Hydrocortisone
drugOn this page
Also known as Acetasol hcActicortAeroseb-hcAla-cortAla-scalpAlkindiAlkindi sprinkleAlphadermAnflamAnugesic hcAnusol hcAnusol plus hcAnusol soothing reliefAnucort-hcAnusol-hcBalneol-hcBeta-hcCalmurid hcCanesten hcCetacort
Summary
Hydrocortisone (CHEMBL389621) is an approved small-molecule anti-inflammatory drug (ATC A07EA02) targeting GPR33, NR3C1, and NR3C2; indicated across 104 conditions including eye disorder and pneumonia.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: A07EA02 (+9 more)
- Targets: 3 (GPR33, NR3C1, NR3C2)
- Indications: 104 conditions
- Clinical trials: 350
- Chemistry: 362.5 Da · C21H30O5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL389621 |
| Name | Hydrocortisone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 5754 |
| ChEBI | CHEBI:17650 |
| ATC | A07EA02, S01CB03, D07XA01, S01BA02, D07AA02, A01AC03, R01AD60, C05AA01, H02AB09, S02BA01 |
| Molecular formula | C21H30O5 |
| Molecular weight | 362.5 |
| InChIKey | JYGXADMDTFJGBT-VWUMJDOOSA-N |
SMILES: C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C)O
IUPAC name: (8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one
ChEBI definition: A 17α-hydroxy-C21-steroid that is pregn-4-ene substituted by oxo groups at positions 3 and 20 and hydroxy groups at positions 11, 17 and 21. Cortisol is a corticosteroid hormone or glucocorticoid produced by zona fasciculata of the adrenal cortex, which is a part of the adrenal gland. It is usually referred to as the “stress hormone” as it is involved in response to stress and anxiety, controlled by corticotropin-releasing hormone (CRH). It increases blood pressure and blood sugar, and reduces immune responses.
Pharmacological roles (ChEBI): anti-inflammatory drug, anti-allergic agent, anti-asthmatic drug, drug allergen.
Other ChEBI roles (chemical / environmental): human metabolite, mouse metabolite.
Also known as: Acetasol hc, Acticort, Aeroseb-hc, Ala-cort, Ala-scalp, Alkindi, Alkindi sprinkle, Alphaderm, Anflam, Anugesic hc, Anusol hc, Anusol plus hc
Patent coverage: 61,095 distinct patent families (207,645 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| GPR33 | GPR33 | Binding | 7.92 | 0% | Q49SQ1 |
| NR3C1 | Glucocorticoid receptor | Agonist | 8 | 0.9% | P04150 |
| NR3C2 | Mineralocorticoid receptor | Agonist | 9.95 | 0% | P08235 |
Broader ChEMBL bioactivity targets: 16 (assay-derived). Sample: Microtubule-associated protein tau, Survival motor neuron protein, Histone-lysine N-methyltransferase 2A, Mineralocorticoid receptor, Glucocorticoid receptor, Progesterone receptor, Corticosteroid-binding globulin, Muscarinic acetylcholine receptor M1, Glucocorticoid receptor, Nuclear factor NF-kappa-B p105 subunit.
