Lidocaine
drugOn this page
Also known as ALGRX 3268ALGRX-3268AlphacaineDentipatchEmbolexIontocaineLidocainaLidocaine component of emlaLidocaine component of fortacinLidocaine component of lanabioticLidocaine component of oraqixLidocaine component of pliaglisLidocaine component of rocephin kitLidocaine component of syneraLidocainumLidodermLmx 4Lignocaine hclNSC-40030
Summary
Lidocaine (CHEMBL79) is an approved small-molecule local anaesthetic (ATC R02AD02) targeting SCN2A, SCN4A, and SCN5A; indicated across 121 conditions including neuralgia and disease of the tendon.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: R02AD02 (+7 more)
- Targets: 5 (SCN2A, SCN4A, SCN5A…)
- Indications: 121 conditions
- Clinical trials: 1,084
- Chemistry: 234.34 Da · C14H22N2O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL79 |
| Name | Lidocaine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 3676 |
| ChEBI | CHEBI:6456 |
| ATC | R02AD02, D04AB01, N01BB02, S01HA07, C01BB01, N01BB52, S02DA01, C05AD01 |
| Molecular formula | C14H22N2O |
| Molecular weight | 234.34 |
| InChIKey | NNJVILVZKWQKPM-UHFFFAOYSA-N |
SMILES: CCN(CC)CC(=O)NC1=C(C=CC=C1C)C
IUPAC name: 2-(diethylamino)-N-(2,6-dimethylphenyl)acetamide
ChEBI definition: The monocarboxylic acid amide resulting from the formal condensation of N,N-diethylglycine with 2,6-dimethylaniline.
Pharmacological roles (ChEBI): local anaesthetic, anti-arrhythmia drug, drug allergen.
Other ChEBI roles (chemical / environmental): environmental contaminant, xenobiotic.
Also known as: ALGRX 3268, ALGRX-3268, Alphacaine, Dentipatch, Embolex, Iontocaine, Lidocaina, Lidocaine, Lidocaine component of emla, Lidocaine component of fortacin, Lidocaine component of lanabiotic, Lidocaine component of oraqix
Parent form; salt/anhydrous children: CHEMBL541521, CHEMBL1200409, CHEMBL3278065
Patent coverage: 41,033 distinct patent families (140,673 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SCN2A | Nav1.2 | Pore blocker | 5 | 0.1% | Q99250 |
| SCN4A | Nav1.4 | Pore blocker | 2.7 | 0% | P35499 |
| SCN5A | Nav1.5 | Pore blocker | 4.8 | 0.2% | Q14524 |
| SCN9A | Nav1.7 | Pore blocker | 3.3 | 0% | Q15858 |
| SCN10A | Nav1.8 | Pore blocker | 4 | 0.1% | Q9Y5Y9 |
Broader ChEMBL bioactivity targets: 15 (assay-derived). Sample: Microtubule-associated protein tau, Prelamin-A/C, 5-hydroxytryptamine receptor 3A, Sodium channel protein type 5 subunit alpha, Beta-lactamase, Sodium channel protein type 4 subunit alpha, Sodium channel alpha subunits; brain (Types I, II, III), Melanocortin receptor 4, Muscarinic acetylcholine receptor M1, Cytochrome P450 3A4.
Bioactivity
ChEMBL activities: 5 potent at pChembl ≥ 5 of 18 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| P00811 | 6.45 | Potency | 354.8 | nM | CHEMBL_ACT_4676386 |
| ALDH1A1 | 6.05 | Potency | 891.3 | nM | CHEMBL_ACT_4148909 |
| SCN4A | 5.7 | IC50 | 2000 | nM | CHEMBL_ACT_13905714 |
| CYP3A4 | 5.7 | Potency | 1995 | nM | CHEMBL_ACT_5006349 |
| CYP3A4 | 5.7 | Potency | 1995 | nM | CHEMBL_ACT_5074856 |
Target pathways
Aggregated over 5 target gene(s): SCN2A, SCN4A, SCN5A, SCN9A, SCN10A.
