Losartan
drugOn this page
Also known as AllisartanAngizaarDup-89E-3174Exp-3174EXP3174HGP-1405HGP1405Losartan carboxylic acidLosarticLozapNSC-758699SID26748956SID144204988SID170465135[14C]-losartanLOSARTAN POTASSIUM
Summary
Losartan (CHEMBL191) is an approved small-molecule antihypertensive agent (ATC C09CA01) targeting AGTR1; indicated across 45 conditions including cardiovascular disorder and diabetic kidney disease.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: C09CA01
- Targets: 1 (AGTR1)
- Indications: 45 conditions
- Clinical trials: 304
- Chemistry: C22H23ClN6O
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL191 |
| Name | Losartan |
| Type | Small molecule |
| Max phase | 4 |
| ChEBI | CHEBI:6541 |
| ATC | C09CA01 |
| Molecular formula | C22H23ClN6O |
| InChIKey | PSIFNNKUMBGKDQ-UHFFFAOYSA-N |
SMILES: CCCCc1nc(Cl)c(CO)n1Cc1ccc(-c2ccccc2-c2nnnn2)cc1
ChEBI definition: A biphenylyltetrazole where a 1,1’-biphenyl group is attached at the 5-position and has an additional trisubstituted imidazol-1-ylmethyl group at the 4’-position
Pharmacological roles (ChEBI): antihypertensive agent, angiotensin receptor antagonist, endothelin receptor antagonist, anti-arrhythmia drug.
Also known as: Allisartan, Angizaar, Dup-89, E-3174, Exp-3174, EXP3174, HGP-1405, HGP1405, Losartan, Losartan carboxylic acid, Losartic, Lozap
Parent form; salt/anhydrous children: CHEMBL995, CHEMBL367465
Patent coverage: 23,253 distinct patent families (88,932 SureChEMBL compound mentions), from 3 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| AGTR1 | AT1 receptor | Antagonist | 8.21 | 0.4% | P30556 |
Broader ChEMBL bioactivity targets: 29 (assay-derived). Sample: Type-1 angiotensin II receptor, Solute carrier organic anion transporter family member 1B1, Solute carrier organic anion transporter family member 1B3, Angiotensin-converting enzyme, Adrenergic receptor alpha-1, Thromboxane A2 receptor, Progesterone receptor, Phosphodiesterase 4, Angiotensin II receptor, Phosphodiesterase 3.
Bioactivity
ChEMBL activities: 141 potent at pChembl ≥ 5 of 157 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| AGTR1 | 9.48 | IC50 | 0.33 | nM | CHEMBL_ACT_10956584 |
| CNR1 | 8.92 | AC50 | 1.2 | nM | CHEMBL_ACT_25116762 |
| AGTR1 | 8.8 | Kd | 1.58 | nM | CHEMBL_ACT_318902 |
| P34976 | 8.8 | Kd | 1.58 | nM | CHEMBL_ACT_656832 |
| AGTR1 | 8.8 | Kd | 1.58 | nM | CHEMBL_ACT_718164 |
| P25095 | 8.74 | IC50 | 1.8 | nM | CHEMBL_ACT_258259 |
| P25095 | 8.72 | Ki | 1.9 | nM | CHEMBL_ACT_1488493 |
| P34976 | 8.52 | IC50 | 3 | nM | CHEMBL_ACT_263892 |
| AGTR1 | 8.49 | IC50 | 3.24 | nM | CHEMBL_ACT_16650273 |
| AGTR1 | 8.48 | Kd | 3.31 | nM | CHEMBL_ACT_1035099 |
| AGTR1 | 8.48 | Kd | 3.31 | nM | CHEMBL_ACT_5202034 |
| P29089 | 8.44 | Ki | 3.6 | nM | CHEMBL_ACT_393695 |
| AGTR1 | 8.43 | Kd | 3.71 | nM | CHEMBL_ACT_1190866 |
| P34976 | 8.43 | Kd | 3.71 | nM | CHEMBL_ACT_793953 |
| P25095 | 8.34 | IC50 | 4.6 | nM | CHEMBL_ACT_671055 |
| AGTR1 | 8.3 | Ki | 5.01 | nM | CHEMBL_ACT_18880679 |
