Ibuprofen
drugOn this page
Also known as Aches-n-painAdvilAdvil liqui-gelsAdvil migraine liqui-gelsAnadin joint painAnadin liquifastAnadin period pain reliefAnadin ultraApsifenApsifen-fArthrofen 200Arthrofen 400Arthrofen 600Brufen retBuranaCaldolorCap-profenChildren's advilChildren's advil-flavoredChildren's elixsure
Summary
Ibuprofen (CHEMBL521) is an approved small-molecule non-steroidal anti-inflammatory drug (ATC G02CC01) targeting SLC36A1, PTGS1, and PTGS2; indicated across 86 conditions including vaginitis and common cold; with CIViC clinical evidence for 1 variant-indication association (e.g. PIK3CA Amplification in head and neck squamous cell carcinoma).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: G02CC01 (+5 more)
- Targets: 6 (SLC36A1, PTGS1, PTGS2…)
- Indications: 86 conditions
- Clinical trials: 578
- Precision-oncology evidence (CIViC): 1 variant–indication association
- Chemistry: 206.28 Da · C13H18O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL521 |
| Name | Ibuprofen |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 3672 |
| ChEBI | CHEBI:5855 |
| ATC | G02CC01, M01AE51, M02AA13, R02AX02, C01EB16, M01AE01 |
| Molecular formula | C13H18O2 |
| Molecular weight | 206.28 |
| InChIKey | HEFNNWSXXWATRW-UHFFFAOYSA-N |
SMILES: CC(C)CC1=CC=C(C=C1)C(C)C(=O)O
IUPAC name: 2-[4-(2-methylpropyl)phenyl]propanoic acid
ChEBI definition: A monocarboxylic acid that is propionic acid in which one of the hydrogens at position 2 is substituted by a 4-(2-methylpropyl)phenyl group.
Pharmacological roles (ChEBI): non-steroidal anti-inflammatory drug, non-narcotic analgesic, cyclooxygenase 2 inhibitor, cyclooxygenase 1 inhibitor, antipyretic, radical scavenger, drug allergen, geroprotector.
Other ChEBI roles (chemical / environmental): xenobiotic, environmental contaminant.
Also known as: Aches-n-pain, Advil, Advil liqui-gels, Advil migraine liqui-gels, Anadin joint pain, Anadin liquifast, Anadin period pain relief, Anadin ultra, Apsifen, Apsifen-f, Arthrofen 200, Arthrofen 400
Parent form; salt/anhydrous children: CHEMBL1201141, CHEMBL1241153, CHEMBL3989408, CHEMBL4594450, CHEMBL5201530
Patent coverage: 70,968 distinct patent families (228,490 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SLC36A1 | Proton-coupled Amino acid Transporter 1 | Inhibition | 3.02 | 0.2% | Q7Z2H8 |
| PTGS1 | COX-1 | Inhibition | 5.52 | 0% | P23219 |
| PTGS2 | COX-2 | Inhibition | 5.87 | 0% | P35354 |
| PPARG | Peroxisome proliferator-activated receptor-γ | Full agonist | 2.6% | P37231 | |
| ASIC1 | ASIC1 | 3.5 | 2.6% | P78348 | |
| SLC5A8 | SMCT1 | Inhibition | 4.2 | 0.2% | Q8N695 |
Broader ChEMBL bioactivity targets: 30 (assay-derived). Sample: Dehydrogenase/reductase SDR family member 9, Prelamin-A/C, Solute carrier family 22 member 6, Solute carrier family 22 member 6, Retinoic acid receptor beta, Estrogen receptor, Cyclooxygenase, Prostaglandin G/H synthase (cyclooxygenase), Polyunsaturated fatty acid 5-lipoxygenase, Prostaglandin G/H synthase 1.