Top Reactome pathways
11 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Developmental Biology | 5 | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| L1CAM interactions | 5 | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| Muscle contraction | 5 | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| Axon guidance | 5 | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| Interaction between L1 and Ankyrins | 5 | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| Cardiac conduction | 5 | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| Phase 0 - rapid depolarisation | 5 | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| Nervous system development | 5 | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| Sensory Perception | 2 | SCN2A, SCN9A |
| Sensory perception of taste | 2 | SCN2A, SCN9A |
| Sensory perception of sweet, bitter, and umami (glutamate) taste | 2 | SCN2A, SCN9A |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| sodium ion transport | 5 |
| sodium ion transmembrane transport | 5 |
| cardiac muscle cell action potential involved in contraction | 5 |
| monoatomic ion transport | 5 |
| monoatomic ion transmembrane transport | 5 |
| transmembrane transport | 5 |
| regulation of heart rate | 4 |
| monoatomic cation transmembrane transport | 4 |
| action potential | 3 |
| neuronal action potential | 2 |
| regulation of membrane potential | 2 |
| cardiac muscle cell action potential | 2 |
| regulation of muscle system process | 2 |
| odontogenesis of dentin-containing tooth | 2 |
| regulation of atrial cardiac muscle cell membrane depolarization | 2 |
Indications & clinical
Indications
121 indications (24 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| neuralgia | 4 | MONDO:0021667 | EFO:0005762 |
| disease of the tendon | 4 | MONDO:0100010 | EFO:1001434 |
| frozen shoulder | 4 | MONDO:0006763 | EFO:1000941 |
| arthritic joint disease | 4 | MONDO:0005578 | EFO:0005856 |
| hemorrhoid | 4 | MONDO:0004872 | EFO:0009552 |
| rectal disorder | 4 | MONDO:0001593 | EFO:0000405 |
| urethritis | 4 | MONDO:0005297 | EFO:0003878 |
| sunburn | 4 | MONDO:0005326 | EFO:0003958 |
| burn | 4 | MONDO:0043519 | EFO:0009516 |
| osteoarthritis | 4 | MONDO:0005178 | MONDO:0005178 |
| premature ejaculation | 4 | MONDO:0001780 | EFO:0803321 |
| osteoarthritis, knee | 3 | MONDO:0005416 | EFO:0004616 |
| peripheral neuropathy | 3 | MONDO:0005244 | EFO:0003100 |
| breast carcinoma | 3 | MONDO:0004989 | EFO:0000305 |
| carpal tunnel syndrome | 3 | MONDO:0007275 | EFO:0004143 |
| fibromyalgia | 3 | MONDO:0005546 | EFO:0005687 |
| parathyroid gland disorder | 3 | MONDO:0001223 | EFO:0005754 |
| preeclampsia | 3 | MONDO:0005081 | EFO:0000668 |
| postmenopausal osteoporosis | 3 | MONDO:0008159 | EFO:0003854 |
| obesity disorder | 3 | MONDO:0011122 | EFO:0001073 |
| stroke disorder | 3 | MONDO:0005098 | EFO:0000712 |
| nutritional disorder | 3 | MONDO:0005137 | EFO:0001069 |
| overactive bladder | 3 | MONDO:0006624 | EFO:1000781 |
| pulpitis | 3 | MONDO:0006937 | EFO:1001139 |
| injury | 3 | MONDO:0021178 | EFO:0000546 |
| morbid obesity | 3 | MONDO:0005139 | EFO:0001074 |
