Lerociclib
drugOn this page
Also known as G1T-38G1t38G1T38 FREE BASE
Summary
Lerociclib (CHEMBL3904602) is a phase-3 clinical-stage small molecule targeting CDK4 and CDK6; indicated across 5 conditions including breast neoplasm and endometrial carcinoma.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 2 (CDK4, CDK6)
- Indications: 5 conditions
- Clinical trials: 4
- Chemistry: 474.6 Da · C26H34N8O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL3904602 |
| Name | Lerociclib |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 86269224 |
| Molecular formula | C26H34N8O |
| Molecular weight | 474.6 |
| InChIKey | YPJRHEKCFKOVRT-UHFFFAOYSA-N |
SMILES: CC(C)N1CCN(CC1)C2=CN=C(C=C2)NC3=NC=C4C=C5C(=O)NCC6(N5C4=N3)CCCCC6
IUPAC name: 4-[[5-(4-propan-2-ylpiperazin-1-yl)-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-2,4,6,8-tetraene-13,1’-cyclohexane]-10-one
Also known as: G1T-38, G1t38, G1T38, G1T38 FREE BASE, Lerociclib, LEROCICLIB
Patent coverage: 390 distinct patent families (1,012 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 1,010 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CDK4 | cyclin dependent kinase 4 | Inhibition | 9 | 58% | P11802 |
| CDK6 | cyclin dependent kinase 6 | Inhibition | 8.33 | 52.1% | Q00534 |
Broader ChEMBL bioactivity targets: 13 (assay-derived). Sample: Cyclin-dependent kinase 4/cyclin D1, Receptor-type tyrosine-protein kinase FLT3, CDK9/cyclin T1, CDK6/cyclin D3, Cyclin-dependent kinase 6, Cyclin-dependent kinase 2, Serine/threonine-protein kinase Nek10, Cyclin-dependent kinase 9, Cyclin-dependent kinase 4, Dual specificity protein kinase TTK.
Bioactivity
ChEMBL activities: 20 potent at pChembl ≥ 5 of 20 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NEK10 | 9.7 | Kd | 0.2 | nM | CHEMBL_ACT_19279485 |
| NUAK2 | 9.15 | Kd | 0.7 | nM | CHEMBL_ACT_19279486 |
| CDK4 | 9 | IC50 | 1 | nM | CHEMBL_ACT_17801306 |
| CDK4 | 9 | IC50 | 1 | nM | CHEMBL_ACT_24993235 |
| CDK4 | 9 | IC50 | 1 | nM | CHEMBL_ACT_29144569 |
| CDK4 | 8.97 | IC50 | 1.06 | nM | CHEMBL_ACT_17801488 |
| CDK2 | 8.82 | IC50 | 1.51 | nM | CHEMBL_ACT_17801497 |
| CDK6 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_24993239 |
| CCND3 | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_29144575 |
| CDK2 | 8.45 | IC50 | 3.58 | nM | CHEMBL_ACT_17801493 |
| TTK | 8.38 | Kd | 4.2 | nM | CHEMBL_ACT_19279487 |
| CCND3 | 8.33 | IC50 | 4.7 | nM | CHEMBL_ACT_17801501 |
| ULK2 | 8.26 | Kd | 5.5 | nM | CHEMBL_ACT_19279488 |
| FLT3 | 8.19 | Kd | 6.5 | nM | CHEMBL_ACT_19279490 |
| FLT3 | 7.66 | Kd | 22 | nM | CHEMBL_ACT_19279489 |
| CDK9 | 7.55 | IC50 | 28 | nM | CHEMBL_ACT_24993247 |
| CCNT1 | 7.55 | IC50 | 28 | nM | CHEMBL_ACT_29144580 |
| CDK9 | 6.55 | IC50 | 280 | nM | CHEMBL_ACT_19279491 |
| CDK2 | 5.82 | IC50 | 1510 | nM | CHEMBL_ACT_17801457 |
| CDK2 | 5.45 | IC50 | 3580 | nM | CHEMBL_ACT_17801382 |
Target pathways
Aggregated over 2 target gene(s): CDK4, CDK6.
