Isoproterenol
drugOn this page
Also known as A-21AleudrinAludrineAsiprenolAsmalarAssiprenolBellasthmanIsonorinIsoprenalinaIsoprenalineIsopropydrinIsoproterenol dl-formIsoreninIsuprenNeo-epinineNeodrenalNovodrinNSC-33791NSC-9975
Summary
Isoproterenol (CHEMBL434) is an approved small-molecule sympathomimetic agent (ATC C01CA02) targeting ADRB1, ADRB2, and ADRB3; indicated across 7 conditions including cardiovascular disorder and obstructive lung disease.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C01CA02 (+3 more)
- Targets: 3 (ADRB1, ADRB2, ADRB3)
- Indications: 7 conditions
- Clinical trials: 16
- Chemistry: 211.26 Da · C11H17NO3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL434 |
| Name | Isoproterenol |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 3779 |
| ChEBI | CHEBI:64317 |
| ATC | C01CA02, R03CB51, R03AB02, R03CB01 |
| Molecular formula | C11H17NO3 |
| Molecular weight | 211.26 |
| InChIKey | JWZZKOKVBUJMES-UHFFFAOYSA-N |
SMILES: CC(C)NCC(C1=CC(=C(C=C1)O)O)O
IUPAC name: 4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol
ChEBI definition: A secondary amino compound that is noradrenaline in which one of the hydrogens attached to the nitrogen is replaced by an isopropyl group. A sympathomimetic acting almost exclusively on β-adrenergic receptors, it is used (mainly as the hydrochloride salt) as a bronghodilator and heart stimulant for the management of a variety of cardiac disorders.
Pharmacological roles (ChEBI): sympathomimetic agent, β-adrenergic agonist, bronchodilator agent, cardiotonic drug.
Also known as: A-21, Aleudrin, Aludrine, Asiprenol, Asmalar, Assiprenol, Bellasthman, Isonorin, Isoprenalina, Isoprenaline, Isopropydrin, Isoproterenol
Parent form; salt/anhydrous children: CHEMBL1711, CHEMBL3989521
Patent coverage: 12,178 distinct patent families (40,234 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 40,137 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ADRB1 | β1-adrenoceptor | Full agonist | 7 | 0% | P08588 |
| ADRB2 | β2-adrenoceptor | Full agonist | 6.6 | 0.4% | P07550 |
| ADRB3 | β3-adrenoceptor | Full agonist | 6.2 | 0.1% | P13945 |
Broader ChEMBL bioactivity targets: 51 (assay-derived). Sample: Microtubule-associated protein tau, 4’-phosphopantetheinyl transferase ffp, Adrenergic receptor alpha-1, Taste receptor type 2 member 31, Adrenergic receptor alpha-2, Adrenergic receptor beta, Adrenergic receptor alpha-1, Adrenergic receptor beta, Beta-2 adrenergic receptor, Beta-adrenergic receptor.
Bioactivity
ChEMBL activities: 151 potent at pChembl ≥ 5 of 163 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ADRB1 | 10.08 | EC50 | 0.08 | nM | CHEMBL_ACT_1436810 |
| ADRB1 | 10.08 | EC50 | 0.08 | nM | CHEMBL_ACT_2117342 |
| ADRB1 | 10.08 | EC50 | 0.08 | nM | CHEMBL_ACT_2374131 |
| ADRB1 | 10.08 | EC50 | 0.08 | nM | CHEMBL_ACT_2448337 |
| ADRB1 | 10.08 | EC50 | 0.08 | nM | CHEMBL_ACT_2565046 |
| P54833 | 10 | IC50 | 0.1 | nM | CHEMBL_ACT_1181729 |
| P54833 | 10 | IC50 | 0.1 | nM | CHEMBL_ACT_461044 |
| P10608 | 10 | IC50 | 0.1 | nM | CHEMBL_ACT_461045 |
| ADRB2 | 9.8 | EC50 | 0.16 | nM | CHEMBL_ACT_1712410 |
| ADRB2 | 9.8 | EC50 | 0.16 | nM | CHEMBL_ACT_663635 |
| ADRB2 | 9.7 | EC50 | 0.2 | nM | CHEMBL_ACT_13871642 |
| ADRB2 | 9.67 | EC50 | 0.21 | nM | CHEMBL_ACT_23306534 |
| ADRB2 | 9.5 | EC50 | 0.32 | nM | CHEMBL_ACT_18786117 |
| ADRB2 | 9.5 | EC50 | 0.32 | nM | CHEMBL_ACT_18988265 |
| ADRB2 | 9.33 | EC50 | 0.47 | nM | CHEMBL_ACT_25928966 |
| ADRB2 | 9.15 | EC50 | 0.7 | nM | CHEMBL_ACT_18704116 |
| ADRB1 | 9.08 | EC50 | 0.84 | nM | CHEMBL_ACT_2509549 |
| ADRB2 | 9.08 | EC50 | 0.84 | nM | CHEMBL_ACT_2706017 |
| ADRB3 | 9.01 | EC50 | 0.97 | nM | CHEMBL_ACT_1436809 |
| ADRB3 | 9.01 | EC50 | 0.97 | nM | CHEMBL_ACT_2117299 |
| ADRB3 | 9.01 | EC50 | 0.97 | nM | CHEMBL_ACT_2374109 |
| ADRB3 | 9.01 | EC50 | 0.97 | nM | CHEMBL_ACT_2448335 |
| ADRB3 | 9.01 | EC50 | 0.97 | nM | CHEMBL_ACT_2509547 |
| ADRB3 | 9.01 | EC50 | 0.97 | nM | CHEMBL_ACT_2565045 |
| ADRB1 | 9 | EC50 | 1 | nM | CHEMBL_ACT_1712412 |
| ADRB1 | 9 | EC50 | 1 | nM | CHEMBL_ACT_663637 |
| ADRB2 | 8.92 | EC50 | 1.2 | nM | CHEMBL_ACT_19313174 |
| ADRB1 | 8.9 | EC50 | 1.26 | nM | CHEMBL_ACT_23306495 |
| ADRA1D | 8.82 | EC50 | 1.5 | nM | CHEMBL_ACT_183713 |
| ADRB1 | 8.75 | EC50 | 1.78 | nM | CHEMBL_ACT_25929010 |