| P25095 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_271865 |
| P25095 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_271869 |
| P29089 | 8.3 | IC50 | 5 | nM | CHEMBL_ACT_575411 |
| AGTR1 | 8.28 | AC50 | 5.2 | nM | CHEMBL_ACT_25176897 |
| P34976 | 8.27 | Kd | 5.37 | nM | CHEMBL_ACT_309548 |
| AGTR2 | 8.26 | Ki | 5.5 | nM | CHEMBL_ACT_27155606 |
| AGTR2 | 8.26 | Ki | 5.5 | nM | CHEMBL_ACT_27725312 |
| AGTR1 | 8.25 | IC50 | 5.62 | nM | CHEMBL_ACT_10973608 |
| AGTR1 | 8.25 | IC50 | 5.62 | nM | CHEMBL_ACT_12710846 |
| P25095 | 8.24 | Ki | 5.7 | nM | CHEMBL_ACT_569086 |
| AGTR1 | 8.22 | IC50 | 6 | nM | CHEMBL_ACT_10973632 |
| P25095 | 8.17 | IC50 | 6.7 | nM | CHEMBL_ACT_1776079 |
| P25095 | 8.17 | IC50 | 6.7 | nM | CHEMBL_ACT_2153787 |
| P29089 | 8.17 | IC50 | 6.7 | nM | CHEMBL_ACT_637000 |
Target pathways
Aggregated over 1 target gene(s): AGTR1.
Top Reactome pathways
11 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 1 | AGTR1 |
| Membrane Trafficking | 1 | AGTR1 |
| Signaling by GPCR | 1 | AGTR1 |
| Class A/1 (Rhodopsin-like receptors) | 1 | AGTR1 |
| Peptide ligand-binding receptors | 1 | AGTR1 |
| GPCR downstream signalling | 1 | AGTR1 |
| G alpha (q) signalling events | 1 | AGTR1 |
| GPCR ligand binding | 1 | AGTR1 |
| Vesicle-mediated transport | 1 | AGTR1 |
| Cargo recognition for clathrin-mediated endocytosis | 1 | AGTR1 |
| Clathrin-mediated endocytosis | 1 | AGTR1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of cell growth | 1 |
| kidney development | 1 |
| renin-angiotensin regulation of aldosterone production | 1 |
| maintenance of blood vessel diameter homeostasis by renin-angiotensin | 1 |
| regulation of systemic arterial blood pressure by renin-angiotensin | 1 |
| inflammatory response | 1 |
| G protein-coupled receptor signaling pathway | 1 |
| phospholipase C-activating G protein-coupled receptor signaling pathway | 1 |
| positive regulation of cytosolic calcium ion concentration | 1 |
| Rho protein signal transduction | 1 |
| positive regulation of macrophage derived foam cell differentiation | 1 |
| regulation of vasoconstriction | 1 |
| calcium-mediated signaling | 1 |
| low-density lipoprotein particle remodeling | 1 |
| regulation of renal sodium excretion | 1 |
Indications & clinical
Indications
45 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| cardiovascular disorder | 4 | MONDO:0004995 | EFO:0000319 |
| diabetic kidney disease | 3 | MONDO:0005016 | EFO:0000401 |
| glioblastoma | 3 | MONDO:0018177 | EFO:0000519 |
| hypertensive disorder | 3 | MONDO:0005044 | EFO:0000537 |
| kidney disorder | 3 | MONDO:0005240 | EFO:0003086 |
| heart failure | 3 | MONDO:0005252 | EFO:0003144 |
| chronic kidney disease | 3 | MONDO:0005300 | EFO:0003884 |
| IgA glomerulonephritis | 3 | MONDO:0005342 | EFO:0004194 |
| metabolic dysfunction-associated steatohepatitis | 3 | MONDO:0007027 | EFO:1001249 |
| proteinuria | 3 | MONDO:0003634 | HP:0000093 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | EFO:0000694 |
| pulmonary hypertension | 3 | MONDO:0005149 | MONDO:0005149 |