| muscle tissue disorder | 3 | MONDO:0003939 | EFO:0002970 |
| colorectal neoplasm | 3 | MONDO:0005335 | EFO:0004142 |
| common cold | 3 | MONDO:0005709 | EFO:0007214 |
| sinusitis | 3 | MONDO:0005961 | EFO:0007486 |
| extramammary Paget disease | 3 | MONDO:0008177 | EFO:1000249 |
| dysplasia of cervix | 3 | MONDO:0006736 | EFO:1000910 |
| scoliosis | 3 | MONDO:0005392 | EFO:0004273 |
| toxic shock syndrome | 3 | MONDO:0001881 | EFO:0006834 |
| cardiac arrest | 3 | MONDO:0000745 | EFO:0009492 |
| stomatitis | 3 | MONDO:0004842 | EFO:0009688 |
| periarthritis | 3 | MONDO:0006898 | EFO:1001097 |
| epicondylitis | 3 | MONDO:0001875 | EFO:1001887 |
| pharyngitis | 3 | MONDO:0002258 | MONDO:0002258 |
| breast neoplasm | 3 | MONDO:0021100 | MONDO:0007254 |
| ileus | 3 | MONDO:0004567 | MONDO:0004567 |
| migraine disorder | 3 | MONDO:0005277 | MONDO:0005277 |
| bone fracture | 3 | MONDO:0005315 | EFO:0003931 |
| pain agnosia | 3 | MONDO:0000675 | EFO:1001484 |
| carcinoma | 2 | MONDO:0004993 | EFO:0000313 |
| urinary tract infection | 2 | MONDO:0100338 | EFO:0003103 |
| anxiety | 2 | MONDO:0011918 | EFO:0005230 |
| cocaine dependence | 2 | MONDO:0005186 | EFO:0002610 |
| infertility disorder | 2 | MONDO:0005047 | EFO:0000545 |
| irritable bowel syndrome | 2 | MONDO:0005052 | EFO:0000555 |
| heart disorder | 2 | MONDO:0005267 | EFO:0003777 |
| myofascial pain syndrome | 2 | MONDO:0006862 | EFO:1001054 |
| shoulder impingement syndrome | 2 | MONDO:0006968 | EFO:1001178 |
| scleroderma | 2 | MONDO:0019340 | EFO:1001993 |
| interstitial cystitis | 2 | MONDO:0018301 | EFO:0008507 |
| diabetic neuropathy | 2 | MONDO:0006626 | EFO:1000783 |
| trigeminal neuralgia | 2 | MONDO:0008599 | EFO:1001219 |
| humerus fracture | 2 | MONDO:0005319 | EFO:0003943 |
| leiomyoma | 2 | MONDO:0001572 | MONDO:0001572 |
| neoplasm | 2 | MONDO:0005070 | EFO:0000616 |
| skin disorder | 2 | MONDO:0005093 | EFO:0000701 |
| temporomandibular joint disorder | 2 | MONDO:0005473 | EFO:0005279 |
| anus disorder | 2 | MONDO:0002519 | EFO:0009660 |
| severe acute respiratory syndrome | 2 | MONDO:0005091 | MONDO:0100096 |
| spasmodic dystonia | 2 | MONDO:0000485 | MONDO:0000485 |
| pulmonary arterial hypertension | 1 | MONDO:0015924 | EFO:0001361 |
| squamous cell carcinoma | 1 | MONDO:0005096 | EFO:0000707 |
| actinic keratosis | 1 | MONDO:0005173 | EFO:0002496 |
| brain neoplasm | 1 | MONDO:0021211 | EFO:0003833 |
| neuroma | 1 | MONDO:0002173 | EFO:0009619 |
| lung neoplasm | 1 | MONDO:0021117 | MONDO:0008903 |
| glioblastoma | 1 | MONDO:0018177 | EFO:0000519 |
| cystic, mucinous, and serous neoplasm | 1 | MONDO:0006720 | EFO:1000889 |
| attention deficit-hyperactivity disorder | 0 | MONDO:0007743 | EFO:0003888 |
| complex regional pain syndrome | 0 | MONDO:0019369 | EFO:1001998 |
| spinal fracture | 0 | MONDO:0005309 | EFO:0003902 |
| skin neoplasm | 0 | MONDO:0002531 | EFO:0004198 |
| parathyroid gland adenoma | 0 | MONDO:0006890 | EFO:1001087 |
| radius fracture | 0 | MONDO:0005325 | EFO:0003957 |
| severe cutaneous adverse reaction | 0 | MONDO:0005594 | EFO:0006346 |
41 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 1,084.