Top Reactome pathways
52 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Cell Cycle | 2 | CDK4, CDK6 |
| Disease | 2 | CDK4, CDK6 |
| Generic Transcription Pathway | 2 | CDK4, CDK6 |
| Cellular responses to stress | 2 | CDK4, CDK6 |
| Oxidative Stress Induced Senescence | 2 | CDK4, CDK6 |
| Senescence-Associated Secretory Phenotype (SASP) | 2 | CDK4, CDK6 |
| Cellular Senescence | 2 | CDK4, CDK6 |
| Oncogene Induced Senescence | 2 | CDK4, CDK6 |
| Mitotic G1 phase and G1/S transition | 2 | CDK4, CDK6 |
| Cyclin D associated events in G1 | 2 | CDK4, CDK6 |
| G1 Phase | 2 | CDK4, CDK6 |
| Cell Cycle, Mitotic | 2 | CDK4, CDK6 |
| RNA Polymerase II Transcription | 2 | CDK4, CDK6 |
| Gene expression (Transcription) | 2 | CDK4, CDK6 |
| Cellular responses to stimuli | 2 | CDK4, CDK6 |
| Diseases of Cellular Senescence | 2 | CDK4, CDK6 |
| Evasion of Oncogene Induced Senescence Due to p16INK4A Defects | 2 | CDK4, CDK6 |
| Evasion of Oncogene Induced Senescence Due to Defective p16INK4A binding to CDK4 and CDK6 | 2 | CDK4, CDK6 |
| Evasion of Oxidative Stress Induced Senescence Due to p16INK4A Defects | 2 | CDK4, CDK6 |
| Evasion of Oxidative Stress Induced Senescence Due to Defective p16INK4A binding to CDK4 and CDK6 | 2 | CDK4, CDK6 |
| Aberrant regulation of mitotic G1/S transition in cancer due to RB1 defects | 2 | CDK4, CDK6 |
| Defective binding of RB1 mutants to E2F1,(E2F2, E2F3) | 2 | CDK4, CDK6 |
| Diseases of mitotic cell cycle | 2 | CDK4, CDK6 |
| Diseases of cellular response to stress | 2 | CDK4, CDK6 |
| Aberrant regulation of mitotic cell cycle due to RB1 defects | 2 | CDK4, CDK6 |
| Drug-mediated inhibition of CDK4/CDK6 activity | 2 | CDK4, CDK6 |
| Developmental Biology | 1 | CDK4 |
| Reproduction | 1 | CDK4 |
| Meiosis | 1 | CDK4 |
| Signal Transduction | 1 | CDK4 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G1/S transition of mitotic cell cycle | 2 |
| signal transduction | 2 |
| regulation of G2/M transition of mitotic cell cycle | 2 |
| regulation of gene expression | 2 |
| positive regulation of fibroblast proliferation | 2 |
| cell division | 2 |
| regulation of cell cycle | 2 |
| protein phosphorylation | 2 |
| positive regulation of cell population proliferation | 1 |
| response to xenobiotic stimulus | 1 |
| positive regulation of G2/M transition of mitotic cell cycle | 1 |
| regulation of transcription initiation by RNA polymerase II | 1 |
| regulation of type B pancreatic cell proliferation | 1 |
| cellular response to lipopolysaccharide | 1 |
| cellular response to interleukin-4 | 1 |
Indications & clinical
Indications
5 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| breast neoplasm | 3 | MONDO:0021100 | MONDO:0007254 |
| endometrial carcinoma | 3 | MONDO:0002447 | EFO:1001512 |
| non-small cell lung carcinoma | 1 | MONDO:0005233 | EFO:0003060 |
| breast ductal adenocarcinoma | 1 | MONDO:0005590 | EFO:0006318 |
| lung neoplasm | 1 | MONDO:0021117 | MONDO:0008903 |
Clinical trials
Total trials: 4.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1/PHASE2 | 2 |
| PHASE3 | 1 |
| PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05712941 | PHASE3 | WITHDRAWN | Comparison of Letrozole With Lerociclib Versus Letrozole With Placebo Control in Patients With Advanced/Metastatic or Recurrent, Grade 1 or Grade 2 Endometrial Cancer |
| NCT02983071 | PHASE1/PHASE2 | UNKNOWN | G1T38, a CDK 4/6 Inhibitor, in Combination With Fulvestrant in Hormone Receptor-Positive, HER2-Negative Locally Advanced or Metastatic Breast Cancer |
| NCT03455829 | PHASE1/PHASE2 | COMPLETED | G1T38, a CDK 4/6 Inhibitor, in Combination With Osimertinib in EGFR-Mutant Non-Small Cell Lung Cancer |
