Indomethacin
drugOn this page
Also known as AconipArtracinArtracin srBerlind 75 retDurametacinFlexin-25 continusFlexin-50 continusFlexin-75 continusImbrilonIndo-lemmonIndo-paedIndocid retIndocid-rIndocinIndocin srIndodermIndoflexIndolarIndolar srIndomax-25
Summary
Indomethacin (CHEMBL6) is an approved small-molecule non-steroidal anti-inflammatory drug (ATC C01EB03) targeting SLC46A1, PTGS1, and PTGS2; indicated across 35 conditions including ankylosing spondylitis and eye disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C01EB03 (+4 more)
- Targets: 5 (SLC46A1, PTGS1, PTGS2…)
- Indications: 35 conditions
- Clinical trials: 124
- Chemistry: 357.8 Da · C19H16ClNO4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL6 |
| Name | Indomethacin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 3715 |
| ChEBI | CHEBI:49662 |
| ATC | C01EB03, M02AA23, M01AB51, S01BC01, M01AB01 |
| Molecular formula | C19H16ClNO4 |
| Molecular weight | 357.8 |
| InChIKey | CGIGDMFJXJATDK-UHFFFAOYSA-N |
SMILES: CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)O
IUPAC name: 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetic acid
ChEBI definition: A member of the class of indole-3-acetic acids that is indole-3-acetic acid in which the indole ring is substituted at positions 1, 2 and 5 by p-chlorobenzoyl, methyl, and methoxy groups, respectively. A non-steroidal anti-inflammatory drug, it is used in the treatment of musculoskeletal and joint disorders including osteoarthritis, rheumatoid arthritis, gout, bursitis and tendinitis.
Pharmacological roles (ChEBI): non-steroidal anti-inflammatory drug, EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor, analgesic, gout suppressant.
Other ChEBI roles (chemical / environmental): drug metabolite, xenobiotic metabolite, xenobiotic, environmental contaminant.
Also known as: Aconip, Artracin, Artracin sr, Berlind 75 ret, Durametacin, Flexin-25 continus, Flexin-50 continus, Flexin-75 continus, Imbrilon, Indo-lemmon, Indo-paed, Indocid ret
Parent form; salt/anhydrous children: CHEMBL2028292, CHEMBL3989410, CHEMBL4590319
Patent coverage: 45,829 distinct patent families (156,366 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 155,846 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SLC46A1 | Proton-coupled folate transporter | Inhibition | 3.7 | 2.7% | Q96NT5 |
| PTGS1 | COX-1 | Inhibition | 6.59 | 0% | P23219 |
| PTGS2 | COX-2 | Inhibition | 5.58 | 0% | P35354 |
| PTGDR2 | DP2 receptor | Full agonist | 7.7 | 0% | Q9Y5Y4 |
| PPARG | Peroxisome proliferator-activated receptor-γ | Partial agonist | 7.38 | 2.6% | P37231 |
Broader ChEMBL bioactivity targets: 69 (assay-derived). Sample: Uracil nucleotide/cysteinyl leukotriene receptor, Microtubule-associated protein tau, Lysine-specific demethylase 4E, Nuclear receptor ROR-gamma, Fructose-bisphosphate aldolase, Prelamin-A/C, Ras-related protein Rab-9A, Peripheral myelin protein 22, Solute carrier family 22 member 6, Organic anion transporter 3.
