Guanfacine
drugOn this page
Also known as GuanfacinaIntunivNSC-759121SID11111221SID11111222SID11113866SID26752038SID90341397SID104171166SID124880211GUANFACINE HYDROCHLORIDE
Summary
Guanfacine (CHEMBL862) is an approved small molecule (ATC C02AC02) targeting ADRA2A, ADRA2B, and ADRA2C; indicated across 17 conditions including hypertensive disorder and tourette syndrome.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C02AC02
- Targets: 3 (ADRA2A, ADRA2B, ADRA2C)
- Indications: 17 conditions
- Clinical trials: 46
- Chemistry: 246.09 Da · C9H9Cl2N3O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL862 |
| Name | Guanfacine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 3519 |
| ATC | C02AC02 |
| Molecular formula | C9H9Cl2N3O |
| Molecular weight | 246.09 |
| InChIKey | INJOMKTZOLKMBF-UHFFFAOYSA-N |
SMILES: C1=CC(=C(C(=C1)Cl)CC(=O)N=C(N)N)Cl
IUPAC name: N-(diaminomethylidene)-2-(2,6-dichlorophenyl)acetamide
Also known as: Guanfacina, Guanfacine, Intuniv, NSC-759121, SID11111221, SID11111222, SID11113866, SID26752038, SID90341397, SID104171166, guanfacine, SID124880211
Parent form; salt/anhydrous children: CHEMBL1200494
Patent coverage: 5,892 distinct patent families (23,781 SureChEMBL compound mentions), from 2 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ADRA2A | α2A-adrenoceptor | Agonist | 6.5 | 0.1% | P08913 |
| ADRA2B | α2B-adrenoceptor | Full agonist | 7.6 | 0.2% | P18089 |
| ADRA2C | α2C-adrenoceptor | Agonist | 7.2 | 0% | P18825 |
Broader ChEMBL bioactivity targets: 25 (assay-derived). Sample: Prelamin-A/C, 5-hydroxytryptamine receptor 2B, Alpha-2A adrenergic receptor, Alpha-2C adrenergic receptor, Alpha-2B adrenergic receptor, Amine oxidase [flavin-containing] A, Menin/Histone-lysine N-methyltransferase MLL, 5-hydroxytryptamine receptor 1A, Alpha-1D adrenergic receptor, 5-hydroxytryptamine receptor 2A.
Bioactivity
ChEMBL activities: 47 potent at pChembl ≥ 5 of 61 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| MAPK1 | 8.4 | Potency | 4 | nM | CHEMBL_ACT_4524498 |
| ADRA1A | 8.03 | AC50 | 9.3 | nM | CHEMBL_ACT_25208506 |
| P08482 | 7.9 | Potency | 12.6 | nM | CHEMBL_ACT_4803461 |
| NISCH | 7.72 | Ki | 19.01 | nM | CHEMBL_ACT_2564083 |
| ADRA1A | 7.61 | AC50 | 24.5 | nM | CHEMBL_ACT_25229650 |
| ADRA2A | 7.3 | Ki | 50 | nM | CHEMBL_ACT_7662161 |
| ADRA2A | 7.28 | EC50 | 52.48 | nM | CHEMBL_ACT_25844356 |
| ADRA2A | 7.25 | AC50 | 56.7 | nM | CHEMBL_ACT_25220891 |
| ADRA2A | 6.96 | AC50 | 110 | nM | CHEMBL_ACT_25157069 |
| ADRA2B | 6.94 | Ki | 114 | nM | CHEMBL_ACT_7662163 |
| CYP2D6 | 6.9 | Potency | 125.9 | nM | CHEMBL_ACT_4998279 |
| CYP2D6 | 6.9 | AC50 | 125.9 | nM | CHEMBL_ACT_5988140 |
| ADRA2A | 6.87 | IC50 | 134 | nM | CHEMBL_ACT_7662160 |
| CYP2C19 | 6.6 | Potency | 251.2 | nM | CHEMBL_ACT_4020442 |
| CYP2C19 | 6.6 | AC50 | 251.2 | nM | CHEMBL_ACT_6056545 |
| ADRA2B | 6.6 | IC50 | 249 | nM | CHEMBL_ACT_7662162 |
| ADRA2B | 6.54 | EC50 | 288.4 | nM | CHEMBL_ACT_25844359 |
| HTR2B | 6.45 | AC50 | 358 | nM | CHEMBL_ACT_25228518 |
| LMNA | 6.45 | Potency | 354.8 | nM | CHEMBL_ACT_3625296 |
| P43140 | 6.26 | Ki | 546 | nM | CHEMBL_ACT_7662155 |
| ADRA2C | 6.22 | EC50 | 602.6 | nM | CHEMBL_ACT_25844362 |
| HTR2A | 6.21 | AC50 | 610 | nM | CHEMBL_ACT_25226146 |
| HTR2C | 6.12 | Ki | 761 | nM | CHEMBL_ACT_7666389 |
| HTR2A | 6.07 | Ki | 861 | nM | CHEMBL_ACT_7666385 |
| ADRA2C | 6.03 | Ki | 937 | nM | CHEMBL_ACT_7662165 |
| HTR2B | 5.99 | AC50 | 1013 | nM | CHEMBL_ACT_25164291 |
| HTR2B | 5.88 | Ki | 1335 | nM | CHEMBL_ACT_7666387 |
