Haloperidol
drugOn this page
Also known as DolpinDozicFortunanHaldolHaldol solutabHaloperidol component of vesaliumHaloperidol decanoate impurityhaloperidol-KentaceKeselenMCN-JR-1625NSC-170973NSC-615296R-1625SerenacehaloperidoleSID11111260SID11112116SID11113356
Summary
Haloperidol (CHEMBL54) is an approved small-molecule serotonergic antagonist (ATC N05AD01) targeting HTR7, HTR1A, and DRD1; indicated across 23 conditions including psychotic disorder and tourette syndrome.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N05AD01
- Targets: 14 (HTR7, HTR1A, DRD1…)
- Indications: 23 conditions
- Clinical trials: 126
- Chemistry: 375.9 Da · C21H23ClFNO2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL54 |
| Name | Haloperidol |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 3559 |
| ChEBI | CHEBI:5613 |
| ATC | N05AD01 |
| Molecular formula | C21H23ClFNO2 |
| Molecular weight | 375.9 |
| InChIKey | LNEPOXFFQSENCJ-UHFFFAOYSA-N |
SMILES: C1CN(CCC1(C2=CC=C(C=C2)Cl)O)CCCC(=O)C3=CC=C(C=C3)F
IUPAC name: 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-1-(4-fluorophenyl)butan-1-one
ChEBI definition: A compound composed of a central piperidine structure with hydroxy and p-chlorophenyl substituents at position 4 and an N-linked p-fluorobutyrophenone moiety.
Pharmacological roles (ChEBI): serotonergic antagonist, first generation antipsychotic, dopaminergic antagonist, antidyskinesia agent, antiemetic.
Also known as: Dolpin, Dozic, Fortunan, Haldol, Haldol solutab, Haloperidol, Haloperidol component of vesalium, Haloperidol decanoate impurity, haloperidol-, Kentace, Keselen, MCN-JR-1625
Parent form; salt/anhydrous children: CHEMBL545608, CHEMBL1160253, CHEMBL2096643, CHEMBL2234294, CHEMBL4297147
Patent coverage: 18,134 distinct patent families (60,883 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HTR7 | 5-HT7 receptor | Antagonist | 6.6 | 0.8% | P34969 |
| HTR1A | 5-HT1A receptor | Antagonist | 5.8 | 0% | P08908 |
| DRD1 | D1 receptor | Antagonist | 8.2 | 0% | P21728 |
| DRD2 | D2 receptor | Antagonist | 8.8 | 0% | P14416 |
| DRD3 | D3 receptor | Antagonist | 8.6 | 0% | P35462 |
| DRD4 | D4 receptor | Antagonist | 8.8 | 0% | P21917 |
| DRD5 | D5 receptor | Antagonist | 6.3 | 0% | P21918 |
| HRH1 | H1 receptor | Antagonist | 6.1 | 0% | P35367 |
| HTR1D | 5-HT1D receptor | Antagonist | 6.6 | 0% | P28221 |
| KCNJ6 | Kir3.2 | Antagonist | 4.1 | 0.1% | P48051 |
| KCNH1 | Kv10.1 | 6.2 | 0.2% | O95259 | |
| TAS2R10 | TAS2R10 | Agonist | 2.2% | Q9NYW0 | |
| HTR2A | 5-HT2A receptor | Antagonist | 7.3 | 0% | P28223 |
| HTR2B | 5-HT2B receptor | Antagonist | 6.4 | 0.4% | P41595 |
Broader ChEMBL bioactivity targets: 112 (assay-derived). Sample: Nuclear receptor ROR-gamma, Thrombopoietin, Peripheral myelin protein 22, AP-2 complex subunit sigma, 5-hydroxytryptamine receptor 2B, D(1B) dopamine receptor, Alpha-2A adrenergic receptor, Glutamate receptor ionotropic, NMDA 2B, Muscarinic acetylcholine receptor, Adrenergic receptor alpha-1.
