Lasofoxifene
drug drugOn this page
Also known as LasofoxifenoLASOFOXIFENE (TARTRATE)
Summary
Lasofoxifene (CHEMBL328190) is an approved small-molecule antineoplastic agent (ATC G03XC03) targeting ESR1 and ESR2; indicated across 4 conditions including osteoporosis and breast neoplasm; with CIViC clinical evidence for 1 variant-indication association (e.g. ESR1 D538G OR ESR1 Y537C OR ESR1 Y537N OR ESR1 Y537S OR ESR1 E380Q OR ESR1 Mutation in breast cancer).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: G03XC03
- Targets: 2 (ESR1, ESR2)
- Indications: 4 conditions
- Clinical trials: 7
- Precision-oncology evidence (CIViC): 1 variant–indication association
- Chemistry: 413.5 Da · C28H31NO2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL328190 |
| Name | Lasofoxifene |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 216416 |
| ChEBI | CHEBI:135938 |
| ATC | G03XC03 |
| Molecular formula | C28H31NO2 |
| Molecular weight | 413.5 |
| InChIKey | GXESHMAMLJKROZ-IAPPQJPRSA-N |
SMILES: C1CCN(C1)CCOC2=CC=C(C=C2)[C@H]3[C@H](CCC4=C3C=CC(=C4)O)C5=CC=CC=C5
IUPAC name: (5R,6S)-6-phenyl-5-[4-(2-pyrrolidin-1-ylethoxy)phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol
ChEBI definition: A member of the class of tetralins that is 5,6,7,8-tetrahydronaphthalen-2-ol in which the hydrogens at positions 5 and 6 are replaced by 4-[2-(pyrrolidin-1-yl)ethoxy]phenyl and phenyl groups, respectively (the 5R,6S-stereoisomer). It is a selective estrogen receptor modulator indicated for the prevention and treatment of osteoporosis in post-menopausal women.
Pharmacological roles (ChEBI): antineoplastic agent, cardioprotective agent, estrogen receptor agonist, estrogen receptor antagonist, bone density conservation agent.
Also known as: Lasofoxifene, Lasofoxifeno, LASOFOXIFENE, LASOFOXIFENE (TARTRATE), lasofoxifene, Lasofoxifene (Tartrate)
Parent form; salt/anhydrous children: CHEMBL2113354, CHEMBL5307767, CHEMBL6067998
Patent coverage: 2,518 distinct patent families (10,617 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 10,576 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ESR1 | Estrogen receptor-α | Partial agonist | 8.51 | 1.7% | P03372 |
| ESR2 | Estrogen receptor-β | Partial agonist | 7.89 | 0.2% | Q92731 |
Broader ChEMBL bioactivity targets: 38 (assay-derived). Sample: Vasopressin V2 receptor, 5-hydroxytryptamine receptor 2B, Alpha-2A adrenergic receptor, Alpha-2C adrenergic receptor, Alpha-2B adrenergic receptor, Glucocorticoid receptor, Estrogen receptor, Estrogen receptor, Estrogen receptor, Muscarinic acetylcholine receptor M2, Beta-1 adrenergic receptor, Muscarinic acetylcholine receptor M1, D(2) dopamine receptor, Motilin receptor, Sodium-dependent noradrenaline transporter, 5-hydroxytryptamine receptor 2A, 5-hydroxytryptamine receptor 2C, Sodium-dependent serotonin transporter, Alpha-1A adrenergic receptor, Prostaglandin G/H synthase 2.