| HTR2B | 5.87 | AC50 | 1342 | nM | CHEMBL_ACT_25164054 |
| P43140 | 5.87 | IC50 | 1348 | nM | CHEMBL_ACT_7662154 |
| ADRA2A | 5.86 | AC50 | 1398 | nM | CHEMBL_ACT_25155884 |
Target pathways
Aggregated over 3 target gene(s): ADRA2A, ADRA2B, ADRA2C.
Top Reactome pathways
19 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Hemostasis | 3 | ADRA2A, ADRA2B, ADRA2C |
| Signal Transduction | 3 | ADRA2A, ADRA2B, ADRA2C |
| Signaling by GPCR | 3 | ADRA2A, ADRA2B, ADRA2C |
| Class A/1 (Rhodopsin-like receptors) | 3 | ADRA2A, ADRA2B, ADRA2C |
| Amine ligand-binding receptors | 3 | ADRA2A, ADRA2B, ADRA2C |
| GPCR downstream signalling | 3 | ADRA2A, ADRA2B, ADRA2C |
| Adrenoceptors | 3 | ADRA2A, ADRA2B, ADRA2C |
| Adrenaline signalling through Alpha-2 adrenergic receptor | 3 | ADRA2A, ADRA2B, ADRA2C |
| G alpha (i) signalling events | 3 | ADRA2A, ADRA2B, ADRA2C |
| G alpha (z) signalling events | 3 | ADRA2A, ADRA2B, ADRA2C |
| GPCR ligand binding | 3 | ADRA2A, ADRA2B, ADRA2C |
| Platelet activation, signaling and aggregation | 3 | ADRA2A, ADRA2B, ADRA2C |
| Platelet Aggregation (Plug Formation) | 3 | ADRA2A, ADRA2B, ADRA2C |
| Metabolism | 2 | ADRA2A, ADRA2C |
| Integration of energy metabolism | 2 | ADRA2A, ADRA2C |
| Metabolism of proteins | 2 | ADRA2A, ADRA2C |
| Adrenaline,noradrenaline inhibits insulin secretion | 2 | ADRA2A, ADRA2C |
| Regulation of insulin secretion | 2 | ADRA2A, ADRA2C |
| Surfactant metabolism | 2 | ADRA2A, ADRA2C |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| epidermal growth factor receptor signaling pathway | 3 |
| G protein-coupled receptor signaling pathway | 3 |
| negative regulation of norepinephrine secretion | 3 |
| regulation of vasoconstriction | 3 |
| platelet activation | 3 |
| negative regulation of epinephrine secretion | 3 |
| positive regulation of MAPK cascade | 3 |
| positive regulation of phosphatidylinositol 3-kinase/protein kinase B signal transduction | 3 |
| adrenergic receptor signaling pathway | 3 |
| adenylate cyclase-inhibiting adrenergic receptor signaling pathway | 3 |
| regulation of smooth muscle contraction | 3 |
| signal transduction | 3 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 2 |
| female pregnancy | 2 |
| negative regulation of insulin secretion | 2 |
Indications & clinical
Indications
17 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| hypertensive disorder | 4 | MONDO:0005044 | EFO:0000537 |
| Tourette syndrome | 3 | MONDO:0007661 | EFO:0004895 |
| delirium | 3 | MONDO:0045057 | EFO:0009267 |
| Alzheimer disease | 3 | MONDO:0004975 | MONDO:0004975 |
| cocaine dependence | 2 | MONDO:0005186 | EFO:0002610 |
| stroke disorder | 2 | MONDO:0005098 | EFO:0000712 |
| attention deficit-hyperactivity disorder | 2 | MONDO:0007743 | EFO:0003888 |
| nicotine dependence | 2 | MONDO:0008575 | EFO:0003768 |
| drug dependence | 2 | MONDO:0005303 | EFO:0003890 |
| cannabis dependence | 2 | MONDO:0005689 | EFO:0007191 |
| trigeminal neuralgia | 2 | MONDO:0008599 | EFO:1001219 |
| schizotypal personality disorder | 2 | MONDO:0001087 | MONDO:0001087 |
| alcohol abuse | 2 | MONDO:0002046 | MONDO:0007079 |
| depressive disorder | 2 | MONDO:0002050 | MONDO:0002050 |
| post-traumatic stress disorder | 1 | MONDO:0005146 | EFO:0001358 |
2 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 46.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 14 |
| PHASE2 | 12 |
| Not specified | 10 |
| PHASE3 | 5 |