Bioactivity
ChEMBL activities: 937 potent at pChembl ≥ 5 of 964 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| DRD3 | 10.22 | IC50 | 0.06 | nM | CHEMBL_ACT_14996266 |
| P61169 | 10.12 | IC50 | 0.07 | nM | CHEMBL_ACT_688088 |
| DRD2 | 9.92 | Ki | 0.12 | nM | CHEMBL_ACT_22850778 |
| DRD2 | 9.92 | Ki | 0.12 | nM | CHEMBL_ACT_946241 |
| DRD2 | 9.8 | IC50 | 0.16 | nM | CHEMBL_ACT_14996282 |
| DRD2 | 9.8 | IC50 | 0.16 | nM | CHEMBL_ACT_19231548 |
| DRD2 | 9.8 | Ki | 0.16 | nM | CHEMBL_ACT_339467 |
| DRD2 | 9.8 | Ki | 0.16 | nM | CHEMBL_ACT_420301 |
| SIGMAR1 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_1483734 |
| P61169 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_162079 |
| P61169 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_246567 |
| P61169 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_306788 |
| P61169 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_333463 |
| SIGMAR1 | 9.68 | Ki | 0.21 | nM | CHEMBL_ACT_18082133 |
| DRD2 | 9.6 | Ki | 0.25 | nM | CHEMBL_ACT_18204404 |
| DRD3 | 9.6 | IC50 | 0.25 | nM | CHEMBL_ACT_19231542 |
| DRD2 | 9.58 | Ki | 0.26 | nM | CHEMBL_ACT_23175808 |
| P18901 | 9.55 | IC50 | 0.28 | nM | CHEMBL_ACT_567587 |
| P20288 | 9.52 | Ki | 0.3 | nM | CHEMBL_ACT_162082 |
| P61169 | 9.48 | Ki | 0.33 | nM | CHEMBL_ACT_302874 |
| SIGMAR1 | 9.48 | Ki | 0.33 | nM | CHEMBL_ACT_772380 |
| P61169 | 9.43 | Ki | 0.37 | nM | CHEMBL_ACT_437594 |
| P61169 | 9.43 | Ki | 0.37 | nM | CHEMBL_ACT_784829 |
| P18901 | 9.4 | IC50 | 0.4 | nM | CHEMBL_ACT_731994 |
| DRD2 | 9.38 | Ki | 0.42 | nM | CHEMBL_ACT_18204398 |
| SIGMAR1 | 9.36 | Ki | 0.44 | nM | CHEMBL_ACT_1278542 |
| DRD2 | 9.36 | Ki | 0.44 | nM | CHEMBL_ACT_339468 |
| DRD2 | 9.36 | Ki | 0.44 | nM | CHEMBL_ACT_772378 |
| DRD2 | 9.33 | Ki | 0.47 | nM | CHEMBL_ACT_19311582 |
| P61169 | 9.33 | Ki | 0.47 | nM | CHEMBL_ACT_450414 |
Target pathways
Aggregated over 14 target gene(s): HTR7, HTR1A, DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1D, KCNJ6, KCNH1, TAS2R10, HTR2A, HTR2B.
Top Reactome pathways
29 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 6 | HTR1A, HTR1D, HTR2A, HTR2B, HTR7, TAS2R10 |
| Signaling by GPCR | 6 | HTR1A, HTR1D, HTR2A, HTR2B, HTR7, TAS2R10 |
| GPCR ligand binding | 6 | HTR1A, HTR1D, HTR2A, HTR2B, HTR7, TAS2R10 |
| Class A/1 (Rhodopsin-like receptors) | 5 | HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| Amine ligand-binding receptors | 5 | HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| GPCR downstream signalling | 5 | HTR1D, HTR2A, HTR2B, HTR7, TAS2R10 |
| Dopamine receptors | 5 | DRD1, DRD2, DRD3, DRD4, DRD5 |
| Serotonin receptors | 5 | HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| G alpha (i) signalling events | 4 | DRD3, DRD4, HTR1D, TAS2R10 |
| G alpha (q) signalling events | 3 | HRH1, HTR2A, HTR2B |
| G alpha (s) signalling events | 3 | DRD1, DRD5, HTR7 |
| Neuronal System | 2 | KCNH1, KCNJ6 |
| Potassium Channels | 2 | KCNH1, KCNJ6 |
| Neurotransmitter receptors and postsynaptic signal transmission | 1 | KCNJ6 |
| Transmission across Chemical Synapses | 1 | KCNJ6 |
| Activation of G protein gated Potassium channels | 1 | KCNJ6 |
| G protein gated Potassium channels | 1 | KCNJ6 |
| Inwardly rectifying K+ channels | 1 | KCNJ6 |
| Voltage gated Potassium channels | 1 | KCNH1 |
| Histamine receptors | 1 | HRH1 |
| Class C/3 (Metabotropic glutamate/pheromone receptors) | 1 | TAS2R10 |
| RHOBTB3 ATPase cycle | 1 | HTR7 |
| Sensory Perception | 1 | TAS2R10 |
| Sensory perception of taste | 1 | TAS2R10 |
| Sensory perception of sweet, bitter, and umami (glutamate) taste | 1 | TAS2R10 |
| GABA receptor activation | 1 | KCNJ6 |
| GABA B receptor activation | 1 | KCNJ6 |
| Activation of GABAB receptors | 1 | KCNJ6 |
| Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits | 1 | KCNJ6 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| signal transduction | 12 |
