Ivarmacitinib
drugOn this page
Also known as SHR-0302 FREE BASESHR0302 FREE BASESHR0302 base
Summary
Ivarmacitinib (CHEMBL5095398) is a phase-3 clinical-stage small molecule targeting JAK1 and JAK2; indicated across 2 conditions including autoimmune disease.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 2 (JAK1, JAK2)
- Indications: 2 conditions
- Clinical trials: 9
- Chemistry: 414.5 Da · C18H22N8O2S
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL5095398 |
| Name | Ivarmacitinib |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 71622431 |
| Molecular formula | C18H22N8O2S |
| Molecular weight | 414.5 |
| InChIKey | DNBCBAXDWNDRNO-FOSCPWQOSA-N |
SMILES: CN(C1C[C@@H]2CN(C[C@@H]2C1)C(=O)NC3=NC(=NS3)OC)C4=NC=NC5=C4C=CN5
IUPAC name: (3aS,6aR)-N-(3-methoxy-1,2,4-thiadiazol-5-yl)-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide
Also known as: Ivarmacitinib, SHR-0302 FREE BASE, SHR0302 FREE BASE, SHR0302 base, IVARMACITINIB
Parent form; salt/anhydrous children: CHEMBL5095399
Patent coverage: 39 distinct patent families (104 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 70 (67%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| JAK1 | Janus kinase 1 | Inhibition | 8.7 | 2.8% | P23458 |
| JAK2 | Janus kinase 2 | Inhibition | 8.3 | 0.7% | O60674 |
Broader ChEMBL bioactivity targets: 2 (assay-derived). Sample: Tyrosine-protein kinase JAK1, Tyrosine-protein kinase JAK2.
Bioactivity
ChEMBL activities: 6 potent at pChembl ≥ 5 of 6 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| JAK1 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_26672315 |
| JAK1 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_26751197 |
| JAK1 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_27755666 |
| JAK2 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_26672480 |
| JAK2 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_26751362 |
| JAK2 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_27755831 |
Target pathways
Aggregated over 2 target gene(s): JAK1, JAK2.
Top Reactome pathways
84 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Interleukin-6 signaling | 2 | JAK1, JAK2 |
| MAPK3 (ERK1) activation | 2 | JAK1, JAK2 |
| RAF-independent MAPK1/3 activation | 2 | JAK1, JAK2 |
| MAPK1 (ERK2) activation | 2 | JAK1, JAK2 |
| Cytokine Signaling in Immune system | 2 | JAK1, JAK2 |
| Signal Transduction | 2 | JAK1, JAK2 |
| Disease | 2 | JAK1, JAK2 |
| Immune System | 2 | JAK1, JAK2 |
| Interleukin-12 family signaling | 2 | JAK1, JAK2 |
| Signaling by Interleukins | 2 | JAK1, JAK2 |
| Interleukin-2 family signaling | 2 | JAK1, JAK2 |
| Interleukin-3, Interleukin-5 and GM-CSF signaling | 2 | JAK1, JAK2 |
| Infectious disease | 2 | JAK1, JAK2 |
| RAF/MAP kinase cascade | 2 | JAK1, JAK2 |
| MAPK family signaling cascades | 2 | JAK1, JAK2 |
| MAPK1/MAPK3 signaling | 2 | JAK1, JAK2 |
| Interleukin-6 family signaling | 2 | JAK1, JAK2 |
| Interleukin-4 and Interleukin-13 signaling | 2 | JAK1, JAK2 |
| IL-6-type cytokine receptor ligand interactions | 2 | JAK1, JAK2 |
| Interferon gamma signaling | 2 | JAK1, JAK2 |
| Regulation of IFNG signaling | 2 | JAK1, JAK2 |
| Interleukin-20 family signaling | 2 | JAK1, JAK2 |
| Interleukin-35 Signalling | 2 | JAK1, JAK2 |
| Interleukin-12 signaling | 2 | JAK1, JAK2 |
| Interleukin-27 signaling | 2 | JAK1, JAK2 |
| Interleukin receptor SHC signaling | 2 | JAK1, JAK2 |
| Interferon Signaling | 2 | JAK1, JAK2 |
| Signaling by CSF3 (G-CSF) | 2 | JAK1, JAK2 |
| Potential therapeutics for SARS | 2 | JAK1, JAK2 |
| SARS-CoV Infections | 2 | JAK1, JAK2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| protein phosphorylation | 2 |
| cell surface receptor signaling pathway via JAK-STAT | 2 |
| cytokine-mediated signaling pathway | 2 |
| cell differentiation | 2 |
| intracellular signal transduction | 2 |
| response to antibiotic | 2 |
| type II interferon-mediated signaling pathway | 2 |
| growth hormone receptor signaling pathway via JAK-STAT | 2 |
| interleukin-6-mediated signaling pathway | 2 |
| cellular response to virus | 2 |
| regulation of cell-cell adhesion | 2 |
| positive regulation of homotypic cell-cell adhesion | 1 |
| interleukin-15-mediated signaling pathway | 1 |
| interleukin-4-mediated signaling pathway | 1 |
| interleukin-2-mediated signaling pathway | 1 |
Indications & clinical
Indications
2 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| autoimmune disease | 1 | MONDO:0007179 | EFO:0005809 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 9.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 4 |
| PHASE4 | 2 |
| Not specified | 2 |
| PHASE1/PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT07451665 | PHASE4 | NOT_YET_RECRUITING | Efficacy and Safety of Vunakizumab and Ivarmacitinib in the Treatment of Active Takayasu’s Arteritis |
| NCT07452445 | PHASE4 | NOT_YET_RECRUITING | Efficacy and Safety of Ivarmacitinib Monotherapy in the Treatment of csDMARDs-IR Rheumatoid Arthritis |
