Methotrexate
drugOn this page
Also known as (r)-methotrexateADX-2191AmethopterinCL 14377CL-14377D-amethopterinD-methotrexateEbetrexEMT-25299Emtexate high-potEmtexate pfJylamvoMaxtrexMethotrexate, (r)-d-MethotrexatumMethylaminopterinMetojectMetotrexato
Summary
Methotrexate (CHEMBL34259) is an approved small-molecule antineoplastic agent (ATC L04AX03) targeting SLC19A1 and SLC46A1; indicated across 164 conditions including rheumatoid arthritis and psoriasis; with CIViC clinical evidence for 14 variant-indication associations (e.g. IKZF1 Deletion in b-lymphoblastic leukemia/lymphoma).
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: L04AX03 (+1 more)
- Targets: 2 (SLC19A1, SLC46A1)
- Indications: 164 conditions
- Clinical trials: 1,300
- Precision-oncology evidence (CIViC): 14 variant–indication associations
- Chemistry: 454.4 Da · C20H22N8O5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL34259 |
| Name | Methotrexate |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 126941 |
| ChEBI | CHEBI:44185 |
| ATC | L04AX03, L01BA01 |
| Molecular formula | C20H22N8O5 |
| Molecular weight | 454.4 |
| InChIKey | FBOZXECLQNJBKD-ZDUSSCGKSA-N |
SMILES: CN(CC1=CN=C2C(=N1)C(=NC(=N2)N)N)C3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O
IUPAC name: (2S)-2-[[4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoyl]amino]pentanedioic acid
Pharmacological roles (ChEBI): antineoplastic agent, antirheumatic drug, EC 1.5.1.3 (dihydrofolate reductase) inhibitor, DNA synthesis inhibitor, abortifacient, dermatologic drug, immunosuppressive agent.
Other ChEBI roles (chemical / environmental): antimetabolite.
Also known as: (r)-methotrexate, ADX-2191, Amethopterin, CL 14377, CL-14377, D-amethopterin, D-methotrexate, Ebetrex, EMT-25299, Emtexate high-pot, Emtexate pf, Jylamvo
Parent form; salt/anhydrous children: CHEMBL1376974, CHEMBL3244648
Patent coverage: 102,924 distinct patent families (398,396 SureChEMBL compound mentions), from 4 matched compound structure(s). One matched structure accounts for 392,229 (98%) of the total. Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| SLC19A1 | Reduced folate transporter 1 | 31.4% | P41440 | ||
| SLC46A1 | Proton-coupled folate transporter | 2.7% | Q96NT5 |
Broader ChEMBL bioactivity targets: 51 (assay-derived). Sample: Dihydrofolate reductase, Tyrosyl-DNA phosphodiesterase 1, Bifunctional dihydrofolate reductase-thymidylate synthase, Microtubule-associated protein tau, Lysine-specific demethylase 4E, Survival motor neuron protein, Prelamin-A/C, RecQ-like DNA helicase BLM, 4’-phosphopantetheinyl transferase ffp, Ferritin light chain.
