Methylprednisolone
drugOn this page
Also known as J3.872EMedrolMedroneMetilprednisolonaNSC-19987U-67,590A6methylprednisoloneSID855789SID56424125SID82706SID144203927SID144212335SID170465051C0164990
Summary
Methylprednisolone (CHEMBL650) is an approved small-molecule anti-inflammatory drug (ATC H02BX01) targeting TRPC5 and NR3C1; indicated across 156 conditions including acne and crohn disease.
At a glance
- Status: Approved (max clinical phase 4)
- Modality: Small molecule
- ATC class: H02BX01 (+3 more)
- Targets: 2 (TRPC5, NR3C1)
- Indications: 156 conditions
- Clinical trials: 614
- Chemistry: 374.5 Da · C22H30O5
Identifiers
Drug identity and classification
| Field | Value |
|---|---|
| ChEMBL ID | CHEMBL650 |
| Name | Methylprednisolone |
| Type | Small molecule |
| Max phase | 4 |
| FDA approved | yes |
| PubChem CID | 6741 |
| ChEBI | CHEBI:6888 |
| ATC | H02BX01, D07AA01, D10AA02, H02AB04 |
| Molecular formula | C22H30O5 |
| Molecular weight | 374.5 |
| InChIKey | VHRSUDSXCMQTMA-PJHHCJLFSA-N |
SMILES: C[C@H]1C[C@H]2[C@@H]3CC[C@@]([C@]3(C[C@@H]([C@@H]2[C@@]4(C1=CC(=O)C=C4)C)O)C)(C(=O)CO)O
IUPAC name: (6S,8S,9S,10R,11S,13S,14S,17R)-11,17-dihydroxy-17-(2-hydroxyacetyl)-6,10,13-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one
ChEBI definition: The 6α-stereoisomer of 6-methylprednisolone.
Pharmacological roles (ChEBI): anti-inflammatory drug, neuroprotective agent, antiemetic, adrenergic agent.
Other ChEBI roles (chemical / environmental): xenobiotic, environmental contaminant.
Also known as: J3.872E, Medrol, Medrone, Methylprednisolone, Metilprednisolona, NSC-19987, U-67,590A, methylprednisolone, 6methylprednisolone, SID855789, METHYLPREDNISOLONE, SID56424125
Parent form; salt/anhydrous children: CHEMBL1200844
Patent coverage: 25,542 distinct patent families (97,827 SureChEMBL compound mentions), from 1 matched compound structure(s). Mentions count patents naming the compound (not distinct inventions), so promiscuous / reference molecules inflate the mention figure — families are the dedup metric.
Targets
Targets
Primary targets (GtoPdb curated mechanism): the Cancer dependency column is the DepMap CRISPR fitness signal (% of screened cell lines dependent on the target).
| Gene | Target | Action | pAffinity | Cancer dependency | UniProt |
|---|---|---|---|---|---|
| TRPC5 | TRPC5 | Activation | 4.92 | 0% | Q9UL62 |
| NR3C1 | Glucocorticoid receptor | Agonist | 8.3 | 0.9% | P04150 |
Broader ChEMBL bioactivity targets: 9 (assay-derived). Sample: ATP-binding cassette sub-family C member 4, Glucocorticoid receptor, Progesterone receptor, Nuclear receptor subfamily 1 group I member 2, 3’,5’-cyclic-AMP phosphodiesterase 4D, Androgen receptor, Nuclear receptor subfamily 1 group I member 2, Hypoxia-inducible factor 1-alpha, Bile salt export pump.
