Memantine
drugOn this page
Also known as D-145DRG-0267MemantinaNSC-757843SID26751885SID90341818SID104171191SID50104569SID144203750SID170464999MEMANTINE HYDROCHLORIDE
Summary
Memantine (CHEMBL807) is an approved small-molecule dopaminergic agent (ATC N06DX01) targeting GRIN2C; indicated across 43 conditions including dementia and autism spectrum disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N06DX01
- Targets: 1 (GRIN2C)
- Indications: 43 conditions
- Clinical trials: 201
- Chemistry: 179.3 Da · C12H21N
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL807 |
| Name | Memantine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 4054 |
| ChEBI | CHEBI:64312 |
| ATC | N06DX01 |
| Molecular formula | C12H21N |
| Molecular weight | 179.3 |
| InChIKey | BUGYDGFZZOZRHP-UHFFFAOYSA-N |
SMILES: CC12CC3CC(C1)(CC(C3)(C2)N)C
IUPAC name: 3,5-dimethyladamantan-1-amine
ChEBI definition: A primary aliphatic amine that is the 3,5-dimethyl derivative of 1-aminoadamantane. A low to moderate affinity uncompetitive (open-channel); NMDA receptor antagonist which binds preferentially to the NMDA receptor-operated cation channels.
Pharmacological roles (ChEBI): dopaminergic agent, antiparkinson drug, NMDA receptor antagonist, neuroprotective agent, antidepressant.
Also known as: D-145, DRG-0267, Memantina, Memantine, NSC-757843, memantine, SID26751885, SID90341818, SID104171191, SID50104569, SID144203750, SID170464999
Parent form; salt/anhydrous children: CHEMBL1699, CHEMBL1882685
Patent coverage: 9,236 distinct patent families (34,597 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| GRIN2C | GluN2C | Antagonist | 6.15 | 0.2% | Q14957 |
Broader ChEMBL bioactivity targets: 19 (assay-derived). Sample: Prelamin-A/C, Glutamate NMDA receptor; GRIN1/GRIN2B, Glutamate NMDA receptor; GRIN1/GRIN2A, Glutamate NMDA receptor, Estrogen receptor, Glutamate [NMDA] receptor, Glutamate NMDA receptor; Grin1/Grin2b, Glutamate NMDA receptor; Grin1/Grin2a, Acetylcholinesterase, Kappa-type opioid receptor.
Bioactivity
ChEMBL activities: 36 potent at pChembl ≥ 5 of 48 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| GRIN1 | 9.02 | IC50 | 0.95 | nM | CHEMBL_ACT_13348817 |
| ACHE | 8.31 | IC50 | 4.9 | nM | CHEMBL_ACT_23223834 |
| GRIN2D | 6.27 | Ki | 540 | nM | CHEMBL_ACT_22479106 |
| GRIN2D | 6.27 | Ki | 540 | nM | CHEMBL_ACT_844198 |
| Q00961 | 6.16 | Ki | 700 | nM | CHEMBL_ACT_237414 |
| ACHE | 6.11 | IC50 | 780 | nM | CHEMBL_ACT_26154518 |
| GRIN1 | 6.11 | IC50 | 780 | nM | CHEMBL_ACT_29100840 |
| GRIN1 | 6.08 | IC50 | 840 | nM | CHEMBL_ACT_29100834 |
| GRIN1 | 6.04 | IC50 | 911 | nM | CHEMBL_ACT_1912604 |
| GRIN1 | 6 | Ki | 1000 | nM | CHEMBL_ACT_18854870 |
| P35439 | 6 | IC50 | 1000 | nM | CHEMBL_ACT_24920111 |
| GRIN1 | 5.99 | IC50 | 1020 | nM | CHEMBL_ACT_1912595 |
| P35439 | 5.96 | IC50 | 1090 | nM | CHEMBL_ACT_15718262 |
