Linsitinib
drugOn this page
Also known as ASP-7487OSI-906OSI-906AAOSI906OSI 906LINSITINIB (OSI-906)MMV676605OSI-906 (LINSITINIB)C0237134
Summary
Linsitinib (CHEMBL1091644) is a phase-3 clinical-stage small-molecule insulin-like growth factor receptor 1 antagonist targeting INSR, IGF1R, and INSRR; indicated across 15 conditions including adrenal cortex carcinoma and neoplasm; with CIViC clinical evidence for 8 variant-indication associations (e.g. MYB::NFIB Fusion in doid:0080202).
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 3 (INSR, IGF1R, INSRR)
- Indications: 15 conditions
- Clinical trials: 24
- Precision-oncology evidence (CIViC): 8 variant–indication associations
- Chemistry: 421.5 Da · C26H23N5O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1091644 |
| Name | Linsitinib |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 11640390 |
| ChEBI | CHEBI:91402 |
| Molecular formula | C26H23N5O |
| Molecular weight | 421.5 |
| InChIKey | PKCDDUHJAFVJJB-UHFFFAOYSA-N |
SMILES: CC1(CC(C1)C2=NC(=C3N2C=CN=C3N)C4=CC5=C(C=C4)C=CC(=N5)C6=CC=CC=C6)O
IUPAC name: 3-[8-amino-1-(2-phenylquinolin-7-yl)imidazo[1,5-a]pyrazin-3-yl]-1-methylcyclobutan-1-ol
ChEBI definition: An imidazopyrazine that is imidazo[1,5-a]pyrazine substituted by 2-phenylquinolin-7-yl, cis-3-hydroxy-3-methylcyclobutyl, and amino groups at positions 1, 3, and 8, respectively. It is dual inhibitor of the IGF-1 receptor and insulin receptor (IC50 = 35 and 75 nM, respectively) that was previously in clinical development for the treatment of cancer and thyroid eye disease.
Pharmacological roles (ChEBI): insulin-like growth factor receptor 1 antagonist, antimycobacterial drug, antineoplastic agent, apoptosis inducer.
Also known as: ASP-7487, Linsitinib, OSI-906, OSI-906AA, LINSITINIB, OSI906, OSI 906, LINSITINIB (OSI-906), MMV676605, OSI-906 (LINSITINIB), linsitinib, OSI-906 (Linsitinib)
Patent coverage: 572 distinct patent families (1,446 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| INSR | Insulin receptor | Inhibition | 7.12 | 0.8% | P06213 |
| IGF1R | Insulin-like growth factor I receptor | Inhibition | 7.46 | 19% | P08069 |
| INSRR | Insulin receptor-related receptor | Inhibition | 7.12 | 0.4% | P14616 |
Broader ChEMBL bioactivity targets: 23 (assay-derived). Sample: Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma, Receptor-interacting serine/threonine-protein kinase 3, Mitogen-activated protein kinase; ERK1/ERK2, Insulin-like growth factor 1 receptor, Receptor-type tyrosine-protein kinase FLT3, Insulin receptor, Aurora kinase B, Dual specificity mitogen-activated protein kinase kinase 2, Dual specificity mitogen-activated protein kinase kinase 1, Hepatocyte growth factor receptor.