Bioactivity
ChEMBL activities: 7 potent at pChembl ≥ 5 of 13 total. Top 30 by potency (10 = 0.1 nM, 6 = 1 µM):
| Target | pChembl | Type | Value | Unit | Activity ID |
|---|---|---|---|---|---|
| NR3C1 | 8.3 | Ki | 5.03 | nM | CHEMBL_ACT_7777363 |
| NR3C1 | 8.05 | AC50 | 9 | nM | CHEMBL_ACT_25176334 |
| NR3C1 | 7.96 | IC50 | 11 | nM | CHEMBL_ACT_7777362 |
| HIF1A | 7.3 | Potency | 50.1 | nM | CHEMBL_ACT_4129624 |
| HIF1A | 7.3 | Potency | 50.1 | nM | CHEMBL_ACT_4518660 |
| PGR | 5.89 | AC50 | 1300 | nM | CHEMBL_ACT_25223456 |
| Q9R1A7 | 5.4 | EC50 | 4000 | nM | CHEMBL_ACT_15463834 |
Target pathways
Aggregated over 2 target gene(s): TRPC5, NR3C1.
Top Reactome pathways
10 total, by targets touching each:
| Pathway | Targets | Genes |
|---|---|---|
| TRP channels | 1 | TRPC5 |
| HSP90 chaperone cycle for steroid hormone receptors (SHR) in the presence of ligand | 1 | NR3C1 |
| Nuclear Receptor transcription pathway | 1 | NR3C1 |
| SUMOylation of intracellular receptors | 1 | NR3C1 |
| Role of second messengers in netrin-1 signaling | 1 | TRPC5 |
| PTK6 Expression | 1 | NR3C1 |
| Regulation of RUNX2 expression and activity | 1 | NR3C1 |
| FOXO-mediated transcription of oxidative stress, metabolic and neuronal genes | 1 | NR3C1 |
| Potential therapeutics for SARS | 1 | NR3C1 |
| Regulation of NPAS4 gene transcription | 1 | NR3C1 |
Dominant GO biological processes
| GO term | Targets |
|---|---|
| calcium ion transport | 1 |
| positive regulation of cytosolic calcium ion concentration | 1 |
| nervous system development | 1 |
| positive regulation of cell population proliferation | 1 |
| neuron differentiation | 1 |
| positive regulation of neuron differentiation | 1 |
| positive regulation of axon extension | 1 |
| negative regulation of dendrite morphogenesis | 1 |
| neuron apoptotic process | 1 |
| regulation of cytosolic calcium ion concentration | 1 |
| calcium ion transmembrane transport | 1 |
| phosphatidylserine exposure on apoptotic cell surface | 1 |
| regulation of membrane hyperpolarization | 1 |
| monoatomic ion transport | 1 |
| monoatomic ion transmembrane transport | 1 |
Indications & clinical
Indications
156 indications (17 at ChEMBL trial phase 4). Phase below is the highest clinical-trial phase recorded for this drug against each disease — not the molecule’s overall approval status (that is in the Summary).
| Indication | Trial phase | MONDO | EFO |
|---|---|---|---|
| acne | 4 | MONDO:0011438 | EFO:0003894 |
| Crohn disease | 4 | MONDO:0005011 | EFO:0000384 |
| rheumatoid arthritis | 4 | MONDO:0008383 | EFO:0000685 |
| frozen shoulder | 4 | MONDO:0006763 | EFO:1000941 |
| ulcerative colitis | 4 | MONDO:0005101 | EFO:0000729 |
| pneumonia | 4 | MONDO:0005249 | EFO:0003106 |
| atopic eczema | 4 | MONDO:0004980 | EFO:0000274 |
| psoriatic arthritis | 4 | MONDO:0011849 | EFO:0003778 |
| tenosynovitis | 4 | MONDO:0004855 | EFO:1001435 |
| asthma | 4 | MONDO:0004979 | MONDO:0004979 |
| osteoarthritis | 4 | MONDO:0005178 | MONDO:0005178 |
| multiple sclerosis | 4 | MONDO:0005301 | MONDO:0005301 |
| endocrine system disorder | 4 | MONDO:0005151 | EFO:0001379 |
| juvenile idiopathic arthritis | 4 | MONDO:0011429 | EFO:0002609 |
| posterior uveitis | 4 | MONDO:0006918 | EFO:1001119 |
| bursitis | 4 | MONDO:0002471 | MONDO:0002471 |