Phase distribution
| Phase | Trials |
|---|---|
| Not specified | 419 |
| PHASE4 | 328 |
| PHASE3 | 123 |
| PHASE2 | 81 |
| PHASE1 | 46 |
| PHASE2/PHASE3 | 33 |
| EARLY_PHASE1 | 30 |
| PHASE1/PHASE2 | 24 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03968822 | PHASE4 | ACTIVE_NOT_RECRUITING | Intralipid® 20% for Reversal of Local Anesthetics |
| NCT04781673 | PHASE4 | ACTIVE_NOT_RECRUITING | Ketamine vs Lidocaine in Traumatic Rib Fractures |
| NCT05031078 | PHASE4 | ACTIVE_NOT_RECRUITING | Assessing Durable Antibody Response to HPV Vaccination |
| NCT05285566 | PHASE4 | RECRUITING | Pain Control for Undergoing Costal Cartilage Harvesting |
| NCT06024733 | PHASE4 | ACTIVE_NOT_RECRUITING | Intravenous Anesthesia by Targeted Controlled Infusion Versus Inhalational Anesthesia on the Surgical Stress Response |
| NCT06045936 | PHASE4 | RECRUITING | A Study of Contralateral Limb Block |
| NCT06189781 | PHASE4 | RECRUITING | Pain Injection Versus Epidural Anesthesia for Hip Surgery in Pediatric Patients With Cerebral Palsy |
| NCT06695585 | PHASE4 | NOT_YET_RECRUITING | Optimal Intravesical Lidocaine Volume for Pain Relief During Office Intra-detrusor Onabotulinum Toxin a Injections |
| NCT06710405 | PHASE4 | RECRUITING | The Effect of Intraoperative Intravenous Lidocaine Infusion on Postoperative Pain and Recovery in Children (< 7 Years Old) Undergoing Thoracoscopic Surgery |
| NCT06795100 | PHASE4 | RECRUITING | Pharmacokinetic Study of Intravenous Lidocaine in Young and Elderly Patients |
| NCT06799494 | PHASE4 | RECRUITING | HPV Vaccine Reduced Dose |
| NCT06918340 | PHASE4 | ACTIVE_NOT_RECRUITING | Evaluation of Analgesic Efficacy of Lidocaine and Diclofenac Spray in Radial Artery Blood Gas Sampling by Visual Analogue Scale and Perfusion Index |
| NCT06966102 | PHASE4 | NOT_YET_RECRUITING | Lidocaine Infusion Versus Magnesium Infusion in Decreasing Fentanyl Requirements in Endoscopic Sinus Surgeries |
| NCT07034300 | PHASE4 | RECRUITING | Lidocaine vs. Lidocaine With Dexmedetomidine for Intravenous Regional Anesthesia (IVRA) in Upper Limb Surgery |
| NCT07043023 | PHASE4 | NOT_YET_RECRUITING | LIDOCRIT : Effect of Continuous Intravenous LIDOcaine on Discomfort in Postoperative CRITical Care Inpatients |
| NCT07048769 | PHASE4 | RECRUITING | Paracervical Block for Pain Reduction in Saline Infusion Sonograms |
| NCT07053176 | PHASE4 | ENROLLING_BY_INVITATION | Impact of Local Lidocaine Paravertebral Cervical Injection on Cervicogenic Dizziness Symptoms |
| NCT07073846 | PHASE4 | RECRUITING | Effect of Lidocaine-Dexmedetomidine on Pain, Inflammation, and Oxidative Stress After Bariatric Surgery. |
| NCT07116408 | PHASE4 | RECRUITING | Intranasal Sphenopalatine Ganglion Blockade for Headaches Following Aneurysmal Subarachnoid Hemorrhage |
| NCT07124650 | PHASE4 | RECRUITING | Sore Throat After Open Neck Elective Surgery |
| NCT07154628 | PHASE4 | NOT_YET_RECRUITING | Effect of Topical Lidocaine Spraying on the Vocal Cords Before Intubation During Robotic Surgery: a Randomized Controlled Trial |
| NCT07169227 | PHASE4 | NOT_YET_RECRUITING | Lidocaine, Paracetamol, and Dexmedetomidine for Rocuronium Injection Pain |
| NCT07224711 | PHASE4 | NOT_YET_RECRUITING | The Impact of Perioperative Lidocaine Infusions on Enhanced Recovery After Non-Cardiac Surgery |
| NCT07231614 | PHASE4 | NOT_YET_RECRUITING | Anesthetic Effectiveness of Lidocaine Versus Articaine in Dentistry |
| NCT07259772 | PHASE4 | ACTIVE_NOT_RECRUITING | Anesthetic Effect of Ropivacaine on Local Infiltration Anesthesia in Arteriovenous Fistula Surgery |
| NCT07268924 | PHASE4 | NOT_YET_RECRUITING | The Effect of Propofol Versus Lidocaine on Emergence Agitation in Children Undergoing Tonsillectomy. |
| NCT07283874 | PHASE4 | NOT_YET_RECRUITING | Does it Matter the Volume of Injectate on the Outcome of Ultrasound-guided Perineural Injection for Carpal Tunnel Syndrome |
