Larotrectinib
drugOn this page
Also known as ARRY-470BAY-2757556BAY2757556Loxo-101LOXO-101 (ARRY-470)LOXO-101LOXO 101LOXO101A-9048VITRAKVIUS8865698, 14Larotrectinib sulfate
Summary
Larotrectinib (CHEMBL3889654) is an approved small molecule (ATC L01EX12) targeting NTRK1; indicated across 4 conditions including neoplasm and plasma cell myeloma; with CIViC clinical evidence for 66 variant-indication associations (e.g. ETV6::NTRK3 Fusion in congenital fibrosarcoma).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L01EX12
- Targets: 1 (NTRK1)
- Indications: 4 conditions
- Clinical trials: 12
- Precision-oncology evidence (CIViC): 66 variant–indication associations
- Chemistry: 428.4 Da · C21H22F2N6O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL3889654 |
| Name | Larotrectinib |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 46188928 |
| ATC | L01EX12 |
| Molecular formula | C21H22F2N6O2 |
| Molecular weight | 428.4 |
| InChIKey | NYNZQNWKBKUAII-KBXCAEBGSA-N |
SMILES: C1C[C@@H](N(C1)C2=NC3=C(C=NN3C=C2)NC(=O)N4CC[C@@H](C4)O)C5=C(C=CC(=C5)F)F
IUPAC name: (3S)-N-[5-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidin-3-yl]-3-hydroxypyrrolidine-1-carboxamide
Also known as: ARRY-470, BAY-2757556, BAY2757556, Larotrectinib, Loxo-101, LOXO-101, LOXO-101 (ARRY-470), LAROTRECTINIB, LOXO-101LOXO 101LOXO101A-9048, VITRAKVI, US8865698, 14, larotrectinib
Parent form; salt/anhydrous children: CHEMBL3989939
Patent coverage: 768 distinct patent families (1,850 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 1,821 (98%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| NTRK1 | neurotrophic receptor tyrosine kinase 1 | Inhibition | 8.01 | 0.1% | P04629 |
Broader ChEMBL bioactivity targets: 6 (assay-derived). Sample: High affinity nerve growth factor receptor, Sphingomyelin phosphodiesterase 3, Activated CDC42 kinase 1, BDNF/NT-3 growth factors receptor, Proto-oncogene tyrosine-protein kinase ROS, NT-3 growth factor receptor.
Bioactivity
ChEMBL activities: 121 potent at pChembl ≥ 5 of 121 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NTRK3 | 9.7 | IC50 | 0.2 | nM | CHEMBL_ACT_25112835 |
| NTRK3 | 9.54 | IC50 | 0.29 | nM | CHEMBL_ACT_28811405 |
| NTRK3 | 9.54 | IC50 | 0.29 | nM | CHEMBL_ACT_28811414 |
| NTRK3 | 9.49 | IC50 | 0.32 | nM | CHEMBL_ACT_28811396 |
| NTRK2 | 9.48 | IC50 | 0.33 | nM | CHEMBL_ACT_28811402 |
| NTRK1 | 9.4 | IC50 | 0.4 | nM | CHEMBL_ACT_24712367 |
| NTRK2 | 9.4 | IC50 | 0.4 | nM | CHEMBL_ACT_28811393 |
| NTRK3 | 9.39 | IC50 | 0.41 | nM | CHEMBL_ACT_28811378 |
| NTRK3 | 9.36 | IC50 | 0.44 | nM | CHEMBL_ACT_28811369 |
| NTRK3 | 9.35 | IC50 | 0.45 | nM | CHEMBL_ACT_28811387 |
| NTRK2 | 9.34 | IC50 | 0.46 | nM | CHEMBL_ACT_28811375 |
| NTRK2 | 9.34 | IC50 | 0.46 | nM | CHEMBL_ACT_28811384 |
| NTRK2 | 9.27 | IC50 | 0.54 | nM | CHEMBL_ACT_28811366 |
| NTRK2 | 9.2 | IC50 | 0.63 | nM | CHEMBL_ACT_28811411 |