| relapsing-remitting multiple sclerosis | 3 | MONDO:0005314 | EFO:0003929 |
| Meniere disease | 3 | MONDO:0007972 | EFO:0006862 |
| graft versus host disease | 3 | MONDO:0013730 | EFO:0004599 |
| chronic progressive multiple sclerosis | 3 | MONDO:0005284 | EFO:0003840 |
| plasma cell myeloma | 3 | MONDO:0009693 | EFO:0001378 |
| respiratory system disorder | 3 | MONDO:0005087 | EFO:0000684 |
| carpal tunnel syndrome | 3 | MONDO:0007275 | EFO:0004143 |
| urinary tract infection | 3 | MONDO:0100338 | EFO:0003103 |
| anterior ischemic optic neuropathy | 3 | MONDO:0006649 | EFO:1000809 |
| lymphoid neoplasm | 3 | MONDO:0005157 | EFO:0001642 |
| kidney disorder | 3 | MONDO:0005240 | EFO:0003086 |
| autoimmune thrombocytopenic purpura | 3 | MONDO:0008558 | EFO:0007160 |
| acute lymphoblastic leukemia | 3 | MONDO:0004967 | EFO:0000220 |
| juvenile dermatomyositis | 3 | MONDO:0008054 | EFO:0000557 |
| leukemia | 3 | MONDO:0005059 | EFO:0000565 |
| lymphoma | 3 | MONDO:0005062 | EFO:0000574 |
| systemic sclerosis | 3 | MONDO:0005100 | EFO:0000717 |
| heart disorder | 3 | MONDO:0005267 | EFO:0003777 |
| chronic kidney disease | 3 | MONDO:0005300 | EFO:0003884 |
| IgA glomerulonephritis | 3 | MONDO:0005342 | EFO:0004194 |
| membranous glomerulonephritis | 3 | MONDO:0005376 | EFO:0004254 |
| anti-neutrophil antibody associated vasculitis | 3 | MONDO:0005435 | EFO:0004826 |
| granulomatosis with polyangiitis | 3 | MONDO:0012105 | EFO:0005297 |
| lupus nephritis | 3 | MONDO:0005556 | EFO:0005761 |
| Bell’s palsy | 3 | MONDO:0005665 | EFO:0007167 |
| vestibular neuronitis | 3 | MONDO:0006008 | EFO:0007537 |
| acute respiratory distress syndrome | 3 | MONDO:0006502 | EFO:1000637 |
| microscopic polyangiitis | 3 | MONDO:0019124 | EFO:1000784 |
| spinal cord injury | 3 | MONDO:0043797 | EFO:1001919 |
| thrombocytopenia | 3 | MONDO:0002049 | HP:0001873 |
| cardiac arrest | 3 | MONDO:0000745 | EFO:0009492 |
| T-cell acute lymphoblastic leukemia | 3 | MONDO:0004963 | EFO:0000209 |
| chronic obstructive pulmonary disease | 3 | MONDO:0005002 | EFO:0000341 |
| severe acute respiratory syndrome | 3 | MONDO:0005091 | EFO:0000694 |
| optic neuritis | 3 | MONDO:0005885 | EFO:0007405 |
| pneumocystosis | 3 | MONDO:0019121 | EFO:0007448 |
| pulpitis | 3 | MONDO:0006937 | EFO:1001139 |
| specific language disorder | 3 | MONDO:0016226 | MONDO:0016226 |
| hematopoietic and lymphoid system neoplasm | 3 | MONDO:0002334 | MONDO:0044881 |
| Hodgkins lymphoma | 3 | MONDO:0004952 | MONDO:0009348 |
| adult acute respiratory distress syndrome | 3 | MONDO:0100130 | MONDO:0100130 |
| primary progressive multiple sclerosis | 3 | MONDO:0000451 | EFO:0008520 |
| myocarditis | 3 | MONDO:0004496 | EFO:0009609 |
| macrophage activation syndrome | 3 | MONDO:0015545 | EFO:1001806 |
| language disorder | 3 | MONDO:0004750 | MONDO:0004750 |
| bronchopulmonary dysplasia | 3 | MONDO:0019091 | MONDO:0019091 |
| injury | 3 | MONDO:0021178 | EFO:0000546 |
| stroke disorder | 3 | MONDO:0005098 | EFO:0000712 |
| idiopathic pulmonary fibrosis | 3 | MONDO:0800504 | EFO:0000768 |
| colitis | 3 | MONDO:0005292 | EFO:0003872 |
| kidney failure | 3 | MONDO:0001106 | EFO:1002048 |
| systemic lupus erythematosus | 3 | MONDO:0007915 | MONDO:0007915 |
| erythema multiforme | 3 | MONDO:0006545 | EFO:1000694 |
| ankylosing spondylitis | 2 | MONDO:0005306 | EFO:0003898 |