Bioactivity
ChEMBL activities: 260 potent at pChembl ≥ 5 of 303 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| DHFR | 11 | Ki | 0.01 | nM | CHEMBL_ACT_18251252 |
| P0ABQ4 | 10.68 | Ki | 0.02 | nM | CHEMBL_ACT_380863 |
| P0ABQ4 | 10.64 | Kd | 0.02 | nM | CHEMBL_ACT_821579 |
| DHFR | 10.42 | Ki | 0.04 | nM | CHEMBL_ACT_939068 |
| Q920D2 | 10.14 | Ki | 0.07 | nM | CHEMBL_ACT_3055900 |
| DHFR | 10.11 | Ki | 0.08 | nM | CHEMBL_ACT_3055901 |
| P0ABQ4 | 10.02 | Kd | 0.1 | nM | CHEMBL_ACT_821582 |
| DHFR | 9.96 | Ki | 0.11 | nM | CHEMBL_ACT_228406 |
| P07382 | 9.89 | Ki | 0.13 | nM | CHEMBL_ACT_197375 |
| DHFR | 9.75 | Ki | 0.18 | nM | CHEMBL_ACT_939069 |
| DHFR | 9.22 | IC50 | 0.6 | nM | CHEMBL_ACT_507772 |
| DHFR | 9.15 | IC50 | 0.7 | nM | CHEMBL_ACT_1263049 |
| DHFR | 9.14 | IC50 | 0.72 | nM | CHEMBL_ACT_507771 |
| DHFR | 9.09 | IC50 | 0.82 | nM | CHEMBL_ACT_81456 |
| P13922 | 9.05 | IC50 | 0.89 | nM | CHEMBL_ACT_28871366 |
| P16184 | 9 | IC50 | 1 | nM | CHEMBL_ACT_1113070 |
| P16184 | 9 | IC50 | 1 | nM | CHEMBL_ACT_1165943 |
| P16184 | 9 | IC50 | 1 | nM | CHEMBL_ACT_1191604 |
| P0A017 | 9 | Ki | 1 | nM | CHEMBL_ACT_16653546 |
| DHFR | 9 | IC50 | 1 | nM | CHEMBL_ACT_2069335 |
| P16184 | 9 | IC50 | 1 | nM | CHEMBL_ACT_818026 |
| Q27793 | 8.96 | IC50 | 1.1 | nM | CHEMBL_ACT_28871168 |
| P16184 | 8.96 | IC50 | 1.1 | nM | CHEMBL_ACT_412077 |
| DHFR | 8.93 | IC50 | 1.18 | nM | CHEMBL_ACT_505257 |
| DHFR | 8.92 | IC50 | 1.2 | nM | CHEMBL_ACT_94090 |
| P16184 | 8.89 | IC50 | 1.3 | nM | CHEMBL_ACT_1092730 |
| P16184 | 8.89 | IC50 | 1.3 | nM | CHEMBL_ACT_1132177 |
| P16184 | 8.89 | IC50 | 1.3 | nM | CHEMBL_ACT_13297327 |
| P00381 | 8.89 | IC50 | 1.3 | nM | CHEMBL_ACT_285163 |
| P16184 | 8.89 | IC50 | 1.3 | nM | CHEMBL_ACT_73582 |
Target pathways
Aggregated over 2 target gene(s): SLC19A1, SLC46A1.
Top Reactome pathways
6 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| Metabolism of folate and pterines | 2 | SLC19A1, SLC46A1 |
| Metabolism | 1 | SLC19A1 |
| Metabolism of water-soluble vitamins and cofactors | 1 | SLC19A1 |
| Metabolism of vitamins and cofactors | 1 | SLC19A1 |
| Iron uptake and transport | 1 | SLC46A1 |
| Heme signaling | 1 | SLC46A1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| folic acid transport | 2 |
| folic acid metabolic process | 2 |
| methotrexate transport | 2 |
| folate transmembrane transport | 2 |
| folate import across plasma membrane | 2 |
| xenobiotic transmembrane transport | 1 |
| female pregnancy | 1 |
| response to xenobiotic stimulus | 1 |
| response to toxic substance | 1 |
| obsolete organic anion transport | 1 |
| cyclic-GMP-AMP transmembrane import across plasma membrane | 1 |
| positive regulation of cGAS/STING signaling pathway | 1 |
| transport across blood-brain barrier | 1 |
| vitamin transmembrane transport | 1 |
| vitamin transport | 1 |
Indications & clinical
Indications
164 indications (20 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| rheumatoid arthritis | 4 | MONDO:0008383 | EFO:0000685 |
| psoriasis | 4 | MONDO:0005083 | EFO:0000676 |
| psoriatic arthritis | 4 | MONDO:0011849 | EFO:0003778 |