| essential hypertension | 3 | MONDO:0001134 | MONDO:0001134 |
| primary hyperoxaluria | 3 | MONDO:0002474 | MONDO:0002474 |
| Marfan syndrome | 3 | MONDO:0007947 | MONDO:0007947 |
| metabolic dysfunction-associated steatotic liver disease | 3 | MONDO:0013209 | EFO:0003095 |
| hypertrophic cardiomyopathy | 2 | MONDO:0005045 | EFO:0000538 |
| HIV infectious disease | 2 | MONDO:0005109 | EFO:0000764 |
| idiopathic pulmonary fibrosis | 2 | MONDO:0800504 | EFO:0000768 |
| post-traumatic stress disorder | 2 | MONDO:0005146 | EFO:0001358 |
| exocrine pancreatic carcinoma | 2 | MONDO:0005192 | EFO:0002618 |
| focal segmental glomerulosclerosis | 2 | MONDO:0100313 | EFO:0004236 |
| acute respiratory distress syndrome | 2 | MONDO:0006502 | EFO:1000637 |
| aortic valve insufficiency | 2 | MONDO:0005648 | EFO:0007148 |
| type 1 diabetes mellitus | 2 | MONDO:0005147 | MONDO:0005147 |
| breast neoplasm | 2 | MONDO:0021100 | MONDO:0007254 |
| cystic fibrosis | 2 | MONDO:0009061 | MONDO:0009061 |
| sickle cell disease | 2 | MONDO:0011382 | MONDO:0011382 |
| schwannoma | 2 | MONDO:0002546 | EFO:0000693 |
| acoustic neuroma | 2 | MONDO:0001569 | HP:0009588 |
| peripheral neuropathy | 2 | MONDO:0005244 | EFO:0003100 |
| injury | 1 | MONDO:0021178 | EFO:0000546 |
| osteosarcoma | 1 | MONDO:0009807 | EFO:0000637 |
| metastatic melanoma | 1 | MONDO:0005191 | EFO:0002617 |
| osteoarthritis, knee | 1 | MONDO:0005416 | EFO:0004616 |
| type 2 diabetes mellitus | 1 | MONDO:0005148 | MONDO:0005148 |
| keloid | 1 | MONDO:0005348 | EFO:0004212 |
| head and neck squamous cell carcinoma | 1 | MONDO:0010150 | EFO:0000181 |
| peripheral arterial disease | 0 | MONDO:0005386 | EFO:0004265 |
6 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 304.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 72 |
| PHASE3 | 61 |
| Not specified | 57 |
| PHASE2 | 48 |
| PHASE1 | 38 |
| EARLY_PHASE1 | 16 |
| PHASE1/PHASE2 | 7 |
| PHASE2/PHASE3 | 5 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT03264352 | PHASE4 | RECRUITING | Intervention for High-normal Blood Pressure in Adults With Type 2 Diabetes |
| NCT04111419 | PHASE4 | ACTIVE_NOT_RECRUITING | Intensive Management of Blood Pressure and Cholesterol in Elderly Chinese With Hypertension and Atrial Fibrillation |
| NCT04715568 | PHASE4 | RECRUITING | Secondhand Tobacco Smoke and Cardiovascular Disease |
| NCT06431477 | PHASE4 | RECRUITING | Efficacy and Safety of Telmisartan Compared With Losartan |
| NCT07099859 | PHASE4 | RECRUITING | Effect of Losartan on the Neurohumoral Axis and Ventricular Remodeling of Patients With Severe Aortic Regurgitation Undergoing Valve Surgery. |
| NCT07135687 | PHASE4 | NOT_YET_RECRUITING | Study to Use Oral Losartan to Decrease the Risk of Postoperative Scarring Following (ACL) Reconstruction |
| NCT07160361 | PHASE4 | NOT_YET_RECRUITING | Exploration of Postoperative Adjuvant Therapy for HCC Patients With Positive TB |
| NCT07241338 | PHASE4 | NOT_YET_RECRUITING | Sacubitril/Allisartan for Hypertensive Patients With Overweight or Obesity |