Target pathways
Aggregated over 3 target gene(s): ADRB1, ADRB2, ADRB3.
Top Reactome pathways
16 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 3 | ADRB1, ADRB2, ADRB3 |
| Signaling by GPCR | 3 | ADRB1, ADRB2, ADRB3 |
| Class A/1 (Rhodopsin-like receptors) | 3 | ADRB1, ADRB2, ADRB3 |
| Amine ligand-binding receptors | 3 | ADRB1, ADRB2, ADRB3 |
| GPCR downstream signalling | 3 | ADRB1, ADRB2, ADRB3 |
| Adrenoceptors | 3 | ADRB1, ADRB2, ADRB3 |
| G alpha (s) signalling events | 3 | ADRB1, ADRB2, ADRB3 |
| GPCR ligand binding | 3 | ADRB1, ADRB2, ADRB3 |
| Membrane Trafficking | 1 | ADRB2 |
| Metabolism of proteins | 1 | ADRB2 |
| Vesicle-mediated transport | 1 | ADRB2 |
| Deubiquitination | 1 | ADRB2 |
| Ub-specific processing proteases | 1 | ADRB2 |
| Post-translational protein modification | 1 | ADRB2 |
| Cargo recognition for clathrin-mediated endocytosis | 1 | ADRB2 |
| Clathrin-mediated endocytosis | 1 | ADRB2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| diet induced thermogenesis | 3 |
| norepinephrine-epinephrine-mediated vasodilation involved in regulation of systemic arterial blood pressure | 3 |
| adenylate cyclase-activating G protein-coupled receptor signaling pathway | 3 |
| response to cold | 3 |
| heat generation | 3 |
| negative regulation of multicellular organism growth | 3 |
| positive regulation of MAPK cascade | 3 |
| brown fat cell differentiation | 3 |
| adenylate cyclase-activating adrenergic receptor signaling pathway | 3 |
| positive regulation of cold-induced thermogenesis | 3 |
| signal transduction | 3 |
| G protein-coupled receptor signaling pathway | 3 |
| positive regulation of cardiac muscle cell apoptotic process | 2 |
| adenylate cyclase-modulating G protein-coupled receptor signaling pathway | 2 |
| negative regulation of smooth muscle contraction | 2 |
Indications & clinical
Indications
7 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| obstructive lung disease | 4 | MONDO:0002267 | HP:0006536 |
| atrial fibrillation | 2 | MONDO:0004981 | EFO:0000275 |
| nephrolithiasis | 2 | MONDO:0008171 | EFO:0004253 |
| lipoma | 1 | MONDO:0005106 | EFO:0000759 |
| orthostatic hypotension | 1 | MONDO:0005469 | EFO:0005252 |
| postural orthostatic tachycardia syndrome | 1 | MONDO:0011479 | EFO:1000645 |
Clinical trials
Total trials: 16.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 9 |
| EARLY_PHASE1 | 3 |
| PHASE2 | 2 |
| PHASE2/PHASE3 | 1 |
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00428428 | PHASE2/PHASE3 | COMPLETED | Pharmacological Modulation of the Intrarenal Pressure During Endourological Procedures in the Upper Urinary Tract |
| NCT00323843 | PHASE2 | UNKNOWN | Retrograde Intrarenal Stone Surgery - A Method of Treating the ESWL Resistant Kidney Stone |
| NCT03032965 | PHASE2 | COMPLETED | Adenosine to Assess Complete Conduction Block During Catheter Ablation of Paroxysmal Atrial Fibrillation |
| NCT00748059 | PHASE1 | COMPLETED | The Pathophysiology of Orthostatic Hypotension |
| NCT05219799 | EARLY_PHASE1 | RECRUITING | Sex Disparities in Hypoxic Vasodilation and Impact of Obesity |
| NCT06520982 | EARLY_PHASE1 | RECRUITING | Early Neurovascular Adaptations in Aging Women |
| NCT06643221 | EARLY_PHASE1 | RECRUITING | Exercise as an Immune Adjuvant for Allogeneic Cell Therapies |
| NCT02673996 | Not specified | RECRUITING | POTS Adrenergic Ab (CIHR Aims #1&2) |
| NCT02725060 | Not specified | ENROLLING_BY_INVITATION | Autoimmune Basis for Postural Tachycardia Syndrome |
| NCT00226551 | Not specified | COMPLETED | Vascular Response to Isoproterenol and β2 Adrenergic Receptor Polymorphisms |
| NCT01377636 | Not specified | COMPLETED | Measurement of Bispectral Index and Awareness in Patients Undergoing Electrophysiology Studies With Isoproterenol |
| NCT02524145 | Not specified | COMPLETED | Chronotropic Incompetence in Patients With HFpEF |
| NCT02615119 | Not specified | COMPLETED | Neural Basis of Meal Related Interoceptive Dysfunction in Anorexia Nervosa |
| NCT02726620 | Not specified | COMPLETED | Decision Support for Intraoperative Low Blood Pressure |
| NCT03019081 | Not specified | UNKNOWN | Augmented Interoceptive Exposure Training in Anorexia Nervosa |
