Meclizine
drugOn this page
Also known as MeclozinaMeclozineNSC-169189monamineMECLIZINE HYDROCHLORIDE
Summary
Meclizine (CHEMBL1623) is an approved small molecule (ATC R06AE55) targeting NR1I3; indicated across 5 conditions including allergic disease and motion sickness.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: R06AE55 (+1 more)
- Targets: 1 (NR1I3)
- Indications: 5 conditions
- Clinical trials: 8
- Chemistry: 390.9 Da · C25H27ClN2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1623 |
| Name | Meclizine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 4034 |
| ATC | R06AE55, R06AE05 |
| Molecular formula | C25H27ClN2 |
| Molecular weight | 390.9 |
| InChIKey | OCJYIGYOJCODJL-UHFFFAOYSA-N |
SMILES: CC1=CC(=CC=C1)CN2CCN(CC2)C(C3=CC=CC=C3)C4=CC=C(C=C4)Cl
IUPAC name: 1-[(4-chlorophenyl)-phenylmethyl]-4-[(3-methylphenyl)methyl]piperazine
Also known as: Meclizine, Meclozina, Meclozine, NSC-169189, meclizine, monamine, MECLIZINE, MECLIZINE HYDROCHLORIDE, meclozine
Parent form; salt/anhydrous children: CHEMBL1085765, CHEMBL1200590, CHEMBL1324020, CHEMBL3989555
Patent coverage: 5,582 distinct patent families (20,272 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 19,677 (97%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| NR1I3 | Constitutive androstane receptor | Antagonist | 7.16 | 0.2% | Q14994 |
Broader ChEMBL bioactivity targets: 24 (assay-derived). Sample: 5-hydroxytryptamine receptor 2B, Alpha-2A adrenergic receptor, Alpha-2C adrenergic receptor, Histamine H2 receptor, D(1A) dopamine receptor, Serine protease hepsin, Muscarinic acetylcholine receptor M2, Muscarinic acetylcholine receptor M1, D(2) dopamine receptor, Cannabinoid receptor 1.
Bioactivity
ChEMBL activities: 20 potent at pChembl ≥ 5 of 28 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| HTR2A | 6.38 | AC50 | 413.3 | nM | CHEMBL_ACT_25173462 |
| KCNH2 | 6.11 | AC50 | 777.5 | nM | CHEMBL_ACT_25117194 |
| DRD3 | 6.02 | AC50 | 950 | nM | CHEMBL_ACT_25193089 |
| HRH1 | 5.96 | AC50 | 1100 | nM | CHEMBL_ACT_25212061 |
| HTR2B | 5.94 | AC50 | 1138 | nM | CHEMBL_ACT_25163994 |
| HRH2 | 5.84 | AC50 | 1454 | nM | CHEMBL_ACT_25114338 |
| CNR1 | 5.74 | AC50 | 1840 | nM | CHEMBL_ACT_25181367 |
| HPN | 5.7 | IC50 | 2020 | nM | CHEMBL_ACT_17720153 |
| ADRA1A | 5.69 | AC50 | 2062 | nM | CHEMBL_ACT_25137668 |
| DRD2 | 5.51 | AC50 | 3100 | nM | CHEMBL_ACT_25139886 |
| SLC6A2 | 5.49 | AC50 | 3239 | nM | CHEMBL_ACT_25145756 |
| DRD4 | 5.37 | AC50 | 4240 | nM | CHEMBL_ACT_25127297 |
| ADRA1A | 5.36 | AC50 | 4413 | nM | CHEMBL_ACT_25138338 |
| ADRA2A | 5.31 | AC50 | 4867 | nM | CHEMBL_ACT_25156185 |
| ADRA2C | 5.26 | AC50 | 5500 | nM | CHEMBL_ACT_25147426 |
| SLC6A3 | 5.22 | AC50 | 5990 | nM | CHEMBL_ACT_25124715 |
| ADORA3 | 5.12 | AC50 | 7608 | nM | CHEMBL_ACT_25198524 |
| CNR1 | 5.1 | AC50 | 8000 | nM | CHEMBL_ACT_25230448 |
| OPRK1 | 5.03 | AC50 | 9278 | nM | CHEMBL_ACT_25129028 |
| DRD1 | 5.01 | AC50 | 9831 | nM | CHEMBL_ACT_25114966 |
Target pathways
Aggregated over 1 target gene(s): NR1I3.