| acute lymphoblastic leukemia | 4 | MONDO:0004967 | EFO:0000220 |
| juvenile idiopathic arthritis | 4 | MONDO:0011429 | EFO:0002609 |
| immune system disorder | 4 | MONDO:0005046 | EFO:0000540 |
| neoplasm | 4 | MONDO:0005070 | EFO:0000616 |
| mycosis fungoides | 4 | MONDO:0009691 | EFO:1001051 |
| B-cell acute lymphoblastic leukemia | 4 | MONDO:0004947 | EFO:0000094 |
| breast carcinoma | 4 | MONDO:0004989 | EFO:0000305 |
| breast neoplasm | 4 | MONDO:0021100 | EFO:0003869 |
| non-Hodgkin lymphoma | 4 | MONDO:0018908 | EFO:0005952 |
| arthritic joint disease | 4 | MONDO:0005578 | MONDO:0024280 |
| Crohn disease | 3 | MONDO:0005011 | EFO:0000384 |
| head and neck squamous cell carcinoma | 3 | MONDO:0010150 | EFO:0000181 |
| cardiovascular disorder | 3 | MONDO:0004995 | EFO:0000319 |
| hydatidiform mole | 3 | MONDO:0006248 | EFO:1000298 |
| upper aerodigestive tract neoplasm | 3 | MONDO:0005398 | EFO:0004284 |
| atopic eczema | 3 | MONDO:0004980 | EFO:0000274 |
| osteosarcoma | 3 | MONDO:0009807 | EFO:0000637 |
| lymphoma | 3 | MONDO:0005062 | EFO:0000574 |
| acute myeloid leukemia | 3 | MONDO:0018874 | EFO:0000222 |
| alopecia areata | 3 | MONDO:0005340 | EFO:0004192 |
| diffuse large B-cell lymphoma | 3 | MONDO:0018905 | EFO:0000403 |
| uveitis | 3 | MONDO:0020283 | EFO:1001231 |
| neoplasm of mature B-cells | 3 | MONDO:0004949 | EFO:0000096 |
| Hodgkins lymphoma | 3 | MONDO:0004952 | EFO:0000183 |
| myelodysplastic syndrome | 3 | MONDO:0018881 | EFO:0000198 |
| T-cell acute lymphoblastic leukemia | 3 | MONDO:0004963 | EFO:0000209 |
| acute promyelocytic leukemia | 3 | MONDO:0012883 | EFO:0000224 |
| chronic myeloid leukemia | 3 | MONDO:0011996 | EFO:0000339 |
| dermatomyositis | 3 | MONDO:0016367 | EFO:0000398 |
| juvenile dermatomyositis | 3 | MONDO:0008054 | EFO:0000557 |
| leukemia | 3 | MONDO:0005059 | EFO:0000565 |
| sarcoma | 3 | MONDO:0005089 | EFO:0000691 |
| squamous cell carcinoma | 3 | MONDO:0005096 | EFO:0000707 |
| medulloblastoma | 3 | MONDO:0007959 | EFO:0002939 |
| anaplastic large cell lymphoma | 3 | MONDO:0020325 | EFO:0003032 |
| brain neoplasm | 3 | MONDO:0021211 | EFO:0003833 |
| ankylosing spondylitis | 3 | MONDO:0005306 | EFO:0003898 |
| lymphoid leukemia | 3 | MONDO:0005402 | EFO:0004289 |
| graft versus host disease | 3 | MONDO:0013730 | EFO:0004599 |
| primitive neuroectodermal tumor | 3 | MONDO:0005462 | EFO:0005235 |
| granulomatosis with polyangiitis | 3 | MONDO:0012105 | EFO:0005297 |
| head and neck cancer | 3 | MONDO:0005627 | EFO:0006859 |
| bullous pemphigoid | 3 | MONDO:0019082 | EFO:0007187 |
| sensorineural hearing loss disorder | 3 | MONDO:0020678 | EFO:1001176 |
| temporal arteritis | 3 | MONDO:0008538 | EFO:1001209 |
| primary biliary cholangitis | 3 | MONDO:0005388 | EFO:1001486 |
| chronic myelomonocytic leukemia | 3 | MONDO:0020311 | EFO:1001779 |
| precursor T-cell acute lymphoblastic leukemia | 3 | MONDO:0020512 | EFO:1001830 |
| aplastic anemia | 3 | MONDO:0015909 | HP:0001915 |
| vasculitis | 3 | MONDO:0018882 | EFO:0006803 |
| ectopic pregnancy | 3 | MONDO:0000755 | HP:0031456 |
| acute erythroid leukemia | 3 | MONDO:0017858 | EFO:0000218 |