Bioactivity
ChEMBL activities: 37 potent at pChembl ≥ 5 of 50 total. Top 100 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ESR1 | 10 | IC50 | 0.1 | nM | CHEMBL_ACT_1432222 |
| ESR1 | 9.7 | Ki | 0.2 | nM | CHEMBL_ACT_29105258 |
| ESR1 | 8.89 | IC50 | 1.3 | nM | CHEMBL_ACT_1432220 |
| ESR1 | 8.85 | IC50 | 1.4 | nM | CHEMBL_ACT_1654175 |
| ESR2 | 8.74 | IC50 | 1.8 | nM | CHEMBL_ACT_1432221 |
| ESR2 | 8.74 | IC50 | 1.8 | nM | CHEMBL_ACT_1654176 |
| ESR1 | 8.64 | IC50 | 2.3 | nM | CHEMBL_ACT_1514343 |
| ESR1 | 8.51 | IC50 | 3.1 | nM | CHEMBL_ACT_1514341 |
| ESR1 | 8.4 | IC50 | 4 | nM | CHEMBL_ACT_1514236 |
| P06211 | 7.96 | IC50 | 11.1 | nM | CHEMBL_ACT_753150 |
| P06211 | 7.95 | IC50 | 11.3 | nM | CHEMBL_ACT_753152 |
| ESR2 | 7.89 | IC50 | 13 | nM | CHEMBL_ACT_1514340 |
| ESR2 | 7.62 | IC50 | 24 | nM | CHEMBL_ACT_1514342 |
| ESR1 | 7.41 | AC50 | 39 | nM | CHEMBL_ACT_25167323 |
| ESR1 | 7.35 | AC50 | 45 | nM | CHEMBL_ACT_25116337 |
| OPRK1 | 7.07 | AC50 | 84.9 | nM | CHEMBL_ACT_25129436 |
| SLC6A3 | 6.93 | AC50 | 116.8 | nM | CHEMBL_ACT_25123967 |
| HTR2B | 6.57 | AC50 | 272 | nM | CHEMBL_ACT_25164117 |
| KCNH2 | 6.14 | AC50 | 730 | nM | CHEMBL_ACT_25117889 |
| HRH3 | 6 | AC50 | 990 | nM | CHEMBL_ACT_25200607 |
| ADRA2C | 5.8 | AC50 | 1600 | nM | CHEMBL_ACT_25147891 |
| SLC6A4 | 5.8 | AC50 | 1600 | nM | CHEMBL_ACT_25150350 |
| NR1I2 | 5.8 | AC50 | 1600 | nM | CHEMBL_ACT_25188187 |
| SLC6A2 | 5.7 | AC50 | 2000 | nM | CHEMBL_ACT_25145017 |
| DRD3 | 5.66 | AC50 | 2200 | nM | CHEMBL_ACT_25193542 |
| MLNR | 5.54 | AC50 | 2900 | nM | CHEMBL_ACT_25189201 |
| Q63921 | 5.3 | AC50 | 5000 | nM | CHEMBL_ACT_25174413 |
| HTR2C | 5.28 | AC50 | 5300 | nM | CHEMBL_ACT_25131822 |
| GHSR | 5.28 | AC50 | 5200 | nM | CHEMBL_ACT_25172769 |
| ADORA3 | 5.24 | AC50 | 5800 | nM | CHEMBL_ACT_25134226 |
| OPRD1 | 5.14 | AC50 | 7200 | nM | CHEMBL_ACT_25154083 |
| ADRA2B | 5.09 | AC50 | 8200 | nM | CHEMBL_ACT_25143716 |
| DRD2 | 5.07 | AC50 | 8600 | nM | CHEMBL_ACT_25140349 |
| NR3C1 | 5.03 | AC50 | 9300 | nM | CHEMBL_ACT_25175858 |
| HTR2B | 5.02 | AC50 | 9487 | nM | CHEMBL_ACT_25227537 |
| ADRB1 | 5 | AC50 | 10000 | nM | CHEMBL_ACT_25121792 |
| ADRA2A | 5 | AC50 | 10000 | nM | CHEMBL_ACT_25221102 |
Target pathways
Aggregated over 2 target gene(s): ESR1, ESR2.
