Imipramine
drugOn this page
Also known as AntideprinBerkomineCristaliaImipraminaMelipramineNSC-169866ORG-2463SermonilTrimipramine maleate impurityimipramine-SID11111330SID11111331SID26751600SID90341377SID104171178SID50100256SID50104254SID124880469SID144203725
Summary
Imipramine (CHEMBL11) is an approved small-molecule adrenergic uptake inhibitor (ATC N06AA02) targeting CHRM2, KCNJ6, and KCNJ5; indicated across 18 conditions including depressive disorder and gastroesophageal reflux disease.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N06AA02
- Targets: 6 (CHRM2, KCNJ6, KCNJ5…)
- Indications: 18 conditions
- Clinical trials: 27
- Chemistry: 280.4 Da · C19H24N2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL11 |
| Name | Imipramine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 3696 |
| ChEBI | CHEBI:47499 |
| ATC | N06AA02 |
| Molecular formula | C19H24N2 |
| Molecular weight | 280.4 |
| InChIKey | BCGWQEUPMDMJNV-UHFFFAOYSA-N |
SMILES: CN(C)CCCN1C2=CC=CC=C2CCC3=CC=CC=C31
IUPAC name: 3-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N,N-dimethylpropan-1-amine
ChEBI definition: A dibenzoazepine that is 5H-dibenzo[b,f]azepine substituted by a 3-(dimethylamino)propyl group at the nitrogen atom.
Pharmacological roles (ChEBI): adrenergic uptake inhibitor, EC 3.4.21.26 (prolyl oligopeptidase) inhibitor, antidepressant.
Also known as: Antideprin, Berkomine, Cristalia, Imipramina, Imipramine, Melipramine, NSC-169866, ORG-2463, Sermonil, Trimipramine maleate impurity, imipramine-, imipramine
Parent form; salt/anhydrous children: CHEMBL1692, CHEMBL3989845
Patent coverage: 13,836 distinct patent families (48,893 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 48,575 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CHRM2 | M2 receptor | Antagonist | 6.9 | 0% | P08172 |
| KCNJ6 | Kir3.2 | Antagonist | 4.3 | 0.1% | P48051 |
| KCNJ5 | Kir3.4 | Antagonist | 4.5 | 0% | P48544 |
| KCNH1 | Kv10.1 | 5.7 | 0.2% | O95259 | |
| SLC6A2 | NET | Inhibition | 7.8 | 0.4% | P23975 |
| SLC6A4 | SERT | Inhibition | 7.69 | 0.7% | P31645 |
Broader ChEMBL bioactivity targets: 73 (assay-derived). Sample: Microtubule-associated protein tau, Prelamin-A/C, Pleiotropic ABC efflux transporter of multiple drugs, Solute carrier family 22 member 2, Multidrug and toxin extrusion protein 1, Solute carrier family 22 member 2, Muscarinic acetylcholine receptor M4, 5-hydroxytryptamine receptor 2B, D(1B) dopamine receptor, Glutamate NMDA receptor.
Bioactivity
ChEMBL activities: 131 potent at pChembl ≥ 5 of 149 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P31390 | 10.22 | IC50 | 0.06 | nM | CHEMBL_ACT_779382 |
| SLC6A4 | 9.28 | Ki | 0.52 | nM | CHEMBL_ACT_13341982 |
| SLC6A4 | 9.11 | Ki | 0.77 | nM | CHEMBL_ACT_6317052 |
| SLC6A4 | 9.06 | IC50 | 0.88 | nM | CHEMBL_ACT_16501777 |
| SLC6A4 | 9.06 | IC50 | 0.88 | nM | CHEMBL_ACT_16838471 |
| SLC6A4 | 9 | Ki | 1 | nM | CHEMBL_ACT_18188070 |
| SLC6A4 | 8.96 | IC50 | 1.1 | nM | CHEMBL_ACT_13342054 |
| HTR3E | 8.96 | IC50 | 1.1 | nM | CHEMBL_ACT_26333207 |
| HTR3E | 8.96 | Ki | 1.1 | nM | CHEMBL_ACT_26333262 |
| P43140 | 8.77 | IC50 | 1.7 | nM | CHEMBL_ACT_725564 |
| SLC6A4 | 8.72 | Ki | 1.9 | nM | CHEMBL_ACT_19226362 |
| SLC6A4 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_13336152 |
| SLC6A4 | 8.7 | Ki | 2 | nM | CHEMBL_ACT_16817151 |
| SLC6A4 | 8.68 | Ki | 2.1 | nM | CHEMBL_ACT_14738667 |
| SLC6A4 | 8.68 | Ki | 2.1 | nM | CHEMBL_ACT_15186971 |
| SLC6A4 | 8.6 | Ki | 2.5 | nM | CHEMBL_ACT_18891578 |
| SLC6A4 | 8.59 | IC50 | 2.6 | nM | CHEMBL_ACT_16579889 |
| SLC6A4 | 8.49 | Ki | 3.2 | nM | CHEMBL_ACT_2381341 |
| SLC6A4 | 8.46 | IC50 | 3.5 | nM | CHEMBL_ACT_13828631 |
| SLC6A4 | 8.39 | IC50 | 4.1 | nM | CHEMBL_ACT_19226363 |
| SLC6A4 | 8.36 | IC50 | 4.4 | nM | CHEMBL_ACT_1611139 |
| Q60857 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_241155 |
