Mefenamic Acid
drugOn this page
Also known as Acide mefenamiqueAcido mefenamicoCI-473CN-35355ContraflamDysman-250Dysman-500GardanINF-3355J2.344BM01AG01MefenamateMefenaminic acidMeflam 250Meflam 500MendysMephenamic acidMephenaminic acidNSC-94437
Summary
Mefenamic Acid (CHEMBL686) is an approved small-molecule analgesic (ATC M01AG01) targeting PTGS1, PTGS2, and KCNMA1; indicated across 5 conditions including rheumatic disorder and diabetes mellitus.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: M01AG01
- Targets: 5 (PTGS1, PTGS2, KCNMA1…)
- Indications: 5 conditions
- Clinical trials: 12
- Chemistry: 241.28 Da · C15H15NO2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL686 |
| Name | Mefenamic Acid |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 4044 |
| ChEBI | CHEBI:6717 |
| ATC | M01AG01 |
| Molecular formula | C15H15NO2 |
| Molecular weight | 241.28 |
| InChIKey | HYYBABOKPJLUIN-UHFFFAOYSA-N |
SMILES: CC1=C(C(=CC=C1)NC2=CC=CC=C2C(=O)O)C
IUPAC name: 2-(2,3-dimethylanilino)benzoic acid
ChEBI definition: An aminobenzoic acid that is anthranilic acid in which one of the hydrogens attached to the nitrogen is replaced by a 2,3-dimethylphenyl group. Although classed as a non-steroidal anti-inflammatory drug, its anti-inflammatory properties are considered to be minor. It is used to relieve mild to moderate pain, including headaches, dental pain, osteoarthritis and rheumatoid arthritis.
Pharmacological roles (ChEBI): analgesic, antirheumatic drug, non-steroidal anti-inflammatory drug, antipyretic, EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor.
Other ChEBI roles (chemical / environmental): environmental contaminant, xenobiotic.
Also known as: Acide mefenamique, Acido mefenamico, CI-473, CN-35355, Contraflam, Dysman-250, Dysman-500, Gardan, INF-3355, J2.344B, M01AG01, Mefenamate
Patent coverage: 16,860 distinct patent families (61,835 SureChEMBL compound mentions), from 4 matched compound structure(s). One matched structure accounts for 56,563 (91%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| PTGS1 | COX-1 | Inhibition | 4.6 | 0% | P23219 |
| PTGS2 | COX-2 | Inhibition | 5.54 | 0% | P35354 |
| KCNMA1 | KCa1.1 | 4 | 0.1% | Q12791 | |
| TRPM3 | TRPM3 | 0.1% | Q9HCF6 | ||
| KCNQ1 | Kv7.1 | 0.2% | P51787 |
Broader ChEMBL bioactivity targets: 24 (assay-derived). Sample: Tyrosyl-DNA phosphodiesterase 1, Nuclear receptor ROR-gamma, Prelamin-A/C, Aldo-keto reductase family 1 member B1, Dihydrofolate reductase, Menin/Histone-lysine N-methyltransferase MLL, Muscarinic acetylcholine receptor M1, Prostaglandin G/H synthase 1, Prostaglandin G/H synthase 2, Myeloperoxidase.
Bioactivity
ChEMBL activities: 28 potent at pChembl ≥ 5 of 43 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NAPRT | 10.3 | Ki | 0.05 | nM | CHEMBL_ACT_19323254 |
| TDP1 | 7.95 | Potency | 11.2 | nM | CHEMBL_ACT_3928025 |
| PTGS1 | 7.94 | AC50 | 11.5 | nM | CHEMBL_ACT_25205171 |
| PTGS1 | 7.46 | AC50 | 34.3 | nM | CHEMBL_ACT_25206104 |
| PTGS1 | 6.94 | IC50 | 116 | nM | CHEMBL_ACT_7747149 |
| AKR1C2 | 6.66 | Ki | 220 | nM | CHEMBL_ACT_12106896 |
| Q63921 | 6.58 | AC50 | 260 | nM | CHEMBL_ACT_25174166 |
| AKR1C3 | 6.52 | Ki | 300 | nM | CHEMBL_ACT_12106880 |
| AKR1C3 | 6.25 | IC50 | 560 | nM | CHEMBL_ACT_12667377 |
| PTGS2 | 6.22 | IC50 | 602 | nM | CHEMBL_ACT_7747151 |
| AKR1C1 | 6.09 | Ki | 810 | nM | CHEMBL_ACT_12106907 |
| MPO | 6.01 | IC50 | 980 | nM | CHEMBL_ACT_18064406 |
| AKR1B10 | 5.8 | IC50 | 1600 | nM | CHEMBL_ACT_15210816 |
| AKR1B10 | 5.8 | IC50 | 1600 | nM | CHEMBL_ACT_29120256 |
| MPO | 5.66 | IC50 | 2210 | nM | CHEMBL_ACT_18064457 |
| PTGS2 | 5.54 | IC50 | 2900 | nM | CHEMBL_ACT_12667371 |
| AKR1C1 | 5.41 | IC50 | 3910 | nM | CHEMBL_ACT_12667383 |
| CYP1A2 | 5.3 | AC50 | 5012 | nM | CHEMBL_ACT_6024931 |
| P04058 | 5.21 | IC50 | 6120 | nM | CHEMBL_ACT_14530724 |
| AKR1C2 | 5.16 | IC50 | 6970 | nM | CHEMBL_ACT_12667380 |
| CYP2C9 | 5.1 | Potency | 7943 | nM | CHEMBL_ACT_5073421 |
| CYP2C9 | 5.1 | AC50 | 7943 | nM | CHEMBL_ACT_5998138 |
| HIF1A | 5 | Potency | 10000 | nM | CHEMBL_ACT_4125744 |
| HIF1A | 5 | Potency | 10000 | nM | CHEMBL_ACT_4132822 |
| HIF1A | 5 | Potency | 10000 | nM | CHEMBL_ACT_4519591 |
| HIF1A | 5 | Potency | 10000 | nM | CHEMBL_ACT_4519953 |
| CYP3A4 | 5 | Potency | 10000 | nM | CHEMBL_ACT_4973798 |
| CYP3A4 | 5 | Potency | 10000 | nM | CHEMBL_ACT_5042824 |