| NCT05085002 | PHASE2 | TERMINATED | A Study of Lerociclib in Participants With Advanced Breast Cancer |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
63 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | CDK4, CDK6 |
| DABRAFENIB | ChEMBL | Phase 4 (approved) | CDK4, CDK6 |
| PALBOCICLIB | ChEMBL | Phase 4 (approved) | CDK4, CDK6 |
| RIBOCICLIB | ChEMBL | Phase 4 (approved) | CDK4, CDK6 |
| TRILACICLIB | ChEMBL | Phase 4 (approved) | CDK4, CDK6 |
| ALVOCIDIB | ChEMBL | Phase 3 | CDK4, CDK6 |
| DALPICICLIB | ChEMBL | Phase 3 | CDK4, CDK6 |
| DINACICLIB | ChEMBL | Phase 3 | CDK4, CDK6 |
| DOVITINIB | ChEMBL | Phase 3 | CDK4, CDK6 |
| LESTAURTINIB | ChEMBL | Phase 3 | CDK4, CDK6 |
| QUERCETIN | ChEMBL | Phase 3 | CDK4, CDK6 |
| AT-7519 | ChEMBL | Phase 2 | CDK4, CDK6 |
| AT-9283 | ChEMBL | Phase 2 | CDK4, CDK6 |
| ATIRMOCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| CROZBACICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| CT-7001 | ChEMBL | Phase 2 | CDK4, CDK6 |
| CULMERCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| EBVACICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| ECIRUCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| INDIRUBIN | ChEMBL | Phase 2 | CDK4, CDK6 |
| INIXACICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| ISTISOCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| MILCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| NARAZACICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| RG-547 | ChEMBL | Phase 2 | CDK4, CDK6 |
| RIVICICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| SELICICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| TEGTOCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| ULECACICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| VORUCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| ZEMIRCICLIB | ChEMBL | Phase 2 | CDK4, CDK6 |
| Afatinib | PubChem | Approved | CDK4, CDK6 |
| Binimetinib | PubChem | Approved | CDK4, CDK6 |
| Crizotinib | PubChem | Approved | CDK4, CDK6 |
| dacomitinib | PubChem | Approved | CDK4, CDK6 |
| Fostamatinib | PubChem | Approved | CDK4, CDK6 |
| Gefitinib | PubChem | Approved | CDK4, CDK6 |
| Idelalisib | PubChem | Approved | CDK4, CDK6 |
| Pazopanib | PubChem | Approved | CDK4, CDK6 |
| Pomalidomide | PubChem | Approved | CDK4, CDK6 |
| regorafenib | PubChem | Approved | CDK4, CDK6 |
| Selumetinib | PubChem | Approved | CDK4, CDK6 |
| Trametinib | PubChem | Approved | CDK4, CDK6 |
| CERITINIB | ChEMBL | Phase 4 (approved) | CDK4 |
| ENCORAFENIB | ChEMBL | Phase 4 (approved) | CDK4 |
| FEDRATINIB | ChEMBL | Phase 4 (approved) | CDK4 |
| GILTERITINIB | ChEMBL | Phase 4 (approved) | CDK4 |
| MOMELOTINIB | ChEMBL | Phase 4 (approved) | CDK6 |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | CDK4 |
| OLAPARIB | ChEMBL | Phase 4 (approved) | CDK6 |
| SORAFENIB | ChEMBL | Phase 4 (approved) | CDK6 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | CDK4 |
| RUBOXISTAURIN | ChEMBL | Phase 3 | CDK4 |
| BI-2536 | ChEMBL | Phase 2 | CDK4 |
| CYC-065 | ChEMBL | Phase 2 | CDK4 |
| ELLAGIC ACID | ChEMBL | Phase 2 | CDK4 |
| FISETIN | ChEMBL | Phase 2 | CDK6 |
| LY-2090314 | ChEMBL | Phase 2 | CDK4 |
| REBASTINIB | ChEMBL | Phase 2 | CDK4 |
| RONICICLIB | ChEMBL | Phase 2 | CDK4 |
Related Atlas pages
- Genes: CDK4, CDK6
- Diseases: breast neoplasm, endometrial carcinoma
- Drugs: Abemaciclib, Dabrafenib, Palbociclib, Ribociclib, Trilaciclib, Alvocidib, Dalpiciclib, Dinaciclib, Dovitinib, Lestaurtinib, Quercetin, Afatinib, Binimetinib, Crizotinib, dacomitinib, Fostamatinib, Gefitinib, Idelalisib, Pazopanib, Pomalidomide, regorafenib, Selumetinib, Trametinib, Ceritinib, Encorafenib, Fedratinib, Gilteritinib, Momelotinib, Nintedanib, Olaparib, Sorafenib, Sunitinib, Ruboxistaurin