| NTRK1 | 9.14 | IC50 | 0.73 | nM | CHEMBL_ACT_28811399 |
| NTRK1 | 9.09 | IC50 | 0.82 | nM | CHEMBL_ACT_28811372 |
| NTRK1 | 9.07 | IC50 | 0.86 | nM | CHEMBL_ACT_28811408 |
| NTRK1 | 9.05 | IC50 | 0.9 | nM | CHEMBL_ACT_25683792 |
| NTRK1 | 9.05 | IC50 | 0.9 | nM | CHEMBL_ACT_26283890 |
| NTRK1 | 9.05 | IC50 | 0.9 | nM | CHEMBL_ACT_28811363 |
| NTRK1 | 9.02 | IC50 | 0.96 | nM | CHEMBL_ACT_28811381 |
| NTRK2 | 9.01 | IC50 | 0.98 | nM | CHEMBL_ACT_25611321 |
| NTRK1 | 8.96 | IC50 | 1.1 | nM | CHEMBL_ACT_25989592 |
| NTRK1 | 8.95 | IC50 | 1.13 | nM | CHEMBL_ACT_28811390 |
| NTRK1 | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_22439521 |
| NTRK1 | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_24365531 |
| NTRK1 | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_24760037 |
| NTRK1 | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_24972363 |
| NTRK1 | 8.88 | IC50 | 1.31 | nM | CHEMBL_ACT_24843607 |
| NTRK3 | 8.77 | IC50 | 1.7 | nM | CHEMBL_ACT_22979696 |
Target pathways
Aggregated over 1 target gene(s): NTRK1.
Top Reactome pathways
10 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| PLC-gamma1 signalling | 1 | NTRK1 |
| Signalling to RAS | 1 | NTRK1 |
| Frs2-mediated activation | 1 | NTRK1 |
| ARMS-mediated activation | 1 | NTRK1 |
| Retrograde neurotrophin signalling | 1 | NTRK1 |
| NGF-independant TRKA activation | 1 | NTRK1 |
| TRKA activation by NGF | 1 | NTRK1 |
| Signalling to p38 via RIT and RIN | 1 | NTRK1 |
| PI3K/AKT activation | 1 | NTRK1 |
| Signalling to STAT3 | 1 | NTRK1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| protein phosphorylation | 1 |
| cell surface receptor protein tyrosine kinase signaling pathway | 1 |
| spermatogenesis | 1 |
| axon guidance | 1 |
| learning or memory | 1 |
| circadian rhythm | 1 |
| negative regulation of cell population proliferation | 1 |
| response to xenobiotic stimulus | 1 |
| programmed cell death involved in cell development | 1 |
| positive regulation of neuron projection development | 1 |
| peptidyl-tyrosine phosphorylation | 1 |
| olfactory nerve development | 1 |
| B cell differentiation | 1 |
| neuron projection development | 1 |
| response to nutrient levels | 1 |
Indications & clinical
Indications
4 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| plasma cell myeloma | 2 | MONDO:0009693 | EFO:0001378 |
| thyroid gland carcinoma | 2 | MONDO:0015075 | EFO:0002892 |
| diffuse intrinsic pontine glioma | 0 | MONDO:0006033 | EFO:1000026 |
Clinical trials
Total trials: 12.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 10 |
| PHASE4 | 1 |
| EARLY_PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT07010393 | PHASE4 | NOT_YET_RECRUITING | Genotype-Driven Neoadjuvant Therapy for Locally Advanced Thyroid Cancer: A Real-World Cohort Study |
| NCT02465060 | PHASE2 | ACTIVE_NOT_RECRUITING | Targeted Therapy Directed by Genetic Testing in Treating Patients With Advanced Refractory Solid Tumors, Lymphomas, or Multiple Myeloma (The MATCH Screening Trial) |
