Lixivaptan
drugOn this page
Also known as CRTX 080CRTX-080CRTX080LixarVPA 985Vpa-985VPA985WAY-VPA-985LixivaptanÊLixivaptanÂ
Summary
Lixivaptan (CHEMBL49429) is a phase-3 clinical-stage small molecule targeting AVPR2; indicated across 4 conditions including autosomal dominant polycystic kidney disease and polycystic kidney disease.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 1 (AVPR2)
- Indications: 4 conditions
- Clinical trials: 11
- Chemistry: 473.9 Da · C27H21ClFN3O2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL49429 |
| Name | Lixivaptan |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 172997 |
| Molecular formula | C27H21ClFN3O2 |
| Molecular weight | 473.9 |
| InChIKey | PPHTXRNHTVLQED-UHFFFAOYSA-N |
SMILES: CC1=C(C=C(C=C1)F)C(=O)NC2=CC(=C(C=C2)C(=O)N3CC4=CC=CN4CC5=CC=CC=C53)Cl
IUPAC name: N-[3-chloro-4-(6,11-dihydropyrrolo[2,1-c][1,4]benzodiazepine-5-carbonyl)phenyl]-5-fluoro-2-methylbenzamide
Also known as: CRTX 080, CRTX-080, CRTX080, Lixivaptan, Lixar, VPA 985, Vpa-985, VPA-985, VPA985, WAY-VPA-985, LIXIVAPTAN, LixivaptanÊ
Parent form; salt/anhydrous children: CHEMBL3526685
Patent coverage: 131 distinct patent families (319 SureChEMBL compound mentions), from 4 matched compound structure(s). One matched structure accounts for 250 (78%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| AVPR2 | V2 receptor | Inverse agonist | 9.2 | 0% | P30518 |
Broader ChEMBL bioactivity targets: 5 (assay-derived). Sample: Vasopressin V2 receptor, Vasopressin V1a receptor, Oxytocin receptor, Vasopressin V1a receptor, Vasopressin V2 receptor.
Bioactivity
ChEMBL activities: 33 potent at pChembl ≥ 5 of 33 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| Q00788 | 9.3 | IC50 | 0.5 | nM | CHEMBL_ACT_717014 |
| AVPR2 | 9 | IC50 | 1 | nM | CHEMBL_ACT_1616620 |
| AVPR2 | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_1177370 |
| AVPR2 | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_1238159 |
| AVPR2 | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_1988043 |
| AVPR2 | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_217966 |
| AVPR2 | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_685575 |
| Q00788 | 8.64 | IC50 | 2.3 | nM | CHEMBL_ACT_1086495 |
| AVPR2 | 8.64 | Ki | 2.3 | nM | CHEMBL_ACT_1179496 |
| Q00788 | 8.64 | IC50 | 2.3 | nM | CHEMBL_ACT_1238161 |
| Q00788 | 8.64 | IC50 | 2.3 | nM | CHEMBL_ACT_217965 |
| AVPR2 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_2052383 |
| AVPR2 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_336919 |
| AVPR2 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_783600 |
| AVPR2 | 7.64 | Ki | 23 | nM | CHEMBL_ACT_1179498 |
| AVPR1A | 7.36 | Ki | 44 | nM | CHEMBL_ACT_1179495 |
| P30560 | 7.09 | IC50 | 82 | nM | CHEMBL_ACT_717013 |
| AVPR2 | 7.05 | Ki | 90 | nM | CHEMBL_ACT_336921 |
| AVPR2 | 7.04 | IC50 | 91 | nM | CHEMBL_ACT_2052418 |
| AVPR2 | 7.04 | IC50 | 91 | nM | CHEMBL_ACT_783601 |
| AVPR1A | 6.91 | IC50 | 124 | nM | CHEMBL_ACT_1988054 |
| AVPR1A | 6.82 | IC50 | 150 | nM | CHEMBL_ACT_2052352 |
| AVPR1A | 6.82 | IC50 | 150 | nM | CHEMBL_ACT_336920 |
| AVPR1A | 6.82 | IC50 | 150 | nM | CHEMBL_ACT_783599 |
| AVPR1A | 6.75 | IC50 | 180 | nM | CHEMBL_ACT_1616619 |
| AVPR1A | 6.64 | IC50 | 230 | nM | CHEMBL_ACT_1177369 |
| AVPR1A | 6.64 | IC50 | 230 | nM | CHEMBL_ACT_1238158 |
| AVPR1A | 6.64 | IC50 | 230 | nM | CHEMBL_ACT_217964 |
| P30560 | 6.47 | IC50 | 340 | nM | CHEMBL_ACT_1238160 |
| P30560 | 6.47 | IC50 | 340 | nM | CHEMBL_ACT_217963 |
Target pathways
Aggregated over 1 target gene(s): AVPR2.
