Lestaurtinib
drugOn this page
Also known as A-154475A-154475.0CEP-701KT-555KT-5555KT5555SP-924SP924SPM-924SID50113274SID144206186CEP701
Summary
Lestaurtinib (CHEMBL603469) is a phase-3 clinical-stage small molecule targeting LATS1, LATS2, and FLT3; indicated across 10 conditions including acute lymphoblastic leukemia and acute myeloid leukemia.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 3 (LATS1, LATS2, FLT3)
- Indications: 10 conditions
- Clinical trials: 11
- Chemistry: 439.5 Da · C26H21N3O4
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL603469 |
| Name | Lestaurtinib |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 126565 |
| Molecular formula | C26H21N3O4 |
| Molecular weight | 439.5 |
| InChIKey | UIARLYUEJFELEN-LROUJFHJSA-N |
SMILES: C[C@@]12[C@](C[C@@H](O1)N3C4=CC=CC=C4C5=C6C(=C7C8=CC=CC=C8N2C7=C53)CNC6=O)(CO)O
IUPAC name: (15S,16S,18R)-16-hydroxy-16-(hydroxymethyl)-15-methyl-28-oxa-4,14,19-triazaoctacyclo[12.11.2.115,18.02,6.07,27.08,13.019,26.020,25]octacosa-1,6,8,10,12,20,22,24,26-nonaen-3-one
Also known as: A-154475, A-154475.0, CEP-701, KT-555, KT-5555, KT5555, Lestaurtinib, SP-924, SP924, SPM-924, SID50113274, LESTAURTINIB
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| LATS1 | large tumor suppressor kinase 1 | Inhibition | 7.52 | 0.1% | O95835 |
| LATS2 | large tumor suppressor kinase 2 | Inhibition | 9 | 0.6% | Q9NRM7 |
| FLT3 | fms related receptor tyrosine kinase 3 | Inhibition | 8.07 | 0.9% | P36888 |
Broader ChEMBL bioactivity targets: 358 (assay-derived). Sample: Leucine-rich repeat serine/threonine-protein kinase 2, Rhodopsin kinase GRK7, Serine/threonine-protein kinase 38, Homeodomain-interacting protein kinase 4, Serine/threonine-protein kinase TAO2, Serine/threonine-protein kinase/endoribonuclease IRE1, Serine/threonine-protein kinase OSR1, Serine/threonine-protein kinase MAK, STE20/SPS1-related proline-alanine-rich protein kinase, Cyclin-dependent kinase-like 5.
Bioactivity
ChEMBL activities: 866 potent at pChembl ≥ 5 of 869 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| PHKG1 | 9.41 | Kd | 0.39 | nM | CHEMBL_ACT_3445241 |
| PHKG1 | 9.41 | Kd | 0.39 | nM | CHEMBL_ACT_7589823 |
| MAP3K19 | 9.28 | Kd | 0.52 | nM | CHEMBL_ACT_3448831 |
| MAP3K19 | 9.28 | Kd | 0.52 | nM | CHEMBL_ACT_7589928 |
| FLT3 | 9.24 | Kd | 0.57 | nM | CHEMBL_ACT_3445125 |
| FLT3 | 9.24 | Kd | 0.57 | nM | CHEMBL_ACT_7589724 |
| FLT3 | 9.18 | Kd | 0.66 | nM | CHEMBL_ACT_3445124 |
| FLT3 | 9.18 | Kd | 0.66 | nM | CHEMBL_ACT_7589723 |
| JAK2 | 9.05 | IC50 | 0.9 | nM | CHEMBL_ACT_24788508 |
| JAK2 | 9.05 | IC50 | 0.9 | nM | CHEMBL_ACT_25555231 |
| JAK2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_24975315 |
| JAK2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_26309192 |
| LATS2 | 9 | Kd | 1 | nM | CHEMBL_ACT_3445168 |
| NUAK2 | 9 | Kd | 1 | nM | CHEMBL_ACT_3448785 |
| LATS2 | 9 | Kd | 1 | nM | CHEMBL_ACT_7589873 |
| NUAK2 | 9 | Kd | 1 | nM | CHEMBL_ACT_7589931 |
| JAK3 | 8.96 | Kd | 1.1 | nM | CHEMBL_ACT_25839827 |
| FLT3 | 8.85 | Kd | 1.4 | nM | CHEMBL_ACT_3445128 |
| MKNK2 | 8.85 | Kd | 1.4 | nM | CHEMBL_ACT_3445205 |