| NCT03155620 | PHASE2 | ACTIVE_NOT_RECRUITING | Targeted Therapy Directed by Genetic Testing in Treating Pediatric Patients With Relapsed or Refractory Advanced Solid Tumors, Non-Hodgkin Lymphomas, or Histiocytic Disorders (The Pediatric MATCH Screening Trial) |
| NCT03213704 | PHASE2 | ACTIVE_NOT_RECRUITING | Larotrectinib in Treating Patients With Relapsed or Refractory Advanced Solid Tumors, Non-Hodgkin Lymphoma, or Histiocytic Disorders With NTRK Fusions (A Pediatric MATCH Treatment Trial) |
| NCT03834961 | PHASE2 | ACTIVE_NOT_RECRUITING | Larotrectinib in Treating Patients With Previously Untreated TRK Fusion Solid Tumors and TRK Fusion Relapsed Acute Leukemia |
| NCT04879121 | PHASE2 | RECRUITING | Larotrectinib for the Treatment of NTRK Amplification Positive, Locally Advanced or Metastatic Solid Tumors |
| NCT05725200 | PHASE2 | RECRUITING | Study to Investigate Outcome of Individualized Treatment in Patients With Metastatic Colorectal Cancer |
| NCT05783323 | PHASE2 | RECRUITING | Larotrectinib to Enhance RAI Avidity in Differentiated Thyroid Cancer |
| NCT06390852 | PHASE2 | ACTIVE_NOT_RECRUITING | Testing LOXO-101 as Potentially Targeted Treatment in Cancers With NTRK Genetic Changes (MATCH - Subprotocol Z1E) |
| NCT06482086 | PHASE2 | RECRUITING | Efficacy of Organoid-Based Drug Screening to Guide Treatment for Locally Advanced Thyroid Cancer |
| NCT06563999 | PHASE2 | RECRUITING | Neoadjuvant Umbrella Trial for Patients With Unresectable Stage III NSCLC Harboring Rare Mutations. |
| NCT04655404 | EARLY_PHASE1 | RECRUITING | A Pilot Study of Larotrectinib for Newly-Diagnosed High-Grade Glioma With NTRK Fusion |
Clinical evidence (CIViC)
Variant × indication × effect (66 predictive associations from 75 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| ETV6::NTRK3 Fusion | Congenital Fibrosarcoma | Sensitivity/Response | Larotrectinib | CIViC A | EID6099 +3 |
| ETV6::NTRK3 Fusion | Solid Tumor | Sensitivity/Response | Larotrectinib | CIViC A | EID7496 |
| NTRK1 Fusion | Solid Tumor | Sensitivity/Response | Larotrectinib | CIViC A | EID6567 |
| NTRK2 Fusion | Solid Tumor | Sensitivity/Response | Larotrectinib | CIViC A | EID10392 |
| NTRK3 Fusion | Solid Tumor | Sensitivity/Response | Larotrectinib | CIViC A | EID6568 |
| NTRK1 Fusion AND NTRK1 F589L | Solid Tumor | Resistance | Larotrectinib | CIViC A | EID11542 |
| NTRK1 Fusion AND NTRK1 G595R | Solid Tumor | Resistance | Larotrectinib | CIViC A | EID11540 |
| NTRK1 Fusion AND NTRK1 G667S | Solid Tumor | Resistance | Larotrectinib | CIViC A | EID11543 |
| NTRK3 F617L | Solid Tumor | Resistance | Larotrectinib | CIViC A | EID11571 |
| NTRK3 Fusion AND NTRK3 G623R | Solid Tumor | Resistance | Larotrectinib | CIViC A | EID11541 |
| NTRK3 Fusion AND NTRK3 G696A | Solid Tumor | Resistance | Larotrectinib | CIViC A | EID11544 |