| G protein-coupled receptor signaling pathway | 12 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 8 |
| chemical synaptic transmission | 8 |
| intracellular calcium ion homeostasis | 6 |
| G protein-coupled serotonin receptor signaling pathway | 5 |
| response to xenobiotic stimulus | 5 |
| behavioral response to cocaine | 5 |
| phospholipase C-activating dopamine receptor signaling pathway | 5 |
| synaptic transmission, dopaminergic | 5 |
| response to cocaine | 5 |
| adenylate cyclase-activating G protein-coupled receptor signaling pathway | 4 |
| response to amphetamine | 4 |
| visual learning | 4 |
| smooth muscle contraction | 3 |
Indications & clinical
Indications
23 indications (7 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| psychotic disorder | 4 | MONDO:0005485 | EFO:0005407 |
| Tourette syndrome | 4 | MONDO:0007661 | EFO:0004895 |
| conduct disorder | 4 | MONDO:0005352 | EFO:0004216 |
| schizoaffective disorder | 4 | MONDO:0005487 | EFO:0005411 |
| mental disorder | 4 | MONDO:0005084 | EFO:0000677 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| delirium | 3 | MONDO:0045057 | EFO:0009267 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| Alzheimer disease | 3 | MONDO:0004975 | MONDO:0004975 |
| bipolar disorder | 3 | MONDO:0004985 | MONDO:0004985 |
| mood disorder | 2 | MONDO:0005371 | EFO:0004247 |
| methamphetamine dependence | 2 | MONDO:0005419 | EFO:0004701 |
| nicotine dependence | 1 | MONDO:0008575 | EFO:0003768 |
| Huntington disease | 1 | MONDO:0007739 | MONDO:0007739 |
8 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 126.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 43 |
| Not specified | 29 |
| PHASE3 | 28 |
| PHASE2 | 12 |
| PHASE2/PHASE3 | 6 |
| PHASE1 | 6 |
| PHASE1/PHASE2 | 1 |
| EARLY_PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT06395428 | PHASE4 | RECRUITING | Haloperidol for Pain Control in Patients With Acute Musculoskeletal Back Pain in the Emergency Department |
| NCT07109245 | PHASE4 | RECRUITING | Do Antipsychotics Block Insulin Action in the Brain: is it a Class Effect? |
| NCT00007774 | PHASE4 | COMPLETED | To Determine if Olanzapine is More Cost Effective Than Haloperidol for the Treatment of Schizophrenia |
| NCT00157378 | PHASE4 | UNKNOWN | Optimization of Acute Treatment in First Episode Schizophrenia |
| NCT00159081 | PHASE4 | COMPLETED | One Year Drug Treatment in First-Episode Schizophrenia |
| NCT00169091 | PHASE4 | TERMINATED | Clozapine Versus Haloperidol for Treating the First Episode of Schizophrenia |
| NCT00191555 | PHASE4 | COMPLETED | Efficacy Study of Switching Stabilized Schizophrenic Patients From Conventional to Atypical Antipsychotic Treatment |
| NCT00253110 | PHASE4 | COMPLETED | A Comparison of Risperidone With Haloperidol in Patients With Schizophrenia and Schizoaffective Disorder |
| NCT00419653 | PHASE4 | TERMINATED | Modulation of Regional Brain Activation in Schizophrenic Patients by Pharmacological Therapy |
| NCT00433121 | PHASE4 | COMPLETED | Discontinuation of Antipsychotics and Antidepressants Among Patients With BPSD |
| NCT00457366 | PHASE4 | COMPLETED | A Comparison Study of the Efficacy of Quetiapine and Haloperidol in Agitated Adults in Emergency Room |
| NCT00767715 | PHASE4 | TERMINATED | A Study in the Treatment of Acute Mania |
| NCT00838032 | PHASE4 | UNKNOWN | Pilot Study to Evaluate the Efficacy and Safety of Quetiapine Fumarate Instant-Release (Seroquel IR) in Controlling Agitation and Aggressive Symptoms in the Acute Treatment of Patients With Schizophrenia |
| NCT00859872 | PHASE4 | COMPLETED | Efficacy and Safety of Risperidone Oral Solution Combination Clonazepam Versus Haloperidol Intramuscular (IM) Injection for Treatment of Acute Psychotic Agitation in Schizophrenia |
| NCT01052389 | PHASE4 | COMPLETED | Pragmatic RCT Comparing Aripiprazole, Olanzapine and Haloperidol in the Treatment of Schizophrenia |