| FLT3 | 8.85 | Kd | 1.4 | nM | CHEMBL_ACT_7589727 |
| MKNK2 | 8.85 | Kd | 1.4 | nM | CHEMBL_ACT_7589898 |
| Q00342 | 8.82 | IC50 | 1.5 | nM | CHEMBL_ACT_14545494 |
| FLT3 | 8.82 | IC50 | 1.5 | nM | CHEMBL_ACT_3444909 |
| PLK4 | 8.82 | Kd | 1.5 | nM | CHEMBL_ACT_3445263 |
| FLT3 | 8.82 | Kd | 1.5 | nM | CHEMBL_ACT_7589725 |
| PLK4 | 8.82 | Kd | 1.5 | nM | CHEMBL_ACT_7589866 |
| PHKG2 | 8.77 | Kd | 1.7 | nM | CHEMBL_ACT_3445242 |
| PHKG2 | 8.77 | Kd | 1.7 | nM | CHEMBL_ACT_7588053 |
| IRAK4 | 8.77 | Kd | 1.7 | nM | CHEMBL_ACT_7589888 |
| PKN2 | 8.74 | Kd | 1.8 | nM | CHEMBL_ACT_3445259 |
Target pathways
Aggregated over 3 target gene(s): LATS1, LATS2, FLT3.
Top Reactome pathways
29 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 2 | LATS1, LATS2 |
| Signaling by Hippo | 2 | LATS1, LATS2 |
| PI3K Cascade | 1 | FLT3 |
| PIP3 activates AKT signaling | 1 | FLT3 |
| Constitutive Signaling by Aberrant PI3K in Cancer | 1 | FLT3 |
| RAF/MAP kinase cascade | 1 | FLT3 |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 1 | FLT3 |
| FLT3 Signaling | 1 | FLT3 |
| STAT5 Activation | 1 | FLT3 |
| FLT3 mutants bind TKIs | 1 | FLT3 |
| STAT5 activation downstream of FLT3 ITD mutants | 1 | FLT3 |
| KW2449-resistant FLT3 mutants | 1 | FLT3 |
| semaxanib-resistant FLT3 mutants | 1 | FLT3 |
| crenolanib-resistant FLT3 mutants | 1 | FLT3 |
| gilteritinib-resistant FLT3 mutants | 1 | FLT3 |
| lestaurtinib-resistant FLT3 mutants | 1 | FLT3 |
| midostaurin-resistant FLT3 mutants | 1 | FLT3 |
| pexidartinib-resistant FLT3 mutants | 1 | FLT3 |
| ponatinib-resistant FLT3 mutants | 1 | FLT3 |
| quizartinib-resistant FLT3 mutants | 1 | FLT3 |
| sorafenib-resistant FLT3 mutants | 1 | FLT3 |
| sunitinib-resistant FLT3 mutants | 1 | FLT3 |
| tandutinib-resistant FLT3 mutants | 1 | FLT3 |
| linifanib-resistant FLT3 mutants | 1 | FLT3 |
| tamatinib-resistant FLT3 mutants | 1 | FLT3 |
| Signaling by FLT3 ITD and TKD mutants | 1 | FLT3 |
| Negative regulation of FLT3 | 1 | FLT3 |
| FLT3 signaling through SRC family kinases | 1 | FLT3 |
| FLT3 signaling by CBL mutants | 1 | FLT3 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| protein phosphorylation | 3 |
| G1/S transition of mitotic cell cycle | 2 |
| inner cell mass cell fate commitment | 2 |
| inner cell mass cellular morphogenesis | 2 |
| intracellular protein localization | 2 |
| hormone-mediated signaling pathway | 2 |
| regulation of transforming growth factor beta receptor signaling pathway | 2 |
| keratinocyte differentiation | 2 |
| hippo signaling | 2 |
| positive regulation of apoptotic process | 2 |
| negative regulation of cyclin-dependent protein serine/threonine kinase activity | 2 |
| regulation of organ growth | 2 |
| cell division | 2 |
| negative regulation of canonical Wnt signaling pathway | 2 |
| negative regulation of protein localization to nucleus | 2 |
Indications & clinical
Indications
10 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| acute lymphoblastic leukemia | 3 | MONDO:0004967 | EFO:0000220 |
| acute myeloid leukemia | 2 | MONDO:0018874 | EFO:0000222 |
| leukemia | 2 | MONDO:0005059 | EFO:0000565 |
