Meclofenamic Acid
drugOn this page
Also known as Acide meclofenamiqueAcido meclofenamicoCI-583CL-583INF 4668INF-4668MeclofenamateNSC-95309meclotenamic acidSID24424562SID26751537SID90341585ACIDE_MECLOFENAMIQUEMedofenamic acidMECLOFENAMIC_acidMECLOFENAMIC-ACIDMeclomenMeciofenamic acid
Summary
Meclofenamic Acid (CHEMBL509) is an approved small-molecule non-steroidal anti-inflammatory drug (ATC M01AG04) targeting PTGS1, PTGS2, and TRPM4; indicated across 3 conditions including rheumatic disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: M01AG04 (+1 more)
- Targets: 3 (PTGS1, PTGS2, TRPM4)
- Indications: 3 conditions
- Clinical trials: 2
- Chemistry: 296.1 Da · C14H11Cl2NO2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL509 |
| Name | Meclofenamic Acid |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 4037 |
| ChEBI | CHEBI:6710 |
| ATC | M01AG04, M02AA18 |
| Molecular formula | C14H11Cl2NO2 |
| Molecular weight | 296.1 |
| InChIKey | SBDNJUWAMKYJOX-UHFFFAOYSA-N |
SMILES: CC1=C(C(=C(C=C1)Cl)NC2=CC=CC=C2C(=O)O)Cl
IUPAC name: 2-(2,6-dichloro-3-methylanilino)benzoic acid
ChEBI definition: An aminobenzoic acid that is anthranilic acid in which one of the hydrogens attached to the nitrogen is replaced by a 2,6-dichloro-3-methylphenyl group. A non-steroidal anti-inflammatory drug, it is used as the sodium salt for the treatment of dysmenorrhoea (painful periods), osteoarthritis and rheumatoid arthritis.
Pharmacological roles (ChEBI): non-steroidal anti-inflammatory drug, antirheumatic drug, antineoplastic agent, anticonvulsant, analgesic, antipyretic, EC 1.13.11.34 (arachidonate 5-lipoxygenase) inhibitor, EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor.
Also known as: Acide meclofenamique, Acido meclofenamico, CI-583, CL-583, INF 4668, INF-4668, Meclofenamate, Meclofenamic acid, NSC-95309, meclofenamic acid, meclotenamic acid, SID24424562
Parent form; salt/anhydrous children: CHEMBL876, CHEMBL1562610
Patent coverage: 11,176 distinct patent families (45,809 SureChEMBL compound mentions), from 3 matched compound structure(s). One matched structure accounts for 45,704 (100%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| PTGS1 | COX-1 | Inhibition | 7.3 | 0% | P23219 |
| PTGS2 | COX-2 | Inhibition | 7.4 | 0% | P35354 |
| TRPM4 | TRPM4 | 5.47 | 0.5% | Q8TD43 |
Broader ChEMBL bioactivity targets: 26 (assay-derived). Sample: Nuclear receptor subfamily 4immunitygroup A member 1, Nuclear receptor ROR-gamma, Thromboxane A2 receptor, Menin/Histone-lysine N-methyltransferase MLL, Cyclooxygenase, Muscarinic acetylcholine receptor M1, Prostaglandin G/H synthase 1, Prostaglandin G/H synthase 2, Alpha-ketoglutarate-dependent dioxygenase FTO, 3’,5’-cyclic-AMP phosphodiesterase 4A.
Bioactivity
ChEMBL activities: 35 potent at pChembl ≥ 5 of 49 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| PTGS2 | 7.96 | IC50 | 11 | nM | CHEMBL_ACT_7768500 |
| PTGS1 | 7.85 | AC50 | 14.2 | nM | CHEMBL_ACT_25205169 |
| PTGS1 | 7.77 | AC50 | 17.1 | nM | CHEMBL_ACT_25206102 |
| PTGS2 | 7.4 | IC50 | 40 | nM | CHEMBL_ACT_859774 |
| P05979 | 7.3 | IC50 | 50 | nM | CHEMBL_ACT_859773 |
| P35355 | 7 | IC50 | 100 | nM | CHEMBL_ACT_320138 |
| P35355 | 7 | IC50 | 100 | nM | CHEMBL_ACT_592653 |
| P35355 | 7 | IC50 | 100 | nM | CHEMBL_ACT_694458 |
| P35355 | 7 | IC50 | 100 | nM | CHEMBL_ACT_997263 |
| Q05769 | 6.7 | IC50 | 200 | nM | CHEMBL_ACT_859776 |
| PTGS1 | 6.69 | IC50 | 203 | nM | CHEMBL_ACT_7768498 |
| PTGS1 | 6.66 | IC50 | 220 | nM | CHEMBL_ACT_12667375 |
| P02692 | 6.59 | Ki | 256 | nM | CHEMBL_ACT_2445259 |
| P02692 | 6.42 | Ki | 379 | nM | CHEMBL_ACT_2445232 |
| Q05769 | 6.4 | IC50 | 400 | nM | CHEMBL_ACT_859777 |
| TTR | 6.32 | Kd | 480 | nM | CHEMBL_ACT_15670989 |
| TTR | 6.3 | IC50 | 504 | nM | CHEMBL_ACT_28697909 |
| AKR1C3 | 6.29 | IC50 | 512 | nM | CHEMBL_ACT_18758607 |
| AKR1C3 | 6.27 | IC50 | 540 | nM | CHEMBL_ACT_12105591 |
| AKR1C3 | 6.27 | IC50 | 540 | nM | CHEMBL_ACT_12667378 |
| PTGS2 | 6.16 | IC50 | 700 | nM | CHEMBL_ACT_12667372 |
| AKR1C1 | 6.13 | IC50 | 740 | nM | CHEMBL_ACT_18758622 |
| RXRA | 6.05 | EC50 | 900 | nM | CHEMBL_ACT_24986579 |
| AKR1C1 | 5.5 | IC50 | 3160 | nM | CHEMBL_ACT_12105570 |
| AKR1C1 | 5.5 | IC50 | 3160 | nM | CHEMBL_ACT_12667384 |
| MAPK1 | 5.5 | IC50 | 3144 | nM | CHEMBL_ACT_7770641 |
| NR4A1 | 5.33 | EC50 | 4700 | nM | CHEMBL_ACT_24986578 |
| FTO | 5.1 | IC50 | 7940 | nM | CHEMBL_ACT_24989147 |
| FTO | 5.1 | IC50 | 8000 | nM | CHEMBL_ACT_24989166 |
| METTL3 | 5.1 | IC50 | 8000 | nM | CHEMBL_ACT_26037627 |
Target pathways
Aggregated over 3 target gene(s): PTGS1, PTGS2, TRPM4.