| spondyloarthropathy | 2 | MONDO:0005095 | EFO:0000706 |
| sinusitis | 2 | MONDO:0005961 | EFO:0007486 |
| alcoholic hepatitis | 2 | MONDO:0001505 | EFO:1001345 |
| neuromyelitis optica | 2 | MONDO:0019100 | EFO:0004256 |
| B-cell chronic lymphocytic leukemia | 2 | MONDO:0004948 | EFO:0000095 |
| metastatic prostate carcinoma | 2 | MONDO:0004956 | EFO:0000196 |
| myelodysplastic syndrome | 2 | MONDO:0018881 | EFO:0000198 |
| peripheral T-cell lymphoma, not otherwise specified | 2 | MONDO:0004964 | EFO:0000211 |
| angioimmunoblastic T-cell lymphoma | 2 | MONDO:0004977 | EFO:0000255 |
| Burkitt lymphoma | 2 | MONDO:0007243 | EFO:0000309 |
| diffuse large B-cell lymphoma | 2 | MONDO:0018905 | EFO:0000403 |
| neoplasm | 2 | MONDO:0005070 | EFO:0000616 |
| polyp | 2 | MONDO:0005079 | EFO:0000662 |
| melanoma | 2 | MONDO:0005105 | EFO:0000756 |
| anaplastic large cell lymphoma | 2 | MONDO:0020325 | EFO:0003032 |
| non-Hodgkin lymphoma | 2 | MONDO:0018908 | EFO:0005952 |
| appendicitis | 2 | MONDO:0005649 | EFO:0007149 |
| hantavirus infectious disease | 2 | MONDO:0005780 | EFO:0007295 |
| nasal cavity polyp | 2 | MONDO:0006314 | EFO:1000391 |
| immunoglobulin A vasculitis | 2 | MONDO:0019167 | EFO:1000965 |
| plantar fasciitis | 2 | MONDO:0004833 | EFO:1001909 |
| aplastic anemia | 2 | MONDO:0015909 | HP:0001915 |
| non-small cell lung carcinoma | 2 | MONDO:0005233 | EFO:0003060 |
| myeloproliferative neoplasm | 2 | MONDO:0020076 | EFO:0002428 |
| fallopian tube neoplasm | 2 | MONDO:0021092 | MONDO:0002158 |
| radiculopathy | 2 | MONDO:0002959 | MONDO:0002959 |
| breast neoplasm | 2 | MONDO:0021100 | MONDO:0007254 |
| ovarian cancer | 2 | MONDO:0008170 | MONDO:0008170 |
| myelodysplastic/myeloproliferative disease | 2 | MONDO:0020077 | MONDO:0020077 |
| amyotrophic lateral sclerosis | 2 | MONDO:0004976 | MONDO:0004976 |
| familial lipoprotein lipase deficiency | 2 | MONDO:0009387 | MONDO:0009387 |
| lymphoproliferative syndrome | 2 | MONDO:0016537 | MONDO:0016537 |
| thrombotic thrombocytopenic purpura | 2 | MONDO:0018896 | MONDO:0018896 |
| Fanconi anemia | 2 | MONDO:0019391 | MONDO:0019391 |
| migraine disorder | 2 | MONDO:0005277 | MONDO:0005277 |
| plasma cell neoplasm | 2 | MONDO:0004959 | EFO:0000200 |
| osteoarthritis, knee | 2 | MONDO:0005416 | EFO:0004616 |
| CD4+/CD56+ hematodermic neoplasm | 2 | MONDO:0019467 | EFO:0010580 |
| atherosclerosis | 1 | MONDO:0005311 | EFO:0003914 |
| drug-induced liver injury | 1 | MONDO:0005359 | EFO:1000905 |
| noise induced hearing loss | 1 | MONDO:0013098 | EFO:1001254 |
| myopathy | 1 | MONDO:0005336 | EFO:0004145 |
| myasthenia gravis | 1 | MONDO:0009688 | EFO:0004991 |
| stiff-person syndrome | 1 | MONDO:0008491 | EFO:0007498 |
| immune system disorder | 1 | MONDO:0005046 | EFO:0000540 |
| optic nerve disorder | 1 | MONDO:0002135 | MONDO:0002135 |
| Kawasaki disease | 1 | MONDO:0012727 | EFO:0004246 |
| Gaucher disease | 1 | MONDO:0018150 | Orphanet:77260 |
| Parkinson disease | 1 | MONDO:0005180 | MONDO:0005180 |
| ovarian hyperstimulation syndrome | 1 | MONDO:0011972 | MONDO:0011972 |
| frontotemporal dementia | 1 | MONDO:0017276 | MONDO:0017276 |
| DiGeorge syndrome | 1 | MONDO:0008564 | MONDO:0018923 |
| radius fracture | 1 | MONDO:0005325 | EFO:0003957 |
| intussusception | 1 | MONDO:0007835 | HP:0002576 |