Top Reactome pathways
6 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Vasopressin-like receptors | 1 | AVPR2 |
| G alpha (s) signalling events | 1 | AVPR2 |
| Vasopressin regulates renal water homeostasis via Aquaporins | 1 | AVPR2 |
| Cargo recognition for clathrin-mediated endocytosis | 1 | AVPR2 |
| Clathrin-mediated endocytosis | 1 | AVPR2 |
| Defective AVP does not bind AVPR2 and causes neurohypophyseal diabetes insipidus (NDI) | 1 | AVPR2 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of systemic arterial blood pressure by vasopressin | 1 |
| positive regulation of systemic arterial blood pressure | 1 |
| renal water retention | 1 |
| G protein-coupled receptor signaling pathway | 1 |
| adenylate cyclase-modulating G protein-coupled receptor signaling pathway | 1 |
| adenylate cyclase-activating G protein-coupled receptor signaling pathway | 1 |
| activation of adenylate cyclase activity | 1 |
| hemostasis | 1 |
| positive regulation of cell population proliferation | 1 |
| negative regulation of cell population proliferation | 1 |
| positive regulation of gene expression | 1 |
| telencephalon development | 1 |
| cellular response to hormone stimulus | 1 |
| response to cytokine | 1 |
| positive regulation of vasoconstriction | 1 |
Indications & clinical
Indications
4 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| autosomal dominant polycystic kidney disease | 3 | MONDO:0004691 | EFO:1001496 |
| polycystic kidney disease | 3 | MONDO:0020642 | EFO:0008620 |
| congestive heart failure | 2 | MONDO:0005009 | EFO:0000373 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 11.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 7 |
| PHASE2 | 2 |
| PHASE1 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00578695 | PHASE3 | COMPLETED | THE BALANCE Study: Treatment of Hyponatremia Based on Lixivaptan in NYHA Class III/IV Cardiac Patient Evaluation |
| NCT00660959 | PHASE3 | COMPLETED | Multicenter, Randomized, Double-blind, Placebo-controlled Study to Evaluate the Efficacy and Safety of Oral Lixivaptan Capsules in Subject With Euvolemic Hyponatremia |
| NCT00876798 | PHASE3 | COMPLETED | A Multicenter, Randomized, Double-blind, Placebo-controlled Study to Evaluate the Safety and Tolerability of Oral Lixivaptan Capsules in Subjects With Euvolemic Hyponatremia |
| NCT00876876 | PHASE3 | WITHDRAWN | International, Multicenter, Open-Label and Randomized Withdrawal Study of Oral Lixivaptan in Heart Failure Patients With Chronic Hyponatremia |
| NCT04064346 | PHASE3 | TERMINATED | Efficacy and Safety of Lixivaptan in the Treatment of Autosomal Dominant Polycystic Kidney Disease |
| NCT04152837 | PHASE3 | TERMINATED | Safety of Lixivaptan in Subjects Previously Treated With Tolvaptan for Autosomal Dominant Polycystic Kidney Disease |
| NCT05208866 | PHASE3 | TERMINATED | Roll-over Study to Assess Safety of Lixivaptan in Participants With ADPKD Who Completed Study PA-ADPKD-303 |
| NCT01055912 | PHASE2 | COMPLETED | Study to Evaluate the Effects of Oral Administration of Lixivaptan in Patients With Congestive Heart Failure |
| NCT03487913 | PHASE2 | COMPLETED | The ELiSA Study - Evaluation of Lixivaptan in Subjects With Autosomal Dominant Polycystic Kidney Disease |
| NCT00675701 | PHASE1 | COMPLETED | A Study to Define the ECG Effects of Lixivaptan Compared to Placebo and Moxifloxacin in Healthy Adult Men and Women: A Thorough ECG Study |
| NCT03717181 | Not specified | NO_LONGER_AVAILABLE | Lixivaptan in a Single Subject With Intractable Pain Due to Polycystic Kidney Disease |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
120 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CINACALCET | ChEMBL + PubChem | Phase 4 (approved) | AVPR2 |