| SLC6A4 | 8.3 | Ki | 5 | nM | CHEMBL_ACT_414938 |
| SLC6A4 | 8.29 | IC50 | 5.1 | nM | CHEMBL_ACT_16817103 |
| SLC6A4 | 8.24 | Ki | 5.7 | nM | CHEMBL_ACT_16579925 |
| SLC6A4 | 8.17 | IC50 | 6.8 | nM | CHEMBL_ACT_13469060 |
| SLC6A4 | 8.16 | IC50 | 6.9 | nM | CHEMBL_ACT_2381314 |
| SLC6A4 | 8.14 | IC50 | 7.3 | nM | CHEMBL_ACT_5165994 |
| SLC6A4 | 8.12 | Ki | 7.57 | nM | CHEMBL_ACT_2701463 |
| SLC6A4 | 8.1 | IC50 | 8 | nM | CHEMBL_ACT_2515842 |
Target pathways
Aggregated over 6 target gene(s): CHRM2, KCNJ6, KCNJ5, KCNH1, SLC6A2, SLC6A4.
Top Reactome pathways
34 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Neuronal System | 4 | KCNH1, KCNJ5, KCNJ6, SLC6A4 |
| Transmission across Chemical Synapses | 3 | KCNJ5, KCNJ6, SLC6A4 |
| Potassium Channels | 3 | KCNH1, KCNJ5, KCNJ6 |
| Neurotransmitter receptors and postsynaptic signal transmission | 2 | KCNJ5, KCNJ6 |
| Activation of G protein gated Potassium channels | 2 | KCNJ5, KCNJ6 |
| G protein gated Potassium channels | 2 | KCNJ5, KCNJ6 |
| Inwardly rectifying K+ channels | 2 | KCNJ5, KCNJ6 |
| SLC-mediated transport of neurotransmitters | 2 | SLC6A2, SLC6A4 |
| GABA receptor activation | 2 | KCNJ5, KCNJ6 |
| GABA B receptor activation | 2 | KCNJ5, KCNJ6 |
| Activation of GABAB receptors | 2 | KCNJ5, KCNJ6 |
| Inhibition of voltage gated Ca2+ channels via Gbeta/gamma subunits | 2 | KCNJ5, KCNJ6 |
| Neurotransmitter clearance | 1 | SLC6A4 |
| Voltage gated Potassium channels | 1 | KCNH1 |
| Signal Transduction | 1 | CHRM2 |
| Disease | 1 | SLC6A2 |
| Membrane Trafficking | 1 | CHRM2 |
| Signaling by GPCR | 1 | CHRM2 |
| Class A/1 (Rhodopsin-like receptors) | 1 | CHRM2 |
| Amine ligand-binding receptors | 1 | CHRM2 |
| Serotonin clearance from the synaptic cleft | 1 | SLC6A4 |
| Transport of small molecules | 1 | SLC6A2 |
| GPCR downstream signalling | 1 | CHRM2 |
| Muscarinic acetylcholine receptors | 1 | CHRM2 |
| G alpha (i) signalling events | 1 | CHRM2 |
| R-HSA-425366 | 1 | SLC6A2 |
| SLC-mediated transmembrane transport | 1 | SLC6A2 |
| GPCR ligand binding | 1 | CHRM2 |
| SLC transporter disorders | 1 | SLC6A2 |
| Defective SLC6A2 causes orthostatic intolerance (OI) | 1 | SLC6A2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| potassium ion transport | 3 |
| monoatomic ion transport | 3 |
| monoatomic ion transmembrane transport | 3 |
| transmembrane transport | 3 |
| chemical synaptic transmission | 2 |
| regulation of monoatomic ion transmembrane transport | 2 |
| potassium ion import across plasma membrane | 2 |
| potassium ion transmembrane transport | 2 |
| neurotransmitter transport | 2 |
| amino acid transport | 2 |
| response to xenobiotic stimulus | 2 |
| obsolete monoamine transport | 2 |
| sodium ion transmembrane transport | 2 |
| neurotransmitter reuptake | 2 |
| regulation of smooth muscle contraction | 1 |
Indications & clinical
Indications
18 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| depressive disorder | 4 | MONDO:0002050 | MONDO:0002050 |
| gastroesophageal reflux disease | 3 | MONDO:0007186 | EFO:0003948 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| dementia | 3 | MONDO:0001627 | HP:0000726 |
| myocardial infarction | 3 | MONDO:0005068 | EFO:0000612 |
| ventricular fibrillation | 3 | MONDO:0000190 | EFO:0004287 |
| somatoform disorder | 2 | MONDO:0003117 | EFO:0009687 |
| rosacea | 2 | MONDO:0006604 | EFO:1000760 |
| dysthymic disorder | 1 | MONDO:0001442 | EFO:0008623 |
| photosensitivity disease | 1 | MONDO:0006597 | HP:0000992 |
| breast neoplasm | 0 | MONDO:0021100 | MONDO:0007254 |
7 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 27.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 9 |
| Not specified | 6 |
| PHASE4 | 4 |
| PHASE2 | 4 |
| PHASE1 | 2 |
| PHASE1/PHASE2 | 1 |
| EARLY_PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00227955 | PHASE4 | COMPLETED | Comparing Various Treatments for Achieving and Maintaining Remission of Depression |