Bioactivity
ChEMBL activities: 385 potent at pChembl ≥ 5 of 462 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| AR | 9.85 | EC50 | 0.14 | nM | CHEMBL_ACT_12651619 |
| PTGS1 | 9.85 | IC50 | 0.14 | nM | CHEMBL_ACT_25553877 |
| PTGS2 | 9.85 | IC50 | 0.14 | nM | CHEMBL_ACT_25553879 |
| NAPRT | 9.82 | Ki | 0.15 | nM | CHEMBL_ACT_19323251 |
| PTGS1 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_132512 |
| P22437 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_1507837 |
| P35355 | 8.54 | IC50 | 2.9 | nM | CHEMBL_ACT_781727 |
| PTGS1 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_84677 |
| PTGS1 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_874568 |
| P05979 | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_1759941 |
| O62664 | 8.39 | IC50 | 4.1 | nM | CHEMBL_ACT_10961892 |
| PTGS1 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_1759893 |
| PTGS2 | 8.23 | IC50 | 5.9 | nM | CHEMBL_ACT_84676 |
| PTGS1 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_2069733 |
| P05979 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_3369555 |
| Q63921 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_390935 |
| P05979 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_6337366 |
| Q63921 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_719250 |
| Q05769 | 8.19 | IC50 | 6.4 | nM | CHEMBL_ACT_403143 |
| Q05769 | 8.19 | IC50 | 6.4 | nM | CHEMBL_ACT_730232 |
| P05979 | 8.17 | IC50 | 6.7 | nM | CHEMBL_ACT_12072252 |
| PTGS1 | 8.09 | IC50 | 8.2 | nM | CHEMBL_ACT_403144 |
| PTGS1 | 8.09 | IC50 | 8.2 | nM | CHEMBL_ACT_730233 |
| PTGS2 | 8.05 | IC50 | 9 | nM | CHEMBL_ACT_132513 |
| Q05769 | 8.05 | IC50 | 9 | nM | CHEMBL_ACT_1507838 |
| PTGS2 | 8.05 | IC50 | 9 | nM | CHEMBL_ACT_874569 |
| P05979 | 8 | IC50 | 10 | nM | CHEMBL_ACT_12098193 |
| PTGS2 | 8 | IC50 | 10 | nM | CHEMBL_ACT_2069734 |
| PTGS1 | 8 | IC50 | 10 | nM | CHEMBL_ACT_2323375 |
| PTGS2 | 8 | IC50 | 10 | nM | CHEMBL_ACT_3369762 |
Target pathways
Aggregated over 5 target gene(s): SLC46A1, PTGS1, PTGS2, PTGDR2, PPARG.
Top Reactome pathways
22 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Synthesis of Prostaglandins (PG) and Thromboxanes (TX) | 2 | PTGS1, PTGS2 |
| COX reactions | 1 | PTGS1 |
| Metabolism of folate and pterines | 1 | SLC46A1 |
| PPARA activates gene expression | 1 | PPARG |
| Synthesis of 15-eicosatetraenoic acid derivatives | 1 | PTGS2 |
| Transcriptional regulation of white adipocyte differentiation | 1 | PPARG |
| Nuclear Receptor transcription pathway | 1 | PPARG |
| Prostanoid ligand receptors | 1 | PTGDR2 |
| SUMOylation of intracellular receptors | 1 | PPARG |
| G alpha (i) signalling events | 1 | PTGDR2 |
| Interleukin-10 signaling | 1 | PTGS2 |
| Interleukin-4 and Interleukin-13 signaling | 1 | PTGS2 |
| Regulation of PTEN gene transcription | 1 | PPARG |
| Biosynthesis of DHA-derived SPMs | 1 | PTGS2 |
| Biosynthesis of EPA-derived SPMs | 1 | PTGS2 |
| MECP2 regulates transcription factors | 1 | PPARG |
| Biosynthesis of DPAn-3 SPMs | 1 | PTGS2 |
| Biosynthesis of electrophilic ω-3 PUFA oxo-derivatives | 1 | PTGS2 |
| Iron uptake and transport | 1 | SLC46A1 |
| Heme signaling | 1 | SLC46A1 |
| MLL4 and MLL3 complexes regulate expression of PPARG target genes in adipogenesis and hepatic steatosis | 1 | PPARG |
| Transcriptional regulation of brown and beige adipocyte differentiation by EBF2 | 1 | PPARG |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of blood pressure | 3 |
| fatty acid metabolic process | 3 |
| prostaglandin biosynthetic process | 2 |
| response to oxidative stress | 2 |
| cyclooxygenase pathway | 2 |
| regulation of cell population proliferation | 2 |
| long-chain fatty acid biosynthetic process | 2 |
| lipid metabolic process | 2 |