Bioactivity
ChEMBL activities: 24 potent at pChembl ≥ 5 of 28 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NR3C2 | 9.3 | Kd | 0.5 | nM | CHEMBL_ACT_18033282 |
| NR3C2 | 8.54 | EC50 | 2.9 | nM | CHEMBL_ACT_27195983 |
| NR3C1 | 7.92 | Ki | 12 | nM | CHEMBL_ACT_7645340 |
| SERPINA6 | 7.88 | Ki | 13.18 | nM | CHEMBL_ACT_956646 |
| NFKB1 | 7.85 | Potency | 14.1 | nM | CHEMBL_ACT_3672781 |
| NFKB1 | 7.85 | Potency | 14.1 | nM | CHEMBL_ACT_4586062 |
| NR3C1 | 7.71 | AC50 | 19.3 | nM | CHEMBL_ACT_25175425 |
| P06536 | 7.6 | IC50 | 25.12 | nM | CHEMBL_ACT_23294469 |
| NR3C1 | 7.58 | IC50 | 26 | nM | CHEMBL_ACT_7645339 |
| P06537 | 7.37 | Kd | 43 | nM | CHEMBL_ACT_14698042 |
| P06536 | 7 | EC50 | 100 | nM | CHEMBL_ACT_24771868 |
| HIF1A | 6.7 | Potency | 199.5 | nM | CHEMBL_ACT_4128963 |
| HIF1A | 6.7 | Potency | 199.5 | nM | CHEMBL_ACT_4520785 |
| P08482 | 6.6 | Potency | 251.2 | nM | CHEMBL_ACT_4811427 |
| P06536 | 6.5 | IC50 | 316.2 | nM | CHEMBL_ACT_24771796 |
| SHBG | 6.2 | Kd | 631 | nM | CHEMBL_ACT_2155681 |
| SMN1 | 6.1 | Potency | 794.3 | nM | CHEMBL_ACT_3902632 |
| NR3C1 | 6.04 | AC50 | 920 | nM | CHEMBL_ACT_25115945 |
| P06536 | 5.6 | EC50 | 2512 | nM | CHEMBL_ACT_23294603 |
| MAPT | 5.35 | Potency | 4467 | nM | CHEMBL_ACT_4514786 |
| MAPT | 5.25 | Potency | 5623 | nM | CHEMBL_ACT_3947532 |
| PGR | 5.12 | AC50 | 7610 | nM | CHEMBL_ACT_25192665 |
| MAPT | 5.1 | Potency | 7943 | nM | CHEMBL_ACT_4034338 |
| KMT2A | 5.05 | Potency | 8912 | nM | CHEMBL_ACT_3785541 |
Target pathways
Aggregated over 3 target gene(s): GPR33, NR3C1, NR3C2.
Top Reactome pathways
14 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| HSP90 chaperone cycle for steroid hormone receptors (SHR) in the presence of ligand | 2 | NR3C1, NR3C2 |
| Nuclear Receptor transcription pathway | 2 | NR3C1, NR3C2 |
| SUMOylation of intracellular receptors | 2 | NR3C1, NR3C2 |
| Cellular responses to stress | 1 | NR3C2 |
| SUMOylation | 1 | NR3C2 |
| SUMO E3 ligases SUMOylate target proteins | 1 | NR3C2 |
| Metabolism of proteins | 1 | NR3C2 |
| Post-translational protein modification | 1 | NR3C2 |
| PTK6 Expression | 1 | NR3C1 |
| Regulation of RUNX2 expression and activity | 1 | NR3C1 |
| Cellular responses to stimuli | 1 | NR3C2 |
| FOXO-mediated transcription of oxidative stress, metabolic and neuronal genes | 1 | NR3C1 |
| Potential therapeutics for SARS | 1 | NR3C1 |
| Regulation of NPAS4 gene transcription | 1 | NR3C1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| signal transduction | 3 |
| regulation of DNA-templated transcription | 2 |
| regulation of transcription by RNA polymerase II | 2 |
| nuclear receptor-mediated steroid hormone signaling pathway | 2 |
| complement receptor mediated signaling pathway | 1 |
| inflammatory response | 1 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 1 |
| positive regulation of cytosolic calcium ion concentration | 1 |
| cell communication | 1 |
| G protein-coupled receptor signaling pathway | 1 |
| signaling | 1 |
| negative regulation of transcription by RNA polymerase II | 1 |
| regulation of gluconeogenesis | 1 |
| chromatin organization | 1 |
| apoptotic process | 1 |
Indications & clinical
Indications
104 indications (36 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| eye disorder | 4 | MONDO:0005328 | EFO:0005752 |
| pneumonia | 4 | MONDO:0005249 | EFO:0003106 |
| atopic conjunctivitis | 4 | MONDO:0005642 | EFO:0007141 |
| leukemia | 4 | MONDO:0005059 | EFO:0000565 |
| lymphoma | 4 | MONDO:0005062 | EFO:0000574 |
| ulcerative colitis | 4 | MONDO:0005101 | EFO:0000729 |
| herpes labialis | 4 | MONDO:0043653 | EFO:1001347 |
| atopic eczema | 4 | MONDO:0004980 | EFO:0000274 |
| Crohn disease | 4 | MONDO:0005011 | EFO:0000384 |
| otitis externa | 4 | MONDO:0004795 | EFO:0009560 |