| NCT01157351 | PHASE4 | COMPLETED | 15 Month Study for Adults Who Have Been Diagnosed With Schizophrenia and Incarcerated |
| NCT01161277 | PHASE4 | COMPLETED | Effects of Aripiprazole and Haloperidol on Mesolimbic System Functioning |
| NCT01164059 | PHASE4 | COMPLETED | Clinical Effectiveness of Newer Antipsychotics in Comparison With Conventional Antipsychotics in Schizophrenia |
| NCT01193166 | PHASE4 | WITHDRAWN | Twelve Month Study Comparing Paliperidone Palmitate and Select Oral Antipsychotics in Adults With Schizophrenia Who Have Been Recently Discharged From an Inpatient Psychiatric Hospital |
| NCT01530308 | PHASE4 | COMPLETED | Haloperidol Prophylaxis in Older Emergency Department Patients |
| NCT01785290 | PHASE4 | COMPLETED | pRophylactic halopEriDol Use for Delirium in iCu patiEnts With a High Risk for Delirium |
| NCT02057549 | PHASE4 | TERMINATED | Haloperidol vs Conventional Therapy for Gastroparesis |
| NCT02098499 | PHASE4 | WITHDRAWN | Haldol/Diphenhydramine Versus Metoclopramide/Diphenhydramine for Treatment of Acute Headache in the ED: A RCT |
| NCT02103881 | PHASE4 | WITHDRAWN | Ketamine Versus Haloperidol for Severe Agitation Outside the Hospital |
| NCT02199743 | PHASE4 | COMPLETED | Lurasidone Effects on Tissue Glutamate in Schizophrenia |
| NCT02213900 | PHASE4 | COMPLETED | Preventing Post-Operative Delirium in Patients Undergoing a Pneumonectomy, Esophagectomy or Thoracotomy |
| NCT02307396 | PHASE4 | COMPLETED | Evaluation of the Necessity of Long-term Pharmacological Treatment With Antipsychotics in Schizophrenic Patients |
| NCT02343575 | PHASE4 | TERMINATED | Valproic Acid for Treatment of Hyperactive or Mixed Delirium in ICU |
| NCT02380118 | PHASE4 | TERMINATED | IM Olanzapine Versus Haloperidol or Midazolam |
| NCT02433041 | PHASE4 | COMPLETED | Baden Prevention and Reduction of Incidence of Postoperative Delirium Trial |
| NCT02747511 | PHASE4 | COMPLETED | IV Haloperidol for the Treatment of Headache in the ED |
| NCT02909465 | PHASE4 | COMPLETED | Reducing Ketamine-Induced Agitation, by Midazolam or Haloperidol Premedication After Adult Procedural Sedation |
| NCT02972502 | PHASE4 | TERMINATED | Efficacy of Haloperidol vs. Metoclopramide for Treatment of Acute Headaches and Migraines in the Emergency Department |
| NCT03056482 | PHASE4 | COMPLETED | Haloperidol Versus Ondansetron for Cannabis Hyperemesis Syndrome (HaVOC) |
| NCT03075657 | PHASE4 | COMPLETED | Study of add-on Ramelteon Therapy on Sleep and Circadian Rhythm Disruption in Patients With Schizophrenia |
| NCT03110900 | PHASE4 | TERMINATED | Inhaled Loxapine vs Intramuscular (IM) Haloperidol + Lorazepam for Agitation |
| NCT03199950 | PHASE4 | UNKNOWN | PROfylactic Haloperidol in Patients Defined as High Risk for DElirium With Delirium Risk mOdel |
| NCT03392376 | PHASE4 | UNKNOWN | Agents Intervening Against Delirium in Intensive Care Unit |
| NCT03489551 | PHASE4 | COMPLETED | Feasibility of Prophylactic Haldol to Prevent Delirium in Cancer Patients |
| NCT03639558 | PHASE4 | COMPLETED | TREC-Lebanon: A Trial for Rapid Tranquilisation for Agitated Patients in the Emergency Setting |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (1) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of DPWG Guideline for haloperidol and CYP2D6 | DPWG | CYP2D6 | yes | yes |
PharmGKB also curates 10 clinical and 65 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
891 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| IMIPRAMINE | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR1D, HTR2A, HTR2B, HTR7, KCNH1 |