| fatty acid biosynthetic process | 2 |
| prostaglandin metabolic process | 2 |
| prostanoid biosynthetic process | 2 |
| cellular oxidant detoxification | 2 |
| brown fat cell differentiation | 2 |
| cellular response to hypoxia | 2 |
| G protein-coupled receptor signaling pathway | 2 |
Indications & clinical
Indications
35 indications (12 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| ankylosing spondylitis | 4 | MONDO:0005306 | EFO:0003898 |
| eye disorder | 4 | MONDO:0005328 | EFO:0005752 |
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| rheumatic disorder | 4 | MONDO:0005554 | EFO:0005755 |
| gout | 4 | MONDO:0005393 | EFO:0004274 |
| patent ductus arteriosus | 4 | MONDO:0011827 | HP:0001643 |
| rheumatoid arthritis | 4 | MONDO:0008383 | EFO:0000685 |
| spondylitis | 4 | MONDO:0003937 | MONDO:0003937 |
| osteoarthritis | 4 | MONDO:0005178 | MONDO:0005178 |
| pancreatitis | 3 | MONDO:0004982 | EFO:0000278 |
| acute pancreatitis | 3 | MONDO:0006515 | EFO:1000652 |
| oral cavity squamous cell carcinoma | 3 | MONDO:0004958 | EFO:0000199 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | MONDO:0100096 |
| Alzheimer disease | 3 | MONDO:0004975 | MONDO:0004975 |
| head and neck squamous cell carcinoma | 2 | MONDO:0010150 | EFO:0000181 |
| metastatic prostate carcinoma | 2 | MONDO:0004956 | EFO:0000196 |
| cutaneous melanoma | 2 | MONDO:0005012 | EFO:0000389 |
| Langerhans cell histiocytosis | 2 | MONDO:0018310 | EFO:1000318 |
| prostate adenocarcinoma | 2 | MONDO:0005082 | EFO:0000673 |
| orthostatic hypotension | 1 | MONDO:0005469 | EFO:0005252 |
| chronic pancreatitis | 1 | MONDO:0005003 | EFO:0000342 |
| breast neoplasm | 1 | MONDO:0021100 | MONDO:0007254 |
| asthma | 1 | MONDO:0004979 | MONDO:0004979 |
| ulcerative colitis | 1 | MONDO:0005101 | EFO:0000729 |
11 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 124.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 29 |
| PHASE4 | 25 |
| PHASE3 | 25 |
| PHASE2 | 14 |
| PHASE1 | 11 |
| PHASE1/PHASE2 | 10 |
| EARLY_PHASE1 | 7 |
| PHASE2/PHASE3 | 3 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT06433453 | PHASE4 | RECRUITING | Three Dimensional Ultrasonographic Detection of Human Ovulation |
| NCT00116623 | PHASE4 | TERMINATED | Magnesium Sulfate Versus Indomethacin for Preterm Labor |
| NCT00226122 | PHASE4 | COMPLETED | The Effect of Indomethacin in Monosymptomatic Enuresis Nocturnal |
| NCT00462111 | PHASE4 | COMPLETED | Indomethacin and Mechanisms Underlying Risk of Falling |
| NCT00470743 | PHASE4 | WITHDRAWN | Comparing Ibuprofen And Indomethacin For The Treatment Of The Patent Ductus Arteriosus in Very Premature Babies |
| NCT00473980 | PHASE4 | COMPLETED | Preoperative Non-steroidal Anti-inflammatory Drugs(NSAID) to Colorectal Cancer Patients |
| NCT00820612 | PHASE4 | TERMINATED | Rectal Indomethacin in the Prevention of Post-endoscopic Retrograde Cholangiopancreatography (ERCP) Pancreatitis in High Risk Patients |
| NCT01073670 | PHASE4 | COMPLETED | Indomethacin and Cardiac Bypass Surgery |
| NCT01830335 | PHASE4 | COMPLETED | Cerebral Blood Flow and PETCO2 on Neuromuscular Function During Environmental Stress |
| NCT01848665 | PHASE4 | COMPLETED | The Influence of Cerebral Blood Flow and PETCO2 on Neuromuscular Function During Passive Heat Stress |
| NCT01957215 | PHASE4 | COMPLETED | Efficacy of Topical Indomethacin Patch Over Placebo in Ankle Sprain Pain Relief |
| NCT02183155 | PHASE4 | COMPLETED | Effect of Meloxicam Tablets on Bleeding Time in Healthy Subjects |
| NCT02438371 | PHASE4 | TERMINATED | Nifedipine or Nifedipine Plus Indomethacin for Treatment of Acute Preterm Labor |
| NCT02577809 | PHASE4 | COMPLETED | Intrathecal Opioid Study |
| NCT02711358 | PHASE4 | COMPLETED | Indomethacin Use in Pain Relief During Intrauterine Device Insertion |
