Glutamic Acid
drugOn this page
Also known as Acide glutamiqueAcido glutamicoE 620E-620E620FEMA NO. 3285l-GlutamidexINS NO.620INS-620L-alpha-aminoglutaric acidL-glutamateL-glutamic acidNSC-143503L-N-Hydroxy glutamate(S)-glutamic acid(S)-glutamateGlutamateSID26751652
Summary
Glutamic Acid (CHEMBL575060) is an approved small-molecule neurotransmitter targeting GRM1, GRM2, and GRM3; indicated across 1 condition including sleep disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- Targets: 8 (GRM1, GRM2, GRM3…)
- Indications: 1 condition
- Clinical trials: 7
- Chemistry: 147.13 Da · C5H9NO4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL575060 |
| Name | Glutamic Acid |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | yes |
| PubChem CID | 33032 |
| ChEBI | CHEBI:16015 |
| Molecular formula | C5H9NO4 |
| Molecular weight | 147.13 |
| InChIKey | WHUUTDBJXJRKMK-VKHMYHEASA-N |
SMILES: C(CC(=O)O)[C@@H](C(=O)O)N
IUPAC name: (2S)-2-aminopentanedioic acid
ChEBI definition: An optically active form of glutamic acid having L-configuration.
Pharmacological roles (ChEBI): neurotransmitter, nutraceutical, micronutrient, ferroptosis inducer.
Other ChEBI roles (chemical / environmental): Escherichia coli metabolite, mouse metabolite.
Also known as: Acide glutamique, Acido glutamico, E 620, E-620, E620, FEMA NO. 3285, Glutamic acid, l-, Glutamidex, INS NO.620, INS-620, L-alpha-aminoglutaric acid
Patent coverage: 311,604 distinct patent families (929,756 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 929,755 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| GRM1 | mGlu1 receptor | Agonist | 5 | 0.2% | Q13255 |
| GRM2 | mGlu2 receptor | Agonist | 5.4 | 0.6% | Q14416 |
| GRM3 | mGlu3 receptor | Agonist | 5.4 | 0.1% | Q14832 |
| GRM4 | mGlu4 receptor | Agonist | 5.5 | 0% | Q14833 |
| GRM5 | mGlu5 receptor | Agonist | 5.5 | 0.2% | P41594 |
| GRM6 | mGlu6 receptor | Agonist | 4.8 | 0.2% | O15303 |
| GRM7 | mGlu7 receptor | Agonist | 3 | 0% | Q14831 |
| GRM8 | mGlu8 receptor | Agonist | 5.6 | 0% | O00222 |
Broader ChEMBL bioactivity targets: 50 (assay-derived). Sample: 4’-phosphopantetheinyl transferase ffp, Glutamate NMDA receptor, Glutamate receptor ionotropic, kainate 1, Glutamate receptor 1, Glutamate receptor ionotropic, AMPA, Glutamate receptor ionotropic, kainate, Glutamate [NMDA] receptor, Glutamate NMDA receptor; Grin1/Grin2b, Glutamate receptor ionotropic AMPA, Glutamate NMDA receptor; Grin1/Grin2a.
Bioactivity
ChEMBL activities: 191 potent at pChembl ≥ 5 of 297 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| GRM8 | 8.24 | IC50 | 5.7 | nM | CHEMBL_ACT_1434487 |
| P47743 | 7.66 | EC50 | 22 | nM | CHEMBL_ACT_1127541 |
| SLC1A1 | 7.29 | Ki | 51 | nM | CHEMBL_ACT_2460119 |
| GRM3 | 7.24 | Ki | 57.54 | nM | CHEMBL_ACT_14930527 |
| P31422 | 7.24 | EC50 | 57.54 | nM | CHEMBL_ACT_16526524 |
| GRM3 | 7.22 | EC50 | 60 | nM | CHEMBL_ACT_14930558 |
| P31422 | 7.22 | EC50 | 60 | nM | CHEMBL_ACT_16526525 |
| P22756 | 7.2 | Ki | 63 | nM | CHEMBL_ACT_581653 |
| GRIN2D | 7.16 | IC50 | 70 | nM | CHEMBL_ACT_12165745 |
| P35439 | 7.16 | IC50 | 69 | nM | CHEMBL_ACT_2436783 |
| GRIN2D | 7.16 | IC50 | 70 | nM | CHEMBL_ACT_24958627 |
| P35439 | 7.16 | IC50 | 70 | nM | CHEMBL_ACT_710133 |
| P35439 | 7.1 | IC50 | 80 | nM | CHEMBL_ACT_729792 |
| P35439 | 6.92 | EC50 | 120 | nM | CHEMBL_ACT_1004046 |
| P22756 | 6.92 | IC50 | 120 | nM | CHEMBL_ACT_729790 |
| P22756 | 6.86 | Ki | 138 | nM | CHEMBL_ACT_2450132 |
| P22756 | 6.86 | Ki | 138 | nM | CHEMBL_ACT_3284462 |
| P22756 | 6.85 | Ki | 140 | nM | CHEMBL_ACT_12629937 |
| P22756 | 6.85 | Ki | 140 | nM | CHEMBL_ACT_2374422 |
| P22756 | 6.85 | Ki | 140 | nM | CHEMBL_ACT_2450131 |
| P22756 | 6.85 | Ki | 140 | nM | CHEMBL_ACT_3284457 |
| P19490 | 6.82 | IC50 | 150 | nM | CHEMBL_ACT_729791 |
| P19490 | 6.77 | Ki | 169 | nM | CHEMBL_ACT_2374361 |
| P35439 | 6.77 | IC50 | 171 | nM | CHEMBL_ACT_417025 |
| P35439 | 6.76 | IC50 | 172 | nM | CHEMBL_ACT_1004045 |
| P35439 | 6.7 | Ki | 200 | nM | CHEMBL_ACT_12629966 |
| P35439 | 6.7 | Ki | 200 | nM | CHEMBL_ACT_14926414 |
| P35439 | 6.7 | Ki | 200 | nM | CHEMBL_ACT_16413094 |
| P35439 | 6.7 | Ki | 200 | nM | CHEMBL_ACT_19037635 |
| P35439 | 6.7 | Ki | 200 | nM | CHEMBL_ACT_1921132 |
Target pathways
Aggregated over 8 target gene(s): GRM1, GRM2, GRM3, GRM4, GRM5, GRM6, GRM7, GRM8.