| NCT00067990 | PHASE4 | COMPLETED | Angiotensin II Blockade for Chronic Allograft Nephropathy |
| NCT00140907 | PHASE4 | COMPLETED | ALLOGRAFT, A Study to Evaluate the Renal Protective Effects of Losartan (0954-222)(COMPLETED) |
| NCT00168857 | PHASE4 | COMPLETED | A Prospective, Randomised, Double-blind, Double-dummy, Forced-titration, Multicentre, Parallel Group, One Year Treatment Trial to Compare Telmisartan (MICARDIS) 80 mg Versus Losartan (COZAAR) 100 mg, in Hypertensive Type 2 Diabetic Patients With Overt Nephropathy (AMADEO Study) |
| NCT00185094 | PHASE4 | COMPLETED | A Comparison of the Effect of Olmesartan Medoxomil, Losartan Potassium, and Atenolol on the Ability of Overweight Patients With High Blood Pressure to Respond to Insulin |
| NCT00198562 | PHASE4 | UNKNOWN | Hypertension Control Based on Home Blood Pressure |
| NCT00239096 | PHASE4 | UNKNOWN | Prevention of Decompensation in Liver Cirrhosis |
| NCT00274638 | PHASE4 | COMPLETED | PROBE Parallel 6-week Treatment Comparing Telmisartan/Hydrochlorothiazide (HCT) (40/12.5 or 80/12.5) With Losartan/HCT (50/12.5) Using Ambulatory Blood Pressure Monitoring (ABPM) |
| NCT00298714 | PHASE4 | COMPLETED | Effects of Losartan on Hepatic Fibrogenesis in Chronic Hepatitis C |
| NCT00369538 | PHASE4 | SUSPENDED | Specific Blockage of Angiotensine 2 and Podocyturia in Glomerular Nephropathies With Hypertension and Proteinuria |
| NCT00407862 | PHASE4 | COMPLETED | Telmisartan and Losartan in Hypertensive IGT |
| NCT00419835 | PHASE4 | COMPLETED | Effect of Enalapril and Losartan Association Therapy on Proteinuria and Inflammatory Biomarkers in Diabetic Nephropathy: a Clinical Trial on Type 2 Diabetes Mellitus |
| NCT00456963 | PHASE4 | TERMINATED | Prevention of Diabetes and Hypertension |
| NCT00492128 | PHASE4 | COMPLETED | Kanagawa Combination Anti-hypertensive Therapy (K-CAT) |
| NCT00496834 | PHASE4 | COMPLETED | LAAS (Losartan Anti-Atherosclerosis Study)(0954-330)(COMPLETED) |
| NCT00663377 | PHASE4 | COMPLETED | Effects of Losartan on Insulin Resistance in Patients With Heart Failure |
| NCT00669435 | PHASE4 | UNKNOWN | Losartan and Simvastatin in Hypertensive Obeses With Liver Steatosis |
| NCT00675987 | PHASE4 | COMPLETED | A Randomized Clinical Trial To Study Losartan On Endothelial Dysfunction and Insulin Resistance In Obese Patients |
| NCT00701428 | PHASE4 | COMPLETED | Losartan in Hypertensive Men and Women With Sleep Apnea Before and on Continuous Positive Airway Pressure (CPAP) Treatment |
| NCT00716950 | PHASE4 | UNKNOWN | Valsartan and Amlodipine Compared to Losartan and Amlodipine in Hypertensive Patients |
| NCT00720226 | PHASE4 | COMPLETED | Efficacy of Losartan in Preventing Progression of COPD |
| NCT00754429 | PHASE4 | COMPLETED | The Effect of Losartan Versus Amlodipine-based Therapy in Ischemic Stroke (0954-338)(COMPLETED) |
| NCT00805311 | PHASE4 | TERMINATED | Aggressive Medical Treatment Evaluation for Asymptomatic Carotid Artery Stenosis |
