Ketanserin
drugOn this page
Also known as Ketanserin tartrateKetanserinaKetanserineKJK 945NSC-758959PerketanR 49945R-41,468R-41468R-49945SerepressSufrexalSID11113781SID26747132SID26751962SID26755333SID90340810SID104171396SID26747133
Summary
Ketanserin (CHEMBL51) is an approved small-molecule α-adrenergic antagonist (ATC C02KD01) targeting HTR2A; indicated across 3 conditions including hypertensive disorder and acute kidney injury.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C02KD01
- Targets: 1 (HTR2A)
- Indications: 3 conditions
- Clinical trials: 7
- Chemistry: 395.4 Da · C22H22FN3O3
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL51 |
| Name | Ketanserin |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 3822 |
| ChEBI | CHEBI:6123 |
| ATC | C02KD01 |
| Molecular formula | C22H22FN3O3 |
| Molecular weight | 395.4 |
| InChIKey | FPCCSQOGAWCVBH-UHFFFAOYSA-N |
SMILES: C1CN(CCC1C(=O)C2=CC=C(C=C2)F)CCN3C(=O)C4=CC=CC=C4NC3=O
IUPAC name: 3-[2-[4-(4-fluorobenzoyl)piperidin-1-yl]ethyl]-1H-quinazoline-2,4-dione
ChEBI definition: A member of the class of quinazolines that is quinazoline-2,4(1H,3H)-dione which is substituted at position 3 by a 2-[4-(p-fluorobenzoyl)piperidin-1-yl]ethyl group.
Pharmacological roles (ChEBI): α-adrenergic antagonist, serotonergic antagonist, antihypertensive agent, cardiovascular drug, EC 3.4.21.26 (prolyl oligopeptidase) inhibitor.
Also known as: Ketanserin, Ketanserin tartrate, Ketanserina, Ketanserine, KJK 945, NSC-758959, Perketan, R 49945, R-41,468, R-41468, R-49945, Serepress
Parent form; salt/anhydrous children: CHEMBL1256709, CHEMBL1628637, CHEMBL1724541, CHEMBL2062337, CHEMBL4303471, CHEMBL5198816
Patent coverage: 8,519 distinct patent families (20,018 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 19,792 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HTR2A | 5-HT2A receptor | Antagonist | 9.7 | 0% | P28223 |
Broader ChEMBL bioactivity targets: 44 (assay-derived). Sample: Microtubule-associated protein tau, Prelamin-A/C, 15-hydroxyprostaglandin dehydrogenase [NAD(+)], 5-hydroxytryptamine receptor 2B, Synaptic vesicular amine transporter, 5-hydroxytryptamine receptor 1B, Adrenergic receptor alpha-1, Alpha-2C adrenergic receptor, Alpha-2B adrenergic receptor, 5-hydroxytryptamine receptor 1D.
Bioactivity
ChEMBL activities: 129 potent at pChembl ≥ 5 of 143 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| HTR2A | 9.64 | Ki | 0.23 | nM | CHEMBL_ACT_2478049 |
| HTR2A | 9.55 | Ki | 0.28 | nM | CHEMBL_ACT_17995194 |
| P14842 | 9.55 | Kd | 0.28 | nM | CHEMBL_ACT_61992 |
| HTR2A | 9.55 | Ki | 0.28 | nM | CHEMBL_ACT_6317044 |
| HTR2A | 9.52 | Ki | 0.3 | nM | CHEMBL_ACT_14738652 |
| HTR2A | 9.52 | Ki | 0.3 | nM | CHEMBL_ACT_15187885 |
| HTR2A | 9.46 | IC50 | 0.35 | nM | CHEMBL_ACT_16501795 |
| HTR2A | 9.46 | IC50 | 0.35 | nM | CHEMBL_ACT_16838453 |
| HTR2A | 9.46 | Ki | 0.35 | nM | CHEMBL_ACT_26333258 |
| P08909 | 9.4 | Ki | 0.4 | nM | CHEMBL_ACT_236671 |
| HTR2A | 9.4 | Ki | 0.4 | nM | CHEMBL_ACT_2478023 |
| P08909 | 9.38 | Kd | 0.42 | nM | CHEMBL_ACT_903225 |
| HTR2A | 9.35 | Ki | 0.45 | nM | CHEMBL_ACT_19226342 |
| P14842 | 9.33 | Ki | 0.47 | nM | CHEMBL_ACT_13457835 |
| HTR2A | 9.31 | Ki | 0.49 | nM | CHEMBL_ACT_13341981 |
| P14842 | 9.31 | Ki | 0.49 | nM | CHEMBL_ACT_1991177 |
| HTR2A | 9.28 | IC50 | 0.52 | nM | CHEMBL_ACT_17995179 |
| HTR2A | 9.2 | IC50 | 0.63 | nM | CHEMBL_ACT_26333203 |
| P08909 | 9.18 | Ki | 0.66 | nM | CHEMBL_ACT_202536 |
| HTR2A | 9.11 | IC50 | 0.77 | nM | CHEMBL_ACT_13336169 |
| HTR2A | 9.09 | IC50 | 0.82 | nM | CHEMBL_ACT_19226343 |
| P14842 | 9.07 | Ki | 0.85 | nM | CHEMBL_ACT_16471367 |
