Lorecivivint
drugOn this page
Also known as AdavivintSM-04690Sm04690
Summary
Lorecivivint (CHEMBL4297639) is a phase-3 clinical-stage small molecule targeting CLK2 and DYRK1A; indicated across 3 conditions including osteoarthritis, knee and intervertebral disk degenerative disorder.
At a glance
- Status: Max clinical phase 3 (not approved)
- Modality: Small molecule
- Targets: 2 (CLK2, DYRK1A)
- Indications: 3 conditions
- Clinical trials: 11
- Chemistry: 505.5 Da · C29H24FN7O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL4297639 |
| Name | Lorecivivint |
| Type | Small molecule |
| Max phase | 3 |
| FDA approved | no |
| PubChem CID | 135565709 |
| Molecular formula | C29H24FN7O |
| Molecular weight | 505.5 |
| InChIKey | AQDWDWAYVBQMAM-UHFFFAOYSA-N |
SMILES: CC(C)CC(=O)NC1=CN=CC(=C1)C2=CC3=C(C=C2)NN=C3C4=NC5=C(N4)C=NC=C5C6=CC(=CC=C6)F
IUPAC name: N-[5-[3-[7-(3-fluorophenyl)-3H-imidazo[4,5-c]pyridin-2-yl]-1H-indazol-5-yl]-3-pyridinyl]-3-methylbutanamide
Also known as: Adavivint, Lorecivivint, SM-04690, Sm04690, SM04690, LORECIVIVINT
Patent coverage: 108 distinct patent families (282 SureChEMBL compound mentions), from 5 matched compound structure(s). One matched structure accounts for 197 (70%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| CLK2 | CDC like kinase 2 | Inhibition | 8.24 | 34% | P49760 |
| DYRK1A | dual specificity tyrosine phosphorylation regulated kinase 1A | Inhibition | 7.57 | 10.5% | Q13627 |
Broader ChEMBL bioactivity targets: 8 (assay-derived). Sample: Dual specificity tyrosine-phosphorylation-regulated kinase 1A, Glycogen synthase kinase-3 beta, Dual specificity protein kinase CLK4, Dual specificity protein kinase CLK1, Dual specificity protein kinase CLK2, Dual specificity protein kinase CLK3, Dual specificity tyrosine-phosphorylation-regulated kinase 2, Dual specificity tyrosine-phosphorylation-regulated kinase 1B.
Bioactivity
ChEMBL activities: 28 potent at pChembl ≥ 5 of 28 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| DYRK1A | 8.3 | EC50 | 5 | nM | CHEMBL_ACT_22938507 |
| CLK1 | 8.23 | Kd | 5.89 | nM | CHEMBL_ACT_25065221 |
| CLK2 | 8.22 | EC50 | 6 | nM | CHEMBL_ACT_22939148 |
| CLK2 | 8.11 | IC50 | 7.8 | nM | CHEMBL_ACT_24691610 |
| CLK2 | 8.11 | IC50 | 7.8 | nM | CHEMBL_ACT_25013105 |
| CLK2 | 8.11 | IC50 | 7.8 | nM | CHEMBL_ACT_25900072 |
| CLK2 | 8.1 | IC50 | 8 | nM | CHEMBL_ACT_24863180 |
| CLK2 | 7.87 | IC50 | 13.6 | nM | CHEMBL_ACT_25064364 |
| DYRK1A | 7.7 | Kd | 19.95 | nM | CHEMBL_ACT_25065184 |
| CLK4 | 7.68 | IC50 | 21 | nM | CHEMBL_ACT_25900139 |
| DYRK1A | 7.57 | IC50 | 26.9 | nM | CHEMBL_ACT_24691634 |
| DYRK1A | 7.57 | IC50 | 26.9 | nM | CHEMBL_ACT_25013133 |
| DYRK1A | 7.57 | IC50 | 26.9 | nM | CHEMBL_ACT_25900135 |
| DYRK1A | 7.52 | IC50 | 30 | nM | CHEMBL_ACT_24863181 |
| DYRK1A | 7.39 | IC50 | 41.1 | nM | CHEMBL_ACT_25065045 |
| CLK3 | 7.35 | IC50 | 44.3 | nM | CHEMBL_ACT_25900099 |
| DYRK1A | 7.32 | IC50 | 48 | nM | CHEMBL_ACT_25064532 |
| CLK3 | 7.25 | EC50 | 56 | nM | CHEMBL_ACT_22939789 |
| CLK3 | 7.12 | IC50 | 76.1 | nM | CHEMBL_ACT_25064420 |
| DYRK1B | 7.05 | IC50 | 89 | nM | CHEMBL_ACT_25064588 |
| DYRK1B | 7.01 | IC50 | 97.2 | nM | CHEMBL_ACT_25065080 |
| GSK3B | 6.81 | Kd | 155.1 | nM | CHEMBL_ACT_25065258 |
| CLK4 | 6.62 | IC50 | 237.7 | nM | CHEMBL_ACT_25064476 |
| CLK1 | 6.62 | IC50 | 239 | nM | CHEMBL_ACT_25900138 |
| CLK1 | 6.61 | IC50 | 246.2 | nM | CHEMBL_ACT_25065010 |
| CLK1 | 6.24 | IC50 | 582.6 | nM | CHEMBL_ACT_25064308 |
| GSK3B | 6.19 | IC50 | 641.4 | nM | CHEMBL_ACT_25064812 |
| DYRK2 | 5.22 | IC50 | 6049 | nM | CHEMBL_ACT_25064644 |
Target pathways
Aggregated over 2 target gene(s): CLK2, DYRK1A.