| acute monocytic leukemia | 3 | MONDO:0007896 | EFO:0000221 |
| acute myelomonocytic leukemia M4 | 3 | MONDO:0018871 | EFO:0000223 |
| myeloproliferative neoplasm | 3 | MONDO:0020076 | EFO:0002428 |
| choriocarcinoma | 3 | MONDO:0005207 | EFO:0002893 |
| acute megakaryoblastic leukemia | 3 | MONDO:0018872 | EFO:0003025 |
| acute myeloblastic leukemia without maturation | 3 | MONDO:0005224 | EFO:0003027 |
| myelodysplastic syndrome with single lineage dysplasia | 3 | MONDO:0005272 | EFO:0003802 |
| myelodysplastic syndrome with excess blasts | 3 | MONDO:0019454 | EFO:0003811 |
| vitiligo | 3 | MONDO:0008661 | EFO:0004208 |
| central nervous system neoplasm | 3 | MONDO:0006130 | EFO:1000158 |
| intermediate uveitis | 3 | MONDO:0006806 | EFO:1000986 |
| brain cancer | 3 | MONDO:0001657 | MONDO:0001657 |
| follicular lymphoma | 3 | MONDO:0018906 | MONDO:0018906 |
| acute biphenotypic leukemia | 3 | MONDO:0020322 | MONDO:0019460 |
| nasal cavity and paranasal sinus lethal midline granuloma | 3 | MONDO:0006828 | MONDO:0019472 |
| urothelial carcinoma | 3 | MONDO:0040679 | EFO:0008528 |
| proliferative vitreoretinopathy | 3 | MONDO:0700115 | EFO:1001129 |
| IgG4-related retroperitoneal fibrosis | 3 | MONDO:0018848 | MONDO:0018848 |
| asthma | 3 | MONDO:0004979 | MONDO:0004979 |
| osteoarthritis | 3 | MONDO:0005178 | MONDO:0005178 |
| multiple sclerosis | 3 | MONDO:0005301 | MONDO:0005301 |
| systemic lupus erythematosus | 3 | MONDO:0007915 | MONDO:0007915 |
| primary cutaneous T-cell non-Hodgkin lymphoma | 3 | MONDO:0000607 | EFO:0002913 |
| ulcerative colitis | 2 | MONDO:0005101 | EFO:0000729 |
| myasthenia gravis | 2 | MONDO:0009688 | EFO:0004991 |
| myocardial infarction | 2 | MONDO:0005068 | EFO:0000612 |
| urticaria | 2 | MONDO:0005492 | EFO:0005531 |
| B-cell chronic lymphocytic leukemia | 2 | MONDO:0004948 | EFO:0000095 |
| peripheral T-cell lymphoma, not otherwise specified | 2 | MONDO:0004964 | EFO:0000211 |
| Burkitt lymphoma | 2 | MONDO:0007243 | EFO:0000309 |
| mesothelioma | 2 | MONDO:0005065 | EFO:0000588 |
| malignant pleural mesothelioma | 2 | MONDO:0005112 | EFO:0000770 |
| ovarian carcinoma | 2 | MONDO:0005140 | EFO:0001075 |
| plasma cell myeloma | 2 | MONDO:0009693 | EFO:0001378 |
| lymphoid neoplasm | 2 | MONDO:0005157 | EFO:0001642 |
| primary myelofibrosis | 2 | MONDO:0009692 | EFO:0002430 |
| juvenile myelomonocytic leukemia | 2 | MONDO:0011908 | EFO:1000309 |
| Langerhans cell histiocytosis | 2 | MONDO:0018310 | EFO:1000318 |
| mantle cell lymphoma | 2 | MONDO:0018876 | EFO:1001469 |
| cutaneous neuroendocrine carcinoma | 2 | MONDO:0019210 | EFO:1001471 |
| angioimmunoblastic T-cell lymphoma | 2 | MONDO:0004977 | EFO:0000255 |
| acquired polycythemia vera | 2 | MONDO:0009891 | EFO:0002429 |
| Waldenstrom macroglobulinemia | 2 | MONDO:0100280 | EFO:0009441 |
| Sezary syndrome | 2 | MONDO:0017844 | EFO:1000785 |
| neuroblastoma | 2 | MONDO:0005072 | EFO:0000621 |
| central serous chorioretinopathy | 2 | MONDO:0018616 | EFO:0009784 |
| blast phase chronic myelogenous leukemia, BCR-ABL1 positive | 2 | MONDO:0006115 | EFO:1000131 |
| kidney cancer | 2 | MONDO:0002367 | MONDO:0002367 |