Bioactivity
ChEMBL activities: 95 potent at pChembl ≥ 5 of 127 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| LMNA | 8.25 | Potency | 5.6 | nM | CHEMBL_ACT_3655867 |
| PTGS2 | 7 | IC50 | 100 | nM | CHEMBL_ACT_917301 |
| PTGS1 | 6.67 | IC50 | 212 | nM | CHEMBL_ACT_7662381 |
| P22437 | 6.66 | IC50 | 220 | nM | CHEMBL_ACT_242732 |
| NFKB1 | 6.65 | Potency | 223.9 | nM | CHEMBL_ACT_3671929 |
| NFKB1 | 6.65 | Potency | 223.9 | nM | CHEMBL_ACT_4585211 |
| PTGS1 | 6.54 | IC50 | 290 | nM | CHEMBL_ACT_13304008 |
| P35355 | 6.22 | IC50 | 600 | nM | CHEMBL_ACT_18521077 |
| Q05769 | 6.07 | IC50 | 860 | nM | CHEMBL_ACT_14569697 |
| PTGS2 | 5.97 | IC50 | 1080 | nM | CHEMBL_ACT_18493976 |
| P05979 | 5.97 | IC50 | 1060 | nM | CHEMBL_ACT_490365 |
| PTGS2 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_12635494 |
| P79208 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_1511306 |
| PTGS2 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_16410618 |
| PTGS2 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_16415047 |
| P79208 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_1885023 |
| Q80UJ1 | 5.96 | Ki | 1100 | nM | CHEMBL_ACT_2202425 |
| P79208 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_2380527 |
| P79208 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_2501470 |
| O62698 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_2613226 |
| P79208 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_2641859 |
| PTGS2 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_2986825 |
| PTGS2 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_2997813 |
| PTGS2 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_3093063 |
| P79208 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_3095167 |
| PTGS2 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_3258177 |
| PTGS2 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_3372844 |
| PTGS2 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_6254919 |
| P79208 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_6379901 |
| PTGS2 | 5.96 | IC50 | 1100 | nM | CHEMBL_ACT_8056068 |
Target pathways
Aggregated over 6 target gene(s): SLC36A1, PTGS1, PTGS2, PPARG, ASIC1, SLC5A8.
Top Reactome pathways
31 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Transport of small molecules | 3 | ASIC1, SLC36A1, SLC5A8 |
| Synthesis of Prostaglandins (PG) and Thromboxanes (TX) | 2 | PTGS1, PTGS2 |
| R-HSA-425393 | 2 | SLC36A1, SLC5A8 |
| SLC-mediated transmembrane transport | 2 | SLC36A1, SLC5A8 |
| COX reactions | 1 | PTGS1 |
| Metabolism | 1 | SLC5A8 |
| Nicotinate metabolism | 1 | SLC5A8 |
| Metabolism of water-soluble vitamins and cofactors | 1 | SLC5A8 |
| Metabolism of vitamins and cofactors | 1 | SLC5A8 |
| R-HSA-197264 | 1 | SLC5A8 |
| PPARA activates gene expression | 1 | PPARG |
| Synthesis of 15-eicosatetraenoic acid derivatives | 1 | PTGS2 |
| Stimuli-sensing channels | 1 | ASIC1 |
| Amino acid transport across the plasma membrane | 1 | SLC36A1 |
| Transcriptional regulation of white adipocyte differentiation | 1 | PPARG |
| Nuclear Receptor transcription pathway | 1 | PPARG |
| SUMOylation of intracellular receptors | 1 | PPARG |
| Proton-coupled neutral amino acid transporters | 1 | SLC36A1 |
| Organic anion transport by SLC5/17/25 transporters | 1 | SLC5A8 |
| Interleukin-10 signaling | 1 | PTGS2 |
| Interleukin-4 and Interleukin-13 signaling | 1 | PTGS2 |
| Regulation of PTEN gene transcription | 1 | PPARG |
| Biosynthesis of DHA-derived SPMs | 1 | PTGS2 |
| Biosynthesis of EPA-derived SPMs | 1 | PTGS2 |
| MECP2 regulates transcription factors | 1 | PPARG |
| Biosynthesis of DPAn-3 SPMs | 1 | PTGS2 |
| Biosynthesis of electrophilic ω-3 PUFA oxo-derivatives | 1 | PTGS2 |
| Ion channel transport | 1 | ASIC1 |
| MLL4 and MLL3 complexes regulate expression of PPARG target genes in adipogenesis and hepatic steatosis | 1 | PPARG |