| P14842 | 9.07 | Ki | 0.85 | nM | CHEMBL_ACT_16571355 |
| P14842 | 9.07 | Ki | 0.85 | nM | CHEMBL_ACT_18454531 |
| P14842 | 9.07 | Ki | 0.85 | nM | CHEMBL_ACT_2943953 |
| P14842 | 9.07 | Ki | 0.85 | nM | CHEMBL_ACT_6228087 |
| P14842 | 9.07 | Ki | 0.85 | nM | CHEMBL_ACT_7966789 |
| HTR2A | 9.05 | IC50 | 0.9 | nM | CHEMBL_ACT_13342053 |
| SIGMAR1 | 9 | IC50 | 1 | nM | CHEMBL_ACT_1147646 |
| P08909 | 9 | Ki | 1 | nM | CHEMBL_ACT_236670 |
Target pathways
Aggregated over 1 target gene(s): HTR2A.
Top Reactome pathways
8 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 1 | HTR2A |
| Signaling by GPCR | 1 | HTR2A |
| Class A/1 (Rhodopsin-like receptors) | 1 | HTR2A |
| Amine ligand-binding receptors | 1 | HTR2A |
| GPCR downstream signalling | 1 | HTR2A |
| Serotonin receptors | 1 | HTR2A |
| G alpha (q) signalling events | 1 | HTR2A |
| GPCR ligand binding | 1 | HTR2A |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| temperature homeostasis | 1 |
| positive regulation of cytokine production involved in immune response | 1 |
| glycolytic process | 1 |
| intracellular calcium ion homeostasis | 1 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 1 |
| positive regulation of cytosolic calcium ion concentration | 1 |
| phospholipase C-activating serotonin receptor signaling pathway | 1 |
| serotonin receptor signaling pathway | 1 |
| chemical synaptic transmission | 1 |
| memory | 1 |
| positive regulation of cell population proliferation | 1 |
| response to xenobiotic stimulus | 1 |
| positive regulation of phosphatidylinositol biosynthetic process | 1 |
| regulation of dopamine secretion | 1 |
| artery smooth muscle contraction | 1 |
Indications & clinical
Indications
3 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| hypertensive disorder | 4 | MONDO:0005044 | EFO:0000537 |
| acute kidney injury | 3 | MONDO:0002492 | HP:0001919 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 7.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 2 |
| PHASE1 | 2 |
| PHASE4 | 1 |
| PHASE1/PHASE2 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03646318 | PHASE4 | UNKNOWN | Ketanserin Effects on Peripheral Temperature and Lactate |
| NCT00557219 | PHASE3 | TERMINATED | Fenoldopam and Ketanserin for Acute Kidney Failure Prevention After Cardiac Surgery |
| NCT01329887 | PHASE3 | COMPLETED | The Effect of Ketanserin on the Microcirculation in Sepsis |
| NCT02632877 | PHASE1/PHASE2 | COMPLETED | Efficacy of Pirfenidone Plus MODD in Diabetic Foot Ulcers |
| NCT03289949 | PHASE1 | RECRUITING | The Neurobiological Effect of 5-HT2AR Modulation |
| NCT04558294 | PHASE1 | COMPLETED | Effect of Ketanserin After LSD Administration |
| NCT02451072 | Not specified | COMPLETED | The Role of 5-HT2A Receptor in the Perception of Self and Personal Meaning in Healthy Volunteers |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 1 clinical and 1 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
387 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | HTR2A |
| FIDAXOMICIN | ChEMBL + PubChem | Phase 4 (approved) | HTR2A |
| PIMAVANSERIN | ChEMBL + PubChem | Phase 4 (approved) | HTR2A |
| PROPOXYPHENE | ChEMBL + PubChem | Phase 4 (approved) | HTR2A |
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | HTR2A |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | HTR2A |
| ACYCLOVIR | ChEMBL | Phase 4 (approved) | HTR2A |
| ALMOTRIPTAN | ChEMBL | Phase 4 (approved) | HTR2A |
| ALOSETRON | ChEMBL | Phase 4 (approved) | HTR2A |
| AMIODARONE | ChEMBL | Phase 4 (approved) | HTR2A |