Bioactivity
ChEMBL activities: 53 potent at pChembl ≥ 5 of 54 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| IGF1R | 8.7 | IC50 | 2 | nM | CHEMBL_ACT_15189356 |
| IGF1R | 8.55 | IC50 | 2.8 | nM | CHEMBL_ACT_16539598 |
| IGF1R | 8.12 | IC50 | 7.6 | nM | CHEMBL_ACT_16539621 |
| MAPK11 | 8 | Kd | 10 | nM | CHEMBL_ACT_17915182 |
| IGF1R | 7.92 | IC50 | 12 | nM | CHEMBL_ACT_13393290 |
| IGF1R | 7.89 | IC50 | 13 | nM | CHEMBL_ACT_13393287 |
| IGF1R | 7.85 | IC50 | 14 | nM | CHEMBL_ACT_16539575 |
| INSR | 7.8 | IC50 | 16 | nM | CHEMBL_ACT_16540673 |
| INSR | 7.75 | IC50 | 18 | nM | CHEMBL_ACT_14652576 |
| IGF1R | 7.75 | IC50 | 18 | nM | CHEMBL_ACT_3240784 |
| IGF1R | 7.68 | IC50 | 21 | nM | CHEMBL_ACT_24953740 |
| INSR | 7.68 | IC50 | 21 | nM | CHEMBL_ACT_24953741 |
| INSRR | 7.68 | IC50 | 21 | nM | CHEMBL_ACT_24953742 |
| IGF1R | 7.62 | IC50 | 24 | nM | CHEMBL_ACT_13393269 |
| IGF1R | 7.62 | IC50 | 24 | nM | CHEMBL_ACT_24953964 |
| IGF1R | 7.62 | IC50 | 24 | nM | CHEMBL_ACT_26240366 |
| IGF1R | 7.62 | IC50 | 24 | nM | CHEMBL_ACT_26240428 |
| IGF1R | 7.62 | IC50 | 24 | nM | CHEMBL_ACT_5197012 |
| MAPK3 | 7.55 | IC50 | 28 | nM | CHEMBL_ACT_26240429 |
| INSR | 7.47 | IC50 | 34 | nM | CHEMBL_ACT_16540666 |
| IGF1R | 7.46 | IC50 | 35 | nM | CHEMBL_ACT_24954200 |
| IGF1R | 7.46 | IC50 | 35 | nM | CHEMBL_ACT_24974948 |
| IGF1R | 7.46 | IC50 | 35 | nM | CHEMBL_ACT_25036517 |
| IGF1R | 7.46 | IC50 | 35 | nM | CHEMBL_ACT_26240421 |
| IGF1R | 7.46 | IC50 | 35 | nM | CHEMBL_ACT_29186998 |
| IGF1R | 7.41 | IC50 | 39 | nM | CHEMBL_ACT_26240565 |
| MAP4K2 | 7.17 | Kd | 67 | nM | CHEMBL_ACT_17913673 |
| INSR | 7.12 | IC50 | 75 | nM | CHEMBL_ACT_24954201 |
| INSRR | 7.12 | IC50 | 75 | nM | CHEMBL_ACT_24954202 |
| INSR | 7.12 | IC50 | 75 | nM | CHEMBL_ACT_24974949 |
Target pathways
Aggregated over 3 target gene(s): INSR, IGF1R, INSRR.
Top Reactome pathways
16 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| PIP3 activates AKT signaling | 1 | INSR |
| Signal Transduction | 1 | INSR |
| Negative regulation of the PI3K/AKT network | 1 | INSR |
| Signaling by Type 1 Insulin-like Growth Factor 1 Receptor (IGF1R) | 1 | IGF1R |
| IRS-related events triggered by IGF1R | 1 | IGF1R |
| SHC-related events triggered by IGF1R | 1 | IGF1R |
| PI5P, PP2A and IER3 Regulate PI3K/AKT Signaling | 1 | INSR |
| IRS activation | 1 | INSR |
| Signal attenuation | 1 | INSR |
| Insulin receptor signalling cascade | 1 | INSR |
| Signaling by Insulin receptor | 1 | INSR |
| Insulin receptor recycling | 1 | INSR |
| Intracellular signaling by second messengers | 1 | INSR |
| Signaling by Receptor Tyrosine Kinases | 1 | INSR |
| Extra-nuclear estrogen signaling | 1 | IGF1R |
| Respiratory syncytial virus (RSV) attachment and entry | 1 | IGF1R |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| insulin receptor signaling pathway | 3 |
| protein autophosphorylation | 3 |
| protein phosphorylation | 3 |
| cell surface receptor protein tyrosine kinase signaling pathway | 3 |
| positive regulation of cell population proliferation | 2 |
| male sex determination | 2 |
| positive regulation of cell migration | 2 |
| positive regulation of protein-containing complex disassembly | 2 |