Top Reactome pathways
1 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| G0 and Early G1 | 1 | DYRK1A |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| protein phosphorylation | 2 |
| protein autophosphorylation | 2 |
| response to ionizing radiation | 1 |
| regulation of RNA splicing | 1 |
| negative regulation of gluconeogenesis | 1 |
| regulation of alternative mRNA splicing, via spliceosome | 1 |
| nervous system development | 1 |
| circadian rhythm | 1 |
| peptidyl-tyrosine phosphorylation | 1 |
| negative regulation of microtubule polymerization | 1 |
| negative regulation of heterochromatin formation | 1 |
| positive regulation of RNA splicing | 1 |
| negative regulation of DNA damage response, signal transduction by p53 class mediator | 1 |
| positive regulation of DNA-templated transcription | 1 |
| negative regulation of mRNA splicing, via spliceosome | 1 |
Indications & clinical
Indications
3 indications (0 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| osteoarthritis, knee | 3 | MONDO:0005416 | EFO:0004616 |
| osteoarthritis | 2 | MONDO:0005178 | MONDO:0005178 |
| intervertebral disk degenerative disorder | 1 | MONDO:0011385 | HP:0008419 |
Clinical trials
Total trials: 11.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE3 | 5 |
| PHASE2 | 4 |
| PHASE1 | 2 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03928184 | PHASE3 | COMPLETED | Patient-Reported and Radiographic Outcomes in Evaluating Lorecivivint (SM04690) for the Treatment of Knee Osteoarthritis |
| NCT04385303 | PHASE3 | COMPLETED | Patient-Reported Outcomes in Evaluating Lorecivivint (SM04690) for Moderate to Severe Knee Osteoarthritis (STRIDES-1) |
| NCT04520607 | PHASE3 | TERMINATED | A Long-Term Safety and Efficacy Study of Lorecivivint in Subjects With Osteoarthritis of the Knee |
| NCT04931667 | PHASE3 | TERMINATED | 3-year, Open-Label Study Evaluating Safety, Tolerability, and Efficacy of Lorecivivint in Knee Osteoarthritis |
| NCT05603754 | PHASE3 | COMPLETED | A Study Utilizing Patient-Reported Outcomes to Evaluate the Safety and Efficacy of Lorecivivint (SM04690) for the Treatment of Moderately to Severely Symptomatic Knee Osteoarthritis (STRIDES) |
| NCT02536833 | PHASE2 | COMPLETED | A Study Evaluating the Safety, Tolerability, and Efficacy of SM04690 Injected in the Target Knee Joint of Moderately to Severely Symptomatic Osteoarthritis Subjects |
| NCT03122860 | PHASE2 | COMPLETED | A Study Evaluating the Safety and Efficacy of SM04690 for the Treatment of Moderately to Severely Symptomatic Knee Osteoarthritis |
| NCT03706521 | PHASE2 | TERMINATED | MRI Study to Evaluate the Safety and Efficacy of SM04690 for Knee Osteoarthritis |
| NCT03727022 | PHASE2 | COMPLETED | Safety and Bone Health Study of SM04690 for the Treatment of Moderately to Severely Symptomatic Knee Osteoarthritis |
| NCT03246399 | PHASE1 | TERMINATED | A Study of the Safety, Tolerability, and Pharmacokinetics of SM04690 Injectable Suspension Following Single Intradiscal Injection in Subjects With Degenerative Disc Disease |
| NCT04598542 | PHASE1 | COMPLETED | Drug-Drug Interaction Study of Lorecivivint and Triamcinolone Acetonide in Healthy Volunteers |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
65 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Afatinib | ChEMBL + PubChem | Phase 4 (approved) | CLK2, DYRK1A |
| BELUMOSUDIL | ChEMBL + PubChem | Phase 4 (approved) | CLK2, DYRK1A |