| psoriasis | 4 | MONDO:0005083 | EFO:1001494 |
| hemorrhoid | 4 | MONDO:0004872 | EFO:0009552 |
| dermatitis | 4 | MONDO:0002406 | MONDO:0002406 |
| adrenocortical insufficiency | 4 | MONDO:0000004 | EFO:0009491 |
| asthma | 4 | MONDO:0004979 | MONDO:0004979 |
| osteoarthritis | 4 | MONDO:0005178 | MONDO:0005178 |
| congenital adrenal hyperplasia | 4 | MONDO:0018479 | MONDO:0008728 |
| rheumatoid arthritis | 4 | MONDO:0008383 | EFO:0000685 |
| skin disorder | 4 | MONDO:0005093 | EFO:0000701 |
| endocrine system disorder | 4 | MONDO:0005151 | EFO:0001379 |
| juvenile idiopathic arthritis | 4 | MONDO:0011429 | EFO:0002609 |
| psoriatic arthritis | 4 | MONDO:0011849 | EFO:0003778 |
| adrenal gland disorder | 4 | MONDO:0005495 | EFO:0005539 |
| exanthem | 4 | MONDO:0006547 | EFO:1000697 |
| seborrheic dermatitis | 4 | MONDO:0006608 | EFO:1000764 |
| type III hypersensitivity disease | 4 | MONDO:0007004 | EFO:1001222 |
| tenosynovitis | 4 | MONDO:0004855 | EFO:1001435 |
| bursitis | 4 | MONDO:0002471 | MONDO:0002471 |
| spondylitis | 4 | MONDO:0003937 | MONDO:0003937 |
| neoplasm | 4 | MONDO:0005070 | MONDO:0004992 |
| toxic shock syndrome | 3 | MONDO:0001881 | EFO:0006834 |
| alopecia areata | 3 | MONDO:0005340 | EFO:0004192 |
| cirrhosis of liver | 3 | MONDO:0005155 | EFO:0001422 |
| acute lymphoblastic leukemia | 3 | MONDO:0004967 | EFO:0000220 |
| myelodysplastic syndrome | 3 | MONDO:0018881 | EFO:0000198 |
| acute myeloid leukemia | 3 | MONDO:0018874 | EFO:0000222 |
| prostate adenocarcinoma | 3 | MONDO:0005082 | EFO:0000673 |
| hypotensive disorder | 3 | MONDO:0005468 | EFO:0005251 |
| oral submucous fibrosis | 3 | MONDO:0018166 | EFO:1001818 |
| cardiac arrest | 3 | MONDO:0000745 | EFO:0009492 |
| T-cell acute lymphoblastic leukemia | 3 | MONDO:0004963 | EFO:0000209 |
| acute erythroid leukemia | 3 | MONDO:0017858 | EFO:0000218 |
| acute monocytic leukemia | 3 | MONDO:0007896 | EFO:0000221 |
| acute myelomonocytic leukemia M4 | 3 | MONDO:0018871 | EFO:0000223 |
| acute megakaryoblastic leukemia | 3 | MONDO:0018872 | EFO:0003025 |
| acute myeloblastic leukemia without maturation | 3 | MONDO:0005224 | EFO:0003027 |
| myelodysplastic syndrome with single lineage dysplasia | 3 | MONDO:0005272 | EFO:0003802 |
| myelodysplastic syndrome with excess blasts | 3 | MONDO:0019454 | EFO:0003811 |
| influenza | 3 | MONDO:0005812 | EFO:0007328 |
| viral pneumonia | 3 | MONDO:0006012 | EFO:0007541 |
| chronic myelomonocytic leukemia | 3 | MONDO:0020311 | EFO:1001779 |
| acute biphenotypic leukemia | 3 | MONDO:0020322 | MONDO:0019460 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | MONDO:0100096 |
| B-cell acute lymphoblastic leukemia | 3 | MONDO:0004947 | EFO:0000094 |
| alcohol abuse | 3 | MONDO:0002046 | MONDO:0007079 |
| bronchopulmonary dysplasia | 3 | MONDO:0019091 | MONDO:0019091 |
| metastatic prostate carcinoma | 3 | MONDO:0004956 | EFO:0000196 |
| prostate carcinoma | 3 | MONDO:0005159 | EFO:0001663 |
| lymphoid leukemia | 3 | MONDO:0005402 | EFO:0004289 |
| heart failure | 2 | MONDO:0005252 | EFO:0003144 |
| injury | 2 | MONDO:0021178 | EFO:0000546 |
| myocardial infarction | 2 | MONDO:0005068 | EFO:0000612 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| plasma cell myeloma | 2 | MONDO:0009693 | EFO:0001378 |
| opiate dependence | 2 | MONDO:0005530 | EFO:0005611 |
| mast cell leukemia | 2 | MONDO:0020334 | EFO:0007359 |
| phobic disorder | 2 | MONDO:0003699 | EFO:1001908 |
| borderline personality disorder | 2 | MONDO:0001156 | HP:0012076 |
| atrial fibrillation | 2 | MONDO:0004981 | EFO:0000275 |
| diffuse large B-cell lymphoma | 2 | MONDO:0018905 | EFO:0000403 |
| adrenal cortex carcinoma | 2 | MONDO:0006639 | EFO:1000796 |
| central nervous system neoplasm | 2 | MONDO:0006130 | EFO:1000158 |