| positive regulation of MAPK cascade | 2 |
| positive regulation of phosphatidylinositol 3-kinase/protein kinase B signal transduction | 2 |
| dendritic spine maintenance | 2 |
| amyloid-beta clearance | 2 |
| positive regulation of receptor internalization | 1 |
| heart morphogenesis | 1 |
| regulation of DNA-templated transcription | 1 |
Indications & clinical
Indications
15 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| adrenal cortex carcinoma | 3 | MONDO:0006639 | EFO:1000796 |
| neoplasm | 2 | MONDO:0005070 | EFO:0000616 |
| small cell lung carcinoma | 2 | MONDO:0008433 | EFO:0000702 |
| hepatocellular carcinoma | 2 | MONDO:0007256 | EFO:0000182 |
| prostate adenocarcinoma | 2 | MONDO:0005082 | EFO:0000673 |
| Ewing sarcoma | 2 | MONDO:0012817 | EFO:0000174 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| head and neck cancer | 2 | MONDO:0005627 | EFO:0006859 |
| breast neoplasm | 2 | MONDO:0021100 | MONDO:0007254 |
| head and neck squamous cell carcinoma | 1 | MONDO:0010150 | EFO:0000181 |
| ovarian cancer | 1 | MONDO:0008170 | MONDO:0008170 |
| skin neoplasm | 1 | MONDO:0002531 | MONDO:0002898 |
| squamous cell carcinoma | 1 | MONDO:0005096 | EFO:0000707 |
| colorectal neoplasm | 1 | MONDO:0005335 | MONDO:0005575 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 24.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 11 |
| PHASE1 | 7 |
| PHASE1/PHASE2 | 3 |
| PHASE2/PHASE3 | 2 |
| PHASE3 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT05276063 | PHASE2/PHASE3 | ACTIVE_NOT_RECRUITING | A Phase 2b, Study of Linsitinib in Subjects With Active, Moderate to Severe Thyroid Eye Disease (TED) |
| NCT06112340 | PHASE2/PHASE3 | RECRUITING | Extension Study of Two Doses of Linsitinib in Subjects With Active, Moderate to Severe Thyroid Eye Disease (TED) |
| NCT00924989 | PHASE3 | COMPLETED | A Study of OSI-906 in Patients With Locally Advanced or Metastatic Adrenocortical Carcinoma |
| NCT00889382 | PHASE1/PHASE2 | COMPLETED | A Study Evaluating Intermittent and Continuous OSI-906 and Weekly Paclitaxel in Patients With Recurrent Epithelial Ovarian Cancer (and Other Solid Tumors) |
| NCT01101906 | PHASE2 | TERMINATED | A Randomized, Placebo-controlled, Double-blind Phase 2 Study With OSI-906 in Patients With Advanced HCC |
| NCT01186861 | PHASE2 | COMPLETED | Phase 2 Study of Maintenance OSI-906 Plus Erlotinib (Tarceva®), or Placebo Plus Erlotinib in Patients With Nonprogression Following 4 Cycles of Platinum-based Chemotherapy |
| NCT01205685 | PHASE2 | TERMINATED | Endocrine Therapy + OSI-906 With or Without Erlotinib for Hormone-Sensitive Metastatic Breast Cancer |
| NCT01221077 | PHASE2 | COMPLETED | Study of Erlotinib (Tarceva®) in Combination With OSI-906 in Patients With Advanced Non-small Cell Lung Cancer (NSCLC) With Activating Mutations of the Epidermal Growth Factor Receptor (EGFR) Gene |
| NCT01334710 | PHASE2 | TERMINATED | A Phase II Trial of OSI-906 and Sorafenib in Advanced Hepatocellular Cancer |
| NCT01427205 | PHASE2 | WITHDRAWN | Phase II Study of Cetuximab With or Without OSI-906 in Head and Neck Squamous Cell Carcinoma (HNSCC) |