| ependymoma | 2 | MONDO:0016698 | MONDO:0003478 |
| ovarian cancer | 2 | MONDO:0008170 | MONDO:0008170 |
| hematopoietic and lymphoid system neoplasm | 2 | MONDO:0002334 | MONDO:0044881 |
| coronary artery disorder | 2 | MONDO:0005010 | EFO:0001645 |
| desmoid tumor | 2 | MONDO:0007608 | EFO:0009907 |
| myelodysplastic/myeloproliferative disease | 2 | MONDO:0020077 | MONDO:0020077 |
| MALT lymphoma | 2 | MONDO:0007650 | EFO:0000191 |
| Wiskott-Aldrich syndrome | 2 | MONDO:0010518 | MONDO:0010518 |
| sickle cell disease | 2 | MONDO:0011382 | MONDO:0011382 |
| Diamond-Blackfan anemia | 2 | MONDO:0015253 | MONDO:0015253 |
| severe combined immunodeficiency | 2 | MONDO:0015974 | MONDO:0015974 |
| osteopetrosis | 2 | MONDO:0017198 | MONDO:0017198 |
| neurofibromatosis type 1 | 2 | MONDO:0018975 | MONDO:0018975 |
| retinitis pigmentosa | 2 | MONDO:0019200 | MONDO:0019200 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| hemoglobinuria | 2 | MONDO:0003656 | MONDO:0100244 |
| plasma cell neoplasm | 2 | MONDO:0004959 | EFO:0000200 |
| testicular cancer | 2 | MONDO:0005447 | EFO:0004281 |
| CD4+/CD56+ hematodermic neoplasm | 2 | MONDO:0019467 | EFO:0010580 |
| colorectal neoplasm | 2 | MONDO:0005335 | MONDO:0005575 |
| malaria | 1 | MONDO:0005136 | EFO:0001068 |
| systemic sclerosis | 1 | MONDO:0005100 | EFO:0000717 |
| cutaneous melanoma | 1 | MONDO:0005012 | EFO:0000389 |
| HIV infectious disease | 1 | MONDO:0005109 | EFO:0000764 |
| plasma cell leukemia | 1 | MONDO:0018689 | EFO:0006475 |
| severe acute respiratory syndrome | 1 | MONDO:0005091 | MONDO:0100096 |
| Fanconi anemia | 1 | MONDO:0019391 | MONDO:0019391 |
| gout | 1 | MONDO:0005393 | EFO:0004274 |
| dermatitis | 0 | MONDO:0002406 | MONDO:0002406 |
32 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 1,300.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 484 |
| PHASE3 | 312 |
| PHASE4 | 169 |
| Not specified | 124 |
| PHASE1 | 95 |
| PHASE1/PHASE2 | 68 |
| PHASE2/PHASE3 | 33 |
| EARLY_PHASE1 | 15 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02714634 | PHASE4 | RECRUITING | Clinical Trial Evaluating Methotrexate or Leflunomide + Targeted Therapy Versus Methotrexate or Leflunomide + Sulfasalazine + Hydroxychloroquine in Patients With Rheumatoid Arthritis and Insufficient Response to Methotrexate or Leflunomide |
| NCT04239859 | PHASE4 | NOT_YET_RECRUITING | Outcomes With Treatment and Withdraw of Secukinumab in Patients With Plaque Psoriasis |
| NCT04314193 | PHASE4 | ACTIVE_NOT_RECRUITING | Effectiveness of Methotrexate Versus Prednisone as First-line Therapy for Pulmonary Sarcoidosis |
| NCT04537689 | PHASE4 | RECRUITING | Outcomes With Treatment and Withdraw of Ixekizumab in Patients With Plaque Psoriasis |
| NCT04579848 | PHASE4 | ACTIVE_NOT_RECRUITING | Methotrexate in Erosive Inflammatory Hand Osteoarthritis |
| NCT05102448 | PHASE4 | RECRUITING | Comparison of Tofacitinib and Methotrexate in Takayasu’s Arteritis |
| NCT05353829 | PHASE4 | ACTIVE_NOT_RECRUITING | Methotrexate in Patients with Early Rheumatoid Arthritis |
| NCT05518383 | PHASE4 | RECRUITING | B-cell Mature Non-Hodgkin’s Lymphoma Treatment Protocol in Children and Adolescents 2021 |