| GRIN2D | 5.92 | Ki | 1200 | nM | CHEMBL_ACT_14530270 |
| P35439 | 5.82 | IC50 | 1500 | nM | CHEMBL_ACT_18854953 |
| P35439 | 5.82 | IC50 | 1500 | nM | CHEMBL_ACT_2409408 |
| P35439 | 5.82 | IC50 | 1500 | nM | CHEMBL_ACT_2479407 |
| P35439 | 5.82 | IC50 | 1500 | nM | CHEMBL_ACT_2586133 |
| P35439 | 5.82 | IC50 | 1500 | nM | CHEMBL_ACT_3130499 |
| ESR1 | 5.8 | AC50 | 1600 | nM | CHEMBL_ACT_25166919 |
| P35439 | 5.58 | IC50 | 2660 | nM | CHEMBL_ACT_26188889 |
| P35439 | 5.57 | EC50 | 2720 | nM | CHEMBL_ACT_27394940 |
| GRIN1 | 5.5 | IC50 | 3162 | nM | CHEMBL_ACT_29198045 |
| P35439 | 5.41 | AC50 | 3937 | nM | CHEMBL_ACT_25120184 |
| GRIN1 | 5.36 | IC50 | 4360 | nM | CHEMBL_ACT_14578586 |
| GRIN1 | 5.36 | IC50 | 4400 | nM | CHEMBL_ACT_15676411 |
| GRIN1 | 5.28 | IC50 | 5200 | nM | CHEMBL_ACT_15676446 |
| GRIN1 | 5.26 | IC50 | 5500 | nM | CHEMBL_ACT_3274060 |
| P35439 | 5.25 | IC50 | 5570 | nM | CHEMBL_ACT_26188894 |
| GRIN1 | 5.25 | IC50 | 5600 | nM | CHEMBL_ACT_3274063 |
Target pathways
Aggregated over 1 target gene(s): GRIN2C.
Top Reactome pathways
6 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Unblocking of NMDA receptors, glutamate binding and activation | 1 | GRIN2C |
| Neurexins and neuroligins | 1 | GRIN2C |
| Synaptic adhesion-like molecules | 1 | GRIN2C |
| Assembly and cell surface presentation of NMDA receptors | 1 | GRIN2C |
| Negative regulation of NMDA receptor-mediated neuronal transmission | 1 | GRIN2C |
| Long-term potentiation | 1 | GRIN2C |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| glutamate receptor signaling pathway | 1 |
| brain development | 1 |
| response to wounding | 1 |
| directional locomotion | 1 |
| ionotropic glutamate receptor signaling pathway | 1 |
| synaptic transmission, glutamatergic | 1 |
| negative regulation of protein catabolic process | 1 |
| regulation of synaptic plasticity | 1 |
| regulation of neuronal synaptic plasticity | 1 |
| neuromuscular process controlling balance | 1 |
| positive regulation of synaptic transmission, glutamatergic | 1 |
| excitatory postsynaptic potential | 1 |
| long-term synaptic potentiation | 1 |
| calcium ion transmembrane import into cytosol | 1 |
| monoatomic cation transmembrane transport | 1 |
Indications & clinical
Indications
43 indications (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| dementia | 4 | MONDO:0001627 | HP:0000726 |
| autism spectrum disorder | 3 | MONDO:0005258 | EFO:0003756 |
| fibromyalgia | 3 | MONDO:0005546 | EFO:0005687 |
| obsessive-compulsive disorder | 3 | MONDO:0008114 | EFO:0004242 |
| anxiety | 3 | MONDO:0011918 | EFO:0005230 |
| open-angle glaucoma | 3 | MONDO:0005338 | EFO:0004190 |
| substance-related disorder | 3 | MONDO:0002494 | MONDO:0002491 |
| drug dependence | 3 | MONDO:0005303 | EFO:0003890 |
| depressive disorder | 3 | MONDO:0002050 | MONDO:0002050 |
| Alzheimer disease | 3 | MONDO:0004975 | MONDO:0004975 |