| follicular lymphoma | 1 | MONDO:0018906 | MONDO:0018906 |
| Friedreich ataxia | 0 | MONDO:0100339 | MONDO:0100339 |
30 further indication records had no mapped disease name (EFO/MeSH-only) or were duplicates, and are omitted.
Clinical trials
Total trials: 614.
Phase distribution
| Phase | Trials |
|---|---|
| PHASE2 | 161 |
| PHASE3 | 125 |
| PHASE4 | 110 |
| Not specified | 97 |
| PHASE2/PHASE3 | 40 |
| PHASE1 | 37 |
| PHASE1/PHASE2 | 33 |
| EARLY_PHASE1 | 11 |
Top trials by phase / activity
| NCT | Phase | Status | Title |
|---|---|---|---|
| NCT02283996 | PHASE4 | RECRUITING | Adhesive Capsulitis: Prospective Analysis of Efficacy and Financial Impact for Use of Physical Therapy in Treatment |
| NCT03098225 | PHASE4 | NOT_YET_RECRUITING | A Trial to Evaluate the Efficacy of Orbital Radiotherapy in Graves’ Orbitopathy |
| NCT04826237 | PHASE4 | RECRUITING | Oral Statins and Protection From Hearing Loss |
| NCT05097976 | PHASE4 | RECRUITING | Medrol Dosepak for Outpatient Total Knee Arthroplasty |
| NCT05867329 | PHASE4 | RECRUITING | Feasibility Pilot Sequential Multiple Assignment Randomized Trial (SMART) for Acute Severe Ulcerative Colitis |
| NCT05927233 | PHASE4 | RECRUITING | Effect of Methylprednisolone on Systemic Inflammatory Response During Pediatric Congenital Open-Heart Surgery |
| NCT06040255 | PHASE4 | ENROLLING_BY_INVITATION | Focal Cerebral Arteriopathy Steroid Trial |
| NCT06268704 | PHASE4 | RECRUITING | Particulate vs. Non-Particulate Steroid for Sacroiliac Joint Injection |
| NCT06762145 | PHASE4 | NOT_YET_RECRUITING | EArly Effect of Glucocorticoid on Incidence of Persistent Left BundlE Branch Block (LBBB) Post-TAVR (EAGLE-TAVR Trial) |
| NCT06892197 | PHASE4 | RECRUITING | Comparing Hydrocortisone and Prednisolone for Community Acquired Pneumonia (CAP) |
| NCT06892210 | PHASE4 | RECRUITING | Comparing Hydrocortisone and Prednisolone for Acute Exacerbation of Chronic Obstructive Pulmonary Disease (AECOPD) |
| NCT06968507 | PHASE4 | RECRUITING | Comparison of the Effectiveness of Oral and Intratympanic Corticosteroid Treatments in Patients Diagnosed With Sudden Sensorineural Hearing Loss |
| NCT07077486 | PHASE4 | RECRUITING | Effects of Telitacicept vs Cyclophosphamide on Lupus Related Interstitial Lung Disease |
| NCT07101445 | PHASE4 | RECRUITING | Evaluating Premedication Regimens (Methylprednisolone vs Dexamethasone-based) for the Prevention of Systemic and Injection Site Reactions to Motixafortide in Patients With Multiple Myeloma Undergoing Stem Cell Mobilization, PARADE Trial |
| NCT07180277 | PHASE4 | NOT_YET_RECRUITING | Methylprednisolone for Moderate to Severe Traumatic Brain Injury |
| NCT07255248 | PHASE4 | RECRUITING | Hoffa’s Fat Pad Impingement (HFPI) |
| NCT07258771 | PHASE4 | RECRUITING | Upadacitinib Combined With Corticosteroids vs Corticosteroid Monotherapy Induction for Inpatients and Outpatients With Acute Severe Ulcerative Colitis |
| NCT07265258 | PHASE4 | NOT_YET_RECRUITING | A Study of Teprotumumab N01 in Subjects With Active Thyroid Eye Disease |
| NCT07394894 | PHASE4 | NOT_YET_RECRUITING | Local Percutaneous Pulsed Radiofrequency Ablation Versus Ultrasound Guided Steroids Injection in Management of Pain in Cases of Chronic Planter Fascitis, Randomised Double Blinded Study |