| Transcriptional regulation of brown and beige adipocyte differentiation by EBF2 | 1 | PPARG |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| monoatomic ion transport | 3 |
| regulation of blood pressure | 3 |
| fatty acid metabolic process | 3 |
| prostaglandin biosynthetic process | 2 |
| response to oxidative stress | 2 |
| cyclooxygenase pathway | 2 |
| regulation of cell population proliferation | 2 |
| long-chain fatty acid biosynthetic process | 2 |
| lipid metabolic process | 2 |
| fatty acid biosynthetic process | 2 |
| prostaglandin metabolic process | 2 |
| prostanoid biosynthetic process | 2 |
| cellular oxidant detoxification | 2 |
| brown fat cell differentiation | 2 |
| cellular response to hypoxia | 2 |
Indications & clinical
Indications
86 indications (21 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| vaginitis | 4 | MONDO:0002234 | EFO:0005757 |
| common cold | 4 | MONDO:0005709 | EFO:0007214 |
| rheumatic disorder | 4 | MONDO:0005554 | EFO:0005755 |
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| juvenile idiopathic arthritis | 4 | MONDO:0011429 | EFO:0002609 |
| rheumatoid arthritis | 4 | MONDO:0008383 | EFO:0000685 |
| patent ductus arteriosus | 4 | MONDO:0011827 | HP:0001643 |
| influenza | 4 | MONDO:0005812 | EFO:0007328 |
| arthritic joint disease | 4 | MONDO:0005578 | EFO:0005856 |
| pharyngitis | 4 | MONDO:0002258 | MONDO:0002258 |
| osteoarthritis | 4 | MONDO:0005178 | MONDO:0005178 |
| migraine disorder | 4 | MONDO:0005277 | MONDO:0005277 |
| obstructive sleep apnea syndrome | 3 | MONDO:0007147 | EFO:0003918 |
| bone fracture | 3 | MONDO:0005315 | EFO:0003931 |
| peptic ulcer disease | 3 | MONDO:0004247 | HP:0004398 |
| cerebral palsy | 3 | MONDO:0006497 | EFO:1000632 |
| HIV infectious disease | 3 | MONDO:0005109 | EFO:0000764 |
| breast neoplasm | 3 | MONDO:0021100 | EFO:0003869 |
| altitude sickness | 3 | MONDO:0006625 | EFO:1000782 |
| vasculitis | 3 | MONDO:0018882 | EFO:0006803 |
| burn | 3 | MONDO:0043519 | EFO:0009516 |
| toxic shock syndrome | 3 | MONDO:0001881 | EFO:0006834 |
| acute respiratory distress syndrome | 3 | MONDO:0006502 | EFO:1000637 |
| complex regional pain syndrome type 2 | 3 | MONDO:0020572 | EFO:1000854 |
| pulpitis | 3 | MONDO:0006937 | EFO:1001139 |
| hypospadias | 3 | MONDO:0005345 | EFO:0004209 |
| tibia fracture | 3 | MONDO:0005320 | EFO:0003944 |
| multiple sclerosis | 3 | MONDO:0005301 | MONDO:0005301 |
| pulmonary emphysema | 2 | MONDO:0004849 | EFO:0000464 |
| hypertensive disorder | 2 | MONDO:0005044 | EFO:0000537 |
| spondyloarthropathy | 2 | MONDO:0005095 | EFO:0000706 |
| retinopathy of prematurity | 2 | MONDO:0006952 | EFO:1001158 |
| periodontitis | 2 | MONDO:0005076 | EFO:0000649 |
| muscle tissue disorder | 2 | MONDO:0003939 | EFO:0002970 |
| canker sore | 2 | MONDO:0005318 | EFO:0003938 |
| sunburn | 2 | MONDO:0005326 | EFO:0003958 |
| temporomandibular joint disorder | 2 | MONDO:0005473 | EFO:0005279 |
| sinusitis | 2 | MONDO:0005961 | EFO:0007486 |
| brachial plexus neuritis | 2 | MONDO:0006682 | EFO:1000843 |
| tooth disorder | 2 | MONDO:0006999 | EFO:1001216 |
| injury | 2 | MONDO:0021178 | EFO:0000546 |
| preeclampsia | 2 | MONDO:0005081 | EFO:0000668 |
| focal epilepsy | 2 | MONDO:0005384 | EFO:0004263 |
| spondylosis, cervical | 2 | MONDO:0008481 | EFO:0009610 |
| acute pancreatitis | 2 | MONDO:0006515 | EFO:1000652 |
| major depressive disorder | 2 | MONDO:0002009 | MONDO:0002009 |
| glioma | 2 | MONDO:0021042 | MONDO:0100342 |
| enuresis | 2 | MONDO:0024290 | MONDO:0024290 |
| type 1 diabetes mellitus | 2 | MONDO:0005147 | MONDO:0005147 |
| tuberculosis | 2 | MONDO:0018076 | MONDO:0018076 |
| chronic granulomatous disease | 2 | MONDO:0018305 | MONDO:0018305 |
| bronchopulmonary dysplasia | 2 | MONDO:0019091 | MONDO:0019091 |
| kidney cancer | 2 | MONDO:0002367 | MONDO:0002367 |