| NCT07354217 | PHASE4 | NOT_YET_RECRUITING | Workflow Optimization During Pulse Field Ablation for Atrial Fibrillation |
| NCT07401745 | PHASE4 | ACTIVE_NOT_RECRUITING | Occlusal Splint Combined With Granisetron Injection for Management of Myofascial Pain Related to Temporomandibular Disorders |
| NCT07423650 | PHASE4 | RECRUITING | Continous Infusion of Nefopam for Patients Undergoing Pancreatoduodenectomy |
| NCT07429292 | PHASE4 | NOT_YET_RECRUITING | SPARK Study - Sympathetic Periarterial Radial Block in Healthy Volunteers |
| NCT07430085 | PHASE4 | NOT_YET_RECRUITING | Post-Operative Pain Relief: Zynrelef or Periarticular Injections in RATKA |
| NCT07456826 | PHASE4 | ENROLLING_BY_INVITATION | Study Evaluating the Efficacy and Safety of Chloroprocaine HCl Ophthalmic Gel 3% vs Proparacaine Ophthalmic Solution 0.5% Plus Subconjunctival Lidocaine in Patients Undergoing Intravitreal Injections |
| NCT07499154 | PHASE4 | NOT_YET_RECRUITING | Perioperative Lidocaine for Lung Protection in Infants Undergoing Cardiac Surgery |
| NCT07546370 | PHASE4 | NOT_YET_RECRUITING | The Effectiveness of Topical Prilocaine-Lidocaine Cream Plus Acetaminophen and Naproxen Compared to Lidocaine Injection Plus Acetaminophen and Naproxen to Manage Pain During IntraUterine Device Insertion |
| NCT07552766 | PHASE4 | NOT_YET_RECRUITING | A Clinical Trial on the Use of Lidocaine Infusion During Surgery for Pediatric Upper Extremity Fractures and Its Impact on Total Perioperative Opioid Requirements |
| NCT07601750 | PHASE4 | ENROLLING_BY_INVITATION | Local Anesthetic Clinical Trial |
| NCT00209872 | PHASE4 | UNKNOWN | Optimal Multimodal Analgesia in Abdominal Hysterectomy |
| NCT00209885 | PHASE4 | UNKNOWN | Optimal Multimodal Analgesia in Laparoscopic Cholecystectomy |
| NCT00330941 | PHASE4 | COMPLETED | Intravenous Lidocaine and Acute Rehabilitation |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 0 clinical and 3 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
223 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AMIODARONE | ChEMBL + PubChem | Phase 4 (approved) | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| AMITRIPTYLINE | ChEMBL + PubChem | Phase 4 (approved) | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| CHLORPROMAZINE | ChEMBL + PubChem | Phase 4 (approved) | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| DILTIAZEM | ChEMBL + PubChem | Phase 4 (approved) | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| HALOPERIDOL | ChEMBL + PubChem | Phase 4 (approved) | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| IMIPRAMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| LAMOTRIGINE | ChEMBL + PubChem | Phase 4 (approved) | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| MEXILETINE | ChEMBL + PubChem | Phase 4 (approved) | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| NIFEDIPINE | ChEMBL + PubChem | Phase 4 (approved) | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| PIMOZIDE | ChEMBL + PubChem | Phase 4 (approved) | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| MIBEFRADIL | ChEMBL | Phase 4 (approved) | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| AJMALINE | ChEMBL | Phase 3 | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| ELECLAZINE | ChEMBL | Phase 3 | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| NITRENDIPINE | ChEMBL | Phase 3 | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| TEDISAMIL | ChEMBL | Phase 3 | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| VIXOTRIGINE | ChEMBL | Phase 3 | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| CIFENLINE | ChEMBL | Phase 2 | SCN10A, SCN2A, SCN4A, SCN5A, SCN9A |
| Carbamazepine | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN4A, SCN5A, SCN9A |
| RILUZOLE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN4A, SCN5A, SCN9A |
| TETRODOTOXIN | ChEMBL | Phase 3 | SCN2A, SCN4A, SCN5A, SCN9A |
| FUNAPIDE | ChEMBL | Phase 2 | SCN10A, SCN2A, SCN5A, SCN9A |