| NCT00296777 | PHASE4 | COMPLETED | Treatment of Depression Following Multiple Brain Tests |
| NCT00404755 | PHASE4 | COMPLETED | Dichotic Listening as a Predictor of Medication Response in Depression |
| NCT01047488 | PHASE4 | UNKNOWN | Imipramine and Pregabalin Combination in Painful Polyneuropathy |
| NCT00000464 | PHASE3 | COMPLETED | Cardiac Arrest in Seattle: Conventional Versus Amiodarone Drug Evaluation (CASCADE) |
| NCT00000518 | PHASE3 | COMPLETED | Electrophysiologic Study Versus Electrocardiographic Monitoring (ESVEM) |
| NCT00005575 | PHASE3 | COMPLETED | Treatment of Non-Cardiac Chest Pain With Imipramine or Cognitive-Behavioral Therapy |
| NCT00164775 | PHASE3 | COMPLETED | The Efficacy of Imipramine in Treatment of Refractory Functional Dyspepsia |
| NCT01179828 | PHASE3 | COMPLETED | Linking Altered Central Pain Processing and Genetic Polymorphism to Drug Efficacy in Chronic Low Back Pain (Predictio) |
| NCT01753128 | PHASE3 | COMPLETED | Efficacy of Imipramine for Treatment of Patients With Esophageal Hypersensitivity/ Functional Heartburn |
| NCT02374567 | PHASE3 | TERMINATED | Pharmacovigilance in Gerontopsychiatric Patients |
| NCT04412876 | PHASE3 | WITHDRAWN | Comparisons of the Impact of Duloxetine Versus Imipramine on Therapeutic Efficacy, Psychological Distress, Sexual Function, Urethral and Bladder Wall Structure and Blood Flow in Women With Stress Urinary Incontinence: a Randomized Controlled Study |
| NCT05677295 | PHASE3 | UNKNOWN | Therapeutic Efficacy in Women With Stress Urinary Incontinence |
| NCT06312813 | PHASE2 | RECRUITING | Evaluating Use of Topical Imipramine and Amitriptyline in Reducing Ultraviolet B Light-Induced Redness in Patients With Rosacea |
| NCT06778434 | PHASE2 | RECRUITING | The Effect of Topical Imipramine on Photodynamic Therapy-Mediated Immunosuppression on Forearms or Face on US Veterans |
| NCT00000504 | PHASE2 | COMPLETED | Cardiac Arrhythmia Pilot Study (CAPS) |
| NCT00296725 | PHASE1/PHASE2 | COMPLETED | Dichotic Listening as a Predictor of Medication Response in Depression |
| NCT01518634 | PHASE2 | COMPLETED | Imipramine Treatment for Patients With Multi-organ Bodily Distress Syndrome |
| NCT05688904 | PHASE1 | RECRUITING | The Effect of Topical Imipramine on Pain and Effectiveness of Topical Photodynamic Therapy |
| NCT03102645 | PHASE1 | COMPLETED | Does Single Dose Imipramine Affect the Opening Pressure of the Urethral and Anal Sphincter? |
| NCT03122444 | EARLY_PHASE1 | COMPLETED | Imipramine on ER+ve and Triple Negative Breast Cancer |
| NCT06497647 | Not specified | RECRUITING | New Treatment for Nocturnal Enuresis in Children |
| NCT06778824 | Not specified | RECRUITING | Neuroregulators for the Treatment of Diseases Associated With Esophageal-brain-gut Axis Communication Abnormalities. |
| NCT00004834 | Not specified | COMPLETED | Randomized Study of Cognitive-Behavioral Therapy vs Imipramine and Their Combination for Panic Disorder |
| NCT00206999 | Not specified | COMPLETED | The Effect of Imipramine on Early Information Processing |
| NCT01028014 | Not specified | COMPLETED | Medication Effects on Periurethral Sensation,Urethral Sphincter Activity and Pressure Flow Parameters |
| NCT01896349 | Not specified | UNKNOWN | Interpersonal Psychotherapy for Treatment Resistant Depression |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (3) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of DPWG Guideline for imipramine and CYP2C19 | DPWG | CYP2C19 | yes | yes |
| Annotation of DPWG Guideline for imipramine and CYP2D6 | DPWG | CYP2D6 | yes | yes |
| Annotation of CPIC Guideline for imipramine and CYP2C19, CYP2D6 | CPIC | CYP2C19;CYP2D6 | yes | yes |
PharmGKB also curates 4 clinical and 36 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