| Parkinson disease | 3 | MONDO:0005180 | MONDO:0005180 |
| migraine disorder | 3 | MONDO:0005277 | MONDO:0005277 |
| multiple sclerosis | 3 | MONDO:0005301 | MONDO:0005301 |
| bipolar disorder | 3 | MONDO:0004985 | MONDO:0004985 |
| autism | 2 | MONDO:0005260 | EFO:0003758 |
| cocaine dependence | 2 | MONDO:0005186 | EFO:0002610 |
| opiate dependence | 2 | MONDO:0005530 | EFO:0005611 |
| neuralgia | 2 | MONDO:0021667 | EFO:0005762 |
| glioblastoma | 2 | MONDO:0018177 | EFO:0000519 |
| heroin dependence | 2 | MONDO:0005367 | EFO:0004240 |
| schizoaffective disorder | 2 | MONDO:0005487 | EFO:0005411 |
| alcohol abuse | 2 | MONDO:0002046 | MONDO:0002046 |
| psychotic disorder | 2 | MONDO:0005485 | EFO:0005407 |
| trichotillomania | 2 | MONDO:0013189 | HP:0012167 |
| amyotrophic lateral sclerosis | 2 | MONDO:0004976 | MONDO:0004976 |
| Huntington disease | 2 | MONDO:0007739 | MONDO:0007739 |
| fragile X syndrome | 2 | MONDO:0010383 | MONDO:0010383 |
| systemic lupus erythematosus | 2 | MONDO:0007915 | MONDO:0007915 |
| nicotine dependence | 1 | MONDO:0008575 | EFO:0003768 |
| obesity disorder | 1 | MONDO:0011122 | EFO:0001073 |
| major depressive disorder | 1 | MONDO:0002009 | MONDO:0002009 |
| central nervous system disorder | 1 | MONDO:0002602 | EFO:0009386 |
| neoplasm | 1 | MONDO:0005070 | MONDO:0004992 |
| central nervous system cancer | 0 | MONDO:0002714 | EFO:0000326 |
| central nervous system neoplasm | 0 | MONDO:0006130 | EFO:1000158 |
8 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 201.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE4 | 52 |
| PHASE2 | 48 |
| PHASE3 | 37 |
| Not specified | 23 |
| PHASE1 | 17 |
| PHASE2/PHASE3 | 14 |
| PHASE1/PHASE2 | 5 |
| EARLY_PHASE1 | 5 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT00120874 | PHASE4 | COMPLETED | Memantine and Comprehensive, Individualized Management of Alzheimer’s Disease and Caregiver Training |
| NCT00183729 | PHASE4 | COMPLETED | Memantine Treatment for Improving Rehabilitation Outcomes and Preventing Depression in Older Adults |
| NCT00187525 | PHASE4 | COMPLETED | A 52 Week Open Label Trial of Memantine for Frontotemporal Lobar Degeneration |
| NCT00196703 | PHASE4 | UNKNOWN | Memantine and Constraint-Induced Language Therapy in Chronic Poststroke Aphasia:A Randomized Controlled Trial |
| NCT00234637 | PHASE4 | COMPLETED | Rivastigmine Monotherapy and Combination Therapy With Memantine in Patients With Moderately Severe Alzheimer’s Disease Who Failed to Benefit From Previous Cholinesterase Inhibitor Treatment |
| NCT00280774 | PHASE4 | COMPLETED | Memantine for Corticosteroid-Induced Mood and Declarative Memory Changes |
| NCT00283309 | PHASE4 | TERMINATED | Memantine or Riluzole Prophylaxis for Corticosteroid-induced Mood and Declarative Memory Changes |
| NCT00305578 | PHASE4 | COMPLETED | Memantine Augmentation of Lamotrigine Incomplete-Response in Bipolar Depression |