Top Reactome pathways
5 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Class C/3 (Metabotropic glutamate/pheromone receptors) | 8 | GRM1, GRM2, GRM3, GRM4, GRM5, GRM6, GRM7, GRM8 |
| G alpha (i) signalling events | 6 | GRM2, GRM3, GRM4, GRM6, GRM7, GRM8 |
| G alpha (q) signalling events | 2 | GRM1, GRM5 |
| Neurexins and neuroligins | 2 | GRM1, GRM5 |
| Sensory perception of sweet, bitter, and umami (glutamate) taste | 2 | GRM1, GRM4 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway | 8 |
| G protein-coupled glutamate receptor signaling pathway | 8 |
| regulation of synaptic transmission, glutamatergic | 8 |
| signal transduction | 8 |
| adenylate cyclase-inhibiting G protein-coupled glutamate receptor signaling pathway | 8 |
| chemical synaptic transmission | 7 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 5 |
| locomotory behavior | 3 |
| positive regulation of MAPK cascade | 3 |
| gene expression | 3 |
| phospholipase C-activating G protein-coupled glutamate receptor signaling pathway | 2 |
| regulation of postsynaptic membrane potential | 2 |
| regulation of postsynaptic cytosolic calcium ion concentration | 2 |
| negative regulation of adenylate cyclase activity | 2 |
| cellular response to stress | 2 |
Indications & clinical
Indications
1 indication (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| sleep disorder | 3 | MONDO:0100081 | EFO:0008568 |
Clinical trials
Total trials: 7.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 4 |
| PHASE3 | 3 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00369564 | PHASE3 | COMPLETED | Glutamic Acid in Reducing Nerve Damage Caused by Vincristine in Young Patients With Cancer |
| NCT00489827 | PHASE3 | COMPLETED | Glutamate for Metabolic Intervention in Coronary Surgery |
| NCT02592824 | PHASE3 | COMPLETED | Glutamate for Metabolic Intervention in Coronary Surgery II |
| NCT00980408 | Not specified | COMPLETED | The Influence of Glutamate on Memory in Humans |
| NCT02523703 | Not specified | COMPLETED | Excitotoxicity Markers and the Clinical-radiological Progression After a Demyelinating Event: a Prospective Pilot Study |
| NCT03180775 | Not specified | UNKNOWN | Effects of Dietary Amino Acids on Serum and Macrophage Atherogenicity |
| NCT04086108 | Not specified | COMPLETED | Relative Oral Bioavailability of GABA From Tomatoes |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
12 molecules share ≥1 primary target. Top 12 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| EGLUMETAD | ChEMBL | Phase 2 | GRM2, GRM3, GRM6, GRM8 |
| FENOBAM | ChEMBL | Phase 2 | GRM1, GRM5 |
| MICONAZOLE | ChEMBL + PubChem | Phase 4 (approved) | GRM6 |
| BASIMGLURANT | ChEMBL | Phase 2 | GRM5 |
| DEXFOSFOSERINE | ChEMBL | Phase 2 | GRM4 |
| DIPRAGLURANT | ChEMBL | Phase 2 | GRM5 |
| FOLIGLURAX | ChEMBL | Phase 2 | GRM4 |
| JNJ-40411813 | ChEMBL | Phase 2 | GRM2 |
| KAINIC ACID | ChEMBL | Phase 2 | GRM5 |
| MAVOGLURANT | ChEMBL | Phase 2 | GRM5 |
| QUINPIROLE | ChEMBL | Phase 2 | GRM5 |
| RASEGLURANT | ChEMBL | Phase 2 | GRM5 |
Related Atlas pages
- Genes: GRM1, GRM2, GRM3, GRM4, GRM5, GRM6, GRM7, GRM8
- Diseases: sleep disorder
- Drugs: Miconazole