| PF-05089771 | ChEMBL | Phase 2 | SCN2A, SCN4A, SCN5A, SCN9A |
| PHENYTOIN | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN4A, SCN5A |
| TETRACAINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN5A, SCN9A |
| DS-1971 | ChEMBL | Phase 2 | SCN2A, SCN5A, SCN9A |
| PF-04531083 | ChEMBL | Phase 2 | SCN10A, SCN5A, SCN9A |
| Dofetilide | PubChem | Approved | SCN10A, SCN2A, SCN4A |
| DESIPRAMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN5A |
| DIBUCAINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN5A |
| DIPHENHYDRAMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN5A |
| DROPERIDOL | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN5A |
| FELODIPINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN5A |
| FLUPHENAZINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN5A |
| LOPERAMIDE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN5A |
| NISOLDIPINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN5A |
| QUINIDINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN5A |
| THIORIDAZINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN5A |
| VERAPAMIL | ChEMBL + PubChem | Phase 4 (approved) | SCN2A, SCN5A |
| BEPRIDIL | ChEMBL | Phase 4 (approved) | SCN2A, SCN5A |
| ETIDOCAINE | ChEMBL | Phase 4 (approved) | SCN2A, SCN5A |
| PRENYLAMINE | ChEMBL | Phase 4 (approved) | SCN2A, SCN5A |
| MEPRYLCAINE | ChEMBL | Phase 2 | SCN2A, SCN5A |
| BROMPHENIRAMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| CHLORPHENIRAMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| COCAINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| CYPROHEPTADINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| DICYCLOMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| LEVORPHANOL | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | SCN5A |
| PHENOXYBENZAMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PHENTOLAMINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PRAMOXINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PRAZOSIN | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PRILOCAINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PROMETHAZINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| PROPARACAINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| QUININE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| RESERPINE | ChEMBL + PubChem | Phase 4 (approved) | SCN2A |
| SAFINAMIDE | ChEMBL + PubChem | Phase 4 (approved) | SCN9A |
Related Atlas pages
- Genes: SCN2A, SCN4A, SCN5A, SCN9A, SCN10A
- Diseases: neuralgia, disease of the tendon, frozen shoulder, arthritic joint disease, hemorrhoid, rectal disorder, urethritis, sunburn, burn, osteoarthritis, premature ejaculation, osteoarthritis, knee, peripheral neuropathy, breast carcinoma, carpal tunnel syndrome, fibromyalgia, parathyroid gland disorder, preeclampsia, postmenopausal osteoporosis, obesity disorder, stroke disorder, nutritional disorder, overactive bladder, pulpitis, injury, morbid obesity, muscle tissue disorder, colorectal neoplasm, common cold, sinusitis, extramammary Paget disease, dysplasia of cervix, scoliosis, toxic shock syndrome, cardiac arrest, stomatitis, epicondylitis, pharyngitis, breast neoplasm, ileus, migraine disorder, bone fracture, pain agnosia
- Drugs: Amiodarone, Amitriptyline, Chlorpromazine, Diltiazem, Haloperidol, Imipramine, Lamotrigine, Mexiletine, Nifedipine, Pimozide, Mibefradil, Sertindole, Ajmaline, Eleclazine, Nitrendipine, Tedisamil, Vixotrigine, Carbamazepine, Riluzole, Tetrodotoxin, Phenytoin, Tetracaine, Dofetilide, Desipramine, Dibucaine, Diphenhydramine, Droperidol, Felodipine, Fluphenazine, Loperamide, Nisoldipine, Quinidine, Thioridazine, Verapamil, Bepridil, Etidocaine, Prenylamine, Brompheniramine, Chlorpheniramine, Cocaine, Cyproheptadine, Dicyclomine, Levorphanol, Paliperidone, Phenoxybenzamine, Phentolamine, Pramoxine, Prazosin, Prilocaine, Promethazine, Proparacaine, Quinine, Reserpine, Safinamide