| NTRK1 Fusion | Sarcoma | Sensitivity/Response | Larotrectinib | CIViC B | EID6569 |
| NTRK3 Fusion | Cancer | Sensitivity/Response | Larotrectinib | CIViC B | EID2954 |
| NTRK1 G595R | Solid Tumor | Resistance | Larotrectinib | CIViC B | EID7267 |
| ETV6::NTRK3 Fusion | B-lymphoblastic Leukemia/lymphoma | Sensitivity/Response | Larotrectinib | CIViC C | EID7993 +2 |
| LMNA::NTRK1 Fusion | Sarcoma | Sensitivity/Response | Larotrectinib | CIViC C | EID2955 +1 |
| NTRK1 Fusion | Pancreatic Cancer | Sensitivity/Response | Larotrectinib | CIViC C | EID6051 +1 |
| PDE4DIP::NTRK1 Fusion | Sarcoma | Sensitivity/Response | Larotrectinib | CIViC C | EID6102 +1 |
| SQSTM1::NTRK1 Fusion | Congenital Fibrosarcoma | Sensitivity/Response | Larotrectinib | CIViC C | EID6103 +1 |
| EML4::NTRK3 Fusion | High Grade Glioma | Sensitivity/Response | Larotrectinib | CIViC C | EID11100 |
| ETV6::NTRK2 Fusion | Acute Myeloid Leukemia | Sensitivity/Response | Larotrectinib | CIViC C | EID6396 |
| ETV6::NTRK2 Fusion AND TERT c.-124C.T | Papillary Thyroid Carcinoma | Sensitivity/Response | Larotrectinib | CIViC C | EID11278 |
| ETV6::NTRK3 Fusion | Congenital Mesoblastic Nephroma | Sensitivity/Response | Larotrectinib | CIViC C | EID10840 |
| ETV6::NTRK3 Fusion | High Grade Glioma | Sensitivity/Response | Larotrectinib | CIViC C | EID10931 |
| ETV6::NTRK3 Fusion | Hematologic Cancer | Sensitivity/Response | Larotrectinib | CIViC C | EID6395 |
| ETV6::NTRK3 Fusion | Breast Secretory Carcinoma | Sensitivity/Response | Larotrectinib | CIViC C | EID6475 |
| ETV6::NTRK3 Fusion | B-lymphoblastic Leukemia/lymphoma | Sensitivity/Response | Etoposide + Methotrexate + Larotrectinib | CIViC C | EID8917 |
| KANK1::NTRK2 Fusion | Anaplastic Ependymoma | Sensitivity/Response | Larotrectinib | CIViC C | EID10360 |
| KANK1::NTRK2 Fusion | Glioblastoma | Sensitivity/Response | Larotrectinib | CIViC C | EID10361 |
| LMNA::NTRK1 Fusion | Solid Tumor | Sensitivity/Response | Larotrectinib | CIViC C | EID9588 |
+36 more predictive associations (showing top 30 by level).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
61 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | NTRK1 |
| REPOTRECTINIB | ChEMBL + PubChem | Phase 4 (approved) | NTRK1 |
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | NTRK1 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | NTRK1 |
| AXITINIB | ChEMBL | Phase 4 (approved) | NTRK1 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | NTRK1 |
| CABOZANTINIB | ChEMBL | Phase 4 (approved) | NTRK1 |
| CERITINIB | ChEMBL | Phase 4 (approved) | NTRK1 |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | NTRK1 |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | NTRK1 |
| LORLATINIB | ChEMBL | Phase 4 (approved) | NTRK1 |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | NTRK1 |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | NTRK1 |