| psoriasis | 2 | MONDO:0005083 | EFO:0000676 |
| essential thrombocythemia | 2 | MONDO:0005029 | EFO:0000479 |
| plasma cell myeloma | 2 | MONDO:0009693 | EFO:0001378 |
| acquired polycythemia vera | 2 | MONDO:0009891 | EFO:0002429 |
| neuroblastoma | 1 | MONDO:0005072 | EFO:0000621 |
| primary myelofibrosis | 1 | MONDO:0009692 | MONDO:0044903 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 11.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 7 |
| PHASE1/PHASE2 | 2 |
| PHASE3 | 1 |
| PHASE1 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00557193 | PHASE3 | COMPLETED | Combination Chemotherapy With or Without Lestaurtinib in Treating Younger Patients With Newly Diagnosed Acute Lymphoblastic Leukemia |
| NCT00030186 | PHASE2 | COMPLETED | Open Study of CEP-701 in Patients With Refractory Acute Myeloid Leukemia With FLT-3 Mutation |
| NCT00079482 | PHASE2 | COMPLETED | Study of CEP-701 (Lestaurtinib) in Patients With Acute Myeloid Leukemia (AML) |
| NCT00081601 | PHASE2 | COMPLETED | Study of CEP-701 in Treatment of Prostate Cancer |
| NCT00236119 | PHASE2 | COMPLETED | Study of the Efficacy, Safety and Tolerability of Oral CEP-701 in Patients With Severe Psoriasis |
| NCT00242827 | PHASE2 | TERMINATED | Efficacy and Safety of Oral CEP-701 for the Treatment of Patients With Advanced Multiple Myeloma |
| NCT00469859 | PHASE1/PHASE2 | COMPLETED | Lestaurtinib, Cytarabine, and Idarubicin in Treating Younger Patients With Relapsed or Refractory Acute Myeloid Leukemia |
| NCT00494585 | PHASE2 | COMPLETED | CEP-701 for PH-negative Myelofibrosis |
| NCT00586651 | PHASE2 | COMPLETED | Open-Label Study of Oral CEP-701 (Lestaurtinib) in Patients With Polycythemia Vera or Essential Thrombocytosis |
| NCT00668421 | PHASE1/PHASE2 | UNKNOWN | CEP-701 (Lestaurtinib) in Myelofibrosis |
| NCT00084422 | PHASE1 | COMPLETED | N2001-03: CEP-701 in Treating Young Patients With Recurrent or Refractory High-Risk Neuroblastoma |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
145 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Afatinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| Axitinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| Bosutinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| Crizotinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| Erlotinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| Fedratinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| Gefitinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| Imatinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| MIDOSTAURIN | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| Neratinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| Nilotinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| Pazopanib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| Quizartinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| Sorafenib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| SUNITINIB | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| Vandetanib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | FLT3, LATS1, LATS2 |