| ABEMACICLIB | ChEMBL | Phase 4 (approved) | CLK2, DYRK1A |
| MIDOSTAURIN | ChEMBL | Phase 4 (approved) | CLK2, DYRK1A |
| PALBOCICLIB | ChEMBL | Phase 4 (approved) | CLK2, DYRK1A |
| RUXOLITINIB | ChEMBL | Phase 4 (approved) | CLK2, DYRK1A |
| SUNITINIB | ChEMBL | Phase 4 (approved) | CLK2, DYRK1A |
| ALVOCIDIB | ChEMBL | Phase 3 | CLK2, DYRK1A |
| ENZASTAURIN | ChEMBL | Phase 3 | CLK2, DYRK1A |
| EPIGALOCATECHIN GALLATE | ChEMBL | Phase 3 | CLK2, DYRK1A |
| LESTAURTINIB | ChEMBL | Phase 3 | CLK2, DYRK1A |
| RUBOXISTAURIN | ChEMBL | Phase 3 | CLK2, DYRK1A |
| AT-7519 | ChEMBL | Phase 2 | CLK2, DYRK1A |
| CC-401 | ChEMBL | Phase 2 | CLK2, DYRK1A |
| LY-2090314 | ChEMBL | Phase 2 | CLK2, DYRK1A |
| R-406 | ChEMBL | Phase 2 | CLK2, DYRK1A |
| RG-547 | ChEMBL | Phase 2 | CLK2, DYRK1A |
| SELICICLIB | ChEMBL | Phase 2 | CLK2, DYRK1A |
| SILMITASERTIB | ChEMBL | Phase 2 | CLK2, DYRK1A |
| SU-014813 | ChEMBL | Phase 2 | CLK2, DYRK1A |
| TG100-115 | ChEMBL | Phase 2 | CLK2, DYRK1A |
| Binimetinib | PubChem | Approved | CLK2, DYRK1A |
| Crizotinib | PubChem | Approved | CLK2, DYRK1A |
| dacomitinib | PubChem | Approved | CLK2, DYRK1A |
| Gefitinib | PubChem | Approved | CLK2, DYRK1A |
| Idelalisib | PubChem | Approved | CLK2, DYRK1A |
| Pazopanib | PubChem | Approved | CLK2, DYRK1A |
| regorafenib | PubChem | Approved | CLK2, DYRK1A |
| Selumetinib | PubChem | Approved | CLK2, DYRK1A |
| Trametinib | PubChem | Approved | CLK2, DYRK1A |
| FEDRATINIB | ChEMBL + PubChem | Phase 4 (approved) | CLK2 |
| AFATINIB DIMALEATE | ChEMBL | Phase 4 (approved) | DYRK1A |
| ALECTINIB | ChEMBL | Phase 4 (approved) | CLK2 |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | CLK2 |
| BRIGATINIB | ChEMBL | Phase 4 (approved) | CLK2 |
| CHLORHEXIDINE | ChEMBL | Phase 4 (approved) | CLK2 |
| ENTRECTINIB | ChEMBL | Phase 4 (approved) | CLK2 |
| GATIFLOXACIN | ChEMBL | Phase 4 (approved) | CLK2 |
| NINTEDANIB | ChEMBL | Phase 4 (approved) | CLK2 |
| NIRAPARIB | ChEMBL | Phase 4 (approved) | DYRK1A |
| RUCAPARIB | ChEMBL | Phase 4 (approved) | DYRK1A |
| TOVORAFENIB | ChEMBL | Phase 4 (approved) | DYRK1A |
| BARASERTIB | ChEMBL | Phase 3 | DYRK1A |
| CANERTINIB | ChEMBL | Phase 3 | DYRK1A |
| CRENOLANIB | ChEMBL | Phase 3 | DYRK1A |
| CURCUMIN | ChEMBL | Phase 3 | DYRK1A |
| DEFACTINIB | ChEMBL | Phase 3 | DYRK1A |
| DOVITINIB | ChEMBL | Phase 3 | CLK2 |
| AT-9283 | ChEMBL | Phase 2 | DYRK1A |
| BGT-226 FREE BASE | ChEMBL | Phase 2 | DYRK1A |
| BI-2536 | ChEMBL | Phase 2 | CLK2 |
| BMS-690514 | ChEMBL | Phase 2 | DYRK1A |
| CENISERTIB | ChEMBL | Phase 2 | CLK2 |
| MILCICLIB | ChEMBL | Phase 2 | DYRK1A |
| MONZOSERTIB | ChEMBL | Phase 2 | CLK2 |
| PELITINIB | ChEMBL | Phase 2 | CLK2 |
| PICTILISIB | ChEMBL | Phase 2 | CLK2 |
| ROGOCEKIB | ChEMBL | Phase 2 | CLK2 |
| SOTRASTAURIN | ChEMBL | Phase 2 | CLK2 |
| TANDUTINIB | ChEMBL | Phase 2 | CLK2 |
Related Atlas pages
- Genes: CLK2, DYRK1A
- Diseases: osteoarthritis, knee
- Drugs: Afatinib, Belumosudil, Abemaciclib, Midostaurin, Palbociclib, Ruxolitinib, Sunitinib, Alvocidib, Enzastaurin, Epigalocatechin Gallate, Lestaurtinib, Ruboxistaurin, Binimetinib, Crizotinib, dacomitinib, Gefitinib, Idelalisib, Pazopanib, regorafenib, Selumetinib, Trametinib, Fedratinib, Alectinib, Bosutinib, Brigatinib, Chlorhexidine, Entrectinib, Gatifloxacin, Nintedanib, Niraparib, Rucaparib, Tovorafenib, Barasertib, Canertinib, Crenolanib, Curcumin, Defactinib, Dovitinib