| NCT01465815 | PHASE1/PHASE2 | WITHDRAWN | Phase I/II Study of Postoperative Adjuvant Chemoradiation for Advanced-Stage Cutaneous Squamous Cell Carcinoma of the Head and Neck (cSCCHN) |
| NCT01533181 | PHASE2 | COMPLETED | Linsitinib or Topotecan Hydrochloride in Treating Patients With Relapsed Small Cell Lung Cancer |
| NCT01533246 | PHASE2 | COMPLETED | Linsitinib in Treating Patients With Asymptomatic or Mildly Symptomatic Metastatic Prostate Cancer |
| NCT01560260 | PHASE2 | COMPLETED | Linsitinib in Treating Patients With Gastrointestinal Stromal Tumors |
| NCT01600807 | PHASE1/PHASE2 | WITHDRAWN | OSI-906 With Gemcitabine and Erlotinib for Metastatic Ductal Adenocarcinoma of the Pancreas |
| NCT02057380 | PHASE2 | COMPLETED | A Rollover Study for Subjects That Have Participated in an Astellas Sponsored Linsitinib Trial |
| NCT02546544 | PHASE2 | COMPLETED | Eurosarc Trial of Linsitinib in Advanced Ewing Sarcoma |
| NCT00514007 | PHASE1 | COMPLETED | Study of Continuous OSI-906 Dosing |
| NCT00514306 | PHASE1 | COMPLETED | Study of Intermittent OSI-906 Dosing |
| NCT00739453 | PHASE1 | COMPLETED | A Phase 1 Dose-escalation Study of OSI-906 and Erlotinib (Tarceva®) |
| NCT01016860 | PHASE1 | TERMINATED | OSI-906 and Irinotecan in Patients With Advanced Cancer |
| NCT01154335 | PHASE1 | COMPLETED | Everolimus and OSI-906 for Patients With Refractory Metastatic Colorectal Cancer |
| NCT01529684 | PHASE1 | COMPLETED | A Study to Look at How a Single Oral Dose of 14C-OSI-906 is Absorbed, Broken Down and Eliminated in the Body |
| NCT01567384 | PHASE1 | WITHDRAWN | A Phase I Study of OSI-906 in Combination With Pemetrexed in Advanced Solid Tumor Malignancies |
Clinical evidence (CIViC)
Variant × indication × effect (8 predictive associations from 8 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| MYB::NFIB Fusion | DOID:0080202 | Sensitivity/Response | Gefitinib + Crizotinib + Linsitinib | CIViC B | EID12167 |
| CDKN2A Loss | Ewing Sarcoma | Sensitivity/Response | Linsitinib + Palbociclib | CIViC D | EID1879 |
| CDKN2B Loss | Ewing Sarcoma | Sensitivity/Response | Palbociclib + Linsitinib | CIViC D | EID1880 |
| IGF1R Overexpression | Salivary Gland Adenoid Cystic Carcinoma | Sensitivity/Response | Crizotinib + Gefitinib + Linsitinib | CIViC D | EID9024 |
| IGF2 Overexpression | Prostate Cancer | Sensitivity/Response | Cabazitaxel + Linsitinib | CIViC D | EID12428 |
| IGF2 Overexpression | Prostate Cancer | Sensitivity/Response | Linsitinib | CIViC D | EID412 |
| IGF2 Overexpression | Prostate Cancer | Sensitivity/Response | Docetaxel + Cabazitaxel + Linsitinib | CIViC D | EID414 |
| MYB::NFIB Fusion | DOID:0080202 | Sensitivity/Response | Linsitinib | CIViC D | EID12164 |
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
52 molecules share ≥1 primary target. Top 52 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| BRIGATINIB | ChEMBL + PubChem | Phase 4 (approved) | IGF1R, INSR, INSRR |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | IGF1R, INSR, INSRR |
| FEDRATINIB | ChEMBL + PubChem | Phase 4 (approved) | IGF1R, INSR, INSRR |
| Pazopanib | ChEMBL + PubChem | Phase 4 (approved) | IGF1R, INSR, INSRR |