| chronic primary adrenal insufficiency | 2 | MONDO:0015129 | MONDO:0015128 |
| pancreatitis | 2 | MONDO:0004982 | EFO:0000278 |
| pyogenic granuloma | 2 | MONDO:0022096 | MONDO:0022096 |
| plasma cell neoplasm | 2 | MONDO:0004959 | EFO:0000200 |
| inflammatory bowel disease | 2 | MONDO:0005265 | EFO:0003767 |
| obesity disorder | 1 | MONDO:0011122 | EFO:0001073 |
| anaplastic large cell lymphoma | 1 | MONDO:0020325 | EFO:0003032 |
| nicotine dependence | 1 | MONDO:0008575 | EFO:0003768 |
| type 1 diabetes mellitus | 1 | MONDO:0005147 | MONDO:0005147 |
| HIV infectious disease | 0 | MONDO:0005109 | EFO:0000764 |
| fibromyalgia | 0 | MONDO:0005546 | EFO:0005687 |
21 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 350.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 84 |
| Not specified | 75 |
| PHASE3 | 70 |
| PHASE4 | 56 |
| PHASE1 | 28 |
| PHASE1/PHASE2 | 15 |
| EARLY_PHASE1 | 12 |
| PHASE2/PHASE3 | 10 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02775227 | PHASE4 | ACTIVE_NOT_RECRUITING | HYPAR Trial - Hydrocortisone vs. Pasireotide in Reducing Pancreatic Surgery Complications |
| NCT04082533 | PHASE4 | ACTIVE_NOT_RECRUITING | Intravenous (IV) Hydrocortisone for TKA (Total Knee Arthroplasty) |
| NCT05193396 | PHASE4 | RECRUITING | Hydrocortisone and Placebo in Patients With Symptoms of Adrenal Insufficiency After Cessation of Glucocorticoid Treatment |
| NCT05435781 | PHASE4 | RECRUITING | Effect of Supplemental Hydrocortisone During Stress in Prednisolone-induced Adrenal Insufficiency |
| NCT05836610 | PHASE4 | RECRUITING | Hydrocortisone Therapy Optimization During Hypothermia Treatment in Asphyxiated Neonates |
| NCT06289673 | PHASE4 | RECRUITING | Identification of Necessary Information for Treatment Induction in Newly Diagnosed Acute Lymphoblastic Leukemia/Lymphoma |
| NCT06892197 | PHASE4 | RECRUITING | Comparing Hydrocortisone and Prednisolone for Community Acquired Pneumonia (CAP) |
| NCT06892210 | PHASE4 | RECRUITING | Comparing Hydrocortisone and Prednisolone for Acute Exacerbation of Chronic Obstructive Pulmonary Disease (AECOPD) |
| NCT06982183 | PHASE4 | RECRUITING | The Effects of Propranolol and Hydrocortisone on Military-Relevant Performance Outcomes |
| NCT07124650 | PHASE4 | RECRUITING | Sore Throat After Open Neck Elective Surgery |
| NCT07154849 | PHASE4 | RECRUITING | Comparative Study Between the Efficacy of Intravenous Hydrocortisone and Intravenous Dexmedetomidine for Prevention of Postoperative Shivering After General Anaesthesia for Abdominal Surgeries |
| NCT07494084 | PHASE4 | NOT_YET_RECRUITING | Sleep Loss and Circadian Misalignment - Mechanisms of Insulin Resistance |
| NCT00149123 | PHASE4 | COMPLETED | Low-dose Hydrocortisone in Acutely Burned Patients |
| NCT00270777 | PHASE4 | COMPLETED | Improving Safety of Antivenom in People Bitten by Snakes |
| NCT00368381 | PHASE4 | WITHDRAWN | Hydrocortisone Versus Hydrocortisone Plus Fludrocortisone for the Treatment of Adrenal Insufficiency in Severe Sepsis |
| NCT00415701 | PHASE4 | COMPLETED | Effect of Etomidate on Hemodynamics and Adrenocortical Function After Cardiac Surgery |
| NCT00490828 | PHASE4 | COMPLETED | Influence of Hydrocortisone on Immunologic Markers and Health Care Related Quality of Life in Patients After Cardiac Surgery |
| NCT00526305 | PHASE4 | COMPLETED | LAL-Ph-2000: Treatment of Acute Lymphoblastic Leukemia Chromosome Philadelphia Positive |
| NCT00674570 | PHASE4 | COMPLETED | Veteran Stress and Learning Study |
| NCT00693693 | PHASE4 | COMPLETED | Adherence to Topical Hydrocortisone 17-butyrate 0.1% (Locoid®) Using Different Vehicles in Adults With Atopic Dermatitis |
| NCT00706173 | PHASE4 | WITHDRAWN | Trial of Hydrocortisone for Post-Traumatic Stress Disorder (PTSD) |