| NCT00305903 | PHASE4 | COMPLETED | Safety and Tolerability of Rivastigmine With Add-on Memantine in Patients With Probable Alzheimer’s Disease |
| NCT00330655 | PHASE4 | COMPLETED | An Open-Label Trial of Memantine in the Treatment of Binge Eating Disorder |
| NCT00344682 | PHASE4 | COMPLETED | Memantine Augmentation of Antidepressants |
| NCT00371059 | PHASE4 | COMPLETED | Memantine for Agitation in Dementia |
| NCT00401167 | PHASE4 | COMPLETED | Memantine for Agitation and Aggression in Severe Alzheimer’s Disease |
| NCT00439699 | PHASE4 | COMPLETED | A Pilot Clinical Trial Of Memantine for Essential Tremor |
| NCT00462228 | PHASE4 | TERMINATED | Effect of Namenda on Short Term Memory and Attention in Patients With Mild to Moderate Traumatic Brain Injury |
| NCT00469456 | PHASE4 | COMPLETED | Effect of Memantine on Functional Communication in Patients With Alzheimer’s Disease |
| NCT00476008 | PHASE4 | COMPLETED | Delaying the Progression of Driving Impairment in Individuals With Mild Alzheimer’s Disease |
| NCT00505167 | PHASE4 | COMPLETED | Memantine Versus Donepezil in Early Stages of Alzheimer’s Disease |
| NCT00545974 | PHASE4 | COMPLETED | Memantine (10mg BID) for the Frontal and Temporal Subtypes of Frontotemporal Dementia |
| NCT00551161 | PHASE4 | COMPLETED | Magnetic Resonance Spectroscopy Study of Memantine in Alzheimer’s Disease |
| NCT00586066 | PHASE4 | COMPLETED | Memantine and Cognitive Dysfunction in Bipolar Disorder |
| NCT00586573 | PHASE4 | COMPLETED | Open-Label Pilot Study of Namenda in Adult Subjects With ADHD and ADHD NOS |
| NCT00638027 | PHASE4 | COMPLETED | Memantine for Spasticity in MS Patients |
| NCT00640198 | PHASE4 | COMPLETED | Memantine and Intensive Speech-Language Therapy in Aphasia |
| NCT00646204 | PHASE4 | COMPLETED | Namenda (Memantine) for Non-motor Symptoms in Parkinson’s Disease |
| NCT00649220 | PHASE4 | TERMINATED | Memantine and Antipsychotics Use |
| NCT00652457 | PHASE4 | COMPLETED | Study of Memantine to Treat Huntington’s Disease |
| NCT00757978 | PHASE4 | COMPLETED | Memantine as Adjunctive Therapy for Schizophrenia Negative Symptoms |
| NCT00768261 | PHASE4 | COMPLETED | Corticolimbic Degeneration and Treatment of Dementia |
| NCT00800709 | PHASE4 | COMPLETED | Memantine and Changes of Biological Markers and Brain PET Imaging in Alzheimer’s Disease |
| NCT00855686 | PHASE4 | COMPLETED | Memantine Versus Placebo in Parkinson’s Disease Dementia or Dementia With Lewy Bodies |
| NCT00862940 | PHASE4 | COMPLETED | A Clinical Study Evaluating the Effects of Memantine on Brain Atrophy in Patients With Alzheimer’s Disease |
| NCT00866060 | PHASE4 | UNKNOWN | Donepezil and Memantine in Moderate to Severe Alzheimer’s Disease |
| NCT00933608 | PHASE4 | COMPLETED | Effects of Memantine on Magnetic Resonance (MR) Spectroscopy in Subjects at Risk for Alzheimer’s Disease |