Top Reactome pathways
1 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Nuclear Receptor transcription pathway | 1 | NR1I3 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| negative regulation of transcription by RNA polymerase II | 1 |
| osteoblast differentiation | 1 |
| signal transduction | 1 |
| cell differentiation | 1 |
| intracellular receptor signaling pathway | 1 |
| positive regulation of transcription by RNA polymerase II | 1 |
| regulation of DNA-templated transcription | 1 |
| negative regulation of DNA-templated transcription | 1 |
Indications & clinical
Indications
5 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| allergic disease | 4 | MONDO:0005271 | MONDO:0005271 |
| motion sickness | 2 | MONDO:0008015 | EFO:0006928 |
| hepatocellular carcinoma | 1 | MONDO:0007256 | EFO:0000182 |
2 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 8.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 2 |
| Not specified | 2 |
| PHASE4 | 1 |
| PHASE3 | 1 |
| PHASE2 | 1 |
| PHASE1/PHASE2 | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT04482985 | PHASE4 | UNKNOWN | Meclizine Plasma Levels in Responders and Non-responders |
| NCT02112578 | PHASE3 | COMPLETED | Non Inferiority of Meclin® (Meclizine Chlorhydrate) Versus Dramin® (Dimenhydrinate) in Control of Acute Vertigo Symptoms From Peripheral Origin |
| NCT01443858 | PHASE2 | COMPLETED | Meclizine as a Potential Smoking Cessation Treatment |
| NCT04564144 | PHASE1/PHASE2 | UNKNOWN | Evaluation of Meclizine Orodispersible Tablet Pharmacokinetic in Human Volunteers |
| NCT01537471 | PHASE1 | COMPLETED | The Effects of Antihistamines on Pre-Pulse Inhibition |
| NCT03253289 | PHASE1 | COMPLETED | Meclizine for Hepatocellular Carcinoma |
| NCT00641797 | Not specified | COMPLETED | Treating Benign Paroxysmal Positional Vertigo (BPPV) in ED Patients |
| NCT02625181 | Not specified | COMPLETED | Real-time Decision Support for Postoperative Nausea and Vomiting (PONV) Prophylaxis |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
73 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| ACETAMINOPHEN | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| AMOXICILLIN | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| BOSENTAN | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| CLOTRIMAZOLE | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| CYCLOSPORINE | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| DICLOFENAC | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| ETHINYL ESTRADIOL | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| OLANZAPINE | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| REPAGLINIDE | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| ROSIGLITAZONE | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| SIMVASTATIN | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| TOLCAPONE | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| VERAPAMIL | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| ZAFIRLUKAST | ChEMBL + PubChem | Phase 4 (approved) | NR1I3 |
| EPALRESTAT | ChEMBL | Phase 4 (approved) | NR1I3 |
| GLIMEPIRIDE | ChEMBL | Phase 4 (approved) | NR1I3 |
| IBUPROFEN | ChEMBL | Phase 4 (approved) | NR1I3 |
| KETOCONAZOLE | ChEMBL | Phase 4 (approved) | NR1I3 |
| LUMIRACOXIB | ChEMBL | Phase 4 (approved) | NR1I3 |
| RACECADOTRIL | ChEMBL | Phase 4 (approved) | NR1I3 |
| RIMONABANT | ChEMBL | Phase 4 (approved) | NR1I3 |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | NR1I3 |
| GLIQUIDONE | ChEMBL | Phase 2 | NR1I3 |
| TIRACIZINE | ChEMBL | Phase 2 | NR1I3 |
| Allantoin | PubChem | Approved | NR1I3 |
| Alprostadil | PubChem | Approved | NR1I3 |
| anhydrous citric acid | PubChem | Approved | NR1I3 |
| arginine | PubChem | Approved | NR1I3 |
| ascorbic acid | PubChem | Approved | NR1I3 |
| Atorvastatin | PubChem | Approved | NR1I3 |
| Benzoic Acid | PubChem | Approved | NR1I3 |
| Biotin | PubChem | Approved | NR1I3 |
| Borneol | PubChem | Approved | NR1I3 |
| Caffeic Acid | PubChem | Approved | NR1I3 |
| Caffeine | PubChem | Approved | NR1I3 |
| Cannabidiol | PubChem | Approved | NR1I3 |
| caprylic acid | PubChem | Approved | NR1I3 |
| Carprofen | PubChem | Approved | NR1I3 |
| Chlorogenic Acid | PubChem | Approved | NR1I3 |
| Cinnamic Acid | PubChem | Approved | NR1I3 |
| Coumarin | PubChem | Approved | NR1I3 |
| Doconexent | PubChem | Approved | NR1I3 |
| eucalyptol | PubChem | Approved | NR1I3 |
| Eugenol | PubChem | Approved | NR1I3 |
| Folic Acid | PubChem | Approved | NR1I3 |
| Gallic Acid | PubChem | Approved | NR1I3 |
| glyceryl laurate | PubChem | Approved | NR1I3 |
| Icosapent | PubChem | Approved | NR1I3 |
| Isoniazid | PubChem | Approved | NR1I3 |
| Lauric Acid | PubChem | Approved | NR1I3 |
| limonene, (+)- | PubChem | Approved | NR1I3 |
| niacin | PubChem | Approved | NR1I3 |
| Oxycodone | PubChem | Approved | NR1I3 |
| Oxymorphone | PubChem | Approved | NR1I3 |
| Palmitic Acid | PubChem | Approved | NR1I3 |
| Phenobarbital | PubChem | Approved | NR1I3 |
| phytonadione | PubChem | Approved | NR1I3 |
| prasterone | PubChem | Approved | NR1I3 |
| Pyrazinamide | PubChem | Approved | NR1I3 |
Related Atlas pages
- Genes: NR1I3
- Diseases: allergic disease
- Drugs: Acetaminophen, Amoxicillin, Bosentan, Clotrimazole, Cyclosporine, Diclofenac, Ethinyl Estradiol, Olanzapine, Regorafenib, Repaglinide, Rosiglitazone, Simvastatin, Tolcapone, Verapamil, Zafirlukast, Epalrestat, Glimepiride, Ibuprofen, Ketoconazole, Lumiracoxib, Racecadotril, Rimonabant, Troglitazone, Alprostadil, anhydrous citric acid, arginine, ascorbic acid, Atorvastatin, Benzoic Acid, Biotin, Borneol, Caffeic Acid, Caffeine, Cannabidiol, Carprofen, Doconexent, eucalyptol, Folic Acid, Icosapent, Isoniazid, niacin, Oxycodone, Oxymorphone, Phenobarbital, phytonadione, prasterone, Pyrazinamide