| NCT06082388 | Not specified | UNKNOWN | Atropine vs Isoprenaline in the Invasive Diagnosis of Arrhythmias |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 1 clinical and 2 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
280 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Crizotinib | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| Desloratadine | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| Dihydroergotamine | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| Pramipexole | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| RIFAMPIN | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| BISOPROLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| EPINEPHRINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| FENOTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| FORMOTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| LABETALOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| LEVOBUNOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| MONTELUKAST | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| NOREPINEPHRINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| PHENYLEPHRINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| PINDOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| PRACTOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| PROPAFENONE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| PROPRANOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| SALMETEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| SOTALOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| THIORIDAZINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| TIMOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2, ADRB3 |
| ALPRENOLOL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| BOPINDOLOL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| CIMATEROL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| FLESTOLOL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| LEVISOPRENALINE | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| LEVOPROPRANOLOL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| MILVETEROL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| RAFABEGRON | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| SOLABEGRON | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| TRETOQUINOL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| XAMOTEROL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| ZENIDOLOL | ChEMBL | Phase 2 | ADRB1, ADRB2, ADRB3 |
| Alogliptin | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Bosentan | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Fidaxomicin | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Glycopyrrolate | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Linagliptin | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Methotrexate | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Propoxyphene | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Pyrazinamide | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| Tiotropium Bromide Monohydrate | PubChem | Approved | ADRB1, ADRB2, ADRB3 |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRB2, ADRB3 |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRB2, ADRB3 |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2 |
| TAMSULOSIN | ChEMBL + PubChem | Phase 4 (approved) | ADRB1, ADRB2 |
| ACEBUTOLOL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| ALBUTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB3 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | ADRB2, ADRB3 |
| ARFORMOTEROL | ChEMBL | Phase 4 (approved) | ADRB1, ADRB2 |
Related Atlas pages
- Genes: ADRB1, ADRB2, ADRB3
- Diseases: cardiovascular disorder, obstructive lung disease
- Drugs: Crizotinib, Desloratadine, Dihydroergotamine, Pramipexole, Rifampin, Tegaserod, Aripiprazole, Bisoprolol, Bromocriptine, Carvedilol, Clotrimazole, Epinephrine, Fenoterol, Formoterol, Labetalol, Levobunolol, Montelukast, Norepinephrine, Phenylephrine, Pimozide, Pindolol, Practolol, Propafenone, Propranolol, Salmeterol, Sotalol, Tamoxifen, Thioridazine, Timolol, Alogliptin, Bosentan, Fidaxomicin, Glycopyrrolate, Linagliptin, Methotrexate, Propoxyphene, Pyrazinamide, Clozapine, Olanzapine, Olodaterol, Tamsulosin, Acebutolol, Albuterol, Amiodarone, Amitriptyline, Amlodipine, Arformoterol