| BREXPIPRAZOLE | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| Dihydroergotamine | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| RISPERIDONE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| PENFLURIDOL | ChEMBL | Phase 2 | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| DOXEPIN | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| KETANSERIN | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| LOXAPINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| MIANSERIN | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| PROMAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| TEGASEROD | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| LYSERGIDE | ChEMBL | Phase 2 | DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1D, HTR2A, HTR7 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR2A, HTR2B |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR2A, HTR2B |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR2A, HTR2B |
| QUETIAPINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| ROPINIROLE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR2A, HTR2B |
| SILODOSIN | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR1D, HTR2B, HTR7 |
| THIORIDAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| THIOTHIXENE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| ZIPRASIDONE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| RITANSERIN | ChEMBL | Phase 2 | DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1A, HTR2A, HTR7 |
| SPIPERONE | ChEMBL | Phase 2 | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| SPIRAMIDE | ChEMBL | Phase 2 | DRD2, DRD3, DRD4, HRH1, HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| Pyrazinamide | PubChem | Approved | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B |
| Fidaxomicin | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B |
| Propoxyphene | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B |
| TAMSULOSIN | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B |
| AZELASTINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HRH1, HTR1D, HTR2A, HTR2B, HTR7 |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HTR1A, HTR2A, HTR2B, HTR7 |
| CINACALCET | ChEMBL | Phase 4 (approved) | DRD2, DRD3, HRH1, HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| EBASTINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B |
| ILOPERIDONE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B |
| KETOTIFEN | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD5, HRH1, HTR2A, HTR2B, HTR7 |
| LURASIDONE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| MAPROTILINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD5, HRH1, HTR1A, HTR2A, HTR2B |
| METHYSERGIDE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HRH1, HTR1A, HTR2A, HTR2B, HTR7 |
| PERGOLIDE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B |
| PROCHLORPERAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B |
| PROMETHAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B |
| ROTIGOTINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B |
| SALMETEROL | ChEMBL | Phase 4 (approved) | DRD2, DRD3, DRD4, HTR1A, HTR1D, HTR2A, HTR2B, HTR7 |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, DRD4, HRH1, HTR1A, HTR2A, HTR2B |
Related Atlas pages
- Genes: HTR7, HTR1A, DRD1, DRD2, DRD3, DRD4, DRD5, HRH1, HTR1D, KCNJ6, KCNH1, TAS2R10, HTR2A, HTR2B
- Diseases: psychotic disorder, Tourette syndrome, conduct disorder, schizoaffective disorder, mental disorder, anxiety, dementia, delirium, depressive disorder, Alzheimer disease, bipolar disorder
- Drugs: Imipramine, Brexpiprazole, Dihydroergotamine, Aripiprazole, Cariprazine, Risperidone, Clozapine, Olanzapine, Pramipexole, Amoxapine, Chlorpromazine, Doxepin, Fluphenazine, Ketanserin, Loxapine, Mianserin, Nefazodone, Promazine, Tegaserod, Paliperidone, Amitriptyline, Apomorphine, Astemizole, Cabergoline, Quetiapine, Ropinirole, Silodosin, Thioridazine, Thiothixene, Ziprasidone, Pyrazinamide, Desloratadine, Fidaxomicin, Propoxyphene, Tamsulosin, Asenapine, Azelastine, Benperidol, Carvedilol, Cinacalcet, Cisapride, Cyproheptadine, Ebastine, Iloperidone, Ketotifen, Lurasidone, Maprotiline, Methysergide, Pergolide, Pimozide, Prochlorperazine, Promethazine, Rotigotine, Salmeterol, Sertindole