| epilepsy | 2 | MONDO:0005027 | EFO:0000474 |
| kidney neoplasm | 2 | MONDO:0021163 | EFO:0003865 |
| osteoarthritis, knee | 1 | MONDO:0005416 | EFO:0004616 |
| allergic rhinitis | 1 | MONDO:0011786 | EFO:0005854 |
| orthostatic hypotension | 1 | MONDO:0005469 | EFO:0005252 |
| malaria | 1 | MONDO:0005136 | EFO:0001068 |
| Alzheimer disease | 1 | MONDO:0004975 | MONDO:0004975 |
| Duchenne muscular dystrophy | 1 | MONDO:0010679 | MONDO:0010679 |
| glycogen storage disease III | 1 | MONDO:0009291 | MONDO:0009291 |
| acute kidney injury | 1 | MONDO:0002492 | HP:0001919 |
| bipolar disorder | 1 | MONDO:0004985 | MONDO:0004985 |
22 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 578.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 170 |
| Not specified | 153 |
| PHASE3 | 93 |
| PHASE2 | 68 |
| PHASE1 | 58 |
| PHASE2/PHASE3 | 13 |
| EARLY_PHASE1 | 12 |
| PHASE1/PHASE2 | 11 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03060434 | PHASE4 | ACTIVE_NOT_RECRUITING | Pentoxifylline and Lumbar Radiculopathy |
| NCT03759028 | PHASE4 | RECRUITING | Supracondylar Post-Operative Pain Study |
| NCT03858231 | PHASE4 | RECRUITING | Opioids Versus Non-Opioids Postoperative After Knee Arthroscopic Surgery |
| NCT04102566 | PHASE4 | RECRUITING | Optimizing Pain Control in Transurethral Resection of the Prostate |
| NCT05076110 | PHASE4 | RECRUITING | Nonopioid Pain Control Regimen After Arthroscopic Hip Procedures |
| NCT05488847 | PHASE4 | ACTIVE_NOT_RECRUITING | Opioid-Free Pain Protocol After Shoulder Arthroplasty |
| NCT05512754 | PHASE4 | RECRUITING | Impact of Anti-inflammatory Medications in Patients With Elevated Serum Prostate-specific Antigen |
| NCT05629494 | PHASE4 | RECRUITING | Anti-inflammatory Drugs and Serum Prostate-Specific Antigen Test |
| NCT05721027 | PHASE4 | RECRUITING | Ibuprofen With or Without Dexamethasone for Acute Radicular Low Back Pain. |
| NCT05919745 | PHASE4 | RECRUITING | Preemptive Ibuprofen Effects on Pain Perception Following Extraction and Bone Graft |
| NCT06398054 | PHASE4 | NOT_YET_RECRUITING | A Study to Investigate the Analgesic Efficacy of Ibuprofen Alone and Ibuprofen Plus Hyoscine-n- Butyl Bromide in Reducing Pain of Outpatient Hysteroscopy |
| NCT06434233 | PHASE4 | RECRUITING | Opioid Use After Laparoscopic Salpingectomy |
| NCT06479122 | PHASE4 | RECRUITING | Efficacy of Acetaminophen Alone Versus Combination of Acetaminophen/Ibuprofen After Cesarean Section |
| NCT06495632 | PHASE4 | RECRUITING | Scheduled or As Needed Pain Regimen? |
| NCT06505148 | PHASE4 | NOT_YET_RECRUITING | Comparing the Difference in Pain Control in the Pediatric General Surgery Population: to Alternate or Combine Acetaminophen and Ibuprofen? |
| NCT06671002 | PHASE4 | RECRUITING | Comparing Analgesic Regimen Effectiveness and Safety for Surgery for Kids Trial |
| NCT06757075 | PHASE4 | RECRUITING | Management of Postoperative Discomfort in Young Children Following Dental Rehabilitation Under General Anesthesia |
| NCT06786650 | PHASE4 | ACTIVE_NOT_RECRUITING | Comparision of the Analgesic Effects of Intravenous Ibuprofen and Tenoxicam in Acute Migraine Attack |
| NCT07512297 | PHASE4 | NOT_YET_RECRUITING | Pain Control During ESWL Using Non-Opioid Analgesics |
| NCT07571252 | PHASE4 | NOT_YET_RECRUITING | Impact of Preemptive Analgesia on Postoperative Pain in Orthognathic Surgery |
| NCT07600697 | PHASE4 | NOT_YET_RECRUITING | Suzetrigine for Opioid-Sparing Postoperative Analgesia Following Transvaginal Pelvic Reconstructive Surgery |
| NCT00046358 | PHASE4 | COMPLETED | The Effect of Short-Term Statins and NSAIDs on Levels of Beta-Amyloid, a Protein Associated With Alzheimer’s Disease |
| NCT00115336 | PHASE4 | TERMINATED | Ketorolac Versus Ibuprofen to Treat Painful Episodes of Sickle Cell Disease |
