Halofantrine
drugOn this page
Also known as DL-WR-171669HalofantrinaHalofantrinHALOFANTRINE.HCLHalofantrine hydrochlorideÊHalofantrine_HCLHalofantrine hydrochlorideÂ
Summary
Halofantrine (CHEMBL1107) is an approved small molecule (ATC P01BX01) targeting KCNH2; indicated across 1 condition including malaria.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: P01BX01
- Targets: 1 (KCNH2)
- Indications: 1 condition
- Chemistry: 500.4 Da · C26H30Cl2F3NO
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1107 |
| Name | Halofantrine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 37393 |
| ATC | P01BX01 |
| Molecular formula | C26H30Cl2F3NO |
| Molecular weight | 500.4 |
| InChIKey | FOHHNHSLJDZUGQ-UHFFFAOYSA-N |
SMILES: CCCCN(CCCC)CCC(C1=C2C=CC(=CC2=C3C=C(C=C(C3=C1)Cl)Cl)C(F)(F)F)O
IUPAC name: 3-(dibutylamino)-1-[1,3-dichloro-6-(trifluoromethyl)phenanthren-9-yl]propan-1-ol
Also known as: DL-WR-171669, Halofantrina, Halofantrine, halofantrine, Halofantrin, HALOFANTRINE, HALOFANTRINE.HCL, Halofantrine hydrochlorideÊ, Halofantrine_HCL, Halofantrine hydrochlorideÂ
Parent form; salt/anhydrous children: CHEMBL1200901, CHEMBL1966423
Patent coverage: 2,223 distinct patent families (9,722 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 9,690 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| KCNH2 | Kv11.1 | Inhibition | 7.4 | 0.3% | Q12809 |
Broader ChEMBL bioactivity targets: 3 (assay-derived). Sample: Voltage-gated L-type calcium channel, Sodium-dependent dopamine transporter, Voltage-gated inwardly rectifying potassium channel KCNH2.
Bioactivity
ChEMBL activities: 15 potent at pChembl ≥ 5 of 16 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| KCNH2 | 7.4 | IC50 | 40 | nM | CHEMBL_ACT_1449649 |
| KCNH2 | 7.4 | IC50 | 40 | nM | CHEMBL_ACT_2395357 |
| KCNH2 | 6.81 | IC50 | 156 | nM | CHEMBL_ACT_18062974 |
| KCNH2 | 6.8 | IC50 | 160 | nM | CHEMBL_ACT_24959578 |
| KCNH2 | 6.8 | IC50 | 160 | nM | CHEMBL_ACT_29118759 |
| KCNH2 | 6.71 | IC50 | 196 | nM | CHEMBL_ACT_306562 |
| KCNH2 | 6.71 | IC50 | 195 | nM | CHEMBL_ACT_5218932 |
| KCNH2 | 6.7 | IC50 | 199.5 | nM | CHEMBL_ACT_1033547 |
| KCNH2 | 6.7 | IC50 | 199.5 | nM | CHEMBL_ACT_1427122 |
| KCNH2 | 6.7 | IC50 | 199.5 | nM | CHEMBL_ACT_1523672 |
| KCNH2 | 6.7 | IC50 | 199.5 | nM | CHEMBL_ACT_2358303 |
| KCNH2 | 6.7 | IC50 | 199.5 | nM | CHEMBL_ACT_2645520 |
| KCNH2 | 6.21 | AC50 | 620 | nM | CHEMBL_ACT_25118602 |
| CACNA1F | 5.72 | IC50 | 1900 | nM | CHEMBL_ACT_15373330 |
| KCNH2 | 5.12 | Ki | 7500 | nM | CHEMBL_ACT_13860055 |
Target pathways
Aggregated over 1 target gene(s): KCNH2.