| PIMOZIDE | ChEMBL + PubChem | Phase 4 (approved) | AVPR2 |
| RIFAMPIN | ChEMBL + PubChem | Phase 4 (approved) | AVPR2 |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | AVPR2 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | AVPR2 |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | AVPR2 |
| ATOSIBAN | ChEMBL | Phase 4 (approved) | AVPR2 |
| BALSALAZIDE | ChEMBL | Phase 4 (approved) | AVPR2 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | AVPR2 |
| CARBETOCIN | ChEMBL | Phase 4 (approved) | AVPR2 |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | AVPR2 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | AVPR2 |
| CONIVAPTAN | ChEMBL | Phase 4 (approved) | AVPR2 |
| DESMOPRESSIN | ChEMBL | Phase 4 (approved) | AVPR2 |
| FLUSPIRILENE | ChEMBL | Phase 4 (approved) | AVPR2 |
| IDEBENONE | ChEMBL | Phase 4 (approved) | AVPR2 |
| IPRINDOLE | ChEMBL | Phase 4 (approved) | AVPR2 |
| ITRACONAZOLE | ChEMBL | Phase 4 (approved) | AVPR2 |
| LASOFOXIFENE | ChEMBL | Phase 4 (approved) | AVPR2 |
| MEFLOQUINE | ChEMBL | Phase 4 (approved) | AVPR2 |
| MOZAVAPTAN | ChEMBL | Phase 4 (approved) | AVPR2 |
| NEBIVOLOL | ChEMBL | Phase 4 (approved) | AVPR2 |
| NERATINIB | ChEMBL | Phase 4 (approved) | AVPR2 |
| NIMESULIDE | ChEMBL | Phase 4 (approved) | AVPR2 |
| NITAZOXANIDE | ChEMBL | Phase 4 (approved) | AVPR2 |
| OXYTOCIN | ChEMBL | Phase 4 (approved) | AVPR2 |
| PYRVINIUM | ChEMBL | Phase 4 (approved) | AVPR2 |
| RIFAXIMIN | ChEMBL | Phase 4 (approved) | AVPR2 |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | AVPR2 |
| SERTRALINE | ChEMBL | Phase 4 (approved) | AVPR2 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | AVPR2 |
| TERFENADINE | ChEMBL | Phase 4 (approved) | AVPR2 |
| THIOTHIXENE | ChEMBL | Phase 4 (approved) | AVPR2 |
| TOLVAPTAN | ChEMBL | Phase 4 (approved) | AVPR2 |
| TRIFLUOPERAZINE | ChEMBL | Phase 4 (approved) | AVPR2 |
| VASOPRESSIN | ChEMBL | Phase 4 (approved) | AVPR2 |
| BALOVAPTAN | ChEMBL | Phase 3 | AVPR2 |
| OTILONIUM BROMIDE | ChEMBL | Phase 3 | AVPR2 |
| PYRONARIDINE | ChEMBL | Phase 3 | AVPR2 |
| QUERCETIN | ChEMBL | Phase 3 | AVPR2 |
| RETOSIBAN | ChEMBL | Phase 3 | AVPR2 |
| BENZETHONIUM | ChEMBL | Phase 2 | AVPR2 |
| DOMIPHEN | ChEMBL | Phase 2 | AVPR2 |
| EPELSIBAN | ChEMBL | Phase 2 | AVPR2 |
| FEDOVAPAGON | ChEMBL | Phase 2 | AVPR2 |
| NELIVAPTAN | ChEMBL | Phase 2 | AVPR2 |
| ORNIPRESSIN | ChEMBL | Phase 2 | AVPR2 |
| PECAVAPTAN | ChEMBL | Phase 2 | AVPR2 |
| RELCOVAPTAN | ChEMBL | Phase 2 | AVPR2 |
| SELEPRESSIN | ChEMBL | Phase 2 | AVPR2 |
| Abiraterone | PubChem | Approved | AVPR2 |
| Acetylcholine | PubChem | Approved | AVPR2 |
| acetylcysteine | PubChem | Approved | AVPR2 |
| Aclidinium Bromide | PubChem | Approved | AVPR2 |
| Acyclovir | PubChem | Approved | AVPR2 |
| Adenine | PubChem | Approved | AVPR2 |
| Afatinib | PubChem | Approved | AVPR2 |
| Allopurinol | PubChem | Approved | AVPR2 |
| Almotriptan | PubChem | Approved | AVPR2 |
| Alogliptin | PubChem | Approved | AVPR2 |
Related Atlas pages
- Genes: AVPR2
- Diseases: autosomal dominant polycystic kidney disease, polycystic kidney disease
- Drugs: Cinacalcet, Pimozide, Rifampin, Tegaserod, Amiodarone, Amoxapine, Atosiban, Balsalazide, Bosutinib, Carbetocin, Chlorhexidine, Clotrimazole, Conivaptan, Desmopressin, Fluspirilene, Idebenone, Iprindole, Itraconazole, Lasofoxifene, Mefloquine, Mozavaptan, Nebivolol, Neratinib, Nimesulide, Nitazoxanide, Oxytocin, Pyrvinium, Rifaximin, Sertindole, Sertraline, Sunitinib, Terfenadine, Thiothixene, Tolvaptan, Trifluoperazine, Vasopressin, Balovaptan, Otilonium Bromide, Pyronaridine, Quercetin, Retosiban, Abiraterone, Acetylcholine, acetylcysteine, Aclidinium Bromide, Acyclovir, Afatinib, Allopurinol, Almotriptan, Alogliptin