| NCT00145730 | PHASE4 | COMPLETED | Prevention of Ectopic Bone Related Pain and Disability After Hip Replacement Surgery With Peri-Operative Ibuprofen |
| NCT00167713 | PHASE4 | COMPLETED | Treatment of Fever Due to Malaria With Ibuprofen |
| NCT00217191 | PHASE4 | COMPLETED | Ibuprofen and Renal Function in Premature Infants |
| NCT00240825 | PHASE4 | COMPLETED | An Effectiveness and Safety Study of Acetaminophen 1000 mg and Ibuprofen 400 mg in Postoperative Dental Pain. |
| NCT00240864 | PHASE4 | COMPLETED | An Effectiveness and Safety Study of Acetaminophen 1000 mg and Ibuprofen 400 mg in Postoperative Dental Pain |
| NCT00261586 | PHASE4 | COMPLETED | A Safety Trial to Compare Different Analgesics in Combination With Low Dose Aspirin to Study Their Bleeding Properties and Their Effects on the Stomach |
| NCT00267293 | PHASE4 | COMPLETED | Ibuprofen Alone and in Combination With Acetaminophen for Treatment of Fever |
| NCT00292747 | PHASE4 | TERMINATED | Drotaverine in Dysmenorrhoea Treatment |
| NCT00346216 | PHASE4 | COMPLETED | Prospective Randomized Evaluation Of Celecoxib Integrated Safety Vs Ibuprofen Or Naproxen |
| NCT00382083 | PHASE4 | COMPLETED | Premedication to Reduce Discomfort With Screening Mammography |
| NCT00470743 | PHASE4 | WITHDRAWN | Comparing Ibuprofen And Indomethacin For The Treatment Of The Patent Ductus Arteriosus in Very Premature Babies |
| NCT00484744 | PHASE4 | COMPLETED | Acetaminophen Versus Ibuprofen for the Control of Immediate and Delayed Pain Following Orthodontic Separator Placement |
| NCT00565500 | PHASE4 | COMPLETED | Celecoxib, Ibuprofen and the Antiplatelet Effect of Aspirin |
| NCT00568217 | PHASE4 | COMPLETED | Antipyretics for Preventing Recurrences of Febrile Seizures |
| NCT00620867 | PHASE4 | COMPLETED | Efficacy and Safety of Celecoxib Versus Ibuprofen in the Treatment of Osteoarthritis of the Knee (United States) |
| NCT00630929 | PHASE4 | COMPLETED | Efficacy and Safety of Celecoxib Versus Ibuprofen in the Treatment of Osteoarthritis of the Knee (Europe) |
| NCT00631514 | PHASE4 | COMPLETED | Interaction Between Antihypertensives and Non-Steroidal Anti-Inflammatory Drugs (NSAIDs) |
Clinical evidence (CIViC)
Variant × indication × effect (1 predictive associations from 1 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| PIK3CA Amplification | Head And Neck Squamous Cell Carcinoma | Sensitivity/Response | Ibuprofen + Aspirin + Sulindac | CIViC B | EID7186 |
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (2) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of CPIC Guideline for celecoxib, flurbiprofen, ibuprofen, l | CPIC | CYP2C9 | yes | yes |
| Annotation of CPIC Guideline for diclofenac, ibuprofen and CYP2C8 | CPIC | CYP2C8 |
PharmGKB also curates 8 clinical and 50 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
478 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| KETOPROFEN | ChEMBL + PubChem | Phase 4 (approved) | PTGS1, PTGS2, SLC5A8 |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | PPARG, PTGS1, PTGS2 |
| LUMIRACOXIB | ChEMBL | Phase 4 (approved) | PPARG, PTGS1, PTGS2 |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | PPARG, PTGS1, PTGS2 |
| RESVERATROL | ChEMBL | Phase 3 | PPARG, PTGS1, PTGS2 |
| Cycloserine | ChEMBL + PubChem | Phase 4 (approved) | PTGS1, SLC36A1 |
| cysteine | ChEMBL + PubChem | Phase 4 (approved) | PTGS1, SLC36A1 |
| FENOPROFEN | ChEMBL + PubChem | Phase 4 (approved) | PTGS1, SLC5A8 |
| Fulvestrant | ChEMBL + PubChem | Phase 4 (approved) | PPARG, PTGS2 |
