase 4 (approved) | PPARA, SLCO2B1 |
| Rosiglitazone | ChEMBL + PubChem | Phase 4 (approved) | PPARA, SLCO2B1 |
| SIMVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO2B1 |
| TANNIC ACID | ChEMBL + PubChem | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| BETA CAROTENE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| CARBENOXOLONE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| DICLOXACILLIN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| ERYTHROMYCIN ESTOLATE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| ERYTHROMYCIN ETHYLSUCCINATE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| LOSARTAN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| MOMETASONE FUROATE | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| NONOXYNOL 9 | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| TELITHROMYCIN | ChEMBL | Phase 4 (approved) | SLCO1B1, SLCO1B3 |
| ADMILPARANT | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| ALISPORIVIR | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| FASIGLIFAM | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| GOSSYPOL | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| PAMIPARIB | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| SILIBININ | ChEMBL | Phase 3 | SLCO1B1, SLCO1B3 |
| BMS-986020 | ChEMBL | Phase 2 | SLCO1B1, SLCO1B3 |
| ENOXOLONE | ChEMBL | Phase 2 | SLCO1B1, SLCO1B3 |
| .gamma.-aminobutyric acid | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Acetaminophen | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Acetazolamide | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Acetohydroxamic Acid | PubChem | Approved | SLCO1B1, SLCO1B3 |
| acetylcysteine | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Acetylsalicylsalicylic acid | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Adenine | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Albendazole | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Allantoin | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Almotriptan | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Aminolevulinic Acid | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Amoxapine | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Ampicillin | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Amprolium ion | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Anthralin | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Antipyrine | PubChem | Approved | SLCO1B1, SLCO1B3 |
| apiole (parsley) | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Apomorphine | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Azaperone | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Azathioprine | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Azelaic Acid | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Bacitracin | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Baclofen | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Beclomethasone Dipropionate | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Benzocaine | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Berberine Chloride | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Betamethasone Valerate | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Bethanechol Chloride | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Biotin | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Bisacodyl | PubChem | Approved | SLCO1B1, SLCO1B3 |
| Bumetanide | PubChem | Approved | SLCO1B1, SLCO1B3 |
Related Atlas pages
- Genes: SLCO1B1, SLCO1B3, SLCO2B1, PPARA
- Indicated for: coronary artery disorder, cardiovascular disorder
- In clinical trials for: nicotine dependence, myocardial ischemia, alcohol abuse, Parkinson disease
- Drugs: Cyclosporine, Atazanavir, Atorvastatin, Clarithromycin, Digoxin, Erlotinib, Indomethacin, Olmesartan Medoxomil, Paclitaxel, Pravastatin, Rifampin, Rifamycin, Ritonavir, Telmisartan, Verapamil, Vinblastine, Vincristine, Eltrombopag, Sulfasalazine, Silybin A, Acyclovir, Allopurinol, Amantadine, aminohippuric acid, Amitriptyline, Atenolol, Cholic Acid, Dexamethasone, Erythromycin, Ezetimibe, Metformin, Methotrexate, Phenytoin, Sildenafil, theophylline, Valacyclovir, Candesartan Cilexetil, Doxorubicin, Etoposide, Fenofibrate, Glyburide, Hydroxyzine Pamoate, Lovastatin, Mitoxantrone, Pioglitazone, Rosiglitazone, Simvastatin, Tannic Acid, Beta Carotene, Carbenoxolone, Dicloxacillin, Erythromycin Estolate, Erythromycin Ethylsuccinate, Losartan, Mometasone Furoate, NONOXYNOL 9, Telithromycin, Admilparant, Alisporivir, Fasiglifam, Gossypol, Pamiparib, Acetaminophen, Acetazolamide, Acetohydroxamic Acid, acetylcysteine, Albendazole, Almotriptan, Aminolevulinic Acid, Amoxapine, Ampicillin, Antipyrine, Apomorphine, Azathioprine, Azelaic Acid, Bacitracin, Baclofen, Beclomethasone Dipropionate, Benzocaine, Berberine Chloride, Betamethasone Valerate, Bethanechol Chloride, Biotin, Bisacodyl, Bumetanide