| NCT00709839 | PHASE4 | COMPLETED | Rapid Effects of Hydrocortisone on Glucose-induced Insulin Secretion in Healthy Humans |
| NCT00773058 | PHASE4 | UNKNOWN | Effect of Treatment With Stress-Doses Glucocorticoid in Patients With Acute Respiratory Distress Syndrome (ARDS) |
| NCT00853008 | PHASE4 | COMPLETED | Treatment of High Risk Adult Acute Lymphoblastic Leukemia |
| NCT00933023 | PHASE4 | WITHDRAWN | Mild Versus Potent Corticosteroids as Treatment for Phimosis in Children |
| NCT01070225 | PHASE4 | COMPLETED | Reversal of Acute β-Blocker Induced Bronchoconstriction |
| NCT01089075 | PHASE4 | TERMINATED | Neuropsychological Effects of Hydrocortisone in Patients With Partial Adrenal Insufficiency |
| NCT01095172 | PHASE4 | UNKNOWN | RituxiMab INDuction in Renal Transplantation |
| NCT01150409 | PHASE4 | TERMINATED | Hemodynamic and Inflammatory Effects of Abrupt Versus Tapered Corticosteroid Discontinuation in Septic Shock |
| NCT01399268 | PHASE4 | COMPLETED | Steroids in Bilateral Total Knee Replacement |
| NCT01448109 | PHASE4 | COMPLETED | ADjunctive coRticosteroid trEatment iN criticAlly ilL Patients With Septic Shock |
| NCT01546922 | PHASE4 | COMPLETED | Hydrocortisone Replacement in Patients With Secondary Adrenal Insufficiency (SUPREME CORT) |
| NCT01815918 | PHASE4 | COMPLETED | Effect of Low Dose Corticosteroids on Perioperative Markers of Thrombosis and Fibrinolysis in Total Knee Arthroplasty |
| NCT02044159 | PHASE4 | COMPLETED | Steroid Use in Pediatric Fluid and Vasoactive Infusion Dependent Shock - Pilot Study |
| NCT02190994 | PHASE4 | UNKNOWN | Effect of Perioperative Glucocorticoid Replacement on Prognosis of Surgical Patients With Sellar Lesions |
| NCT02266264 | PHASE4 | COMPLETED | Hyperglycemia and Effects of Daily 100 mg Versus 200 mg of Hydrocortisone Therapy in Patients With Septic Shock |
| NCT02277587 | PHASE4 | COMPLETED | Dual RElease Hydrocortisone Versus conventionAl Glucocorticoid replaceMent Therapy in Hypocortisolism (DREAM) |
| NCT02282150 | PHASE4 | UNKNOWN | Modified-release Compared to Conventional Hydrocortisone on Diurnal Fatigue in Secondary Hypoadrenalism |
| NCT02425852 | PHASE4 | COMPLETED | A Randomized, Multicenter Open Label Study Comparing Early Administration of Azathioprine Plus IFX to Steroids Plus Azathioprine for Acute Severe Colitis |
| NCT02760862 | PHASE4 | COMPLETED | Comparative Study Between Hydrocortisone and Mannitol in Treatment of Postdural Puncture Headache |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 0 clinical and 4 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
179 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ENZALUTAMIDE | ChEMBL + PubChem | Phase 4 (approved) | NR3C1, NR3C2 |
| EPLERENONE | ChEMBL + PubChem | Phase 4 (approved) | NR3C1, NR3C2 |
| FLUDROCORTISONE | ChEMBL + PubChem | Phase 4 (approved) | NR3C1, NR3C2 |
| BUDESONIDE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| DEXAMETHASONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| FLUTICASONE FUROATE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| FLUTICASONE PROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| HYDROCORTISONE BUTYRATE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| PREDNISOLONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| PROGESTERONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| SPIRONOLACTONE | ChEMBL | Phase 4 (approved) | NR3C1, NR3C2 |
| ASOPRISNIL | ChEMBL | Phase 3 | NR3C1, NR3C2 |
| BALCINRENONE | ChEMBL | Phase 3 | NR3C1, NR3C2 |
| METRIBOLONE | ChEMBL | Phase 2 | NR3C1, NR3C2 |
| ONAPRISTONE | ChEMBL | Phase 2 | NR3C1, NR3C2 |
| STANOLONE | ChEMBL | Phase 2 | NR3C1, NR3C2 |
| TUROFEXORATE ISOPROPYL | ChEMBL | Phase 2 | NR3C1, NR3C2 |