| NCT05626348 | PHASE4 | RECRUITING | The Clinical Efficacy of Immunomodulators in RA Patients |
| NCT06289673 | PHASE4 | RECRUITING | Identification of Necessary Information for Treatment Induction in Newly Diagnosed Acute Lymphoblastic Leukemia/Lymphoma |
| NCT06498089 | PHASE4 | RECRUITING | A Randomized, Controlled, Open-label, Multicenter Clinical Trial Comparing the Efficacy and Safety of a Precision Treatment Regimen Based on Clinical-molecular Phenotypes with a Conventional Treatment Regimen in the Treatment of Patients with Active Takayasu’s Arteritis |
| NCT06578728 | PHASE4 | ACTIVE_NOT_RECRUITING | Local Methotrexate Injections for the Treatment of Nail Psoriasis |
| NCT06649136 | PHASE4 | RECRUITING | MethMax Trial: MAXimising the METHotrexate Therapy Potential in Patients with Active Rheumatoid Arthritis |
| NCT06653634 | PHASE4 | RECRUITING | Optimizing Treatment for Patients With Juvenile Idiopathic Arthritis in Sustained Remission: The MOVE-JIA Trial |
| NCT06913907 | PHASE4 | RECRUITING | Changes in MTX-PG Concentrations During Subcutaneous MTX Therapy in Patients With Rheumatoid Arthritis(COSMOS Study) |
| NCT06943482 | PHASE4 | NOT_YET_RECRUITING | Comparing Effectiveness of Steroids and Methotrexate in Treatment of Chronic Inflammatory Breast Disease |
| NCT07352566 | PHASE4 | NOT_YET_RECRUITING | Utilization of a Microdevice for Psoriasis and Atopic Dermatitis |
| NCT07381556 | PHASE4 | RECRUITING | Cyclosporine Or Methotrexate for Pediatric Alopecia Areata: Routine Clinical Care Effectiveness Study |
| NCT07406204 | PHASE4 | NOT_YET_RECRUITING | Tofacitinib vs Methotrexate for Severe Alopecia Areata (TOFA-MTX-AA) |
| NCT07432386 | PHASE4 | NOT_YET_RECRUITING | Methotrexate Versus Apremilast for Pruritus in Psoriasis |
| NCT07432815 | PHASE4 | RECRUITING | Treatment of Psoriasis With Depression and/or Anxiety With Methotrexate vs Combined Methotrexate and Antidepressant |
| NCT07459933 | PHASE4 | NOT_YET_RECRUITING | Topical Methotrexate vs Minoxidil for Localized Alopecia Areata |
| NCT07477691 | PHASE4 | NOT_YET_RECRUITING | Immune Modulation During Palynziq® Treatment in Adults (IMPALA) |
| NCT00029523 | PHASE4 | COMPLETED | DepoCyt Therapy in Patients With Neoplastic Meningitis From Lymphoma or a Solid Tumor |
| NCT00037102 | PHASE4 | COMPLETED | Combination Therapy With Avonex and BiMonthly High Dose Intravenous Methotrexate in Multiple Sclerosis |
| NCT00037115 | PHASE4 | WITHDRAWN | Induction Therapy With a Single High Dose Bolus of Intravenous Methotrexate With Leucovorin Rescue, Prior to Initiation of AVONEX® Treatment, in Patients Presenting With a First Acute Demyelinating Event. |
| NCT00112034 | PHASE4 | COMPLETED | AVONEX® Combination Trial - ACT |
| NCT00129506 | PHASE4 | COMPLETED | Comparing Methotrexate Followed by Misoprostol to Misoprostol Alone for Early Abortion |
| NCT00153530 | PHASE4 | COMPLETED | Whole Brain Irradiation in Primary Central Nervous System (CNS) Lymphoma (PCNSL) |
| NCT00161655 | PHASE4 | COMPLETED | Study Evaluating Etanercept and Methotrexate in Plaque Psoriasis |