| NCT00813722 | PHASE4 | UNKNOWN | Effect of Active Telephone Calls in the Compliance of Hypertensive Patients With Treatment |
| NCT00931710 | PHASE4 | COMPLETED | Valsartan/Amlodipine As Compared to Losartan Treatment in Stage 2 Systolic Hypertension |
| NCT00949884 | PHASE4 | COMPLETED | Olmesartan Comparison to Losartan in Hypertensive Subjects |
| NCT00994617 | PHASE4 | UNKNOWN | Monotherapy Versus Dual Therapy for Initial Treatment for Hypertension |
| NCT01150201 | PHASE4 | COMPLETED | Aliskiren Combined With Losartan in Proteinuric, Non-diabetic Chronic Kidney Disease |
| NCT01176032 | PHASE4 | COMPLETED | ALiskiren or Losartan Effects on bioMARKers of Myocardial Remodeling |
| NCT01180413 | PHASE4 | COMPLETED | Intensive Vasodilator Therapy in Patients With Essential Hypertension |
| NCT01271374 | PHASE4 | UNKNOWN | Changes in Endothelial Function and Biomarkers in African Americans (AA) With Metabolic Syndrome |
| NCT01603940 | PHASE4 | COMPLETED | Comparison Between Losartan and Benazepril in Diabetic Hypertensive Patients Not Controlled by Amlodipine |
| NCT01766050 | PHASE4 | COMPLETED | Study to Evaluate Effect of Belatacept on Pharmacokinetics of Inje Cocktail in Healthy Volunteers |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No PharmGKB pharmacogenomic data curated for this drug.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
140 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CRIZOTINIB | ChEMBL + PubChem | Phase 4 (approved) | AGTR1 |
| OLMESARTAN MEDOXOMIL | ChEMBL + PubChem | Phase 4 (approved) | AGTR1 |
| RIFAMPIN | ChEMBL + PubChem | Phase 4 (approved) | AGTR1 |
| SPARSENTAN | ChEMBL + PubChem | Phase 4 (approved) | AGTR1 |
| TEGASEROD | ChEMBL + PubChem | Phase 4 (approved) | AGTR1 |
| ALFACALCIDOL | ChEMBL | Phase 4 (approved) | AGTR1 |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | AGTR1 |
| ANGIOTENSIN II | ChEMBL | Phase 4 (approved) | AGTR1 |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | AGTR1 |
| BALSALAZIDE | ChEMBL | Phase 4 (approved) | AGTR1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | AGTR1 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | AGTR1 |
| CALCITRIOL | ChEMBL | Phase 4 (approved) | AGTR1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | AGTR1 |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | AGTR1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | AGTR1 |
| DABIGATRAN ETEXILATE | ChEMBL | Phase 4 (approved) | AGTR1 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | AGTR1 |
| DISULFIRAM | ChEMBL | Phase 4 (approved) | AGTR1 |
| DOFETILIDE | ChEMBL | Phase 4 (approved) | AGTR1 |
| DONEPEZIL | ChEMBL | Phase 4 (approved) | AGTR1 |
| EFAVIRENZ | ChEMBL | Phase 4 (approved) | AGTR1 |
| EPALRESTAT | ChEMBL | Phase 4 (approved) | AGTR1 |
| EPROSARTAN | ChEMBL | Phase 4 (approved) | AGTR1 |
| FELODIPINE | ChEMBL | Phase 4 (approved) | AGTR1 |
| FENTICONAZOLE | ChEMBL | Phase 4 (approved) | AGTR1 |
| GUAIFENESIN | ChEMBL | Phase 4 (approved) | AGTR1 |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | AGTR1 |