| NCT00037115 | PHASE4 | WITHDRAWN | Induction Therapy With a Single High Dose Bolus of Intravenous Methotrexate With Leucovorin Rescue, Prior to Initiation of AVONEX® Treatment, in Patients Presenting With a First Acute Demyelinating Event. |
| NCT00048165 | PHASE4 | COMPLETED | A Study to Evaluate the Efficacy and Safety of Zenapax in Combination With CellCept, Cyclosporine, and Corticosteroids in Patients Undergoing Cardiac Transplantation |
| NCT00127985 | PHASE4 | UNKNOWN | 6-Methyl-Prednisolone for Multiple Organ Dysfunction Syndrome |
| NCT00149994 | PHASE4 | COMPLETED | Cyclosporine A C-2h Monitoring Versus Tacrolimus C-0h Monitoring in de Novo Liver Transplant Recipients |
| NCT00261820 | PHASE4 | COMPLETED | Study Comparing Two Immunosuppressive Regimens in De Novo Renal Allograft Recipients |
| NCT00281710 | PHASE4 | COMPLETED | Urinary Aquaporin 2 Excretion After Methylprednisolone in Fasting Healthy Humans |
| NCT00307671 | PHASE4 | COMPLETED | Treatment of Necrotizing Vasculitides for Patients Older Than 65 Years |
| NCT00396747 | PHASE4 | COMPLETED | A Comparison of Methotrexate Alone or Combined to Infliximab or to Pulse Methylprednisolone in Early Rheumatoid Arthritis: A Magnetic Resonance Imaging Study |
| NCT00427388 | PHASE4 | UNKNOWN | Steroids In caRdiac Surgery Trial (SIRS Trial) |
| NCT00492466 | PHASE4 | COMPLETED | Investigating if Interferon-Beta Can be Used in Patients With MS After They Have Developed Neutralizing Antibodies |
| NCT00493116 | PHASE4 | COMPLETED | Is IFN-beta Treatment in MS Useful After a Washout Period in Patients With Neutralizing Antibodies to Interferon Beta |
| NCT00627731 | PHASE4 | COMPLETED | Oral Glucocorticosteroid in the Treatment of Severe Asthma Exacerbation in Hospitalized Patients |
| NCT00717470 | PHASE4 | COMPLETED | A Study in Kidney Transplant Subjects to Investigate the Optimal Suppression of Immunity to Help Prevent Kidney Rejection |
| NCT00753792 | PHASE4 | COMPLETED | Oral Corticotherapy in Megadoses to Treat Multiple Sclerosis During Relapse |
| NCT00908583 | PHASE4 | COMPLETED | Desensitization in Kidney Transplantation |
| NCT00908713 | PHASE4 | COMPLETED | Corticoids in Severe Community-Acquired Pneumonia (CAP) |
| NCT00915473 | PHASE4 | COMPLETED | Greater Occipital Nerve Block for Migraine Prophylaxis |
| NCT00957801 | PHASE4 | COMPLETED | Anabolic and Inflammatory Responses to Short-Term Testosterone Administration in Older Men |
| NCT00968578 | PHASE4 | COMPLETED | Effects of Methylprednisolone After Total Knee Arthroplasty |
| NCT00968903 | PHASE4 | COMPLETED | Effects of Methylprednisolone After Total Hip Arthroplasty |
| NCT01000610 | PHASE4 | COMPLETED | A Study of MabThera (Rituximab) in Patients With Rheumatoid Arthritis and an Inadequate Response to Methotrexate |
Clinical evidence (CIViC)
No CIViC predictive evidence (expected for non-precision-medicine drugs).
Pharmacology
Pharmacogenomics
No CPIC/DPWG dosing guideline, but PharmGKB curates 1 clinical and 3 variant annotation(s) for this drug (gene-keyed; see PharmGKB).
Related molecules
Related molecules
Molecules sharing ≥1 of this drug’s curated primary targets, merged from two biobtree sources and ranked by shared-target count, then clinical phase: ChEMBL clinical-stage candidates (development phase ≥2) and PubChem drug-class bioactivity (approved / known drugs acting on the target). Deduplicated by drug name; the drug’s own salt forms are excluded. Note: for a drug with few primary targets a shared-target match can reflect off-target / promiscuous binding rather than the same therapeutic mechanism — the phase ordering surfaces bona-fide therapeutics first.