| DOVITINIB | ChEMBL | Phase 3 | FLT3, LATS1, LATS2 |
| LINIFANIB | ChEMBL | Phase 3 | FLT3, LATS1, LATS2 |
| RUBOXISTAURIN | ChEMBL | Phase 3 | FLT3, LATS1, LATS2 |
| SU-014813 | ChEMBL | Phase 2 | FLT3, LATS1, LATS2 |
| TG100-115 | ChEMBL | Phase 2 | FLT3, LATS1, LATS2 |
| TOZASERTIB | ChEMBL | Phase 2 | FLT3, LATS1, LATS2 |
| Idelalisib | PubChem | Approved | FLT3, LATS1, LATS2 |
| Selumetinib | PubChem | Approved | FLT3, LATS1, LATS2 |
| Abemaciclib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1 |
| Cabozantinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1 |
| Ceritinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1 |
| Entrectinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1 |
| FOSTAMATINIB | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1 |
| GILTERITINIB | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1 |
| IBRUTINIB | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1 |
| Pacritinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1 |
| Palbociclib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1 |
| Pexidartinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1 |
| Ponatinib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1 |
| Tivozanib | ChEMBL + PubChem | Phase 4 (approved) | FLT3, LATS1 |
| CRENOLANIB | ChEMBL | Phase 3 | FLT3, LATS1 |
| DEFACTINIB | ChEMBL | Phase 3 | FLT3, LATS1 |
| LINSITINIB | ChEMBL | Phase 3 | FLT3, LATS1 |
| ORANTINIB | ChEMBL | Phase 3 | FLT3, LATS1 |
| AT-9283 | ChEMBL | Phase 2 | FLT3, LATS1 |
| MILCICLIB | ChEMBL | Phase 2 | FLT3, LATS1 |
| R-406 | ChEMBL | Phase 2 | FLT3, LATS2 |
| Acalabrutinib | PubChem | Approved | LATS1, LATS2 |
| Binimetinib | PubChem | Approved | FLT3, LATS1 |
| dacomitinib | PubChem | Approved | FLT3, LATS1 |
| Duvelisib | PubChem | Approved | LATS1, LATS2 |
| Lapatinib | PubChem | Approved | LATS1, LATS2 |
| Ruxolitinib | PubChem | Approved | LATS1, LATS2 |
| Tofacitinib | PubChem | Approved | LATS1, LATS2 |
| Trametinib | PubChem | Approved | FLT3, LATS1 |
| CAPIVASERTIB | ChEMBL + PubChem | Phase 4 (approved) | LATS1 |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | FLT3 |
| DASATINIB | ChEMBL | Phase 4 (approved) | FLT3 |
| FILGOTINIB | ChEMBL | Phase 4 (approved) | FLT3 |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | FLT3 |
| PRALSETINIB | ChEMBL | Phase 4 (approved) | FLT3 |
| ALVOCIDIB | ChEMBL | Phase 3 | FLT3 |
Related Atlas pages
- Genes: LATS1, LATS2, FLT3
- Diseases: acute lymphoblastic leukemia
- Drugs: Afatinib, Axitinib, Bosutinib, Crizotinib, Erlotinib, Fedratinib, Gefitinib, Imatinib, Midostaurin, Neratinib, Nilotinib, Pazopanib, Quizartinib, Sorafenib, Sunitinib, Vandetanib, Nintedanib, Dovitinib, Linifanib, Ruboxistaurin, Idelalisib, Selumetinib, Abemaciclib, Cabozantinib, Ceritinib, Entrectinib, Fostamatinib, Gilteritinib, Ibrutinib, Pacritinib, Palbociclib, Pexidartinib, Ponatinib, Regorafenib, Tivozanib, Crenolanib, Defactinib, Linsitinib, Orantinib, Acalabrutinib, Binimetinib, dacomitinib, Duvelisib, Lapatinib, Ruxolitinib, Tofacitinib, Trametinib, Capivasertib, Brigatinib, Dasatinib, Filgotinib, Infigratinib, Pralsetinib, Alvocidib