| SUNITINIB | ChEMBL + PubChem | Phase 4 (approved) | IGF1R, INSR, INSRR |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | IGF1R, INSR, INSRR |
| LESTAURTINIB | ChEMBL | Phase 3 | IGF1R, INSR, INSRR |
| BMS-754807 | ChEMBL | Phase 2 | IGF1R, INSR, INSRR |
| FORETINIB | ChEMBL | Phase 2 | IGF1R, INSR, INSRR |
| R-406 | ChEMBL | Phase 2 | IGF1R, INSR, INSRR |
| TOZASERTIB | ChEMBL | Phase 2 | IGF1R, INSR, INSRR |
| Afatinib | PubChem | Approved | IGF1R, INSR, INSRR |
| Gefitinib | PubChem | Approved | IGF1R, INSR, INSRR |
| Idelalisib | PubChem | Approved | IGF1R, INSR, INSRR |
| Selumetinib | PubChem | Approved | IGF1R, INSR, INSRR |
| LAPATINIB | ChEMBL + PubChem | Phase 4 (approved) | INSR, INSRR |
| NERATINIB | ChEMBL + PubChem | Phase 4 (approved) | INSR, INSRR |
| SORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | INSR, INSRR |
| CERITINIB | ChEMBL | Phase 4 (approved) | IGF1R, INSR |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | IGF1R, INSR |
| LINIFANIB | ChEMBL | Phase 3 | INSR, INSRR |
| CENISERTIB | ChEMBL | Phase 2 | IGF1R, INSR |
| ELLAGIC ACID | ChEMBL | Phase 2 | IGF1R, INSR |
| ILORASERTIB | ChEMBL | Phase 2 | IGF1R, INSR |
| SU-014813 | ChEMBL | Phase 2 | INSR, INSRR |
| belumosudil | PubChem | Approved | IGF1R, INSR |
| Binimetinib | PubChem | Approved | IGF1R, INSR |
| dacomitinib | PubChem | Approved | IGF1R, INSR |
| Fostamatinib | PubChem | Approved | IGF1R, INSR |
| regorafenib | PubChem | Approved | IGF1R, INSR |
| Trametinib | PubChem | Approved | IGF1R, INSR |
| INFIGRATINIB | ChEMBL | Phase 4 (approved) | INSR |
| OSIMERTINIB | ChEMBL | Phase 4 (approved) | INSR |
| DOVITINIB | ChEMBL | Phase 3 | INSR |
| QUERCETIN | ChEMBL | Phase 3 | IGF1R |
| OSI-632 | ChEMBL | Phase 2 | INSR |
| Abemaciclib | PubChem | Approved | INSRR |
| Acalabrutinib | PubChem | Approved | INSRR |
| Axitinib | PubChem | Approved | INSRR |
| Belzutifan | PubChem | Approved | INSR |
| Bosutinib | PubChem | Approved | INSRR |
| Duvelisib | PubChem | Approved | INSRR |
| Erlotinib | PubChem | Approved | INSRR |
| Imatinib | PubChem | Approved | INSRR |
| Midostaurin | PubChem | Approved | INSRR |
| Nilotinib | PubChem | Approved | INSRR |
| Quizartinib | PubChem | Approved | INSRR |
| Ruxolitinib | PubChem | Approved | INSRR |
| Sirolimus | PubChem | Approved | INSRR |
| Tivozanib | PubChem | Approved | INSRR |
| Tofacitinib | PubChem | Approved | INSRR |
| Vandetanib | PubChem | Approved | INSRR |
Related Atlas pages
- Genes: INSR, IGF1R, INSRR
- Diseases: adrenal cortex carcinoma, Ewing sarcoma, salivary gland adenoid cystic carcinoma, prostate carcinoma
- Drugs: Brigatinib, Crizotinib, Fedratinib, Pazopanib, Sunitinib, Nintedanib, Lestaurtinib, Afatinib, Gefitinib, Idelalisib, Selumetinib, Lapatinib, Neratinib, Sorafenib, Ceritinib, Entrectinib, Linifanib, belumosudil, Binimetinib, dacomitinib, Fostamatinib, regorafenib, Trametinib, Infigratinib, Osimertinib, Dovitinib, Quercetin, Abemaciclib, Acalabrutinib, Axitinib, Belzutifan, Bosutinib, Duvelisib, Erlotinib, Imatinib, Midostaurin, Nilotinib, Quizartinib, Ruxolitinib, Sirolimus, Tivozanib, Tofacitinib, Vandetanib
- Biomarker genes: IGF2