Lofexidine
drugOn this page
Also known as LofexidinaSID170466275
Summary
Lofexidine (CHEMBL17860) is an approved small-molecule α-adrenergic agonist (ATC N07BC04) targeting ADRA2A, ADRA2B, and ADRA2C; indicated across 7 conditions including drug dependence and opiate dependence.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N07BC04
- Targets: 3 (ADRA2A, ADRA2B, ADRA2C)
- Indications: 7 conditions
- Clinical trials: 25
- Chemistry: 259.13 Da · C11H12Cl2N2O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL17860 |
| Name | Lofexidine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 30668 |
| ChEBI | CHEBI:51368 |
| ATC | N07BC04 |
| Molecular formula | C11H12Cl2N2O |
| Molecular weight | 259.13 |
| InChIKey | KSMAGQUYOIHWFS-UHFFFAOYSA-N |
SMILES: CC(C1=NCCN1)OC2=C(C=CC=C2Cl)Cl
IUPAC name: 2-[1-(2,6-dichlorophenoxy)ethyl]-4,5-dihydro-1H-imidazole
Pharmacological roles (ChEBI): α-adrenergic agonist, antihypertensive agent.
Also known as: Lofexidina, Lofexidine, lofexidine, SID170466275, LOFEXIDINE
Parent form; salt/anhydrous children: CHEMBL1788132
Patent coverage: 1,038 distinct patent families (3,777 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| ADRA2A | α2A-adrenoceptor | Agonist | 8.36 | 0.1% | P08913 |
| ADRA2B | α2B-adrenoceptor | Agonist | 7.17 | 0.2% | P18089 |
| ADRA2C | α2C-adrenoceptor | Agonist | 7.16 | 0% | P18825 |
Broader ChEMBL bioactivity targets: 11 (assay-derived). Sample: Alpha-2A adrenergic receptor, Adrenergic receptor alpha-1, Alpha-2C adrenergic receptor, Alpha-2B adrenergic receptor, Adrenergic receptor alpha-2, 5-hydroxytryptamine receptor 1A, Sodium-dependent serotonin transporter, Alpha-1A adrenergic receptor, Kappa-type opioid receptor, Voltage-gated inwardly rectifying potassium channel KCNH2.
Bioactivity
ChEMBL activities: 19 potent at pChembl ≥ 5 of 21 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ADRA2C | 8.86 | EC50 | 1.38 | nM | CHEMBL_ACT_8056358 |
| P19328 | 8.6 | IC50 | 2.5 | nM | CHEMBL_ACT_178923 |
| ADRA2A | 8.36 | Ki | 4.37 | nM | CHEMBL_ACT_8056273 |
| Q4G017 | 8.25 | Ki | 5.62 | nM | CHEMBL_ACT_16610442 |
| ADRA2A | 8.2 | EC50 | 6.31 | nM | CHEMBL_ACT_8056257 |
| ADRA1A | 8.15 | AC50 | 7.1 | nM | CHEMBL_ACT_25229549 |
| ADRA2A | 7.8 | AC50 | 16 | nM | CHEMBL_ACT_25220760 |
| ADRA2B | 7.17 | Ki | 67.61 | nM | CHEMBL_ACT_8056293 |
| ADRA2C | 7.16 | Ki | 69.18 | nM | CHEMBL_ACT_8056313 |
| HTR1A | 6.9 | Ki | 125.9 | nM | CHEMBL_ACT_11009777 |
| ADRA2B | 6.9 | EC50 | 125.9 | nM | CHEMBL_ACT_8056338 |
| ADRA2A | 6.89 | AC50 | 130 | nM | CHEMBL_ACT_25155848 |
| HTR1A | 6.54 | AC50 | 290 | nM | CHEMBL_ACT_25164399 |
| ADRA2C | 6.38 | AC50 | 420 | nM | CHEMBL_ACT_25147534 |
| P15823 | 6.18 | IC50 | 660 | nM | CHEMBL_ACT_178922 |
| ADRA2B | 6.13 | AC50 | 740 | nM | CHEMBL_ACT_25143369 |
| ADRA1A | 6.09 | AC50 | 803.5 | nM | CHEMBL_ACT_25137731 |
| HTR1A | 5.96 | AC50 | 1100 | nM | CHEMBL_ACT_25216695 |
| KCNH2 | 5.05 | AC50 | 8860 | nM | CHEMBL_ACT_25117354 |
Target pathways
Aggregated over 3 target gene(s): ADRA2A, ADRA2B, ADRA2C.