| AMISULPRIDE | ChEMBL | Phase 4 (approved) | HTR2A |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | HTR2A |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | HTR2A |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | HTR2A |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | HTR2A |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR2A |
| ASENAPINE | ChEMBL | Phase 4 (approved) | HTR2A |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | HTR2A |
| ATOMOXETINE | ChEMBL | Phase 4 (approved) | HTR2A |
| AZATADINE | ChEMBL | Phase 4 (approved) | HTR2A |
| AZELASTINE | ChEMBL | Phase 4 (approved) | HTR2A |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | HTR2A |
| BEDAQUILINE | ChEMBL | Phase 4 (approved) | HTR2A |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | HTR2A |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | HTR2A |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | HTR2A |
| BENZPHETAMINE | ChEMBL | Phase 4 (approved) | HTR2A |
| BENZQUINAMIDE | ChEMBL | Phase 4 (approved) | HTR2A |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | HTR2A |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | HTR2A |
| BIFONAZOLE | ChEMBL | Phase 4 (approved) | HTR2A |
| BLONANSERIN | ChEMBL | Phase 4 (approved) | HTR2A |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | HTR2A |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | HTR2A |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | HTR2A |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | HTR2A |
| BUSPIRONE | ChEMBL | Phase 4 (approved) | HTR2A |
| BUTENAFINE | ChEMBL | Phase 4 (approved) | HTR2A |
| BUTRIPTYLINE | ChEMBL | Phase 4 (approved) | HTR2A |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | HTR2A |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | HTR2A |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | HTR2A |
| CANNABIDIOL | ChEMBL | Phase 4 (approved) | HTR2A |
| CAPTOPRIL | ChEMBL | Phase 4 (approved) | HTR2A |
| CARBENOXOLONE | ChEMBL | Phase 4 (approved) | HTR2A |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | HTR2A |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | HTR2A |
| CETIRIZINE | ChEMBL | Phase 4 (approved) | HTR2A |
| CHLOPHEDIANOL | ChEMBL | Phase 4 (approved) | HTR2A |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | HTR2A |
| CHLORPHENIRAMINE | ChEMBL | Phase 4 (approved) | HTR2A |
| CHLORPHENTERMINE | ChEMBL | Phase 4 (approved) | HTR2A |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | HTR2A |
| CHLORPROPAMIDE | ChEMBL | Phase 4 (approved) | HTR2A |
| CINACALCET | ChEMBL | Phase 4 (approved) | HTR2A |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | HTR2A |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | HTR2A |
| CITALOPRAM | ChEMBL | Phase 4 (approved) | HTR2A |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | HTR2A |
| CLINDAMYCIN | ChEMBL | Phase 4 (approved) | HTR2A |
Related Atlas pages
- Genes: HTR2A
- Diseases: hypertensive disorder, acute kidney injury
- Drugs: Dihydroergotamine, Fidaxomicin, Pimavanserin, Propoxyphene, Abemaciclib, Acetophenazine, Acyclovir, Almotriptan, Alosetron, Amiodarone, Amisulpride, Amitriptyline, Amlodipine, Amoxapine, Apomorphine, Aripiprazole, Asenapine, Astemizole, Atomoxetine, Azatadine, Azelastine, Bazedoxifene, Bedaquiline, Benfluorex, Benperidol, Benzbromarone, Benzphetamine, Benzquinamide, Benztropine, Bepridil, Bifonazole, Blonanserin, Bosutinib, Brexpiprazole, Bromocriptine, Bromperidol, Buspirone, Butenafine, Butriptyline, Cabergoline, Cabozantinib, Candesartan Cilexetil, Cannabidiol, Captopril, Carbenoxolone, Cariprazine, Carvedilol, Cetirizine, Chlophedianol, Chlorhexidine, Chlorpheniramine, Chlorphentermine, Chlorpromazine, Chlorpropamide, Cinacalcet, Cinnarizine, Cisapride, Citalopram, Clemastine, Clindamycin