Mesoridazine
drugOn this page
Also known as LidanarMesoridazinaNC-123NSC-186066TPS-23SID26756521SID447728SID144203603SID144205571SID170465272
Summary
Mesoridazine (CHEMBL1088) is an approved small-molecule dopaminergic antagonist (ATC N05AC03) targeting HTR1A, DRD1, and DRD2; indicated across 1 condition including psychotic disorder.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: N05AC03
- Targets: 6 (HTR1A, DRD1, DRD2…)
- Indications: 1 condition
- Chemistry: 386.6 Da · C21H26N2OS2
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL1088 |
| Name | Mesoridazine |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | no |
| PubChem CID | 4078 |
| ChEBI | CHEBI:6780 |
| ATC | N05AC03 |
| Molecular formula | C21H26N2OS2 |
| Molecular weight | 386.6 |
| InChIKey | SLVMESMUVMCQIY-UHFFFAOYSA-N |
SMILES: CN1CCCCC1CCN2C3=CC=CC=C3SC4=C2C=C(C=C4)S(=O)C
IUPAC name: 10-[2-(1-methylpiperidin-2-yl)ethyl]-2-methylsulfinylphenothiazine
ChEBI definition: A phenothiazine substituted at position 2 (para to the S atom) by a methylsulfinyl group, and on the nitrogen by a 2-(1-methylpiperidin-2-yl)ethyl group.
Pharmacological roles (ChEBI): dopaminergic antagonist, first generation antipsychotic.
Also known as: Lidanar, Mesoridazina, Mesoridazine, NC-123, NSC-186066, TPS-23, mesoridazine, SID26756521, SID447728, MESORIDAZINE, SID144203603, SID144205571
Parent form; salt/anhydrous children: CHEMBL1201052
Patent coverage: 3,218 distinct patent families (12,814 SureChEMBL compound mentions), from 2 matched compound structure(s). One matched structure accounts for 12,748 (99%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| HTR1A | 5-HT1A receptor | Antagonist | 6.98 | 0% | P08908 |
| DRD1 | D1 receptor | Antagonist | 6.99 | 0% | P21728 |
| DRD2 | D2 receptor | Antagonist | 8.66 | 0% | P14416 |
| DRD3 | D3 receptor | Antagonist | 7.64 | 0% | P35462 |
| HTR2A | 5-HT2A receptor | Antagonist | 7.26 | 0% | P28223 |
| HTR2C | 5-HT2C receptor | Antagonist | 6.39 | 0% | P28335 |
Broader ChEMBL bioactivity targets: 12 (assay-derived). Sample: Microtubule-associated protein tau, Alpha-2A adrenergic receptor, D(1A) dopamine receptor, Muscarinic acetylcholine receptor M2, 5-hydroxytryptamine receptor 1A, Sodium-dependent noradrenaline transporter, Alpha-1A adrenergic receptor, Mu-type opioid receptor, D(3) dopamine receptor, Sodium-dependent dopamine transporter.
Bioactivity
ChEMBL activities: 14 potent at pChembl ≥ 5 of 18 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| ADRA1A | 7.77 | AC50 | 17.1 | nM | CHEMBL_ACT_25218727 |
| DRD3 | 7.71 | AC50 | 19.7 | nM | CHEMBL_ACT_25194379 |
| DRD1 | 7.15 | AC50 | 71.2 | nM | CHEMBL_ACT_25115063 |
| CHRM2 | 6.82 | AC50 | 153 | nM | CHEMBL_ACT_25195589 |
| HTR1A | 6.67 | AC50 | 214.4 | nM | CHEMBL_ACT_25164877 |
| KCNH2 | 6.5 | IC50 | 320 | nM | CHEMBL_ACT_2295026 |
| KCNH2 | 6.5 | IC50 | 320 | nM | CHEMBL_ACT_2295137 |
| KCNH2 | 6.5 | IC50 | 316.2 | nM | CHEMBL_ACT_5218929 |
| KCNH2 | 6.49 | IC50 | 323.6 | nM | CHEMBL_ACT_1056883 |
| KCNH2 | 6.49 | IC50 | 323.6 | nM | CHEMBL_ACT_2358296 |
| KCNH2 | 6.26 | IC50 | 549.5 | nM | CHEMBL_ACT_1523681 |
| ADRA2A | 5.59 | AC50 | 2587 | nM | CHEMBL_ACT_25156282 |
| OPRM1 | 5.52 | AC50 | 2991 | nM | CHEMBL_ACT_25158028 |
| KCNH2 | 5.44 | AC50 | 3600 | nM | CHEMBL_ACT_25117376 |
Target pathways
Aggregated over 6 target gene(s): HTR1A, DRD1, DRD2, DRD3, HTR2A, HTR2C.