Top Reactome pathways
17 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| PIP3 activates AKT signaling | 2 | ESR1, ESR2 |
| Constitutive Signaling by Aberrant PI3K in Cancer | 2 | ESR1, ESR2 |
| Nuclear Receptor transcription pathway | 2 | ESR1, ESR2 |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 2 | ESR1, ESR2 |
| ESR-mediated signaling | 2 | ESR1, ESR2 |
| Extra-nuclear estrogen signaling | 2 | ESR1, ESR2 |
| Nuclear signaling by ERBB4 | 1 | ESR1 |
| SUMOylation of intracellular receptors | 1 | ESR1 |
| Ovarian tumor domain proteases | 1 | ESR1 |
| TFAP2 (AP-2) family regulates transcription of growth factors and their receptors | 1 | ESR1 |
| RUNX1 regulates estrogen receptor mediated transcription | 1 | ESR1 |
| RUNX1 regulates transcription of genes involved in WNT signaling | 1 | ESR1 |
| Regulation of RUNX2 expression and activity | 1 | ESR1 |
| Estrogen-dependent gene expression | 1 | ESR1 |
| Mitochondrial unfolded protein response (UPRmt) | 1 | ESR1 |
| Developmental Lineage of Mammary Gland Luminal Epithelial Cells | 1 | ESR1 |
| Developmental Lineage of Mammary Gland Alveolar Cells | 1 | ESR1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| negative regulation of transcription by RNA polymerase II | 2 |
| regulation of DNA-templated transcription | 2 |
| regulation of transcription by RNA polymerase II | 2 |
| signal transduction | 2 |
| estrogen receptor signaling pathway | 2 |
| positive regulation of DNA-templated transcription | 2 |
| positive regulation of transcription by RNA polymerase II | 2 |
| obsolete positive regulation of DNA-binding transcription factor activity | 2 |
| cellular response to estradiol stimulus | 2 |
| cellular response to oxygen-containing compound | 2 |
| antral ovarian follicle growth | 1 |
| epithelial cell development | 1 |
| chromatin remodeling | 1 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 1 |
| positive regulation of cytosolic calcium ion concentration | 1 |
Indications & clinical
Indications
3 diseases in clinical trials (phase 1–3, investigational — not approved indications). Highest ChEMBL trial phase per disease; a non-cancer approved use is occasionally logged at phase 3 here.
| Disease (in trials) | Phase | MONDO | EFO |
|---|---|---|---|
| osteoporosis | 3 | MONDO:0005298 | EFO:0003882 |
| breast neoplasm | 3 | MONDO:0021100 | MONDO:0007254 |
| angiosarcoma | 2 | MONDO:0016982 | EFO:0003968 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 7.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 5 |
| PHASE3 | 2 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00141323 | PHASE3 | COMPLETED | Postmenopausal Evaluation and Risk-reduction With Lasofoxifene (PEARL) |
| NCT00163137 | PHASE3 | COMPLETED | Comparison of Raloxifene and Lasofoxifene - A Randomized, Blinded Study of These Drugs and Placebo on Bone Loss |
| NCT01042379 | PHASE2 | RECRUITING | I-SPY TRIAL: Neoadjuvant and Personalized Adaptive Novel Agents to Treat Breast Cancer |
| NCT00143273 | PHASE2 | COMPLETED | Dose Response Study of Lasofoxifene in Postmenopausal Women With Osteoporosis - Japanese Asian Dose Evaluation |
| NCT00674453 | PHASE2 | COMPLETED | The Prevention Of Postmenopausal Osteoporosis With Lasofoxifene And Cytokine Evaluation |
| NCT03781063 | PHASE2 | COMPLETED | Evaluation of Lasofoxifene Versus Fulvestrant in Advanced or Metastatic ER+/HER2- Breast Cancer With an ESR1 Mutation |
| NCT04432454 | PHASE2 | COMPLETED | Evaluation of Lasofoxifene Combined With Abemaciclib in Advanced or Metastatic ER+/HER2- Breast Cancer With an ESR1 Mutation |