| PHASE1 | 5 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT07300956 | PHASE4 | NOT_YET_RECRUITING | Treating Young Children With Attention Deficit Hyperactivity Disorder |
| NCT00353379 | PHASE4 | TERMINATED | Pharmacology of Cognition in Schizotypal Personality Disorder |
| NCT00429273 | PHASE4 | COMPLETED | Single Versus Combination Medication Treatment for Children With Attention Deficit Hyperactivity Disorder |
| NCT00469664 | PHASE4 | UNKNOWN | Guanfacine Adjunctive Treatment to Atypical Antipsychotics for Cognitive Dysfunction in Schizophrenia |
| NCT01133847 | PHASE4 | COMPLETED | Interventions for Children With Attention and Reading Disorders |
| NCT01156051 | PHASE4 | TERMINATED | Effect of Guanfacine Extended-Release on Attention Deficit Hyperactivity Disorder (ADHD)-Associated Insomnia |
| NCT01238575 | PHASE4 | COMPLETED | Guanfacine for the Treatment of Hyperactivity in Pervasive Developmental Disorder |
| NCT01681264 | PHASE4 | TERMINATED | Effect of Guanfacine on Opioid-induced Hyperalgesia (OIH) and Tolerance |
| NCT01709695 | PHASE4 | COMPLETED | Neurobiological Basis of Response to Guanfacine Extended Release in Children and Adolescents With ADHD |
| NCT02048241 | PHASE4 | COMPLETED | Intuniv vs Placebo in the Treatment of Childhood Intermittent Explosive Disorder |
| NCT02141113 | PHASE4 | COMPLETED | Efficacy and Safety Eval of Guanfacine Hydrochloride in Combination With Psychostimulants in Adults (18-65). |
| NCT02699125 | PHASE4 | COMPLETED | Treatment of OSA Associated Hypertension With Alpha 2 Agonist or Diuretic |
| NCT04085172 | PHASE4 | COMPLETED | A Study of TAK-503 in Children and Teenagers With Attention Deficit Hyperactivity Disorder (ADHD) |
| NCT04181736 | PHASE4 | COMPLETED | The BIomarker Guided (BIG) Study for Depression |
| NCT03116126 | PHASE3 | ACTIVE_NOT_RECRUITING | Noradrenergic Add-on Therapy With Guanfacine |
| NCT00004376 | PHASE3 | COMPLETED | Phase III Randomized, Double-Blind, Placebo-Controlled Study of Guanfacine for Tourette Syndrome and Attention Deficit Hyperactivity Disorder |
| NCT00389675 | PHASE3 | TERMINATED | DORADO-AC-EX - A Long-Term Safety Extension Study to the Phase 3 DORADOC-AC Study (Protocol DAR-312) of Darusentan in Resistant Hypertension |
| NCT00389779 | PHASE3 | COMPLETED | DORADO-AC - Optimized Doses of Darusentan as Compared to an Active Control in Resistant Hypertension |
| NCT04578886 | PHASE3 | COMPLETED | The Effect of Guanfacine on Delirium in Critically Ill Patients |
| NCT06408246 | PHASE2 | RECRUITING | ACE-D Aim 3 Clinical Cognitive Trial to Enhance Translation in Depression |
| NCT00613015 | PHASE2 | COMPLETED | Stress and Medication Effects on Cocaine Cue Reactivity |
| NCT00773357 | PHASE2 | COMPLETED | Modeling Stress-precipitated Smoking Behavior for Medication Development |
| NCT00955253 | PHASE2 | COMPLETED | Guanfacine for the Treatment of Spatial Neglect and Impaired Vigilance |
| NCT01904526 | PHASE2 | COMPLETED | PK/PD Comparison of Guanfacine ER and IR |
| NCT02051309 | PHASE2 | COMPLETED | Guanfacine Clinical Trial for Smoking Cessation |
| NCT02164422 | PHASE2 | COMPLETED | Does Guanfacine Attenuate Stress-Induced Drinking? |
| NCT02524899 | PHASE2 | COMPLETED | CRT-Guanfacine for SPD |
| NCT03865940 | PHASE2 | COMPLETED | Efficacy of Guanfacine and Lidocaine Combination in Trigeminal Nerve Block for Pain Management in Trigeminal Neuropathy |
| NCT03980184 | PHASE2 | COMPLETED | Guanfacine to Improve Substance Use Outcomes in Women |
| NCT04742673 | PHASE2 | COMPLETED | Maximizing trEatment of Neurological Dysfunction Using INtravenous Guanfacine Study |