Target pathways
Aggregated over 5 target gene(s): PTGS1, PTGS2, KCNMA1, TRPM3, KCNQ1.
Top Reactome pathways
27 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Neuronal System | 2 | KCNMA1, KCNQ1 |
| Potassium Channels | 2 | KCNMA1, KCNQ1 |
| Synthesis of Prostaglandins (PG) and Thromboxanes (TX) | 2 | PTGS1, PTGS2 |
| Hemostasis | 1 | KCNMA1 |
| Ca2+ activated K+ channels | 1 | KCNMA1 |
| Voltage gated Potassium channels | 1 | KCNQ1 |
| COX reactions | 1 | PTGS1 |
| Synthesis of 15-eicosatetraenoic acid derivatives | 1 | PTGS2 |
| TRP channels | 1 | TRPM3 |
| Nitric oxide stimulates guanylate cyclase | 1 | KCNMA1 |
| Muscle contraction | 1 | KCNQ1 |
| Platelet homeostasis | 1 | KCNMA1 |
| cGMP effects | 1 | KCNMA1 |
| Phase 3 - rapid repolarisation | 1 | KCNQ1 |
| Cardiac conduction | 1 | KCNQ1 |
| Phase 2 - plateau phase | 1 | KCNQ1 |
| Interleukin-10 signaling | 1 | PTGS2 |
| Interleukin-4 and Interleukin-13 signaling | 1 | PTGS2 |
| Biosynthesis of DHA-derived SPMs | 1 | PTGS2 |
| Biosynthesis of EPA-derived SPMs | 1 | PTGS2 |
| Biosynthesis of DPAn-3 SPMs | 1 | PTGS2 |
| Biosynthesis of electrophilic ω-3 PUFA oxo-derivatives | 1 | PTGS2 |
| Sensory processing of sound | 1 | KCNMA1 |
| Sensory processing of sound by inner hair cells of the cochlea | 1 | KCNMA1 |
| Sensory processing of sound by outer hair cells of the cochlea | 1 | KCNMA1 |
| Acetylcholine inhibits contraction of outer hair cells | 1 | KCNMA1 |
| Sensory Perception | 1 | KCNMA1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| regulation of blood pressure | 3 |
| monoatomic ion transport | 3 |
| monoatomic ion transmembrane transport | 3 |
| transmembrane transport | 3 |
| prostaglandin biosynthetic process | 2 |
| response to oxidative stress | 2 |
| cyclooxygenase pathway | 2 |
| regulation of cell population proliferation | 2 |
| long-chain fatty acid biosynthetic process | 2 |
| lipid metabolic process | 2 |
| fatty acid metabolic process | 2 |
| fatty acid biosynthetic process | 2 |
| prostaglandin metabolic process | 2 |
| prostanoid biosynthetic process | 2 |
| cellular oxidant detoxification | 2 |
Indications & clinical
Indications
5 indications (2 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| rheumatic disorder | 4 | MONDO:0005554 | EFO:0005755 |
| diabetes mellitus | 1 | MONDO:0005015 | EFO:0000400 |
3 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 12.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE1 | 5 |
| PHASE4 | 2 |
| PHASE2/PHASE3 | 2 |
| PHASE2 | 2 |
| Not specified | 1 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT01295294 | PHASE4 | COMPLETED | Management of Initial Bleeding/Spotting Associated With the Levonorgestrel-releasing Intrauterine System (MIRENA) |
| NCT07466342 | PHASE4 | COMPLETED | Vitamin E Plus Mefenamic Acid Versus Mefenamic Acid Alone for Treating Primary Dysmenorrhea in Women |
| NCT01942122 | PHASE2/PHASE3 | COMPLETED | DLBS1442 for The Treatment of Pain in Patients Suspected Endometriosis |
| NCT03323671 | PHASE2/PHASE3 | COMPLETED | Preemptive Analgesia for Primary Dysmenorrhoea |
| NCT02183025 | PHASE2 | COMPLETED | Efficacy and Safety Study of Meloxicam Versus Mefenamic Acid in Patients With Dysmenorrhea |
| NCT02417337 | PHASE2 | COMPLETED | Efficacy of Different Drugs to Control Post Root Canal Treatment Pain |
| NCT03070678 | PHASE1 | COMPLETED | Interaction Study to Evaluate the Effects of Mefenamic Acid on the Pharmacokinetics and Pharmacodynamics of Sotagliflozin in Healthy Male and Female Subjects |
| NCT04902105 | PHASE1 | COMPLETED | Drug-Drug Interaction Study to Evaluate the Effect of Inhibition of UGTs on the PK of Ecopipam and Its Active Metabolite |
| NCT05064449 | PHASE1 | COMPLETED | A Study of Soticlestat With Itraconazole and Mefenamic Acid in Healthy Adults |
| NCT05181007 | PHASE1 | COMPLETED | Drug-drug Interaction Between Ciprofol and Mefanamic Acid or Valproate |
| NCT06277609 | PHASE1 | COMPLETED | A Trial Investigating Lu AF28996 in Healthy Adult Participants |
| NCT06369012 | Not specified | COMPLETED | Management of Abnormal Uterine Bleeding |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline or drug-level clinical/variant annotations in PharmGKB for this molecule.
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
442 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| CANNABIDIOL | ChEMBL + PubChem | Phase 4 (approved) | KCNMA1, PTGS2 |