177 molecules share ≥1 primary target. Top 60 by shared-target count:
| Molecule | Source | Status | Shared targets |
|---|---|---|---|
| Progesterone | ChEMBL + PubChem | Phase 4 (approved) | NR3C1, TRPC5 |
| FULVESTRANT | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| PODOFILOX | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| REGORAFENIB | ChEMBL + PubChem | Phase 4 (approved) | NR3C1 |
| ACENOCOUMAROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| ALCLOMETASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| AMCINONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| AMIODARONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| APREPITANT | ChEMBL | Phase 4 (approved) | NR3C1 |
| AURANOFIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| BAZEDOXIFENE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BECLOMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BENZBROMARONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE DIPROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE PHOSPHORIC ACID | ChEMBL | Phase 4 (approved) | NR3C1 |
| BETAMETHASONE VALERATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BUDESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| BUTOCONAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CANDESARTAN CILEXETIL | ChEMBL | Phase 4 (approved) | NR3C1 |
| CANRENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CHLORMADINONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CICLESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOBETASOL PROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOFAZIMINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CLOTRIMAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| CORTISONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DANAZOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DAUNORUBICIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEFLAZACORT | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOGESTREL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOXIMETASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DESOXYCORTICOSTERONE PIVALATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEXAMETHASONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DEXTROTHYROXINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIENESTROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIETHYLSTILBESTROL | ChEMBL | Phase 4 (approved) | NR3C1 |
| DIFLORASONE DIACETATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| DOXORUBICIN | ChEMBL | Phase 4 (approved) | NR3C1 |
| DROSPIRENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| ECONAZOLE | ChEMBL | Phase 4 (approved) | NR3C1 |
| EFAVIRENZ | ChEMBL | Phase 4 (approved) | NR3C1 |
| ENZALUTAMIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| EPLERENONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| ESTRADIOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| ESTRIOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| ETHINYL ESTRADIOL | ChEMBL | Phase 4 (approved) | NR3C1 |