Top Reactome pathways
19 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Hemostasis | 3 | ADRA2A, ADRA2B, ADRA2C |
| Signal Transduction | 3 | ADRA2A, ADRA2B, ADRA2C |
| Signaling by GPCR | 3 | ADRA2A, ADRA2B, ADRA2C |
| Class A/1 (Rhodopsin-like receptors) | 3 | ADRA2A, ADRA2B, ADRA2C |
| Amine ligand-binding receptors | 3 | ADRA2A, ADRA2B, ADRA2C |
| GPCR downstream signalling | 3 | ADRA2A, ADRA2B, ADRA2C |
| Adrenoceptors | 3 | ADRA2A, ADRA2B, ADRA2C |
| Adrenaline signalling through Alpha-2 adrenergic receptor | 3 | ADRA2A, ADRA2B, ADRA2C |
| G alpha (i) signalling events | 3 | ADRA2A, ADRA2B, ADRA2C |
| G alpha (z) signalling events | 3 | ADRA2A, ADRA2B, ADRA2C |
| GPCR ligand binding | 3 | ADRA2A, ADRA2B, ADRA2C |
| Platelet activation, signaling and aggregation | 3 | ADRA2A, ADRA2B, ADRA2C |
| Platelet Aggregation (Plug Formation) | 3 | ADRA2A, ADRA2B, ADRA2C |
| Metabolism | 2 | ADRA2A, ADRA2C |
| Integration of energy metabolism | 2 | ADRA2A, ADRA2C |
| Metabolism of proteins | 2 | ADRA2A, ADRA2C |
| Adrenaline,noradrenaline inhibits insulin secretion | 2 | ADRA2A, ADRA2C |
| Regulation of insulin secretion | 2 | ADRA2A, ADRA2C |
| Surfactant metabolism | 2 | ADRA2A, ADRA2C |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| epidermal growth factor receptor signaling pathway | 3 |
| G protein-coupled receptor signaling pathway | 3 |
| negative regulation of norepinephrine secretion | 3 |
| regulation of vasoconstriction | 3 |
| platelet activation | 3 |
| negative regulation of epinephrine secretion | 3 |
| positive regulation of MAPK cascade | 3 |
| positive regulation of phosphatidylinositol 3-kinase/protein kinase B signal transduction | 3 |
| adrenergic receptor signaling pathway | 3 |
| adenylate cyclase-inhibiting adrenergic receptor signaling pathway | 3 |
| regulation of smooth muscle contraction | 3 |
| signal transduction | 3 |
| adenylate cyclase-inhibiting G protein-coupled receptor signaling pathway | 2 |
| female pregnancy | 2 |
| negative regulation of insulin secretion | 2 |
Indications & clinical
Indications
7 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| drug dependence | 4 | MONDO:0005303 | EFO:0003890 |
| opiate dependence | 3 | MONDO:0005530 | EFO:0005611 |
| cannabis dependence | 2 | MONDO:0005689 | EFO:0007191 |
| cocaine dependence | 1 | MONDO:0005186 | EFO:0002610 |
| heroin dependence | 1 | MONDO:0005367 | EFO:0004240 |
| liver failure | 1 | MONDO:0100192 | MONDO:0100192 |
1 further indication record had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 25.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 8 |
| PHASE1 | 8 |
| PHASE4 | 3 |
| PHASE3 | 3 |
| PHASE2/PHASE3 | 2 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01675648 | PHASE4 | COMPLETED | Lofexidine for Inpatient Opiate Detox in Singapore |
| NCT04126083 | PHASE4 | COMPLETED | Lofexidine for Adults Undergoing Lumbar Spine Surgery |
| NCT05569031 | PHASE4 | COMPLETED | Treatment of Withdrawal Symptoms and Prevention of Relapse in Patients With Tramadol Abuse |
| NCT00032942 | PHASE3 | COMPLETED | Lofexidine for Opiate Withdrawal - 1 |
| NCT00235729 | PHASE3 | COMPLETED | Lofexidine for Inpatient Opiate Detox |
| NCT01020019 | PHASE2/PHASE3 | COMPLETED | Combined Pharmacotherapy for Cannabis Dependency |
| NCT02363998 | PHASE3 | COMPLETED | Open-Label, Safety Study of Lofexidine |
| NCT04325659 | PHASE2/PHASE3 | COMPLETED | An Innovative Intervention for OUD Treatment |
| NCT05027919 | PHASE2 | RECRUITING | Assessing a Clinically-meaningful Opioid Withdrawal Phenotype |
| NCT05511909 | PHASE2 | RECRUITING | Evaluating Buspirone to Treat Opioid Withdrawal |
| NCT00142909 | PHASE2 | COMPLETED | Effectiveness of Lofexidine to Prevent Stress-Related Opiate Relapse During Naltrexone Treatment - 1 |
| NCT00373503 | PHASE2 | COMPLETED | Effect of Lofexidine and Oral THC on Marijuana Withdrawal and Relapse |
| NCT03718065 | PHASE2 | COMPLETED | Impact of Lofexidine on Stress, Craving and Opioid Use |
| NCT04056182 | PHASE2 | COMPLETED | Lofexidine for Management of Opioid Withdrawal With XR-NTX Treatment |
| NCT04070157 | PHASE2 | TERMINATED | Randomized, Double-Blind, Placebo-Controlled Pilot Study on the Safety and Effectiveness of LUCEMYRA During an Opioid Taper in Treatment of Withdrawal |