| NCT02770950 | PHASE4 | COMPLETED | Zushima Plaster for Treating Knee Osteoarthritis |
| NCT02797067 | PHASE4 | COMPLETED | Rectal Indomethacin to Prevent Post ESWL-pancreatitis |
| NCT02947932 | PHASE4 | UNKNOWN | Oral Resveratrol to Prevent Post-ERCP Pancreatitis |
| NCT02964403 | PHASE4 | UNKNOWN | COX-2 Inhibitor to Prevent Post-ERCP Pancreatitis |
| NCT03261635 | PHASE4 | COMPLETED | Ranibizumab Plus Indomethacin |
| NCT03473665 | PHASE4 | TERMINATED | Non-Steroidal Anti-inflammatory Drugs in Axial Spondyloarthritis |
| NCT03708458 | PHASE4 | UNKNOWN | Pharmacological Prophylaxis of Post- Endoscopic Retrograde Cholangiopancreatography (ERCP) Pancreatitis |
| NCT05132829 | PHASE4 | UNKNOWN | Azithromycin to Improve Latency in Exam Indicated Cerclage Control Trial |
| NCT05664074 | PHASE4 | COMPLETED | Rectal Indomethacin vs Intravenous Ketorolac |
| NCT06253702 | PHASE4 | COMPLETED | Brain Blood Flow Responses to Stress: Sex Differences |
| NCT02205762 | PHASE2/PHASE3 | ACTIVE_NOT_RECRUITING | LCH-IV, International Collaborative Treatment Protocol for Children and Adolescents With Langerhans Cell Histiocytosis |
| NCT03713879 | PHASE3 | RECRUITING | Comparative Effectiveness Between Indomethacin and Pancreatic Stenting in the Prevention of Post ERCP Pancreatitis |
| NCT05252754 | PHASE3 | RECRUITING | Rectal Indomethacin and Oral Tacrolimus Versus Combination to Prevent Post-ERCP Pancreatitis |
| NCT00000494 | PHASE3 | COMPLETED | Management of Patent Ductus in Premature Infants |
| NCT00009646 | PHASE3 | COMPLETED | Trial of Indomethacin Prophylaxis in Preterm Infants (TIPP) |
| NCT00033917 | PHASE3 | COMPLETED | Indomethacin Germinal Matrix Hemorrhage/Intraventricular Hemorrhage (GMH/IVH) Prevention Trial |
| NCT00432081 | PHASE3 | COMPLETED | Effect of Indomethacin on the Progression of Alzheimer’s Disease |
| NCT00485160 | PHASE3 | COMPLETED | Ibuprofen vs. Continuous Indomethacin in the Treatment of PDA |
| NCT00549549 | PHASE3 | COMPLETED | Celebrex In Acute Gouty Arthritis Study |
| NCT00750581 | PHASE2/PHASE3 | TERMINATED | An Escalating Dose Indomethacin for the Treatment of Persistent Patent Ductus Arteriosus (PDA) In Preterm Infants |
| NCT00855920 | PHASE3 | COMPLETED | Study Utilizing Rilonacept in Gout Exacerbations |
| NCT01265849 | PHASE3 | COMPLETED | Efficacy and Safety Study of Leukocyte Interleukin,Injection (LI) to Treat Cancer of the Oral Cavity |
| NCT01360034 | PHASE3 | UNKNOWN | Nifedipine Versus Indomethacin in the Treatment of Preterm Labour |
| NCT01543685 | PHASE3 | COMPLETED | Study of Indomethacin Capsules to Treat Pain Following Bunionectomy |
| NCT01626118 | PHASE3 | COMPLETED | Study of Indomethacin Capsules to Treat Pain Following Bunionectomy |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (1) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of CPIC Guideline for aceclofenac, aspirin, diclofenac, dip | CPIC | CYP2C9 |
PharmGKB also curates 2 clinical and 13 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
483 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| LUMIRACOXIB | ChEMBL | Phase 4 (approved) | PPARG, PTGS1, PTGS2 |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | PPARG, PTGS1, PTGS2 |
| RESVERATROL | ChEMBL | Phase 3 | PPARG, PTGS1, PTGS2 |
| Fulvestrant | ChEMBL + PubChem | Phase 4 (approved) | PPARG, PTGS2 |