736 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| HALOPERIDOL | ChEMBL + PubChem | Phase 4 (approved) | CHRM2, KCNH1, SLC6A2, SLC6A4 |
| ACLIDINIUM BROMIDE | ChEMBL + PubChem | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| AFATINIB | ChEMBL + PubChem | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| AMITRIPTYLINE | ChEMBL + PubChem | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CHENODIOL | ChEMBL + PubChem | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| Mefloquine | ChEMBL + PubChem | Phase 4 (approved) | KCNJ5, SLC6A2, SLC6A4 |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| PIMAVANSERIN | ChEMBL + PubChem | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| Propafenone | ChEMBL + PubChem | Phase 4 (approved) | KCNJ5, SLC6A2, SLC6A4 |
| Tadalafil | ChEMBL + PubChem | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| UMECLIDINIUM | ChEMBL + PubChem | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| Vorapaxar | ChEMBL + PubChem | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| AMBENONIUM | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| ASENAPINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| AZELASTINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| BENZYDAMINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| BROMODIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| BROMPHENIRAMINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CARBINOXAMINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CHLORPROTHIXENE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CITALOPRAM | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CLOMIPHENE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| COBIMETINIB | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CYCLOBENZAPRINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| DEQUALINIUM | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| DESIPRAMINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| DESLORATADINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| DEXBROMPHENIRAMINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| DEXCHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| DIBENZEPIN | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| DIPHENHYDRAMINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| DOTHIEPIN | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| DOXAZOSIN | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| DOXEPIN | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| DRONEDARONE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| EBASTINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| ETHOPROPAZINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| ETHYLESTRENOL | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| FLUOXETINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | CHRM2, SLC6A2, SLC6A4 |
Related Atlas pages
- Genes: CHRM2, KCNJ6, KCNJ5, KCNH1, SLC6A2, SLC6A4
- Diseases: depressive disorder, gastroesophageal reflux disease, anxiety, dementia, myocardial infarction, ventricular fibrillation
- Drugs: Haloperidol, Aclidinium Bromide, Afatinib, Amitriptyline, Chenodiol, Mefloquine, Olodaterol, Pimavanserin, Propafenone, Tadalafil, Umeclidinium, Vorapaxar, Ambenonium, Amiodarone, Amoxapine, Aripiprazole, Asenapine, Astemizole, Azelastine, Bazedoxifene, Benztropine, Benzydamine, Bosutinib, Bromodiphenhydramine, Brompheniramine, Carbinoxamine, Chlorhexidine, Chlorpheniramine, Chlorpromazine, Chlorprothixene, Cinnarizine, Citalopram, Clemastine, Clomiphene, Clomipramine, Clotrimazole, Clozapine, Cobimetinib, Cyclobenzaprine, Cyproheptadine, Dequalinium, Desipramine, Desloratadine, Desogestrel, Dexbrompheniramine, Dibenzepin, Diethylstilbestrol, Diphenhydramine, Dothiepin, Doxazosin, Doxepin, Dronedarone, Ebastine, Econazole, Ethopropazine, Ethylestrenol, Fluoxetine, Fluphenazine