| EXEMESTANE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FELODIPINE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUDROCORTISONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUNISOLIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUOCINOLONE ACETONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUOCINONIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUOROMETHOLONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUOXYMESTERONE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLURANDRENOLIDE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUTICASONE FUROATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| FLUTICASONE PROPIONATE | ChEMBL | Phase 4 (approved) | NR3C1 |
| GLUCAGON | ChEMBL | Phase 4 (approved) | NR3C1 |
Related Atlas pages
- Genes: TRPC5, NR3C1
- Diseases: acne, Crohn disease, rheumatoid arthritis, frozen shoulder, ulcerative colitis, pneumonia, atopic eczema, psoriatic arthritis, tenosynovitis, asthma, osteoarthritis, multiple sclerosis, endocrine system disorder, juvenile idiopathic arthritis, posterior uveitis, bursitis, relapsing-remitting multiple sclerosis, Meniere disease, graft versus host disease, chronic progressive multiple sclerosis, plasma cell myeloma, respiratory system disorder, carpal tunnel syndrome, urinary tract infection, anterior ischemic optic neuropathy, lymphoid neoplasm, kidney disorder, autoimmune thrombocytopenic purpura, acute lymphoblastic leukemia, juvenile dermatomyositis, leukemia, lymphoma, systemic sclerosis, heart disorder, chronic kidney disease, IgA glomerulonephritis, membranous glomerulonephritis, anti-neutrophil antibody associated vasculitis, granulomatosis with polyangiitis, lupus nephritis, Bell’s palsy, vestibular neuronitis, acute respiratory distress syndrome, microscopic polyangiitis, spinal cord injury, thrombocytopenia, cardiac arrest, T-cell acute lymphoblastic leukemia, chronic obstructive pulmonary disease, severe acute respiratory syndrome, optic neuritis, pneumocystosis, pulpitis, specific language disorder, hematopoietic and lymphoid system neoplasm, Hodgkins lymphoma, adult acute respiratory distress syndrome, primary progressive multiple sclerosis, myocarditis, macrophage activation syndrome, language disorder, bronchopulmonary dysplasia, injury, stroke disorder, idiopathic pulmonary fibrosis, colitis, kidney failure, systemic lupus erythematosus, erythema multiforme
- Drugs: Progesterone, Fulvestrant, Podofilox, Regorafenib, Acenocoumarol, Alclometasone Dipropionate, Amcinonide, Amiodarone, Aprepitant, Auranofin, Bazedoxifene, Beclomethasone Dipropionate, Benzbromarone, Betamethasone, Betamethasone Dipropionate, Betamethasone Phosphoric Acid, Betamethasone Valerate, Budesonide, Butoconazole, Candesartan Cilexetil, Canrenone, Chlormadinone, Ciclesonide, Clobetasol Propionate, Clofazimine, Clotrimazole, Cortisone, Danazol, Daunorubicin, Deflazacort, Desogestrel, Desonide, Desoximetasone, Desoxycorticosterone Pivalate, Dexamethasone, Dextrothyroxine, Dienestrol, Diethylstilbestrol, Diflorasone Diacetate, Doxorubicin, Drospirenone, Econazole, Efavirenz, Enzalutamide, Eplerenone, Estradiol, Estriol, Ethinyl Estradiol, Exemestane, Felodipine, Fludrocortisone, Flunisolide, Fluocinolone Acetonide, Fluocinonide, Fluorometholone, Fluoxymesterone, Flurandrenolide, Fluticasone Furoate, Fluticasone Propionate, Glucagon