| NCT00195494 | PHASE4 | COMPLETED | Study Comparing Etanercept and Methotrexate vs. Methotrexate Alone in Rheumatoid Arthritis |
| NCT00198978 | PHASE4 | COMPLETED | German Multicenter Trial for Treatment of Elderly Patients With Newly Diagnosed Acute Lymphoblastic Leukemia |
| NCT00198991 | PHASE4 | COMPLETED | German Multicenter Trial for Treatment of Newly Diagnosed Acute Lymphoblastic Leukemia in Adults (07/2003) |
| NCT00199004 | PHASE4 | COMPLETED | Trial for Treatment of Adult Patients With Standard Risk Acute Lymphoblastic Leukemia With Chemotherapy and Rituximab |
| NCT00199017 | PHASE4 | COMPLETED | German Multicenter Trial for the Treatment of Newly Diagnosed T-lymphoblastic Lymphoma in Adults |
| NCT00199056 | PHASE4 | COMPLETED | German Multicenter Trial for Treatment of Newly Diagnosed Acute Lymphoblastic Leukemia in Adults (06/99) |
| NCT00199069 | PHASE4 | COMPLETED | German Multicenter Trial for Treatment of Newly Diagnosed Acute Lymphoblastic Leukemia in Adults (05/93) |
| NCT00199082 | PHASE4 | COMPLETED | Newly Diagnosed Mature B-ALL, Burkitt’s Lymphoma and Other High-grade Lymphoma in Adults |
| NCT00199095 | PHASE4 | COMPLETED | Treatment of Elderly Patients (>65 Years) With Acute Lymphoblastic Leukemia |
| NCT00209859 | PHASE4 | COMPLETED | Methotrexate and Cyclosporine in Treatment of Early Rheumatoid Arthritis |
Clinical evidence (CIViC)
Variant × indication × effect (14 predictive associations from 14 curated evidence items):
| Variant | Indication | Effect | Therapy | Level | CIViC |
|---|---|---|---|---|---|
| IKZF1 Deletion | B-lymphoblastic Leukemia/lymphoma | Sensitivity/Response | Methotrexate + Daunorubicin + Cytarabine + Fludarabine + Imatinib | CIViC B | EID7366 |
| SLCO1B1 N130D | Cancer | Adverse Response | Methotrexate | CIViC B | EID1842 |
| SLCO1B1 RS4149056 | Cancer | Adverse Response | Methotrexate | CIViC B | EID1841 |
| TYMS RS34743033 | Cancer | Adverse Response | Methotrexate | CIViC B | EID1843 |
| ETV6::NTRK3 Fusion | B-lymphoblastic Leukemia/lymphoma | Sensitivity/Response | Etoposide + Methotrexate + Larotrectinib | CIViC C | EID8917 |
| PRPS1 A190T | B-lymphoblastic Leukemia/lymphoma | Resistance | Cytarabine + Asparaginase + Methotrexate + Daunorubicin | CIViC D | EID7928 |
| PRPS1 D183E | B-lymphoblastic Leukemia/lymphoma | Resistance | Asparaginase + Methotrexate + Cytarabine + Daunorubicin | CIViC D | EID7927 |
| PRPS1 K176N | B-lymphoblastic Leukemia/lymphoma | Resistance | Daunorubicin + Cytarabine + Methotrexate + Asparaginase | CIViC D | EID7926 |
| PRPS1 L191F | B-lymphoblastic Leukemia/lymphoma | Resistance | Asparaginase + Daunorubicin + Methotrexate | CIViC D | EID7923 |
| PRPS1 N144S | B-lymphoblastic Leukemia/lymphoma | Resistance | Daunorubicin + Methotrexate + Asparaginase | CIViC D | EID7930 |
| PRPS1 S103N | B-lymphoblastic Leukemia/lymphoma | Resistance | Methotrexate + Asparaginase + Daunorubicin + Cytarabine | CIViC D | EID7925 |
| PRPS1 S103T | B-lymphoblastic Leukemia/lymphoma | Resistance | Methotrexate + Asparaginase + Daunorubicin + Cytarabine | CIViC D | EID7924 |
| PRPS1 T303S | B-lymphoblastic Leukemia/lymphoma | Resistance | Asparaginase + Daunorubicin + Cytarabine + Methotrexate | CIViC D | EID7929 |