Top Reactome pathways
11 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Synthesis of Prostaglandins (PG) and Thromboxanes (TX) | 2 | PTGS1, PTGS2 |
| COX reactions | 1 | PTGS1 |
| Synthesis of 15-eicosatetraenoic acid derivatives | 1 | PTGS2 |
| TRP channels | 1 | TRPM4 |
| Interleukin-10 signaling | 1 | PTGS2 |
| Interleukin-4 and Interleukin-13 signaling | 1 | PTGS2 |
| Biosynthesis of DHA-derived SPMs | 1 | PTGS2 |
| Biosynthesis of EPA-derived SPMs | 1 | PTGS2 |
| Biosynthesis of DPAn-3 SPMs | 1 | PTGS2 |
| Biosynthesis of electrophilic ω-3 PUFA oxo-derivatives | 1 | PTGS2 |
| Sensory perception of sweet, bitter, and umami (glutamate) taste | 1 | TRPM4 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| prostaglandin biosynthetic process | 2 |
| response to oxidative stress | 2 |
| regulation of blood pressure | 2 |
| cyclooxygenase pathway | 2 |
| regulation of cell population proliferation | 2 |
| long-chain fatty acid biosynthetic process | 2 |
| lipid metabolic process | 2 |
| fatty acid metabolic process | 2 |
| fatty acid biosynthetic process | 2 |
| prostaglandin metabolic process | 2 |
| prostanoid biosynthetic process | 2 |
| cellular oxidant detoxification | 2 |
| embryo implantation | 1 |
| response to nematode | 1 |
| response to selenium ion | 1 |
Indications & clinical
Indications
3 indications (3 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| rheumatic disorder | 4 | MONDO:0005554 | EFO:0005755 |
2 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 2.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 1 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02930005 | PHASE2 | COMPLETED | Pentosan Polysulfate Sodium and Meclofenamic Acid as Treatments in Patients With Psychotic Disorders |
| NCT02429570 | Not specified | ACTIVE_NOT_RECRUITING | Meclofenamate in Subjects With Recurrent or Progressive Brain Metastasis From Solid Tumor Primary |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
406 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| 3,3’,4’,5-TETRACHLOROSALICYLANILIDE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ACEMETACIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| BROMFENAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CAPSAICIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CAPTOPRIL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CARPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CIANIDANOL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DEXIBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DEXKETOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DICLOFENAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ESFLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ETODOLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ETORICOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| FLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| GLAFENINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| IBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| KETOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| KETOROLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LEVODOPA | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LOXOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LUMIRACOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MEFENAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MELOXICAM | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MOFEZOLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MONOBENZONE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| NAPROXEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| NIMESULIDE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| OMADACYCLINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| OXAPROZIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| PIROXICAM | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| PRIMAQUINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| RANITIDINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ROFECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| SELINEXOR | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| SUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TEGASEROD | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TELOTRISTAT | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TOLMETIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| VALDECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| VORTIOXETINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CURCUMIN | ChEMBL | Phase 3 | PTGS1, PTGS2 |
| RESVERATROL | ChEMBL | Phase 3 | PTGS1, PTGS2 |
| CIMICOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| DERACOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| ENOFELAST | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| FIROCOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| FLUFENAMIC ACID | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| LICOFELONE | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| MAVACOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| MIROPROFEN | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| NIFLUMIC ACID | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| PHENOTHIAZINE | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| PIRMAGREL | ChEMBL | Phase 2 | PTGS1, PTGS2 |
Related Atlas pages
- Genes: PTGS1, PTGS2, TRPM4
- Diseases: rheumatic disorder
- Drugs: 3,3’,4’,5-TETRACHLOROSALICYLANILIDE, Acemetacin, Aspirin, Bromfenac, Capsaicin, Captopril, Carprofen, Celecoxib, Cianidanol, Dexibuprofen, Dexketoprofen, Diclofenac, Diethylstilbestrol, Doxorubicin, Esflurbiprofen, Etodolac, Etoricoxib, Flurbiprofen, Glafenine, Hexachlorophene, Ibuprofen, Indomethacin, Ketorolac, Levodopa, Loxoprofen, Lumiracoxib, Mefenamic Acid, Meloxicam, Mofezolac, Monobenzone, Naproxen, Nimesulide, Omadacycline, Oxaprozin, Piroxicam, Primaquine, Ranitidine, Rofecoxib, Selinexor, Suprofen, Tegaserod, Telotristat, Tolmetin, Troglitazone, Valdecoxib, Vortioxetine, Curcumin, Resveratrol