| NCT04360681 | PHASE2 | COMPLETED | Lofexidine Combined With Buprenorphine for Reducing Symptoms of PTSD and OU Relapse in Veterans |
| NCT00000345 | PHASE1 | COMPLETED | Evaluation of Lofexidine for Treatment of Opiate Withdrawal - 10 |
| NCT00000354 | PHASE1 | COMPLETED | Evaluation of Lofexidine for Treatment of Opioid Withdrawal - 3 |
| NCT00000358 | PHASE1 | COMPLETED | Evaluation of Lofexidine for Treatment of Opioid Withdrawal - 7 |
| NCT00218530 | PHASE1 | COMPLETED | Effectiveness of Naltrexone and Lofexidine in Treating Detoxified Heroin Addicts - 1 |
| NCT01148992 | PHASE1 | TERMINATED | Interactions Between Intravenous (IV) Cocaine and Lofexidine |
| NCT02318836 | PHASE1 | COMPLETED | Single-Dose Pharmacokinetics and Safety of Oral Lofexidine in Hepatically-Impaired Subjects |
| NCT02446002 | PHASE1 | COMPLETED | Assessment of the Effect of Naltrexone on Lofexidine Single Dose Pharmacokinetics in Healthy Subjects |
| NCT02681198 | PHASE1 | COMPLETED | Lofexidine Pharmacokinetics in the Presence of Paroxetine in Healthy Volunteers |
| NCT05053503 | Not specified | COMPLETED | Delivering Transcutaneous Auricular Neurostimulation to Improve Relapse Prevention in Opioid Use Disorder |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
607 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ACLIDINIUM BROMIDE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| Afatinib | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| Almotriptan | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHENODIOL | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| GENTIAN VIOLET | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| NAPHAZOLINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| OLODATEROL | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| PALIPERIDONE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| PRAMIPEXOLE | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| TAMSULOSIN | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ACETOPHENAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ALFUZOSIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMISULPRIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| APRACLONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ASENAPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| AZELASTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENFLUOREX | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZQUINAMIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZTHIAZIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BENZTROPINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BITHIONOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BRIMONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| BROMPERIDOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CABERGOLINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLOROQUINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CINNARIZINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLONIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DANAZOL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DARIFENACIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DEXMEDETOMIDINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOBUTAMINE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOMPERIDONE | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
| DOTHIEPIN | ChEMBL | Phase 4 (approved) | ADRA2A, ADRA2B, ADRA2C |
Related Atlas pages
- Genes: ADRA2A, ADRA2B, ADRA2C
- Diseases: drug dependence, opiate dependence
- Drugs: Aclidinium Bromide, Afatinib, Almotriptan, Chenodiol, Clozapine, Crizotinib, Desloratadine, Dihydroergotamine, Naphazoline, Olanzapine, Olodaterol, Paliperidone, Pramipexole, Tamsulosin, Tegaserod, Acetophenazine, Alfuzosin, Amisulpride, Amitriptyline, Amoxapine, Apomorphine, Apraclonidine, Aripiprazole, Asenapine, Astemizole, Azelastine, Bazedoxifene, Benfluorex, Benperidol, Benzbromarone, Benzquinamide, Benzthiazide, Benztropine, Bithionol, Brexpiprazole, Brimonidine, Bromocriptine, Bromperidol, Cabergoline, Candesartan Cilexetil, Cariprazine, Carvedilol, Chlorhexidine, Chloroquine, Chlorpromazine, Cinnarizine, Cisapride, Clemastine, Clomipramine, Clonidine, Clotrimazole, Cyproheptadine, Danazol, Darifenacin, Dexmedetomidine, Diethylstilbestrol, Dobutamine, Domperidone, Dothiepin