| IBANDRONIC ACID | ChEMBL | Phase 4 (approved) | AGTR1 |
| INDOCYANINE GREEN ACID FORM | ChEMBL | Phase 4 (approved) | AGTR1 |
| IRBESARTAN | ChEMBL | Phase 4 (approved) | AGTR1 |
| IVACAFTOR | ChEMBL | Phase 4 (approved) | AGTR1 |
| LEFLUNOMIDE | ChEMBL | Phase 4 (approved) | AGTR1 |
| LOVASTATIN | ChEMBL | Phase 4 (approved) | AGTR1 |
| MILTEFOSINE | ChEMBL | Phase 4 (approved) | AGTR1 |
| NIFEDIPINE | ChEMBL | Phase 4 (approved) | AGTR1 |
| NIMESULIDE | ChEMBL | Phase 4 (approved) | AGTR1 |
| NITAZOXANIDE | ChEMBL | Phase 4 (approved) | AGTR1 |
| NORGESTIMATE | ChEMBL | Phase 4 (approved) | AGTR1 |
| NOSCAPINE | ChEMBL | Phase 4 (approved) | AGTR1 |
| OXYMETHOLONE | ChEMBL | Phase 4 (approved) | AGTR1 |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | AGTR1 |
| PONATINIB | ChEMBL | Phase 4 (approved) | AGTR1 |
| PRAZOSIN | ChEMBL | Phase 4 (approved) | AGTR1 |
| PROPRANOLOL | ChEMBL | Phase 4 (approved) | AGTR1 |
| PYRVINIUM | ChEMBL | Phase 4 (approved) | AGTR1 |
| RIMONABANT | ChEMBL | Phase 4 (approved) | AGTR1 |
| RITONAVIR | ChEMBL | Phase 4 (approved) | AGTR1 |
| ROCURONIUM | ChEMBL | Phase 4 (approved) | AGTR1 |
| ROSIGLITAZONE | ChEMBL | Phase 4 (approved) | AGTR1 |
| SARALASIN | ChEMBL | Phase 4 (approved) | AGTR1 |
| SELEXIPAG | ChEMBL | Phase 4 (approved) | AGTR1 |
| SIMVASTATIN | ChEMBL | Phase 4 (approved) | AGTR1 |
| SORAFENIB | ChEMBL | Phase 4 (approved) | AGTR1 |
| SULCONAZOLE | ChEMBL | Phase 4 (approved) | AGTR1 |
| SUNITINIB | ChEMBL | Phase 4 (approved) | AGTR1 |
| TELMISARTAN | ChEMBL | Phase 4 (approved) | AGTR1 |
| TELOTRISTAT | ChEMBL | Phase 4 (approved) | AGTR1 |
| TELOTRISTAT ETHYL | ChEMBL | Phase 4 (approved) | AGTR1 |
| TIPRANAVIR | ChEMBL | Phase 4 (approved) | AGTR1 |
Related Atlas pages
- Genes: AGTR1
- Diseases: cardiovascular disorder, diabetic kidney disease, glioblastoma, hypertensive disorder, kidney disorder, heart failure, chronic kidney disease, IgA glomerulonephritis, metabolic dysfunction-associated steatohepatitis, proteinuria, severe acute respiratory syndrome, pulmonary hypertension, essential hypertension, primary hyperoxaluria, Marfan syndrome, metabolic dysfunction-associated steatotic liver disease
- Drugs: Crizotinib, Olmesartan Medoxomil, Rifampin, Sparsentan, Tegaserod, Alfacalcidol, Amitriptyline, Angiotensin Ii, Aripiprazole, Balsalazide, Benzbromarone, Butoconazole, Calcitriol, Candesartan Cilexetil, Carvedilol, Clotrimazole, Dabigatran Etexilate, Desogestrel, Disulfiram, Dofetilide, Donepezil, Efavirenz, Epalrestat, Eprosartan, Felodipine, Fenticonazole, Guaifenesin, Haloperidol, Ibandronic Acid, Indocyanine Green Acid Form, Irbesartan, Ivacaftor, Leflunomide, Lovastatin, Miltefosine, Nifedipine, Nimesulide, Nitazoxanide, Norgestimate, Noscapine, Oxymetholone, Pimozide, Ponatinib, Prazosin, Propranolol, Pyrvinium, Rimonabant, Ritonavir, Rocuronium, Rosiglitazone, Saralasin, Selexipag, Simvastatin, Sorafenib, Sulconazole, Sunitinib, Telmisartan, Telotristat, Telotristat Ethyl, Tipranavir