Clinical evidence (CIViC)
Variant × indication × effect (1 predictive associations from 1 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| ESR1 D538G OR ESR1 Y537C OR ESR1 Y537N OR ESR1 Y537S OR ESR1 E380Q OR ESR1 Mutation | Breast Cancer | Sensitivity/Response | Lasofoxifene | CIViC A | EID12934 |
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
178 molecules share ≥1 primary target. Top 100 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| FULVESTRANT | ChEMBL + PubChem | Phase 4 (approved) | ESR1, ESR2 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| BITHIONOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| CISPLATIN | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ELACESTRANT | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTETROL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTRIOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ESTRONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| MEDROXYPROGESTERONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| MIFEPRISTONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| PHENOLPHTHALEIN | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| RALOXIFENE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| SPIRONOLACTONE | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| TAMOXIFEN | ChEMBL | Phase 4 (approved) | ESR1, ESR2 |
| ACOLBIFENE | ChEMBL | Phase 3 | ESR1, ESR2 |
| AFIMOXIFENE | ChEMBL | Phase 3 | ESR1, ESR2 |
| AMCENESTRANT | ChEMBL | Phase 3 | ESR1, ESR2 |
| ARZOXIFENE | ChEMBL | Phase 3 | ESR1, ESR2 |
| BENSERAZIDE | ChEMBL | Phase 3 | ESR1, ESR2 |
| ALFATRADIOL | ChEMBL | Phase 2 | ESR1, ESR2 |
| AUS-131 | ChEMBL | Phase 2 | ESR1, ESR2 |
| BRILANESTRANT | ChEMBL | Phase 2 | ESR1, ESR2 |
| DAIDZEIN | ChEMBL | Phase 2 | ESR1, ESR2 |
| ERTEBEREL | ChEMBL | Phase 2 | ESR1, ESR2 |
| GENISTEIN | ChEMBL | Phase 2 | ESR1, ESR2 |
| GTX-758 | ChEMBL | Phase 2 | ESR1, ESR2 |
| IDOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| LEVORMELOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| MOXESTROL | ChEMBL | Phase 2 | ESR1, ESR2 |
| PIPENDOXIFENE | ChEMBL | Phase 2 | ESR1, ESR2 |
| PRINABEREL | ChEMBL | Phase 2 | ESR1, ESR2 |
| STALLIMYCIN | ChEMBL | Phase 2 | ESR1, ESR2 |
| Bosentan | PubChem | Approved | ESR1, ESR2 |
| Dihydroergotamine | PubChem | Approved | ESR1, ESR2 |
| Fidaxomicin | PubChem | Approved | ESR1, ESR2 |
| Propoxyphene | PubChem | Approved | ESR1, ESR2 |
| Pyrazinamide | PubChem | Approved | ESR1, ESR2 |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | ESR1 |
| ALECTINIB | ChEMBL | Phase 4 (approved) | ESR1 |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | ESR1 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ESR1 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | ESR1 |
| AZTREONAM | ChEMBL | Phase 4 (approved) | ESR1 |
| BELINOSTAT | ChEMBL | Phase 4 (approved) | ESR1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | ESR1 |
| BEXAROTENE | ChEMBL | Phase 4 (approved) | ESR1 |
| BISACODYL | ChEMBL | Phase 4 (approved) | ESR1 |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ESR1 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | ESR1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | ESR1 |
| CASPOFUNGIN | ChEMBL | Phase 4 (approved) | ESR1 |
| CEFADROXIL | ChEMBL | Phase 4 (approved) | ESR1 |
| CEFEPIME | ChEMBL | Phase 4 (approved) | ESR1 |
| CEFTAZIDIME | ChEMBL | Phase 4 (approved) | ESR1 |
| CERIVASTATIN | ChEMBL | Phase 4 (approved) | ESR1 |