| FULVESTRANT | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| PODOFILOX | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| ACENOCOUMAROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| ALCLOMETASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| AMCINONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| APREPITANT | ChEMBL | Phase 4 (approved) | NR3C1 |
| AURANOFIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BECLOMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE PHOSPHORIC ACID | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE VALERATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | NR3C1 |
| CANRENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CHLORMADINONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CICLESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOBETASOL PROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOFAZIMINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CORTISONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DANAZOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEFLAZACORT | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOXIMETASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOXYCORTICOSTERONE PIVALATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEXTROTHYROXINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIENESTROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIFLORASONE DIACETATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| DROSPIRENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| EFAVIRENZ | ChEMBL | Phase 4 (approved) | NR3C1 |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | NR3C1 |
Related Atlas pages
- Genes: GPR33, NR3C1, NR3C2
- Diseases: eye disorder, pneumonia, atopic conjunctivitis, leukemia, lymphoma, ulcerative colitis, herpes labialis, atopic eczema, Crohn disease, otitis externa, psoriasis, hemorrhoid, dermatitis, adrenocortical insufficiency, asthma, osteoarthritis, congenital adrenal hyperplasia, rheumatoid arthritis, skin disorder, endocrine system disorder, juvenile idiopathic arthritis, psoriatic arthritis, adrenal gland disorder, exanthem, seborrheic dermatitis, type III hypersensitivity disease, tenosynovitis, bursitis, spondylitis, neoplasm, toxic shock syndrome, alopecia areata, cirrhosis of liver, acute lymphoblastic leukemia, myelodysplastic syndrome, acute myeloid leukemia, prostate adenocarcinoma, hypotensive disorder, oral submucous fibrosis, cardiac arrest, T-cell acute lymphoblastic leukemia, acute monocytic leukemia, acute megakaryoblastic leukemia, acute myeloblastic leukemia without maturation, myelodysplastic syndrome with single lineage dysplasia, myelodysplastic syndrome with excess blasts, influenza, viral pneumonia, chronic myelomonocytic leukemia, acute biphenotypic leukemia, severe acute respiratory syndrome, B-cell acute lymphoblastic leukemia, alcohol abuse, bronchopulmonary dysplasia, metastatic prostate carcinoma, prostate carcinoma, lymphoid leukemia
- Drugs: Enzalutamide, Eplerenone, Fludrocortisone, Budesonide, Dexamethasone, Fluticasone Furoate, Fluticasone Propionate, Hydrocortisone Butyrate, Medroxyprogesterone, Mifepristone, Prednisolone, Progesterone, Spironolactone, Asoprisnil, Balcinrenone, Fulvestrant, Podofilox, Regorafenib, Acenocoumarol, Alclometasone Dipropionate, Amcinonide, Amiodarone, Aprepitant, Auranofin, Bazedoxifene, Beclomethasone Dipropionate, Benzbromarone, Betamethasone, Betamethasone Dipropionate, Betamethasone Phosphoric Acid, Betamethasone Valerate, Butoconazole, Candesartan Cilexetil, Canrenone, Chlormadinone, Ciclesonide, Clobetasol Propionate, Clofazimine, Clotrimazole, Cortisone, Danazol, Daunorubicin, Deflazacort, Desogestrel, Desonide, Desoximetasone, Desoxycorticosterone Pivalate, Dextrothyroxine, Dienestrol, Diethylstilbestrol, Diflorasone Diacetate, Doxorubicin, Drospirenone, Econazole, Efavirenz, Estradiol