| NCT06042257 | PHASE2 | TERMINATED | Guanfacine for Hyperactivity in Children With Down Syndrome (HYPEbeGONE_DS) |
| NCT06642181 | PHASE1 | RECRUITING | Combined Guanfacine and Mindfulness Meditation as an Adjunct to Buprenorphine Maintenance in Opioid Use Disorder |
| NCT00018603 | PHASE1 | COMPLETED | Guanfacine for the Treatment of Post Traumatic Stress Disorder (PTSD) |
| NCT00223717 | PHASE1 | COMPLETED | Treatment of Supine Hypertension in Autonomic Failure |
| NCT00585754 | PHASE1 | COMPLETED | Guanfacine to Reduce Stress-Induced Cocaine/Alcohol Craving and Relapse |
| NCT01467999 | PHASE1 | COMPLETED | Open-Label Pilot Study of Guanfacine-Extended Release for the Treatment of Cannabis Dependence |
| NCT00025779 | Not specified | COMPLETED | Methylphenidate in Children and Adolescents With Pervasive Developmental Disorders |
| NCT00358969 | Not specified | UNKNOWN | Guanfacine to Treat Borderline Personality Disorder |
| NCT00935493 | Not specified | COMPLETED | Guanfacine Treatment for Prefrontal Cognitive Dysfunction in Elderly Subjects |
| NCT01600885 | Not specified | COMPLETED | The Effects of Ketamine and Guanfacine on Working Memory in Healthy Subjects |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
607 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ACLIDINIUM BROMIDE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| Afatinib | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| Almotriptan | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHENODIOL | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| NAPHAZOLINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| TAMSULOSIN | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ALFUZOSIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMISULPRIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| APRACLONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ASENAPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AZELASTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZQUINAMIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZTHIAZIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BITHIONOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BRIMONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLOROQUINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DANAZOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DARIFENACIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DEXMEDETOMIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOTHIEPIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
Related Atlas pages
- Genes: ADRA2A, ADRA2B, ADRA2C
- Diseases: hypertensive disorder, Tourette syndrome, delirium, Alzheimer disease
- Drugs: Aclidinium Bromide, Afatinib, Almotriptan, Chenodiol, Clozapine, Crizotinib, Desloratadine, Dihydroergotamine, Naphazoline, Olanzapine, Olodaterol, Paliperidone, Pramipexole, Tamsulosin, Tegaserod, Acetophenazine, Alfuzosin, Amisulpride, Amitriptyline, Amoxapine, Apomorphine, Apraclonidine, Aripiprazole, Asenapine, Astemizole, Azelastine, Bazedoxifene, Benfluorex, Benperidol, Benzbromarone, Benzquinamide, Benzthiazide, Benztropine, Bithionol, Brexpiprazole, Brimonidine, Bromocriptine, Bromperidol, Cabergoline, Candesartan Cilexetil, Cariprazine, Carvedilol, Chlorhexidine, Chloroquine, Chlorpromazine, Cinnarizine, Cisapride, Clemastine, Clomipramine, Clonidine, Clotrimazole, Cyproheptadine, Danazol, Darifenacin, Dexmedetomidine, Diethylstilbestrol, Dobutamine, Domperidone, Dothiepin