| PONATINIB | ChEMBL | Phase 4 (approved) | NTRK1 |
| QUIZARTINIB | ChEMBL | Phase 4 (approved) | NTRK1 |
| RUXOLITINIB | ChEMBL | Phase 4 (approved) | NTRK1 |
| SORAFENIB | ChEMBL | Phase 4 (approved) | NTRK1 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | NTRK1 |
| ALISERTIB | ChEMBL | Phase 3 | NTRK1 |
| CRENOLANIB | ChEMBL | Phase 3 | NTRK1 |
| DEFACTINIB | ChEMBL | Phase 3 | NTRK1 |
| DOVITINIB | ChEMBL | Phase 3 | NTRK1 |
| ENTOSPLETINIB | ChEMBL | Phase 3 | NTRK1 |
| LESTAURTINIB | ChEMBL | Phase 3 | NTRK1 |
| LINIFANIB | ChEMBL | Phase 3 | NTRK1 |
| SITRAVATINIB | ChEMBL | Phase 3 | NTRK1 |
| ALTIRATINIB | ChEMBL | Phase 2 | NTRK1 |
| AZD-1480 | ChEMBL | Phase 2 | NTRK1 |
| BMS-754807 | ChEMBL | Phase 2 | NTRK1 |
| BMS-777607 | ChEMBL | Phase 2 | NTRK1 |
| CEP-11981 | ChEMBL | Phase 2 | NTRK1 |
| DANUSERTIB | ChEMBL | Phase 2 | NTRK1 |
| DORAMAPIMOD | ChEMBL | Phase 2 | NTRK1 |
| ENMD-2076 | ChEMBL | Phase 2 | NTRK1 |
| FORETINIB | ChEMBL | Phase 2 | NTRK1 |
| GOLVATINIB | ChEMBL | Phase 2 | NTRK1 |
| GZ-389988 | ChEMBL | Phase 2 | NTRK1 |
| ILORASERTIB | ChEMBL | Phase 2 | NTRK1 |
| MERESTINIB | ChEMBL | Phase 2 | NTRK1 |
| MILCICLIB | ChEMBL | Phase 2 | NTRK1 |
| MK-2461 | ChEMBL | Phase 2 | NTRK1 |
| OCIFISERTIB | ChEMBL | Phase 2 | NTRK1 |
| PEXMETINIB | ChEMBL | Phase 2 | NTRK1 |
| PICTILISIB | ChEMBL | Phase 2 | NTRK1 |
| R-406 | ChEMBL | Phase 2 | NTRK1 |
| REBASTINIB | ChEMBL | Phase 2 | NTRK1 |
| SELITRECTINIB | ChEMBL | Phase 2 | NTRK1 |
| SU-014813 | ChEMBL | Phase 2 | NTRK1 |
| TANDUTINIB | ChEMBL | Phase 2 | NTRK1 |
| TOZASERTIB | ChEMBL | Phase 2 | NTRK1 |
| UCN-01 | ChEMBL | Phase 2 | NTRK1 |
| Afatinib | PubChem | Approved | NTRK1 |
| Binimetinib | PubChem | Approved | NTRK1 |
| dacomitinib | PubChem | Approved | NTRK1 |
| Fostamatinib | PubChem | Approved | NTRK1 |
| Gefitinib | PubChem | Approved | NTRK1 |
| Idelalisib | PubChem | Approved | NTRK1 |
| Pazopanib | PubChem | Approved | NTRK1 |
| regorafenib | PubChem | Approved | NTRK1 |
| Selumetinib | PubChem | Approved | NTRK1 |
Related Atlas pages
- Genes: NTRK1
- Diseases: neoplasm, congenital fibrosarcoma, sarcoma, cancer, B-cell acute lymphoblastic leukemia, malignant pancreatic neoplasm, malignant glioma, acute myeloid leukemia by FAB classification, thyroid gland papillary carcinoma, congenital mesoblastic nephroma, hematopoietic and lymphoid cell neoplasm, breast secretory carcinoma, anaplastic ependymoma, glioblastoma
- Drugs: Crizotinib, Repotrectinib, Abemaciclib, Amitriptyline, Axitinib, Bosutinib, Cabozantinib, Ceritinib, Entrectinib, Fedratinib, Lorlatinib, Midostaurin, Nintedanib, Ponatinib, Quizartinib, Ruxolitinib, Sorafenib, Sunitinib, Alisertib, Crenolanib, Defactinib, Dovitinib, Entospletinib, Lestaurtinib, Linifanib, Sitravatinib, Afatinib, Binimetinib, dacomitinib, Fostamatinib, Gefitinib, Idelalisib, Pazopanib, regorafenib, Selumetinib
- Biomarker genes: NTRK3