| NCT06731153 | PHASE2 | NOT_YET_RECRUITING | JAK1 Inhibitor Ivarmacitinib Reversing Immunotherapy Resistance in TNBC |
| NCT07313202 | PHASE2 | NOT_YET_RECRUITING | Ivarmacitinib in Advanced Solid Tumors: A Prospective, Two-Cohort, Two-Phase Exploratory Study in Patients Discontinued Due to Immune Intolerance |
| NCT07381114 | PHASE1/PHASE2 | NOT_YET_RECRUITING | A Clinical Study on the Efficacy and Safety of Ivarmacitinib in Preventing aGVHD After HLA-matched Transplantation |
| NCT07505186 | PHASE2 | NOT_YET_RECRUITING | Camrelizumab, Chemotherapy and Ivarmacitinib in Patients With Resectable Esophageal Squamous Cell Carcinoma |
| NCT07570745 | PHASE2 | RECRUITING | Low-Dose ATG/PTCy Plus Ivarmacitinib for aGVHD Prevention in Haplo-PBSCT From Parous Female Donors |
| NCT07266168 | Not specified | NOT_YET_RECRUITING | Efficacy and Safety of Ivarmacitinib in the Treatment of Patients With Polymyalgia Rheumatica |
| NCT07270003 | Not specified | RECRUITING | A Prospective, Single-arm, Open-label Clinical Trial to Evaluate the Efficacy and Safety of Ivarmacitinib in the Treatment of Palmoplantar Pustulosis |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
104 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | JAK1, JAK2 |
| DEUCRAVACITINIB | ChEMBL + PubChem | Phase 4 (approved) | JAK1, JAK2 |
| Pazopanib | ChEMBL + PubChem | Phase 4 (approved) | JAK1, JAK2 |
| RITLECITINIB | ChEMBL + PubChem | Phase 4 (approved) | JAK1, JAK2 |
| ABROCITINIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| BARICITINIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| CERITINIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| FILGOTINIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| MOMELOTINIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| PACRITINIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| PEFICITINIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| PONATINIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| RUXOLITINIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| TOFACITINIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| UPADACITINIB | ChEMBL | Phase 4 (approved) | JAK1, JAK2 |
| ABIVERTINIB | ChEMBL | Phase 3 | JAK1, JAK2 |
| BREPOCITINIB | ChEMBL | Phase 3 | JAK1, JAK2 |
| DELGOCITINIB | ChEMBL | Phase 3 | JAK1, JAK2 |
| DOVITINIB | ChEMBL | Phase 3 | JAK1, JAK2 |
| ITACITINIB | ChEMBL | Phase 3 | JAK1, JAK2 |
| LESTAURTINIB | ChEMBL | Phase 3 | JAK1, JAK2 |
| POVORCITINIB | ChEMBL | Phase 3 | JAK1, JAK2 |
| AT-9283 | ChEMBL | Phase 2 | JAK1, JAK2 |
| ATINVICITINIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| AZD-1480 | ChEMBL | Phase 2 | JAK1, JAK2 |
| BMS-911543 | ChEMBL | Phase 2 | JAK1, JAK2 |
| CC-401 | ChEMBL | Phase 2 | JAK1, JAK2 |
| CERDULATINIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| DECERNOTINIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| GANDOTINIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| GOLIDOCITINIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| GUSACITINIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| IFIDANCITINIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| IZENCITINIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| LONDAMOCITINIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| NEZULCITINIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| NS-018 | ChEMBL | Phase 2 | JAK1, JAK2 |
| OCLACITINIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| R-406 | ChEMBL | Phase 2 | JAK1, JAK2 |
| REBASTINIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| ROPSACITINIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| SOLCITINIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| SU-014813 | ChEMBL | Phase 2 | JAK1, JAK2 |
| TOZASERTIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| ZOTIRACICLIB | ChEMBL | Phase 2 | JAK1, JAK2 |
| Afatinib | PubChem | Approved | JAK1, JAK2 |
| Fostamatinib | PubChem | Approved | JAK1, JAK2 |
| Gefitinib | PubChem | Approved | JAK1, JAK2 |
| Idelalisib | PubChem | Approved | JAK1, JAK2 |
| Imatinib | PubChem | Approved | JAK1, JAK2 |
| Selumetinib | PubChem | Approved | JAK1, JAK2 |
| Trametinib | PubChem | Approved | JAK1, JAK2 |
| AXITINIB | ChEMBL | Phase 4 (approved) | JAK2 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | JAK2 |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | JAK2 |
Related Atlas pages
- Genes: JAK1, JAK2
- Drugs: Crizotinib, Deucravacitinib, Pazopanib, Ritlecitinib, Abrocitinib, Baricitinib, Ceritinib, Entrectinib, Fedratinib, Filgotinib, Midostaurin, Momelotinib, Nintedanib, Pacritinib, Peficitinib, Ponatinib, Ruxolitinib, Sunitinib, Tofacitinib, Upadacitinib, Abivertinib, Brepocitinib, Delgocitinib, Dovitinib, Itacitinib, Lestaurtinib, Povorcitinib, Afatinib, Fostamatinib, Gefitinib, Idelalisib, Imatinib, Selumetinib, Trametinib, Axitinib, Bosutinib, Brigatinib