| 3,3’,4’,5-TETRACHLOROSALICYLANILIDE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ACEMETACIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| BROMFENAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| CAPSAICIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CAPTOPRIL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CARPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CIANIDANOL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DEXIBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DEXKETOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DICLOFENAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ESFLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ETODOLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ETORICOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| FLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| GLAFENINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| KETOROLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LASOFOXIFENE | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| LEVODOPA | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LEVOTHYROXINE | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| LOXOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MASOPROCOL | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| MECLOFENAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MEFENAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MELOXICAM | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MOFEZOLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MONOBENZONE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| NAPROXEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| NIMESULIDE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| OMADACYCLINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| OXAPROZIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| PIROXICAM | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| PRIMAQUINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| RANITIDINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ROFECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| SELINEXOR | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| SULINDAC | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| SUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TEGASEROD | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TELOTRISTAT | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TIPRANAVIR | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| TOLMETIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| VALDECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| VORTIOXETINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CURCUMIN | ChEMBL | Phase 3 | PTGS1, PTGS2 |
Related Atlas pages
- Genes: SLC36A1, PTGS1, PTGS2, PPARG, ASIC1, SLC5A8
- Diseases: vaginitis, common cold, rheumatic disorder, cardiovascular disorder, juvenile idiopathic arthritis, rheumatoid arthritis, patent ductus arteriosus, influenza, arthritic joint disease, pharyngitis, osteoarthritis, migraine disorder, obstructive sleep apnea syndrome, bone fracture, peptic ulcer disease, cerebral palsy, HIV infectious disease, breast neoplasm, altitude sickness, vasculitis, burn, toxic shock syndrome, acute respiratory distress syndrome, complex regional pain syndrome type 2, pulpitis, hypospadias, tibia fracture, multiple sclerosis, head and neck squamous cell carcinoma
- Drugs: Ketoprofen, Indomethacin, Lumiracoxib, Troglitazone, Resveratrol, Cycloserine, cysteine, Fenoprofen, Fulvestrant, 3,3’,4’,5-TETRACHLOROSALICYLANILIDE, Acemetacin, Aspirin, Bromfenac, Candesartan Cilexetil, Cannabidiol, Capsaicin, Captopril, Carprofen, Celecoxib, Cianidanol, Dexibuprofen, Diclofenac, Diethylstilbestrol, Doxorubicin, Esflurbiprofen, Etodolac, Etoricoxib, Flurbiprofen, Glafenine, Hexachlorophene, Ketorolac, Lasofoxifene, Levodopa, Levothyroxine, Loxoprofen, Masoprocol, Meclofenamic Acid, Mefenamic Acid, Meloxicam, Mofezolac, Monobenzone, Naproxen, Nimesulide, Omadacycline, Oxaprozin, Piroxicam, Primaquine, Ranitidine, Rofecoxib, Selinexor, Sulindac, Suprofen, Tegaserod, Telotristat, Tipranavir, Tolmetin, Valdecoxib, Vortioxetine, Curcumin