| 3,3’,4’,5-TETRACHLOROSALICYLANILIDE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ACEMETACIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| BROMFENAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| CAPSAICIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CAPTOPRIL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CARPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CIANIDANOL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DEXIBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DEXKETOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DICLOFENAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ESFLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ETODOLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ETORICOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| FLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| GLAFENINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| IBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| KETOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| KETOROLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LASOFOXIFENE | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| LEVODOPA | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LEVOTHYROXINE | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| LOXOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MASOPROCOL | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| MECLOFENAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MEFENAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MELOXICAM | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MOFEZOLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MONOBENZONE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| NAPROXEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| NIMESULIDE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| OMADACYCLINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| OXAPROZIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| PIROXICAM | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| PRIMAQUINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| RANITIDINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ROFECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| SELINEXOR | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| SULINDAC | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| SUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TEGASEROD | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TELOTRISTAT | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TIPRANAVIR | ChEMBL | Phase 4 (approved) | PPARG, PTGS2 |
| TOLMETIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| VALDECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| VORTIOXETINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CURCUMIN | ChEMBL | Phase 3 | PTGS1, PTGS2 |
| GAMOLENIC ACID | ChEMBL | Phase 3 | PPARG, PTGS1 |
| ICOSAPENT | ChEMBL | Phase 3 | PPARG, PTGS1 |
| QUERCETIN | ChEMBL | Phase 3 | PPARG, PTGS2 |
Related Atlas pages
- Genes: SLC46A1, PTGS1, PTGS2, PTGDR2, PPARG
- Diseases: ankylosing spondylitis, eye disorder, cardiovascular disorder, rheumatic disorder, gout, patent ductus arteriosus, rheumatoid arthritis, spondylitis, osteoarthritis, pancreatitis, acute pancreatitis, oral cavity squamous cell carcinoma, severe acute respiratory syndrome, Alzheimer disease
- Drugs: Lumiracoxib, Troglitazone, Resveratrol, Fulvestrant, 3,3’,4’,5-TETRACHLOROSALICYLANILIDE, Acemetacin, Aspirin, Bromfenac, Candesartan Cilexetil, Cannabidiol, Capsaicin, Captopril, Carprofen, Celecoxib, Cianidanol, Dexibuprofen, Dexketoprofen, Diclofenac, Diethylstilbestrol, Doxorubicin, Esflurbiprofen, Etodolac, Etoricoxib, Flurbiprofen, Glafenine, Hexachlorophene, Ibuprofen, Ketorolac, Lasofoxifene, Levodopa, Levothyroxine, Loxoprofen, Masoprocol, Meclofenamic Acid, Mefenamic Acid, Meloxicam, Mofezolac, Monobenzone, Naproxen, Nimesulide, Omadacycline, Oxaprozin, Piroxicam, Primaquine, Ranitidine, Rofecoxib, Selinexor, Sulindac, Suprofen, Tegaserod, Telotristat, Tipranavir, Tolmetin, Valdecoxib, Vortioxetine, Curcumin, Gamolenic Acid, Icosapent, Quercetin