| CHLOROTRIANISENE | ChEMBL | Phase 4 (approved) | ESR1 |
| CLOFAZIMINE | ChEMBL | Phase 4 (approved) | ESR1 |
| CLOMIPHENE | ChEMBL | Phase 4 (approved) | ESR1 |
| CYCLOFENIL | ChEMBL | Phase 4 (approved) | ESR1 |
| DANAZOL | ChEMBL | Phase 4 (approved) | ESR1 |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | ESR1 |
| DEMECLOCYCLINE | ChEMBL | Phase 4 (approved) | ESR2 |
| DEQUALINIUM | ChEMBL | Phase 4 (approved) | ESR1 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | ESR1 |
| DIENESTROL | ChEMBL | Phase 4 (approved) | ESR1 |
| DINOPROSTONE | ChEMBL | Phase 4 (approved) | ESR1 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | ESR1 |
| DRONEDARONE | ChEMBL | Phase 4 (approved) | ESR1 |
| ERGOCALCIFEROL | ChEMBL | Phase 4 (approved) | ESR1 |
| ERTAPENEM | ChEMBL | Phase 4 (approved) | ESR1 |
| ESTRADIOL CYPIONATE | ChEMBL | Phase 4 (approved) | ESR1 |
| ESTRADIOL VALERATE | ChEMBL | Phase 4 (approved) | ESR1 |
| ESTRAMUSTINE | ChEMBL | Phase 4 (approved) | ESR1 |
| ETHYLESTRENOL | ChEMBL | Phase 4 (approved) | ESR1 |
| ETHYNODIOL DIACETATE | ChEMBL | Phase 4 (approved) | ESR1 |
| ETONOGESTREL | ChEMBL | Phase 4 (approved) | ESR1 |
| ETRAVIRINE | ChEMBL | Phase 4 (approved) | ESR1 |
| FLUPIRTINE | ChEMBL | Phase 4 (approved) | ESR1 |
| HEXESTROL | ChEMBL | Phase 4 (approved) | ESR1 |
| IBUPROFEN | ChEMBL | Phase 4 (approved) | ESR1 |
| ISOCONAZOLE | ChEMBL | Phase 4 (approved) | ESR1 |
| LENVATINIB | ChEMBL | Phase 4 (approved) | ESR1 |
| LEVONORGESTREL | ChEMBL | Phase 4 (approved) | ESR1 |
| LUSUTROMBOPAG | ChEMBL | Phase 4 (approved) | ESR1 |
| LYMECYCLINE | ChEMBL | Phase 4 (approved) | ESR1 |
| MASOPROCOL | ChEMBL | Phase 4 (approved) | ESR1 |
| MEMANTINE | ChEMBL | Phase 4 (approved) | ESR1 |
| MESTRANOL | ChEMBL | Phase 4 (approved) | ESR1 |
| METHYSERGIDE | ChEMBL | Phase 4 (approved) | ESR2 |
| MICAFUNGIN | ChEMBL | Phase 4 (approved) | ESR1 |
| MIFAMURTIDE ACID | ChEMBL | Phase 4 (approved) | ESR1 |
| MILTEFOSINE | ChEMBL | Phase 4 (approved) | ESR1 |
| MITOXANTRONE | ChEMBL | Phase 4 (approved) | ESR1 |
| MOLSIDOMINE | ChEMBL | Phase 4 (approved) | ESR1 |
| MONTELUKAST | ChEMBL | Phase 4 (approved) | ESR1 |
| NORETHINDRONE | ChEMBL | Phase 4 (approved) | ESR1 |
Related Atlas pages
- Genes: ESR1, ESR2
- Indicated for: breast carcinoma
- In clinical trials for: osteoporosis, breast neoplasm, angiosarcoma
- Drugs: Fulvestrant, Bazedoxifene, Bithionol, Cisplatin, Diethylstilbestrol, Elacestrant, Estetrol, Estradiol, Estriol, Estrone, Ethinyl Estradiol, Hexachlorophene, Medroxyprogesterone, Mifepristone, Phenolphthalein, Raloxifene, Spironolactone, Tamoxifen, Acolbifene, Afimoxifene, Amcenestrant, Arzoxifene, Benserazide, Bosentan, Dihydroergotamine, Fidaxomicin, Propoxyphene, Pyrazinamide, Acetophenazine, Alectinib, Apomorphine, Aripiprazole, Aspirin, Aztreonam, Belinostat, Benzbromarone, Bexarotene, Bisacodyl, Bromocriptine, Butoconazole, Candesartan Cilexetil, Caspofungin, Cefadroxil, Cefepime, Ceftazidime, Cerivastatin, Chlorotrianisene, Clofazimine, Clomiphene, Cyclofenil, Danazol, Daunorubicin, Demeclocycline, Dequalinium, Desogestrel, Dienestrol, Dinoprostone, Doxorubicin, Dronedarone, Ergocalciferol, Ertapenem, Estradiol Cypionate, Estradiol Valerate, Estramustine, Ethylestrenol, Ethynodiol Diacetate, Etonogestrel, Etravirine, Flupirtine, Hexestrol, Ibuprofen, Isoconazole, Lenvatinib, Levonorgestrel, Lusutrombopag, Lymecycline, Masoprocol, Memantine, Mestranol, Methysergide, Micafungin, Mifamurtide Acid, Miltefosine, Mitoxantrone, Molsidomine, Montelukast, Norethindrone