Top Reactome pathways
6 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Neuronal System | 1 | KCNH2 |
| Potassium Channels | 1 | KCNH2 |
| Voltage gated Potassium channels | 1 | KCNH2 |
| Muscle contraction | 1 | KCNH2 |
| Phase 3 - rapid repolarisation | 1 | KCNH2 |
| Cardiac conduction | 1 | KCNH2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of heart rate by hormone | 1 |
| potassium ion transport | 1 |
| regulation of membrane potential | 1 |
| positive regulation of DNA-templated transcription | 1 |
| potassium ion homeostasis | 1 |
| cardiac muscle contraction | 1 |
| regulation of membrane repolarization | 1 |
| regulation of ventricular cardiac muscle cell membrane repolarization | 1 |
| cellular response to xenobiotic stimulus | 1 |
| potassium ion transmembrane transport | 1 |
| ventricular cardiac muscle cell action potential | 1 |
| membrane repolarization | 1 |
| membrane depolarization during action potential | 1 |
| membrane repolarization during action potential | 1 |
| membrane repolarization during cardiac muscle cell action potential | 1 |
Indications & clinical
Indications
1 indication (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| malaria | 4 | MONDO:0005136 | EFO:0001068 |
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
617 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | KCNH2 |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | KCNH2 |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | KCNH2 |
| MAVORIXAFOR | ChEMBL + PubChem | Phase 4 (approved) | KCNH2 |
| PIMAVANSERIN | ChEMBL + PubChem | Phase 4 (approved) | KCNH2 |
| PROPOXYPHENE | ChEMBL + PubChem | Phase 4 (approved) | KCNH2 |
| RELUGOLIX | ChEMBL + PubChem | Phase 4 (approved) | KCNH2 |
| RIOCIGUAT | ChEMBL + PubChem | Phase 4 (approved) | KCNH2 |
| VORAPAXAR | ChEMBL + PubChem | Phase 4 (approved) | KCNH2 |
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | KCNH2 |
| ACENOCOUMAROL | ChEMBL | Phase 4 (approved) | KCNH2 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| ACLIDINIUM BROMIDE | ChEMBL | Phase 4 (approved) | KCNH2 |
| ALBENDAZOLE | ChEMBL | Phase 4 (approved) | KCNH2 |
| ALMOTRIPTAN | ChEMBL | Phase 4 (approved) | KCNH2 |
| ALOSETRON | ChEMBL | Phase 4 (approved) | KCNH2 |
| ALPIDEM | ChEMBL | Phase 4 (approved) | KCNH2 |
| AMBENONIUM | ChEMBL | Phase 4 (approved) | KCNH2 |
| AMCINONIDE | ChEMBL | Phase 4 (approved) | KCNH2 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | KCNH2 |
| AMISULPRIDE | ChEMBL | Phase 4 (approved) | KCNH2 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| AMODIAQUINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| AMOROLFINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| AMSACRINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| ANISOTROPINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| ANTAZOLINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | KCNH2 |
| ASCIMINIB | ChEMBL | Phase 4 (approved) | KCNH2 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | KCNH2 |
| ATOMOXETINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| ATRACURIUM | ChEMBL | Phase 4 (approved) | KCNH2 |
| AVATROMBOPAG | ChEMBL | Phase 4 (approved) | KCNH2 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | KCNH2 |
| BEDAQUILINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | KCNH2 |
| BENOXINATE | ChEMBL | Phase 4 (approved) | KCNH2 |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | KCNH2 |
| BENZPHETAMINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| BENZYDAMINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | KCNH2 |
| BERBERINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| BETRIXABAN | ChEMBL | Phase 4 (approved) | KCNH2 |
| BEXAROTENE | ChEMBL | Phase 4 (approved) | KCNH2 |
| BIFONAZOLE | ChEMBL | Phase 4 (approved) | KCNH2 |
| BIPERIDEN | ChEMBL | Phase 4 (approved) | KCNH2 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | KCNH2 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | KCNH2 |
| BROMHEXINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | KCNH2 |
| BUCLIZINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| BUFLOMEDIL | ChEMBL | Phase 4 (approved) | KCNH2 |
| BUPIVACAINE | ChEMBL | Phase 4 (approved) | KCNH2 |
| BUPRENORPHINE | ChEMBL | Phase 4 (approved) | KCNH2 |
Related Atlas pages
- Genes: KCNH2
- Diseases: malaria
- Drugs: Afatinib, Dihydroergotamine, Mavorixafor, Pimavanserin, Propoxyphene, Relugolix, Riociguat, Vorapaxar, Abemaciclib, Acenocoumarol, Acetophenazine, Aclidinium Bromide, Albendazole, Almotriptan, Alosetron, Alpidem, Ambenonium, Amcinonide, Amiodarone, Amisulpride, Amitriptyline, Amlodipine, Amodiaquine, Amorolfine, Amoxapine, Amsacrine, Anisotropine, Antazoline, Apomorphine, Aripiprazole, Asciminib, Asenapine, Astemizole, Atomoxetine, Atracurium, Avatrombopag, Azelastine, Bazedoxifene, Bedaquiline, Benfluorex, Benoxinate, Benperidol, Benzphetamine, Benztropine, Benzydamine, Bepridil, Berberine, Betrixaban, Bexarotene, Bifonazole, Biperiden, Bithionol, Bosutinib, Bromhexine, Bromperidol, Buclizine, Buflomedil, Bupivacaine, Buprenorphine