| NCT01025466 | PHASE4 | COMPLETED | Exelon Patch and Combination With Memantine Comparative Trial |
| NCT01032759 | PHASE4 | TERMINATED | Memantine and Postoperative Pain |
| NCT01041313 | PHASE4 | UNKNOWN | Memantine for Post-Operative Pain Control |
| NCT01108029 | PHASE4 | COMPLETED | Study of Memantine for Gait Disorders And Attention Deficit In Parkinson’s Disease |
| NCT01112683 | PHASE4 | COMPLETED | Efficacy and Safety of Memantine Hydrochloride in Enhancing the Cognitive Abilities of Young Adults With Down Syndrome |
| NCT01333865 | PHASE4 | COMPLETED | A Study of Memantine Hydrochloride (Namenda®) for Cognitive and Behavioral Impairment in Adults With Autism Spectrum Disorders |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 1 clinical and 2 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
29 molecules share ≥1 primary target. Top 29 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| AMANTADINE | ChEMBL + PubChem | Phase 4 (approved) | GRIN2C |
| CHLORPROMAZINE | ChEMBL + PubChem | Phase 4 (approved) | GRIN2C |
| DEXTROMETHORPHAN | ChEMBL + PubChem | Phase 4 (approved) | GRIN2C |
| KETAMINE | ChEMBL + PubChem | Phase 4 (approved) | GRIN2C |
| LEVORPHANOL | ChEMBL + PubChem | Phase 4 (approved) | GRIN2C |
| ORPHENADRINE | ChEMBL + PubChem | Phase 4 (approved) | GRIN2C |
| CYCLOSERINE | ChEMBL | Phase 4 (approved) | GRIN2C |
| PROCYCLIDINE | ChEMBL | Phase 4 (approved) | GRIN2C |
| GLUTAMIC ACID | ChEMBL + PubChem | Phase 3 (approved) | GRIN2C |
| DALZANEMDOR | ChEMBL | Phase 3 | GRIN2C |
| ESMETHADONE | ChEMBL | Phase 3 | GRIN2C |
| ALPHAMETHADOL | ChEMBL | Phase 2 | GRIN2C |
| BETAMETHADOL | ChEMBL | Phase 2 | GRIN2C |
| BUDIPINE | ChEMBL | Phase 2 | GRIN2C |
| DEXTRORPHAN | ChEMBL | Phase 2 | GRIN2C |
| DIZOCILPINE | ChEMBL | Phase 2 | GRIN2C |
| IFENPRODIL | ChEMBL | Phase 2 | GRIN2C |
| LANICEMINE | ChEMBL | Phase 2 | GRIN2C |
| LEVOMETHADONE | ChEMBL | Phase 2 | GRIN2C |
| LICOSTINEL | ChEMBL | Phase 2 | GRIN2C |
| PERZINFOTEL | ChEMBL | Phase 2 | GRIN2C |
| PHENCYCLIDINE | ChEMBL | Phase 2 | GRIN2C |
| RACEMETHORPHAN | ChEMBL | Phase 2 | GRIN2C |
| RADIPRODIL | ChEMBL | Phase 2 | GRIN2C |
| SELFOTEL | ChEMBL | Phase 2 | GRIN2C |
| TEZAMPANEL | ChEMBL | Phase 2 | GRIN2C |
| TRAXOPRODIL | ChEMBL | Phase 2 | GRIN2C |
| ZELQUISTINEL | ChEMBL | Phase 2 | GRIN2C |
| Nimodipine | PubChem | Approved | GRIN2C |
Related Atlas pages
- Genes: GRIN2C
- Diseases: dementia, autism spectrum disorder, fibromyalgia, obsessive-compulsive disorder, anxiety, open-angle glaucoma, substance-related disorder, drug dependence, depressive disorder, Alzheimer disease, Parkinson disease, migraine disorder, multiple sclerosis, bipolar disorder
- Drugs: Amantadine, Chlorpromazine, Dextromethorphan, Ketamine, Levorphanol, Orphenadrine, Cycloserine, Procyclidine, Glutamic Acid, Dalzanemdor, Esmethadone, Nimodipine