| ETRAVIRINE | ChEMBL + PubChem | Phase 4 (approved) | KCNQ1, PTGS1 |
| SILODOSIN | ChEMBL + PubChem | Phase 4 (approved) | KCNQ1, PTGS1 |
| TOLTERODINE | ChEMBL + PubChem | Phase 4 (approved) | KCNQ1, PTGS1 |
| 3,3’,4’,5-TETRACHLOROSALICYLANILIDE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ACEMETACIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ASPIRIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| BROMFENAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CAPSAICIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CAPTOPRIL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CARPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CELECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CIANIDANOL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DEXIBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DEXKETOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DICLOFENAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ESFLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ETODOLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ETORICOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| FLURBIPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| GLAFENINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| HEXACHLOROPHENE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| IBUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| INDOMETHACIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| KETOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| KETOROLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LEVODOPA | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LOXOPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| LUMIRACOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MECLOFENAMIC ACID | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MELOXICAM | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MOFEZOLAC | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| MONOBENZONE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| NAPROXEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| NIMESULIDE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| OMADACYCLINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| OXAPROZIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| PIROXICAM | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| PRIMAQUINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| RANITIDINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| ROFECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| SELINEXOR | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| SUPROFEN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TEGASEROD | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TELOTRISTAT | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TOLMETIN | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| TROGLITAZONE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| VALDECOXIB | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| VORTIOXETINE | ChEMBL | Phase 4 (approved) | PTGS1, PTGS2 |
| CURCUMIN | ChEMBL | Phase 3 | PTGS1, PTGS2 |
| RESVERATROL | ChEMBL | Phase 3 | PTGS1, PTGS2 |
| CIMICOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| DERACOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| ENOFELAST | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| FIROCOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| FLUFENAMIC ACID | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| LICOFELONE | ChEMBL | Phase 2 | PTGS1, PTGS2 |
| MAVACOXIB | ChEMBL | Phase 2 | PTGS1, PTGS2 |
Related Atlas pages
- Genes: PTGS1, PTGS2, KCNMA1, TRPM3, KCNQ1
- Diseases: rheumatic disorder
- Drugs: Cannabidiol, Etravirine, Silodosin, Tolterodine, 3,3’,4’,5-TETRACHLOROSALICYLANILIDE, Acemetacin, Aspirin, Bromfenac, Capsaicin, Captopril, Carprofen, Celecoxib, Cianidanol, Dexibuprofen, Dexketoprofen, Diclofenac, Diethylstilbestrol, Doxorubicin, Esflurbiprofen, Etodolac, Etoricoxib, Flurbiprofen, Glafenine, Hexachlorophene, Ibuprofen, Indomethacin, Ketorolac, Levodopa, Loxoprofen, Lumiracoxib, Meclofenamic Acid, Meloxicam, Mofezolac, Monobenzone, Naproxen, Nimesulide, Omadacycline, Oxaprozin, Piroxicam, Primaquine, Ranitidine, Rofecoxib, Selinexor, Suprofen, Tegaserod, Telotristat, Tolmetin, Troglitazone, Valdecoxib, Vortioxetine, Curcumin, Resveratrol