| TP53 R273H | Osteosarcoma | Resistance | Doxorubicin + Methotrexate | CIViC D | EID7430 |
Pharmacology
Pharmacogenomics
PharmGKB dosing guidelines (2) — CPIC / DPWG genotype-guided dosing for this drug (drug × pharmacogene):
| Guideline | Source | Gene(s) | Dosing | Recommendation |
|---|---|---|---|---|
| Annotation of RNPGx Guideline for methotrexate and ABCB1, MTHFR, SLC19 | RNPGx | ABCB1;MTHFR;SLC19A1;SLCO1B1 | ||
| Annotation of DPWG Guideline for methotrexate and MTHFR | DPWG | MTHFR |
PharmGKB also curates 175 clinical and 1,054 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
5 molecules share ≥1 primary target. Top 5 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| PEMETREXED | ChEMBL + PubChem | Phase 4 (approved) | SLC19A1, SLC46A1 |
| PRALATREXATE | ChEMBL + PubChem | Phase 4 (approved) | SLC19A1, SLC46A1 |
| RALTITREXED | ChEMBL | Phase 4 (approved) | SLC19A1, SLC46A1 |
| Indomethacin | PubChem | Approved | SLC46A1 |
| Leucovorin | PubChem | Approved | SLC19A1 |
Related Atlas pages
- Genes: SLC19A1, SLC46A1
- Diseases: rheumatoid arthritis, psoriasis, psoriatic arthritis, acute lymphoblastic leukemia, juvenile idiopathic arthritis, immune system disorder, neoplasm, mycosis fungoides, B-cell acute lymphoblastic leukemia, breast carcinoma, breast neoplasm, non-Hodgkin lymphoma, arthritic joint disease, Crohn disease, head and neck squamous cell carcinoma, cardiovascular disorder, hydatidiform mole, upper aerodigestive tract neoplasm, atopic eczema, osteosarcoma, lymphoma, acute myeloid leukemia, alopecia areata, diffuse large B-cell lymphoma, uveitis, neoplasm of mature B-cells, Hodgkins lymphoma, myelodysplastic syndrome, T-cell acute lymphoblastic leukemia, acute promyelocytic leukemia, chronic myeloid leukemia, dermatomyositis, juvenile dermatomyositis, leukemia, sarcoma, squamous cell carcinoma, medulloblastoma, anaplastic large cell lymphoma, brain neoplasm, ankylosing spondylitis, lymphoid leukemia, graft versus host disease, primitive neuroectodermal tumor, granulomatosis with polyangiitis, head and neck cancer, bullous pemphigoid, sensorineural hearing loss disorder, temporal arteritis, primary biliary cholangitis, chronic myelomonocytic leukemia, precursor T-cell acute lymphoblastic leukemia, aplastic anemia, vasculitis, ectopic pregnancy, acute monocytic leukemia, myeloproliferative neoplasm, choriocarcinoma, acute megakaryoblastic leukemia, acute myeloblastic leukemia without maturation, myelodysplastic syndrome with single lineage dysplasia, myelodysplastic syndrome with excess blasts, vitiligo, central nervous system neoplasm, intermediate uveitis, brain cancer, follicular lymphoma, acute biphenotypic leukemia, nasal cavity and paranasal sinus lethal midline granuloma, urothelial carcinoma, proliferative vitreoretinopathy, IgG4-related retroperitoneal fibrosis, asthma, osteoarthritis, multiple sclerosis, systemic lupus erythematosus, primary cutaneous T-cell non-Hodgkin lymphoma, cancer, pediatric osteosarcoma
- Drugs: Pemetrexed, Pralatrexate, Raltitrexed, Indomethacin
- Biomarker genes: SLCO1B1, TYMS