Top Reactome pathways
11 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Signal Transduction | 3 | HTR1A, HTR2A, HTR2C |
| Signaling by GPCR | 3 | HTR1A, HTR2A, HTR2C |
| Class A/1 (Rhodopsin-like receptors) | 3 | HTR1A, HTR2A, HTR2C |
| Amine ligand-binding receptors | 3 | HTR1A, HTR2A, HTR2C |
| Dopamine receptors | 3 | DRD1, DRD2, DRD3 |
| Serotonin receptors | 3 | HTR1A, HTR2A, HTR2C |
| GPCR ligand binding | 3 | HTR1A, HTR2A, HTR2C |
| GPCR downstream signalling | 2 | HTR2A, HTR2C |
| G alpha (q) signalling events | 2 | HTR2A, HTR2C |
| G alpha (s) signalling events | 1 | DRD1 |
| G alpha (i) signalling events | 1 | DRD3 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| G protein-coupled receptor signaling pathway | 6 |
| signal transduction | 6 |
| G protein-coupled receptor signaling pathway, coupled to cyclic nucleotide second messenger | 4 |
| response to xenobiotic stimulus | 4 |
| behavioral response to cocaine | 4 |
| locomotory behavior | 4 |
| response to cocaine | 4 |
| intracellular calcium ion homeostasis | 4 |
| behavioral fear response | 3 |
| serotonin receptor signaling pathway | 3 |
| chemical synaptic transmission | 3 |
| G protein-coupled serotonin receptor signaling pathway | 3 |
| temperature homeostasis | 3 |
| visual learning | 3 |
| dopamine metabolic process | 3 |
Indications & clinical
Indications
1 indication (1 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| psychotic disorder | 4 | MONDO:0005485 | EFO:0005407 |
Clinical trials
Total trials: 0.
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 0 clinical and 1 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
820 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| DESLORATADINE | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| DIHYDROERGOTAMINE | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| Fidaxomicin | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| Propoxyphene | ChEMBL + PubChem | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| AMITRIPTYLINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| AMLODIPINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| AMOXAPINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| APOMORPHINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| ARIPIPRAZOLE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| ASENAPINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| ASTEMIZOLE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| BENPERIDOL | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| BOSUTINIB | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| BREXPIPRAZOLE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| BROMOCRIPTINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| CARIPRAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| CARVEDILOL | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| CHLORPROMAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| CISAPRIDE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| CLEMASTINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| CLOMIPRAMINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| CLOZAPINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| CYPROHEPTADINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| DOXEPIN | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| EBASTINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| ERGOTAMINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| FLUPHENAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| HALOPERIDOL | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| ILOPERIDONE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| IMIPRAMINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| KETANSERIN | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| LOXAPINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| LURASIDONE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| MAPROTILINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| METHYLERGONOVINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| METHYSERGIDE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| MIANSERIN | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| NEFAZODONE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| NORTRIPTYLINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| OLANZAPINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| PERGOLIDE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| PHENOXYBENZAMINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| PIMOZIDE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| PROCHLORPERAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| PROMAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| PROMETHAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| QUETIAPINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| RISPERIDONE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| SERTINDOLE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| SUNITINIB | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| TEGASEROD | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| TERFENADINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| THIORIDAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| THIOTHIXENE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| TRAZODONE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| TRIFLUOPERAZINE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| VERAPAMIL | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| ZIPRASIDONE | ChEMBL | Phase 4 (approved) | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| LISURIDE | ChEMBL | Phase 3 | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
| MELITRACEN | ChEMBL | Phase 3 | DRD1, DRD2, DRD3, HTR1A, HTR2A, HTR2C |
Related Atlas pages
- Genes: HTR1A, DRD1, DRD2, DRD3, HTR2A, HTR2C
- Diseases: psychotic disorder
- Drugs: Desloratadine, Dihydroergotamine, Fidaxomicin, Propoxyphene, Amitriptyline, Amlodipine, Amoxapine, Apomorphine, Aripiprazole, Asenapine, Astemizole, Benperidol, Bosutinib, Brexpiprazole, Bromocriptine, Cariprazine, Carvedilol, Chlorpromazine, Cisapride, Clemastine, Clomipramine, Clozapine, Cyproheptadine, Doxepin, Ebastine, Ergotamine, Fluphenazine, Haloperidol, Iloperidone, Imipramine, Ketanserin, Loxapine, Lurasidone, Maprotiline, Methylergonovine, Methysergide, Mianserin, Nefazodone, Nortriptyline, Olanzapine, Pergolide, Phenoxybenzamine, Pimozide, Prochlorperazine, Promazine, Promethazine, Quetiapine, Risperidone, Sertindole, Sunitinib, Tegaserod, Terfenadine, Thioridazine, Thiothixene, Trazodone, Trifluoperazine, Verapamil, Ziprasidone, Lisuride, Melitracen